![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Ägräs_VYS_Single_Barrel_import.png | 2024-08-13 17:17 | 142K | |
| Éiregold_Irish_Whiskey_Special_Reserve_-_Pot_Still_import.png | 2024-08-13 17:17 | 214K | |
| Öufi-Brauerei_2012_Öufi-Whisky_import.png | 2024-08-13 17:17 | 82K | |
| 022CBA61-CB86-4100-A48D-EFD1BFDBF555.jpeg | 2024-08-13 17:05 | 148K | |
| 0713D24B-9E2D-4ACE-AFC9-149BCAE32A56.jpeg | 2024-08-13 17:05 | 137K | |
| 09a0f974473e2dc074d26cc84b594161.jpg | 2024-08-13 17:05 | 177K | |
| 2B261.jpg | 2024-08-13 17:06 | 476K | |
| 3J057.jpg | 2024-08-13 17:06 | 428K | |
| 3J301.jpg | 2024-08-13 17:06 | 327K | |
| 3Makers_46.jpg | 2024-08-13 17:06 | 14K | |
| 5BEARFACE-whisky-bottle-shadow.png | 2024-08-13 17:06 | 153K | |
| 5Boann_Summer_Solstice_Vintage_Mash_Bill_2025png.png | 2025-06-19 23:11 | 229K | |
| 5Copeland_Release_25.1.png | 2025-06-10 21:51 | 162K | |
| 5Copeland_Release_25.1_cask_strength.png | 2025-06-10 21:49 | 159K | |
| 5Dingle_Gheimhridh.png | 2024-08-13 17:06 | 165K | |
| 5Dingle_conocht_an_earraigh.png | 2024-08-13 17:06 | 139K | |
| 5Dunvilles-Special-SS-19YO-992-w-TUBE-LR-658x992.png | 2024-08-13 17:06 | 283K | |
| 5Garavogue_20_year_old.png | 2025-06-09 21:56 | 183K | |
| 5IMG_0028.png | 2024-08-13 17:06 | 127K | |
| 5IMG_0173.png | 2024-08-13 17:06 | 189K | |
| 5IMG_0537.jpeg | 2024-08-13 17:06 | 173K | |
| 5IMG_0936.png | 2024-08-13 17:06 | 147K | |
| 5IMG_0939.png | 2024-08-13 17:06 | 290K | |
| 5IMG_0941.png | 2024-08-13 17:06 | 278K | |
| 5IMG_0943.png | 2024-08-13 17:06 | 284K | |
| 5IMG_3224.png | 2024-08-13 17:06 | 130K | |
| 5IMG_3230.png | 2024-08-13 17:06 | 278K | |
| 5IMG_3232.png | 2024-08-13 17:06 | 287K | |
| 5IMG_3234.png | 2024-08-13 17:06 | 237K | |
| 5IMG_3236.png | 2024-08-13 17:06 | 272K | |
| 5IMG_3243.png | 2024-08-13 17:06 | 122K | |
| 5IMG_3417.png | 2024-08-13 17:06 | 188K | |
| 5IMG_3419.jpeg | 2024-08-13 17:06 | 222K | |
| 5IMG_3420.png | 2024-08-13 17:06 | 159K | |
| 5IMG_3424.jpeg | 2024-08-13 17:06 | 208K | |
| 5IMG_3447.png | 2024-08-13 17:06 | 160K | |
| 5IMG_3620.png | 2024-08-13 17:06 | 152K | |
| 5IMG_3622.png | 2024-08-13 17:06 | 145K | |
| 5IMG_3625.jpeg | 2024-08-13 17:06 | 140K | |
| 5IMG_9626.png | 2024-08-13 17:06 | 181K | |
| 5IMG_9859.png | 2024-08-13 17:06 | 198K | |
| 5IMG_9861.png | 2024-08-13 17:06 | 192K | |
| 5IMG_9942.png | 2024-08-13 17:06 | 146K | |
| 5Killowen_creatur_buachaill_caol_dubh.png | 2024-08-13 17:06 | 225K | |
| 5Midleton_very_rare_2025.png | 2025-04-15 23:04 | 215K | |
| 5OldCarrickMills_Steve_Staunton.png | 2024-08-13 17:06 | 122K | |
| 5RedBreast_15_CaskStrength.png | 2025-06-19 22:03 | 170K | |
| 5Thomond-Gate-the_clash_of_the_ash.png | 2024-08-13 17:06 | 288K | |
| 5achillislandpeatedcaskstrengthpng.png | 2024-08-13 17:06 | 136K | |
| 5achillislandsinglemaltbordeaux.png | 2024-08-13 17:06 | 118K | |
| 5achillislandsinglemaltpng.png | 2024-08-13 17:06 | 120K | |
| 5belgrove_peated_rye.png | 2024-08-13 17:06 | 108K | |
| 5blackwater_irish_poitin.png | 2024-08-13 17:06 | 240K | |
| 5blackwater_peat_magic_dragon.png | 2024-08-13 17:06 | 256K | |
| 5blantons_sfb_twe.png | 2024-08-13 17:06 | 185K | |
| 5boann_cork_whiskey_fest_2025.png | 2025-03-26 22:58 | 140K | |
| 5boann_vintage_mashbill_set.png | 2024-08-13 17:06 | 131K | |
| 5bottle-one-eleven-with-shadow.png | 2024-08-13 17:06 | 160K | |
| 5dingle_lunasa.png | 2024-08-13 17:06 | 138K | |
| 5elijahCraig_RyderCup2023.png | 2024-08-13 17:06 | 155K | |
| 5friendathand_reconciliation_gift_set.png | 2024-08-13 17:06 | 96K | |
| 5glendalough_pot_still_peated.png | 2025-04-14 21:43 | 143K | |
| 5jameson22yearold.png | 2024-08-13 17:06 | 230K | |
| 5killara_kd62.png | 2024-08-13 17:06 | 260K | |
| 5killowen_6_rum_raisin_WL2023.png | 2024-08-13 17:06 | 247K | |
| 5killowen_barantuil_c54.png | 2024-08-13 17:06 | 190K | |
| 5killowen_barantuil_kd008.png | 2024-08-13 17:06 | 208K | |
| 5killowen_barantuil_kd014.png | 2025-06-29 21:58 | 138K | |
| 5killowen_barantuil_kd024.png | 2024-08-13 17:06 | 271K | |
| 5killowen_barantuil_kd200.png | 2024-08-13 17:06 | 287K | |
| 5killowen_coconut_rum.png | 2024-08-13 17:06 | 197K | |
| 5killowen_joe_Hill.png | 2024-08-13 17:06 | 188K | |
| 5killowen_kd202.png | 2024-08-13 17:06 | 195K | |
| 5lakeview_coming_ofAge_edition2.png | 2024-08-13 17:06 | 207K | |
| 5landing-mitlenatch-image.png | 2024-08-13 17:06 | 146K | |
| 5lochlea_our_barley.png | 2024-08-13 17:06 | 243K | |
| 5macallan_folio_7.png | 2024-08-13 17:06 | 160K | |
| 5methodandmadness_mescal_twe.png | 2024-08-13 17:06 | 157K | |
| 5methodmadness_garryana_barrels.png | 2024-08-13 17:06 | 150K | |
| 5redbreast_18_year.png | 2024-09-17 16:41 | 199K | |
| 5redbreast_dreamcask_zenith_edition.png | 2024-08-13 17:06 | 161K | |
| 5redbreast_tawny_port.png | 2024-08-13 17:06 | 139K | |
| 5roe_and_co_solera.png | 2024-08-13 17:06 | 166K | |
| 5roeandco_flor.png | 2024-08-13 17:06 | 169K | |
| 5shortcross_DistilleryExclusiveBottle_720x.png | 2024-08-13 17:06 | 101K | |
| 5smws_71.102.png | 2024-08-13 17:06 | 105K | |
| 5teeling_belgian_ale_casks_duvel.png | 2024-08-13 17:06 | 264K | |
| 5thomond_gate_the_nightingale.png | 2025-04-14 21:49 | 340K | |
| 5transportationwhiskey_flogging_molly.png | 2024-08-13 17:06 | 211K | |
| 5two_stack_dram_in_a_can_raspberry_brandy.png | 2024-08-13 17:06 | 219K | |
| 5two_stack_polaris_1_3.png | 2024-08-13 17:06 | 219K | |
| 5two_stack_polaris_4_1.png | 2025-04-27 22:14 | 148K | |
| 5two_stacks_blenders_cut_artist_warehouse_exclusive.png | 2024-08-13 17:06 | 202K | |
| 5two_stacks_blenders_cut_artist_warehouse_exclusive_3L.png | 2024-08-13 17:06 | 172K | |
| 5two_stacks_pump_up_the_jam.png | 2024-08-13 17:06 | 203K | |
| 5west_cork_12_cork_whiskey_fest_2025.png | 2025-03-26 22:56 | 254K | |
| 5westland_garryana_7th.png | 2024-08-13 17:06 | 272K | |
| 8Echlinville_The_Beginning.png | 2024-08-13 17:06 | 140K | |
| 8Marmalade-Overdrive-GX-web__34615.png | 2024-08-13 17:06 | 110K | |
| 8Teeling_WOW_Sweedish_Wood.png | 2024-08-13 17:06 | 232K | |
| 8TwoStacks_Mescal_CWS.png | 2024-08-13 17:06 | 157K | |
| 8_Doors_Distillery_New_Make_import.png | 2024-08-13 17:06 | 138K | |
| 8rb_dc_27_porttoport.png | 2024-08-13 17:06 | 160K | |
| 8two_stacks_hawaii_6yo.png | 2024-08-13 17:06 | 180K | |
| 9A384A004-B6EC-4958-B177-5F20D6AD03E5.png | 2024-08-13 17:06 | 184K | |
| 9AD2B6F17-7CFA-456F-8A17-964E33C71170.png | 2024-08-13 17:06 | 163K | |
| 9All-Sherry-13-Year-2021-1.png | 2024-08-13 17:06 | 175K | |
| 9ArdbegTriaghBhan19.png | 2024-08-13 17:06 | 288K | |
| 9BAB02388-65CC-4EBE-B4DA-A6AF6CE6A9B4.jpeg | 2024-08-13 17:06 | 226K | |
| 9BWW-on-wall-scaled.jpg | 2024-08-13 17:06 | 281K | |
| 9Benromach40YO2021.png | 2024-08-13 17:06 | 322K | |
| 9Bill-Phil-CS-66358.png | 2024-08-13 17:06 | 210K | |
| 9Blackpitts-Cask-Strength-3-1-1.png | 2024-08-13 17:06 | 151K | |
| 9Boann_SPS_Madeira.png | 2024-08-13 17:06 | 264K | |
| 9Boann_SPS_Marsala.png | 2024-08-13 17:06 | 272K | |
| 9Boann_SPS_PX.png | 2024-08-13 17:06 | 265K | |
| 9Boann_Summer_Solstice_2023.png | 2025-01-30 20:48 | 190K | |
| 9Boann_Winter_Solstice_2022.png | 2025-01-30 20:52 | 192K | |
| 9Boann_Winter_Solstice_Vintage_Mash_Bill_2024.png | 2025-01-30 20:43 | 246K | |
| 9Buffalo_trace_carryout_killarney.png | 2024-08-13 17:06 | 154K | |
| 9Bush_causeway_2022-Pomerol-1000x1000.jpg | 2024-08-13 17:06 | 136K | |
| 9Bush_causeway_2022-Vermouth-1000x1000.jpg | 2024-08-13 17:06 | 133K | |
| 9Bushmill_25_single_malt.png | 2024-08-13 17:06 | 233K | |
| 9Bushmill_30_single_malt.png | 2024-08-13 17:06 | 243K | |
| 9Bushmills-13yo-Duoro-Cask-2021.png | 2024-08-13 17:06 | 369K | |
| 9Bushmills-Prohibition-Recipe-June-2022_600.jpg | 2024-08-13 17:06 | 148K | |
| 9Bushmills_10_Years_Single_Malt_Whiskey_1021_Cuvee_Cask_54_8_24826.png | 2024-08-13 17:06 | 309K | |
| 9Bushmills_2011_banyuls_twc.png | 2024-08-13 17:06 | 152K | |
| 9Bushmills_Causeway_2021_2011_Banyuls.png | 2024-08-13 17:06 | 310K | |
| 9Bushmills_causeway_2021_30_newOak.png | 2024-08-13 17:06 | 429K | |
| 9C7D550AC-153A-4245-B6E3-B5D0C55956FE.jpeg | 2024-08-13 17:06 | 289K | |
| 9CWC_DevilsKeep1.png | 2024-08-13 17:06 | 237K | |
| 9ClanColla_19_year_old.png | 2024-08-13 17:06 | 192K | |
| 9ClanColla_20_year_old.png | 2024-08-13 17:06 | 308K | |
| 9ClannColla_11_year_old.png | 2024-08-13 17:06 | 191K | |
| 9Clonakilty_Crossroads_Ales_Lagers.png | 2024-08-13 17:06 | 164K | |
| 9Clonakilty_Dick_Macks_2025.png | 2025-07-13 17:57 | 115K | |
| 9Clonakilty_Galley_Head.png | 2024-08-13 17:06 | 173K | |
| 9Clonakilty_Oharas_cask.png | 2024-08-13 17:06 | 183K | |
| 9Clonakilty_Revival_You_Thirsty.png | 2024-08-13 17:06 | 167K | |
| 9Connacht_single_malt_batch1.png | 2024-08-13 17:06 | 186K | |
| 9D3387405-2AAB-4217-8C5C-F636BE55267D.jpeg | 2024-08-13 17:06 | 135K | |
| 9D9899465-9155-40B5-833C-7F6DB37D3D77.jpeg | 2024-08-13 17:06 | 231K | |
| 9DAA9FB76-2699-489C-88C2-CA55C01AFBEB.png | 2024-08-13 17:06 | 111K | |
| 9DYC-12.png | 2024-08-13 17:06 | 209K | |
| 9Dingle-SPS-Batch-5_720x.png | 2024-08-13 17:06 | 196K | |
| 9Dingle-Single-Malt.png | 2024-08-13 17:06 | 663K | |
| 9Dingle La Le Bride.png | 2024-08-13 17:06 | 136K | |
| 9Dingle_CS_15dewihisk.png | 2024-08-13 17:06 | 199K | |
| 9Dingle_founding_father_fearannri.png | 2024-08-13 17:06 | 168K | |
| 9Dunville-18-989.png | 2024-08-13 17:06 | 309K | |
| 9Dunville1710.jpg | 2024-08-13 17:06 | 262K | |
| 9Dunville_1808.png | 2024-08-13 17:06 | 191K | |
| 9Dunville_SC_14_1699.png | 2024-08-13 17:06 | 182K | |
| 9Dunville_SC_19_1636.png | 2024-08-13 17:06 | 186K | |
| 9Dunville_SC_20_1206.png | 2024-08-13 17:06 | 310K | |
| 9Dunville_SC_20_1639.png | 2024-08-13 17:06 | 301K | |
| 9E3C95EEB-B313-42C9-A60F-573960138E94.png | 2024-08-13 17:06 | 171K | |
| 9E9F88B52-6550-4A6A-A9F1-F08E408A422D.png | 2024-08-13 17:06 | 124K | |
| 9E79113D6-7569-4252-A800-226A6B139DB5.png | 2024-08-13 17:06 | 322K | |
| 9EA96593F-3E83-4904-9A72-FB88102DDD50.png | 2024-08-13 17:06 | 178K | |
| 9EC82A25B-C94E-44F6-923E-BE6E435ED906.jpeg | 2024-08-13 17:06 | 147K | |
| 9EE0B179D-FE81-49A3-A9ED-C4A8F65BC1B6.jpeg | 2024-08-13 17:06 | 258K | |
| 9F0C765B5-6D78-4335-BB07-F19C7566306C.png | 2024-08-13 17:06 | 187K | |
| 9F32B798D-A928-46D6-9AFC-52CDE1D247B0.png | 2024-08-13 17:06 | 126K | |
| 9F153ED24-9F23-4E36-A49C-6AEA5739A4E0.png | 2024-08-13 17:06 | 178K | |
| 9FlyingTumbler_the_bird.png | 2024-08-13 17:06 | 285K | |
| 9FlyingTumbler_the_tippler.png | 2024-08-13 17:06 | 298K | |
| 9Flying_tumbler_the_roller.png | 2024-08-13 17:06 | 194K | |
| 9Foxes-Bow.png | 2024-08-13 17:06 | 176K | |
| 9Gold_spot_9_135_anniversary.png | 2024-08-13 17:06 | 277K | |
| 9HINCH-BOTTLE-PEATED-SINGLE-MALT-2.png | 2024-08-13 17:06 | 81K | |
| 9HINCH-BOTTLE-SMALL-BATCH.png | 2024-08-13 17:06 | 435K | |
| 9Hinch-5-Year-Old-Irish-Whiskey.png | 2024-08-13 17:06 | 356K | |
| 9Hinch-10-Year-Old-Blended-Irish-Whiskey.png | 2024-08-13 17:06 | 330K | |
| 9IMG_3053_3.jpg | 2024-08-13 17:06 | 409K | |
| 9IMG_7254.png | 2024-10-23 17:51 | 178K | |
| 9IMG_9266.png | 2024-08-13 17:06 | 154K | |
| 9IMG_9268.png | 2024-08-13 17:06 | 138K | |
| 9IMG_9296.png | 2024-08-13 17:06 | 186K | |
| 9IMG_9801.png | 2024-08-13 17:06 | 125K | |
| 9IWS Label outc x Front.jpg | 2024-08-13 17:06 | 137K | |
| 9JD10YrOld.png | 2024-08-13 17:06 | 218K | |
| 9Jameson2015_carbon.png | 2024-08-13 17:06 | 293K | |
| 9Jameson Crested Eight Degrees -1000x1000.png | 2024-08-13 17:06 | 136K | |
| 9JamesonXDickies.png | 2024-08-13 17:06 | 131K | |
| 9Jameson_15_YO_Pot_still.png | 2024-08-13 17:06 | 156K | |
| 9Jameson_Classic_Football_shirts.png | 2024-08-13 17:06 | 207K | |
| 9Killowen-Belgrove-Rye-RR-Finish.png | 2024-08-13 17:06 | 195K | |
| 9Killowen-Bundle_peat_poitin_rum.png | 2024-08-13 17:06 | 190K | |
| 9KillowenPeatedRum.png | 2024-08-13 17:06 | 281K | |
| 9KillowenRumRaisinB2.png | 2024-08-13 17:06 | 293K | |
| 9KillowenRumRaisinB3.png | 2024-08-13 17:06 | 211K | |
| 9KillowenRumRaisinb5.png | 2024-08-13 17:06 | 250K | |
| 9Liberator-Port-n-Peat.png | 2024-08-13 17:06 | 175K | |
| 9Liberator_Storehouse_Special.png | 2024-08-13 17:06 | 114K | |
| 9M&MRyeMalt.png | 2024-08-13 17:06 | 216K | |
| 9Macallan Folio 6.png | 2024-08-13 17:06 | 202K | |
| 9Macallan_2021_Rare_Cask_box.png | 2024-08-13 17:06 | 376K | |
| 9Macallan_Classic_Cut_2022_Edition-776x1176.png | 2024-08-13 17:06 | 224K | |
| 9Macallan_harmony_guardian_oak.png | 2025-03-05 23:23 | 130K | |
| 9MattDarcy10.png | 2024-08-13 17:06 | 196K | |
| 9May-loag-small-peated.jpg | 2024-08-13 17:06 | 165K | |
| 9McConnell’s_Sherry_Cask_Finish-1000x1000.png | 2024-08-13 17:07 | 138K | |
| 9McConnells_Sherry_Cask_Finish-1000x1000.png | 2024-08-13 17:07 | 121K | |
| 9MethdodandMadnessOatsandMalt.png | 2024-08-13 17:07 | 160K | |
| 9Micil_small_batch.png | 2024-08-13 17:07 | 202K | |
| 9Micil_sps_earl_island.png | 2024-08-13 17:07 | 180K | |
| 9Midleton_kylebeg_wood_tree1.png | 2024-08-13 17:07 | 317K | |
| 9Old-comber-new.png | 2024-08-13 17:07 | 165K | |
| 9OldOak_GrandSlam.png | 2024-08-13 17:07 | 166K | |
| 9Powers-Irish-Rye-bottle.jpg | 2024-08-13 17:07 | 191K | |
| 9RedBreast_KentuckyOak.png | 2024-08-13 17:07 | 210K | |
| 9Redbreast__22-YO-Single-Cask-TSMS-Exclusive.jpg.png | 2024-08-13 17:07 | 210K | |
| 9RoeandCoSugi.png | 2024-08-13 17:07 | 195K | |
| 9RoeandCo_Cs_13_year.png | 2024-08-13 17:07 | 190K | |
| 9Shortcross_Irish_Whiskey_(2)-776x1176 (1)-1000x1000.jpg | 2024-08-13 17:07 | 272K | |
| 9Shortcross_Rye_Malt_Irish_Whiskey_(1)-776x1176.png | 2024-08-13 17:07 | 121K | |
| 9Shortcross_Rye_malt.png | 2024-08-13 17:07 | 122K | |
| 9Slane_Catle_limited_edition-776x1176.png | 2024-08-13 17:07 | 172K | |
| 9Springbank_localbarely.png | 2024-08-13 17:07 | 195K | |
| 9TGTBTS.png | 2024-08-13 17:07 | 418K | |
| 9TS_AppleBrandy_Mockup.jpg | 2024-08-13 17:07 | 144K | |
| 9Teeling_30_year_sauternes_bourbon.png | 2024-08-13 17:07 | 237K | |
| 9Teeling_SC_17_55120.png | 2024-08-13 17:07 | 351K | |
| 9Teeling_SPS_SC_12600.png | 2024-08-13 17:07 | 362K | |
| 9Teeling_WOW_SPS_Chestnut.png | 2024-08-13 17:07 | 366K | |
| 9Teeling_single_malt_crystal_malt.png | 2024-08-13 17:07 | 324K | |
| 9Teeling_three_rivers_5458.png | 2024-08-13 17:07 | 260K | |
| 9The Whistler Boedgea PNG.png | 2024-08-13 17:07 | 9.3M | |
| 9The_Bridge_Single_Malt_DeadCentre_1-1000x1000.png | 2024-08-13 17:07 | 111K | |
| 9The_Bridge_Single_Malt_DeadCentre_2-1000x1000.png | 2024-08-13 17:07 | 111K | |
| 9Thomond-Gate-John-Wolfe.png | 2024-08-13 17:07 | 209K | |
| 9Thomond-Gate-Western-Herd.png | 2024-08-13 17:07 | 410K | |
| 9Thomond-Gate-galloping_hogan_regular.png | 2024-08-13 17:07 | 181K | |
| 9Thomondgate__Cognac-SM.png | 2024-08-13 17:07 | 491K | |
| 9Tipperary-Port-Cask_sc059.png | 2024-08-13 17:07 | 237K | |
| 9Two-Stacks-Dram-In-A-Can-Single-Malt-4PK.jpg | 2024-08-13 17:07 | 186K | |
| 9Two-Stacks-Dram-In-A-Can_4Pk.jpg | 2024-08-13 17:07 | 181K | |
| 9Two-Stacks__Imperial-Coffee Finish.png | 2024-08-13 17:07 | 1.5M | |
| 9WD-O-Connell__Bill-Phil-CS.png | 2024-08-13 17:07 | 492K | |
| 9WF-MicroCuvee-PiqueNique.png | 2024-08-13 17:07 | 310K | |
| 9WFSFOBalyroe.png | 2024-08-13 17:07 | 251K | |
| 9WhiteMountainJacks_Apricot_Brandy.png | 2024-08-13 17:07 | 231K | |
| 9Wild_turkey_12_distiller_reserve.png | 2024-08-13 17:07 | 256K | |
| 9WriterTearSinglePotStill.png | 2024-08-13 17:07 | 339K | |
| 9Writers_Tears_CaskStrength_2025.png | 2025-07-13 17:50 | 203K | |
| 9Yellow_Spot_13_Box_Bottle_2000x.jpg | 2024-08-13 17:07 | 48K | |
| 9aquavitae.png | 2024-08-13 17:06 | 252K | |
| 9ardbegScorchCommitteeRelease.png | 2024-08-13 17:06 | 186K | |
| 9ardbeg_committee_release_fermutation.png | 2024-08-13 17:06 | 167K | |
| 9ardbeg_smoketrails_manzilla.png | 2024-08-13 17:06 | 122K | |
| 9athru_17_single_caskpng.png | 2024-08-13 17:06 | 261K | |
| 9athruscoloroso6yo.png | 2024-08-13 17:06 | 283K | |
| 9athruscpx16yo.png | 2024-08-13 17:06 | 283K | |
| 9athrusctokaji16yo.png | 2024-08-13 17:06 | 281K | |
| 9athrusmallbatch.png | 2024-08-13 17:06 | 246K | |
| 9ballykeefe_single_pot_still.png | 2024-08-13 17:06 | 193K | |
| 9balvenie_15_madeira_cask.png | 2024-08-13 17:06 | 288K | |
| 9baoilleach_the_first_cut.png | 2024-08-13 17:06 | 154K | |
| 9barts_blended.png | 2024-08-13 17:06 | 227K | |
| 9blackwater_a_do.png | 2024-08-13 17:06 | 208K | |
| 9bluespot_7yo_caskstrength_ps.jpg | 2024-08-13 17:06 | 326K | |
| 9bsh_5630_port_33yo_bottle_and_pack_light_rgb_-1.png | 2024-08-13 17:06 | 263K | |
| 9burkes_15_cask7869.png | 2024-08-13 17:06 | 195K | |
| 9bushmill_causeway_2008_jupille.png | 2024-08-13 17:06 | 247K | |
| 9bushmills-causeway-2021_2011-sauternes_1_540x.jpg | 2024-08-13 17:06 | 69K | |
| 9bushmills_10_years_sherry_cask_finish_1.png | 2024-08-13 17:06 | 248K | |
| 9bushmills_28_year_american_oak_chinese.png | 2024-08-13 17:06 | 248K | |
| 9bushmills_30_year_madeira.png | 2024-08-13 17:06 | 258K | |
| 9bushmills_80_20.png | 2024-08-13 17:06 | 261K | |
| 9bushmills_1991_causewaycollection_madeiracasks_ps.png | 2024-08-13 17:06 | 397K | |
| 9bushmills_1995_causewaycollection_marsala_ps.png | 2024-08-13 17:06 | 333K | |
| 9bushmills_2000_causewaycollection_portcask_ps.png | 2024-08-13 17:06 | 361K | |
| 9bushmills_causeway_27yo_2021.png | 2024-08-13 17:06 | 518K | |
| 9bushmills_causeway_2021_1989.png | 2024-08-13 17:06 | 393K | |
| 9bushmills_causeway_collection_18_grand_cru.png | 2024-08-13 17:06 | 250K | |
| 9ciwc_the_brollach.png | 2024-08-13 17:06 | 261K | |
| 9clancolla_20_px_edition.png | 2024-08-13 17:06 | 280K | |
| 9connacht-thefirstcask.png | 2024-08-13 17:06 | 251K | |
| 9crownroyal-apple.png | 2024-08-13 17:06 | 250K | |
| 9crownroyalblack.png | 2024-08-13 17:06 | 215K | |
| 9dalmore302021.png | 2024-08-13 17:06 | 172K | |
| 9dewarsJapaneseSmooth.png | 2024-08-13 17:06 | 144K | |
| 9dingle-carryout-part1.png | 2024-08-13 17:06 | 173K | |
| 9dingle__founding_fathers-an-chead-hocht.jpg.png | 2024-08-13 17:06 | 227K | |
| 9dingle_carry_out_pt_2.png | 2024-08-13 17:06 | 163K | |
| 9dingle_samhain.png | 2024-08-13 17:06 | 161K | |
| 9dingle_single_cask_kirsch.png | 2024-08-13 17:06 | 254K | |
| 9dingle_single_cask_kirsch_port.png | 2024-08-13 17:06 | 251K | |
| 9dingle_single_malt_batch6_cs.png | 2024-08-13 17:06 | 354K | |
| 9dingle_stoneturn_founders.png | 2024-08-13 17:06 | 179K | |
| 9douglaslaing_oldparticular_kroenenhalle_bar.png | 2024-08-13 17:06 | 159K | |
| 9drumshanbo_galanta_2021.png | 2024-08-13 17:06 | 269K | |
| 9drumshanbo_pinot_noir.jpg | 2024-08-13 17:06 | 213K | |
| 9dubliner_beer_cask_series_smoked_stout.png | 2024-08-13 17:06 | 177K | |
| 9dunville_20_px_1668.png | 2024-08-13 17:06 | 191K | |
| 9dunville__bww-px121330.png | 2024-08-13 17:06 | 353K | |
| 9dunville_sc_the_errigle.png | 2024-08-13 17:06 | 272K | |
| 9dunville_single_cask_991.png | 2024-08-13 17:06 | 340K | |
| 9feargrinnmointeach.png | 2024-08-13 17:06 | 185K | |
| 9fercullen-13-foxcask_720x.jpg | 2024-08-13 17:06 | 63K | |
| 9fercullen-mill-1.png | 2024-08-13 17:06 | 304K | |
| 9fercullen-theitaliangardens-amarone.jpg | 2024-08-13 17:06 | 278K | |
| 9fercullen-themillhouse-amarone_box_2000x.jpg | 2024-08-13 17:06 | 49K | |
| 9fercullen8.jpg | 2024-08-13 17:06 | 11K | |
| 9fercullen16.jpg | 2024-08-13 17:06 | 38K | |
| 9fercullen_21.png | 2024-08-13 17:06 | 123K | |
| 9fercullen_falls_blended.jpg | 2024-08-13 17:06 | 123K | |
| 9full-180x660-US-rarecask01.png | 2024-08-13 17:06 | 45K | |
| 9glendalough_7_yr_mizunara.png | 2024-08-13 17:06 | 254K | |
| 9gom-amarone-19.png | 2024-08-13 17:06 | 418K | |
| 9grace_o_malley_18_port.png | 2024-08-13 17:06 | 243K | |
| 9grace_o_malley_19_amarone.png | 2024-08-13 17:06 | 267K | |
| 9heavens-door__redbreast.png | 2024-08-13 17:06 | 451K | |
| 9heavensdoortrilogy.png | 2024-08-13 17:06 | 192K | |
| 9hinch-18.png | 2024-08-13 17:06 | 301K | |
| 9hinch_craft_cask_red_rye.png | 2024-08-13 17:06 | 228K | |
| 9hinch_craft_cask_rye_stout.png | 2024-08-13 17:06 | 222K | |
| 9hinch_craft_casks_imperial_stout.png | 2024-08-13 17:06 | 218K | |
| 9hinch_peak_at_the_peat_belfast_whiskey_week.png | 2024-08-13 17:06 | 217K | |
| 9hinch_sps.png | 2024-08-13 17:06 | 410K | |
| 9hydeno11.png | 2024-08-13 17:06 | 226K | |
| 9image.jpg | 2024-08-13 17:06 | 129K | |
| 9irish-single-malt-1-13-year-old-that-boutiquey-whisky-company-whiskey.png | 2024-08-13 17:06 | 191K | |
| 9irish-single-malt-2-15-year-old-that-boutiquey-whisky-company-whiskey.png | 2024-08-13 17:06 | 382K | |
| 9irishamerican19.png | 2024-08-13 17:06 | 225K | |
| 9irishman_17.png | 2024-08-13 17:06 | 299K | |
| 9irishman_cask_strength_2022.png | 2024-08-13 17:06 | 382K | |
| 9irishman_cs_2021.png | 2024-08-13 17:06 | 429K | |
| 9irishman_dick_mac_red_ale.png | 2024-08-13 17:06 | 180K | |
| 9jameson21yearold.png | 2024-08-13 17:06 | 329K | |
| 9jamesonLimeGinger.png | 2024-08-13 17:06 | 169K | |
| 9jamesonOrange.png | 2024-08-13 17:06 | 155K | |
| 9jameson_bartenders_ball_2017.png | 2024-08-13 17:06 | 131K | |
| 9jameson_black_barrel_proof.png | 2024-08-13 17:06 | 140K | |
| 9jameson_patricks_day_2010.png | 2024-08-13 17:06 | 125K | |
| 9jameson_united_football_shirts.png | 2024-08-13 17:06 | 200K | |
| 9jj_corry_bonders_blend_4.png | 2024-08-13 17:06 | 247K | |
| 9jj_corry_cyber_monday.png | 2024-08-13 17:06 | 233K | |
| 9jj_corry_the_battalion.png | 2024-08-13 17:06 | 254K | |
| 9jj_corry_the_cross_no_3.png | 2024-08-13 17:06 | 200K | |
| 9jj_corry_the_flintlock_batch_3.png | 2024-08-13 17:06 | 187K | |
| 9kilbeggan_11_year_single_malt.png | 2024-08-13 17:06 | 211K | |
| 9kilbeggan_black.png | 2024-08-13 17:06 | 191K | |
| 9killowen-dalridan-pt1.png | 2024-08-13 17:06 | 225K | |
| 9killowen-dalridan-pt2.png | 2024-08-13 17:06 | 243K | |
| 9killowenCuigePoitin.jpg | 2024-08-13 17:06 | 209K | |
| 9killowenGloria.png | 2024-08-13 17:06 | 211K | |
| 9killowenRum.jpg | 2024-08-13 17:06 | 1.0M | |
| 9killowen__rum-and-raisin.png | 2024-08-13 17:06 | 209K | |
| 9killowen_barantuil_c1.png | 2024-08-13 17:06 | 190K | |
| 9killowen_barantuil_c2.png | 2024-08-13 17:06 | 193K | |
| 9killowen_bonded_international_belgrove_oat.png | 2024-08-13 17:06 | 193K | |
| 9killowen_bonded_international_belgrove_rye.png | 2024-08-13 17:06 | 191K | |
| 9killowen_bulcan_1.png | 2024-08-13 17:06 | 239K | |
| 9killowen_bulcan_2.png | 2024-08-13 17:06 | 238K | |
| 9killowen_bww-tawny-port.png | 2024-08-13 17:06 | 260K | |
| 9killowen_bww_11yr_cuige_poitin_finish.png | 2024-08-13 17:06 | 239K | |
| 9killowen_kd211.png | 2024-08-13 17:06 | 149K | |
| 9killowen_kdc041_jamesjfox.png | 2024-08-13 17:06 | 213K | |
| 9killowen_still_series_peatedRum.png | 2024-08-13 17:06 | 192K | |
| 9killowen_stone_soup.png | 2024-08-13 17:06 | 167K | |
| 9kinahan_release_28.png | 2024-08-13 17:06 | 195K | |
| 9kinahans-irish-whiskey-kasc-project-b.png | 2024-08-13 17:06 | 258K | |
| 9kinahans_project_m.png | 2024-08-13 17:06 | 181K | |
| 9kingscountybarrelproof.png | 2024-08-13 17:06 | 218K | |
| 9kingscountybib.png | 2024-08-13 17:06 | 212K | |
| 9kingscountyempirerye.png | 2024-08-13 17:06 | 200K | |
| 9kingscountypeatedbourbon.png | 2024-08-13 17:06 | 212K | |
| 9kingscountysinglemalt.png | 2024-08-13 17:06 | 209K | |
| 9kingscountystraightbourbon.png | 2024-08-13 17:06 | 212K | |
| 9knappogue_12_cask_Strength.png | 2024-08-13 17:06 | 284K | |
| 9knappogue_1994_devoted_friend.png | 2024-08-13 17:06 | 139K | |
| 9knappogue_1994_selfish_giant.png | 2024-08-13 17:06 | 275K | |
| 9knappogue_1996_remarkable_rocket.png | 2024-08-13 17:06 | 140K | |
| 9knappogue_castle_12_cognac.png | 2024-08-13 17:06 | 229K | |
| 9knappogue_castle_1994_the_happy_prince.png | 2024-08-13 17:06 | 140K | |
| 9kyro_monbazillac_cask.png | 2024-08-13 17:06 | 134K | |
| 9laeview_single_estate_first_release.png | 2024-08-13 17:06 | 237K | |
| 9laphroaig_cairdeas_2021.png | 2024-08-13 17:06 | 137K | |
| 9liberator_port_b3.png | 2024-08-13 17:06 | 207K | |
| 9liberator_portnpeat.png | 2024-08-13 17:06 | 182K | |
| 9liberator_small_batch_double_port.png | 2024-08-13 17:06 | 203K | |
| 9liberatory_storehouse_b1.png | 2024-08-13 17:06 | 175K | |
| 9liberatory_storehouse_b2.png | 2024-08-13 17:06 | 164K | |
| 9limavady_single_malt.png | 2024-08-13 17:06 | 133K | |
| 9littleBookChapter5.png | 2024-08-13 17:06 | 327K | |
| 9lochlea_first_sowing.png | 2024-08-13 17:06 | 302K | |
| 9lough-ree_the-bridge.png | 2024-08-13 17:06 | 217K | |
| 9lough_ree_the_bridge_barley_harbour.png | 2024-08-13 17:06 | 165K | |
| 9lough_ree_the_bridge_bethleham.png | 2024-08-13 17:06 | 152K | |
| 9lough_ree_the_bridge_st_mels_1.png | 2024-08-13 17:06 | 133K | |
| 9macallan_distil_london.png | 2024-08-13 17:06 | 269K | |
| 9macallan_harmony_fine_cacao.png | 2024-08-13 17:06 | 221K | |
| 9macallan_harmony_intense_arabic.png | 2024-08-13 17:06 | 226K | |
| 9macallan_harmony_rich_cacao.png | 2024-08-13 17:06 | 322K | |
| 9macallan_harmony_smooth_arabic.png | 2024-08-13 17:06 | 234K | |
| 9macallan_new.png | 2024-08-13 17:06 | 314K | |
| 9macallan_nightonearth_inscotland.png | 2024-08-13 17:06 | 297K | |
| 9mackmyra_bww.png | 2024-08-13 17:06 | 158K | |
| 9mayLoagDiamondSherry.png | 2024-08-13 17:06 | 221K | |
| 9mayLoagDiamondSherry_set.png | 2024-08-13 17:06 | 235K | |
| 9mayLoagTripleWood.png | 2024-08-13 17:07 | 213K | |
| 9mayloagoriel.png | 2024-08-13 17:06 | 206K | |
| 9methodandmadness_33_japanese.png | 2024-08-13 17:07 | 292K | |
| 9methodandmadness_Cedar.png | 2024-08-13 17:07 | 157K | |
| 9methodandmadness_Chestnut.png | 2024-08-13 17:07 | 159K | |
| 9michaelcollinsirishwhiskey(transparent).png | 2024-08-13 17:07 | 164K | |
| 9midleotnjamesfox1999.png | 2024-08-13 17:07 | 322K | |
| 9midleton__single-cask__1998-1825Room.png | 2024-08-13 17:07 | 302K | |
| 9midleton__very-rare__2022.png | 2024-08-13 17:07 | 345K | |
| 9midleton_silent_distillery_chapter_3.png | 2024-08-13 17:07 | 276K | |
| 9murphyStoutFriendorFoe.PNG | 2024-08-13 17:07 | 158K | |
| 9murphystoutTwoMayors.PNG | 2024-08-13 17:07 | 268K | |
| 9oxfordRye.png | 2024-08-13 17:07 | 201K | |
| 9oxfordgiftset.png | 2024-08-13 17:07 | 165K | |
| 9paddysshare.png | 2024-08-13 17:07 | 168K | |
| 9pearse-marriagemalt20191.png | 2024-08-13 17:07 | 315K | |
| 9portmagee-SPS-1.png | 2024-08-13 17:07 | 359K | |
| 9powers_sc_125997.png | 2024-08-13 17:07 | 298K | |
| 9rb_single_cask_barrel_batch_10755.png | 2024-08-13 17:07 | 293K | |
| 9rb_single_cask_cws_34970.png | 2024-08-13 17:07 | 259K | |
| 9rb_single_cask_friends_midleton.png | 2024-08-13 17:07 | 245K | |
| 9rb_single_cask_sweden_59815.png | 2024-08-13 17:07 | 276K | |
| 9rbpxiberian.png | 2024-08-13 17:07 | 241K | |
| 9red_spot_sc_thewhiskeyexchange.png | 2024-08-13 17:07 | 245K | |
| 9redbreast+20+year+sc.png | 2024-08-13 17:07 | 184K | |
| 9redbreast_1989_TWE.png | 2024-08-13 17:07 | 279K | |
| 9redbreast__DreamCask-29.png | 2024-08-13 17:07 | 527K | |
| 9redbreast__dc30_doubleCask.png | 2024-08-13 17:07 | 266K | |
| 9redbreast_cs_21.png | 2024-08-13 17:07 | 202K | |
| 9redbreast_cuatro_barriles.png | 2024-08-13 17:07 | 207K | |
| 9redbreast_single_cask_fah_3413.png | 2024-08-13 17:07 | 240K | |
| 9redearl-cs.png | 2024-08-13 17:07 | 0 | |
| 9santais_malt_himmelberg.png | 2024-08-13 17:07 | 252K | |
| 9shortcross_storiesandsips.png | 2024-08-13 17:07 | 149K | |
| 9shortcrosspoitin_590x.png | 2024-08-13 17:07 | 90K | |
| 9slane_batch_proof.png | 2024-08-13 17:07 | 165K | |
| 9smws_46.123.png | 2024-08-13 17:07 | 144K | |
| 9squadron303.png | 2024-08-13 17:07 | 206K | |
| 9teeling13grain.png | 2024-08-13 17:07 | 365K | |
| 9teeling30yearsvr.png | 2024-08-13 17:07 | 260K | |
| 9teeling32yearold.png | 2024-08-13 17:07 | 240K | |
| 9teeling_32_rumand_px.png | 2024-08-13 17:07 | 255K | |
| 9teeling__6thBirthday.png | 2024-08-13 17:07 | 74K | |
| 9teeling_daz_12_yo.png | 2024-08-13 17:07 | 181K | |
| 9teeling_greek_12_yo.png | 2024-08-13 17:07 | 280K | |
| 9teeling_renaissance_series_5.png | 2024-08-13 17:07 | 290K | |
| 9teeling_sc_15_nectar.png | 2024-08-13 17:07 | 196K | |
| 9teeling_sc_29566.png | 2024-08-13 17:07 | 366K | |
| 9teeling_sc_53829.png | 2024-08-13 17:07 | 162K | |
| 9teeling_sc_55120.png | 2024-08-13 17:07 | 360K | |
| 9teeling_sc_100135.png | 2024-08-13 17:07 | 213K | |
| 9teeling_sc_100182.png | 2024-08-13 17:07 | 249K | |
| 9teeling_sc_sps_67908.png | 2024-08-13 17:07 | 186K | |
| 9teeling_sc_the_wine_market.png | 2024-08-13 17:07 | 327K | |
| 9teeling_small_batch_aquavit_cask.png | 2024-08-13 17:07 | 316K | |
| 9teeling_somm_amarone.png | 2024-08-13 17:07 | 366K | |
| 9teeling_sps_belgium_luxemburg.png | 2024-08-13 17:07 | 352K | |
| 9teeling_sps_jamesfox.png | 2024-08-13 17:07 | 290K | |
| 9teeling_sps_whiskyClub_it.png | 2024-08-13 17:07 | 274K | |
| 9teeling_united_we_stand_ukraine.png | 2024-08-13 17:07 | 189K | |
| 9the-sexton-single-malt-whiskey.png | 2024-08-13 17:07 | 134K | |
| 9the_bridge_rindoon_release.png | 2024-08-13 17:07 | 160K | |
| 9the_bridge_santins_island.png | 2024-08-13 17:07 | 160K | |
| 9the_confession_box_6_yr_special.jpg | 2024-08-13 17:07 | 221K | |
| 9the_irishman_friends_of_walsh.png | 2024-08-13 17:07 | 144K | |
| 9the_irishman_the_harvest.png | 2024-08-13 17:07 | 182K | |
| 9the_whistler_sc_bww.png | 2024-08-13 17:07 | 188K | |
| 9the_whistler_sc_daz.png | 2024-08-13 17:07 | 171K | |
| 9the_whistler_sc_daz_1112.png | 2024-08-13 17:07 | 181K | |
| 9the_whistler_sc_daz_1195.png | 2024-08-13 17:07 | 177K | |
| 9the_whistler_sc_daz_1205.png | 2024-08-13 17:07 | 184K | |
| 9thesexton_walkingdead.png | 2024-08-13 17:07 | 227K | |
| 9thomond_gate_danish_rye.png | 2024-08-13 17:07 | 190K | |
| 9thomond_gate_ex_heather_cask.png | 2024-08-13 17:07 | 211K | |
| 9thomond_ruby_port.png | 2024-08-13 17:07 | 189K | |
| 9thomondgate_peterlacey_imperial.png | 2024-08-13 17:07 | 219K | |
| 9thoomand_galloping_hogan_rubyport.png | 2024-08-13 17:07 | 213K | |
| 9thoomand_inaugral.png | 2024-08-13 17:07 | 355K | |
| 9tipperary_single_cask_2008_rijoja.png | 2024-08-13 17:07 | 264K | |
| 9tipphomegrown-1-1.png | 2024-08-13 17:07 | 95K | |
| 9titanic_05_px.png | 2024-08-13 17:07 | 126K | |
| 9tomatin_french_collection_cognac.png | 2024-08-13 17:07 | 370K | |
| 9tomatin_french_collection_monbazillac.png | 2024-08-13 17:07 | 301K | |
| 9tomatin_french_collection_rivesaltes.png | 2024-08-13 17:07 | 286K | |
| 9tomatin_french_collection_sauternes.png | 2024-08-13 17:07 | 283K | |
| 9two_stacks_pillar_creation_2024.png | 2024-08-13 17:07 | 150K | |
| 9two_stacks_polaris_1_2.png | 2024-08-13 17:07 | 150K | |
| 9two_stacks_polaris_collection_first_bottling.png | 2024-08-13 17:07 | 235K | |
| 9two_stacks_stories_and_sips_2024.png | 2024-08-13 17:07 | 163K | |
| 9twostack-blenders-cask-strength.png | 2024-08-13 17:07 | 209K | |
| 9twostack_timewellspent.PNG | 2024-08-13 17:07 | 134K | |
| 9twostacksdoublecreamliquor.png | 2024-08-13 17:07 | 126K | |
| 9uais_irish_blend.png | 2024-08-13 17:07 | 188K | |
| 9waterford__micro-cuvee-primavera.png | 2024-08-13 17:07 | 288K | |
| 9waterford_biodynamic_luna_1_1.png | 2024-08-13 17:07 | 318K | |
| 9waterford_cuvee.png | 2024-08-13 17:07 | 6.6M | |
| 9waterford_heritage_hunter.png | 2024-08-13 17:07 | 118K | |
| 9waterford_micro_cuvee_blood_brother.png | 2024-08-13 17:07 | 291K | |
| 9waterford_micro_cuvee_hearth.png | 2024-08-13 17:07 | 302K | |
| 9waterford_micro_cuvee_rue_du_nil.png | 2024-08-13 17:07 | 118K | |
| 9waterford_micro_cuvee_voyages_extraordinare.png | 2024-08-13 17:07 | 284K | |
| 9waterford_sfo_grattansbrook_1_1.png | 2024-08-13 17:07 | 294K | |
| 9waterford_sfo_lakefield_1_1.png | 2024-08-13 17:07 | 292K | |
| 9waterford_the_cuvee.png | 2024-08-13 17:07 | 322K | |
| 9wd-oconnell-10-year-single-grain.png | 2024-08-13 17:07 | 156K | |
| 9wd-oconnell-lochindaal.png | 2024-08-13 17:07 | 194K | |
| 9wd_o_connel_single_grain.png | 2024-08-13 17:07 | 305K | |
| 9wd_o_connell_bill_phil.png | 2024-08-13 17:07 | 291K | |
| 9wd_o_connell_px_series_19_yo.png | 2024-08-13 17:07 | 144K | |
| 9wd_o_connell_tomasin.png | 2024-08-13 17:07 | 178K | |
| 9whistler_7_cs.png | 2024-08-13 17:07 | 338K | |
| 9wiseowl.png | 2024-08-13 17:07 | 216K | |
| 9writer_tear_cask_strength_2022.png | 2024-08-13 17:07 | 385K | |
| 9writers_tears_ulysses.png | 2024-08-13 17:07 | 159K | |
| 9writerstears_inniskillen_wine_1.png | 2024-08-13 17:07 | 360K | |
| 9writertear-giftbook.png | 2024-08-13 17:07 | 226K | |
| 10IMG_20210310_160932_699.jpg | 2024-08-13 17:05 | 60K | |
| 10NEW-Ballykeefe-Whiskey-Double-Box-Cropped-768x689.jpg | 2024-08-13 17:05 | 116K | |
| 10NEW-Ballykeefe-Whiskey-Single-Box-copy-768x686.jpg | 2024-08-13 17:05 | 90K | |
| 12Aberfeldy 12.jpg | 2024-08-13 17:05 | 525K | |
| 12Aberlour 10.jpg | 2024-08-13 17:05 | 255K | |
| 20_4.jpg | 2024-08-13 17:06 | 185K | |
| 34_1a.jpg | 2024-08-13 17:06 | 243K | |
| 51_1.jpg | 2024-08-13 17:06 | 193K | |
| 63ED431C-CAC1-43C1-A8DA-D4049996ADD4.jpeg | 2024-08-13 17:06 | 66K | |
| 63FA638F-ECE4-4E2B-8A39-0528DC8F5CC5.jpeg | 2024-08-13 17:06 | 134K | |
| 76F47452-BE21-4681-9719-EA2938D2EC2F.jpeg | 2024-08-13 17:06 | 149K | |
| 82_Chapters_to_Newcastle_2008_82NC_Creatures_of_Cask_Strength_import.png | 2024-08-13 17:06 | 113K | |
| 82_Chapters_to_Newcastle_Secret_Islay_82NC_Exklusive_Selected_and_Handfilled_import.png | 2024-08-13 17:06 | 97K | |
| 84A88A91-CB3A-4766-A3A4-C5CA17EDCEF7.jpeg | 2024-08-13 17:06 | 112K | |
| 89image.jpg | 2024-08-13 17:06 | 3.3M | |
| 90E87071F-C2E4-4A7C-A6FD-3172CD8EB20C.png | 2024-08-13 17:06 | 118K | |
| 93piece killowen.png | 2024-08-13 17:06 | 150K | |
| 94BC802E2-30A3-43DB-96B2-25118CF8D232.png | 2024-08-13 17:06 | 184K | |
| 94D9629D1-7E29-4C06-824B-F6D0A6580604.jpeg | 2024-08-13 17:06 | 112K | |
| 96DEA6577-D102-4463-A9FC-5A6A1AA86D50.png | 2024-08-13 17:06 | 278K | |
| 96FC2B985-6B1C-4E86-8BE7-CC622DAD5C15.png | 2024-08-13 17:06 | 137K | |
| 97E10DED2-311A-4B5E-98D6-D5742A92D5EC.png | 2024-08-13 17:06 | 85K | |
| 98BBFBBE7-251F-49AB-911A-3FB8314BD7CB.png | 2024-08-13 17:06 | 127K | |
| 99CD1AC92-4306-4326-967A-4279F44AFB73.jpeg | 2024-08-13 17:06 | 112K | |
| 100_Pipers_08-year-old_Blended_Malt_Scotch_Whisky_import.png | 2024-08-13 17:05 | 99K | |
| 100_Pipers_08-year-old_import.png | 2024-08-13 17:05 | 104K | |
| 162FC5F4E1E-EC16-43D5-875A-87F471B2FCB7.jpeg | 2024-08-13 17:05 | 2.9M | |
| 179D49C047D-93AF-468A-99EA-BAA1C8AB0514.jpeg | 2024-08-13 17:05 | 2.0M | |
| 179E3218E93-2B53-4E2B-AAAC-5310B2D6E53E.jpeg | 2024-08-13 17:05 | 730K | |
| 195Hibiki-Blossom-Harmony-Limited-Release-2021-Pre-Order.jpg | 2024-08-13 17:06 | 285K | |
| 195Rye.jpg | 2024-08-13 17:06 | 206K | |
| 195cognac cask 49%.jpg | 2024-08-13 17:06 | 144K | |
| 195heather peated madeira.jpg | 2024-08-13 17:06 | 140K | |
| 195image.jpg | 2024-08-13 17:06 | 170K | |
| 195peated bourbon.jpg | 2024-08-13 17:06 | 174K | |
| 195red ale.jpg | 2024-08-13 17:06 | 220K | |
| 195stout 53.28.jpg | 2024-08-13 17:06 | 218K | |
| 195teelings heroes.jpg | 2024-08-13 17:06 | 258K | |
| 285currach-single-malt.jpg | 2024-08-13 17:06 | 101K | |
| 302_1.jpg | 2024-08-13 17:06 | 323K | |
| 313_1.jpg | 2024-08-13 17:06 | 176K | |
| 319FDB19301-8CE5-47C9-964A-90614DF4175E.png | 2024-08-13 17:06 | 13K | |
| 320-Dingle-PPS-2-776x776.jpg | 2024-08-13 17:06 | 97K | |
| 328IMG_20210415_114144__01.jpg | 2024-08-13 17:06 | 3.6M | |
| 328IMG_20210415_114909__01__01.jpg | 2024-08-13 17:06 | 1.1M | |
| 328IMG_20210415_114921__01.jpg | 2024-08-13 17:06 | 1.3M | |
| 328IMG_20210415_114942__01.jpg | 2024-08-13 17:06 | 1.8M | |
| 328Jameson-Midleton-Distillery-Reserve-776x1176.jpg | 2024-08-13 17:06 | 39K | |
| 341IMG_5020.jpg | 2024-08-13 17:06 | 2.7M | |
| 341Takamine.png.jpg | 2024-08-13 17:06 | 43K | |
| 398WoW Amburana.PNG | 2024-08-13 17:06 | 410K | |
| 398WoW Cherry.PNG | 2024-08-13 17:06 | 283K | |
| 421_1.jpg | 2024-10-10 14:27 | 205K | |
| 429The-Bridge-MOUNTDILLON-776x1176.jpg | 2024-08-13 17:06 | 56K | |
| 473-Jameson-Grace-2.jpg | 2024-08-13 17:06 | 61K | |
| 601Coopers-Cask-Single-Malt-Cask-Strength-Whiskey-single-box.gif | 2024-08-13 17:06 | 108K | |
| 601main_1205_Tamdhu-120th-Anniversary-Bottle__q-100.jpg | 2024-08-13 17:06 | 389K | |
| 623IMG_20221009_130527348.jpg | 2024-08-13 17:06 | 195K | |
| 637writers-tears-cask-strength-2021.jpeg | 2024-08-13 17:06 | 95K | |
| 823-Midleton-2017-Old-Style-1.jpg | 2024-08-13 17:06 | 145K | |
| 858Bushmills The Rare Casks.jpeg | 2024-08-13 17:06 | 37K | |
| 909FE0B7C-9CF7-401D-8A6D-4B816FD53BDB.png | 2024-08-13 17:06 | 296K | |
| 916F617B1-DA5C-4871-B1C1-693DCC691A09.png | 2024-08-13 17:06 | 147K | |
| 924CFE0FE-AF13-4893-847C-260E254BE280.png | 2024-08-13 17:06 | 116K | |
| 932D484DA-3B8D-4609-AA7E-2EAA60C730BF.png | 2024-08-13 17:06 | 181K | |
| 938F841A0-C976-4B63-A670-12A5357E3F47.png | 2024-08-13 17:06 | 85K | |
| 941B4C2D6-441F-45BB-B89C-C4F4F0FA2976.png | 2024-08-13 17:06 | 194K | |
| 976C12CED-D531-4A72-AD14-E1471FFB8AD5.png | 2024-08-13 17:06 | 265K | |
| 981A89F83-D5C4-4438-9DBC-EC7BC35A404D.png | 2024-08-13 17:06 | 129K | |
| 1000IMG_3053_3.jpg | 2024-08-13 17:05 | 409K | |
| 1000celticwhiskey2001.jpg | 2024-08-13 17:05 | 114K | |
| 1019FE8F3D2-EBBB-4232-B2C5-CAF17881AF1F.png | 2024-08-13 17:05 | 102K | |
| 1153PADDYS FRONT.PNG | 2024-08-13 17:05 | 3.7M | |
| 1232Bushmills-Rare-Cask-29-year-PX-cask-1240x696.jpeg | 2024-08-13 17:05 | 123K | |
| 1232Bushmills 12.jpeg | 2024-08-13 17:05 | 20K | |
| 1232Bushmills Prohibition Recipe jpg.jpg | 2024-08-13 17:05 | 34K | |
| 1232Egan's 10 Year Single Malt.png | 2024-08-13 17:05 | 241K | |
| 1232Hyde-1922-Rum-Finish-776x1176.jpeg | 2024-08-13 17:05 | 214K | |
| 1232Keeper's Heart jpeg.jpg | 2024-08-13 17:05 | 91K | |
| 1232Lost Irish jpg.jpg | 2024-08-13 17:05 | 91K | |
| 1232M&M-malt-French Oak.jpeg | 2024-08-13 17:05 | 63K | |
| 1232M&M single-pot-Chestnut.jpeg | 2024-08-13 17:05 | 62K | |
| 1232Pearse-12-YO-Trans_BRIGHT-822b5254.jpg | 2024-08-13 17:05 | 138K | |
| 1232Screen Shot 2021-09-01 at 3.37.53 PM.png | 2024-08-13 17:05 | 521K | |
| 1232Screen Shot 2021-11-01 at 1.47.01 PM.png | 2024-08-13 17:05 | 95K | |
| 1232Screen Shot 2021-11-01 at 1.56.41 PM.png | 2024-08-13 17:05 | 96K | |
| 1232Teeling 25 Rum Cask.png | 2024-08-13 17:05 | 707K | |
| 1232Teeling Pot Still -WOW-Chinkapin Oak.jpg | 2024-08-13 17:05 | 249K | |
| 1232conviction-796x2048.jpg | 2024-08-13 17:05 | 80K | |
| 1232kh-bottle-front-lg-01.png | 2024-08-13 17:05 | 314K | |
| 1625C88FFFA-9C16-4C48-9145-5355A3EED8C5.jpeg | 2024-08-13 17:05 | 31K | |
| 1770_2015_-_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 103K | |
| 1770_2016_-_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 120K | |
| 1770_2016_-_Glasgow_Single_Malt_import.png | 2024-08-13 17:05 | 102K | |
| 1770_2016_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 107K | |
| 1770_2017_-_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 93K | |
| 1770_2017_-_Glasgow_Single_Malt_import.png | 2024-08-13 17:05 | 109K | |
| 1770_2017_Glasgow_Single_Malt_-_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 110K | |
| 1770_2018_-_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 114K | |
| 1770_2018_-_Glasgow_Single_Malt_import.png | 2024-08-13 17:05 | 239K | |
| 1770_2018_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 107K | |
| 1770_2018_Limited_Edtion_Release_import.png | 2024-08-13 17:05 | 94K | |
| 1770_2018_Small_Batch_Series_-_Peated_import.png | 2024-08-13 17:05 | 117K | |
| 1770_2018_Small_Batch_Series_import.png | 2024-08-13 17:05 | 216K | |
| 1770_2018_import.png | 2024-08-13 17:05 | 110K | |
| 1770_Glasgow_Single_Malt_Limited_Edition_Release_-_The_Netherlands_Exclusive_import.png | 2024-08-13 17:05 | 104K | |
| 1770_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:05 | 111K | |
| 1770_Glasgow_Single_Malt_Peated_-_Cask_Strength_import.png | 2024-08-13 17:05 | 102K | |
| 1770_Glasgow_Single_Malt_The_Original_-_Cask_Strength_-_Batch_01_import.png | 2024-08-13 17:05 | 105K | |
| 1770_Glasgow_Single_Malt_The_Original_-_Fresh_&_Fruity_import.png | 2024-08-13 17:05 | 105K | |
| 1770_Glasgow_Single_Malt_Triple_Distilled_import.png | 2024-08-13 17:05 | 106K | |
| 1792 Ridgemont Reserve.jpg | 2024-08-13 17:05 | 145K | |
| 1792_Full_Proof_Single_Barrel_Select_import.png | 2024-08-13 17:05 | 196K | |
| 1989_wt-101.jpg | 2024-08-13 17:06 | 155K | |
| 3195C692E0F-6BAA-40B8-9E65-A769E651211A.jpeg | 2024-08-13 17:06 | 263K | |
| 3474defaultbottle.png | 2024-08-13 17:06 | 27K | |
| 3553Celtic-Cask-Se-Deag-776x1176.jpg | 2024-08-13 17:06 | 224K | |
| 3553Celtic_Cask_17.jpg | 2024-08-13 17:06 | 220K | |
| 3553Celtic_Cask_18.jpg | 2024-08-13 17:06 | 219K | |
| 3553Celtic_Cask_38-776x1176-1000x1000.jpg | 2024-08-13 17:06 | 160K | |
| 3553Lagavulin-Offerman-Edition-Charred-Oak-Cask-11-year-Oct-2022_600.jpg | 2024-08-13 17:06 | 331K | |
| 3553Screenshot 2022-11-27 212922.png | 2024-08-13 17:06 | 151K | |
| 3553Screenshot 2022-11-27 212947.png | 2024-08-13 17:06 | 148K | |
| 3553Screenshot 2024-06-26 at 18.04.02.png | 2024-08-13 17:06 | 189K | |
| 3553The_Whistler_Palo_Cortado_Single_Cask.png | 2024-08-13 17:06 | 137K | |
| 3553WOW__II_CWS-776x1176.jpg | 2024-08-13 17:06 | 227K | |
| 3553bushmills-Tequila-Casks-Causeway-Collection.png | 2024-08-13 17:06 | 248K | |
| 3553images.jpeg | 2024-10-10 14:21 | 174K | |
| 3553jura-19-years-old-2001-2020-distillery-cask-no1708.jpg | 2024-08-13 17:06 | 276K | |
| 3553photo_2022-11-27_12-38-44.jpg | 2024-08-13 17:06 | 238K | |
| 3553photo_2022-11-27_20-32-33.jpg | 2024-08-13 17:06 | 201K | |
| 3553photo_2022-11-27_20-36-56.jpg | 2024-08-13 17:06 | 209K | |
| 3553photo_2022-11-27_21-07-01.jpg | 2024-08-13 17:06 | 187K | |
| 4067irishman_17_6961.png | 2024-08-13 17:06 | 256K | |
| 4067natterjack_caskstrength.jpg | 2024-08-13 17:06 | 215K | |
| 9019DEFAF-F687-4C6D-8D18-AFF5B0C973EE.png | 2024-08-13 17:06 | 242K | |
| 9456B92B4-8AB9-4602-9425-1BB1DF9ED375.png | 2024-08-13 17:06 | 115K | |
| 9903BBE89-E7DD-4EE5-94A5-B748AD042718.jpeg | 2024-08-13 17:06 | 121K | |
| 16233CD5DA2-41CE-44F0-8229-A37A34CC6AB2.jpeg | 2024-08-13 17:05 | 69K | |
| 16865A706B6-527E-4BCE-912C-BB0E4EBA7399.jpeg | 2024-08-13 17:05 | 53K | |
| 20261_big.jpg | 2024-08-13 17:06 | 158K | |
| 43018_connemara_22yo_fl_gh.png | 2024-08-13 17:06 | 1.0M | |
| 75629-XpOm66hlLzwVFVULGSNkog.jpg | 2024-10-10 14:16 | 249K | |
| 89920dfd7a18dc12aac657d089cf05d7455b8fbc_1024x1024.png | 2024-08-13 17:06 | 550K | |
| 90874BAA3-DB23-4822-B0BE-B6ECFA34A778.png | 2024-08-13 17:06 | 230K | |
| 91808DickMacksHoneyandHempIWS.png | 2024-08-13 17:06 | 143K | |
| 93717C745-818E-40C4-97DC-A9873FEE9D86.png | 2024-08-13 17:06 | 215K | |
| 94610FE08-2C32-4FE9-97D7-1C16FAB13BF9.png | 2024-08-13 17:06 | 143K | |
| 94915C400-24E2-4EDD-B81A-39E3492CAFBF.png | 2024-08-13 17:06 | 204K | |
| 95774C4D2-91CE-41A4-BD1E-36452E1D4BDA.png | 2024-08-13 17:06 | 241K | |
| 98331AD07-11ED-47DF-9290-D1EAC163022F.png | 2024-08-13 17:06 | 132K | |
| 101611C345D-1FFE-4B1D-8092-706D6EB8570A.jpeg | 2024-08-13 17:05 | 69K | |
| 144281-big.jpg | 2024-08-13 17:05 | 265K | |
| 154851_600x600.jpg | 2024-08-13 17:05 | 274K | |
| 157106-big.jpg | 2024-08-13 17:05 | 232K | |
| 228648-big.jpg | 2024-08-13 17:06 | 135K | |
| 250621-big.jpg | 2024-08-13 17:06 | 102K | |
| 347612_7_8_827_BOURBONMAKERSMARK750ml2.jpg | 2024-08-13 17:06 | 133K | |
| 913076C99-14FF-4EA9-A06C-6C2B01D0C6AE.png | 2024-08-13 17:06 | 231K | |
| 970030FE6-64B8-4605-A5A0-6B85193567B0.png | 2024-08-13 17:06 | 173K | |
| 1687414A9F1-6DEA-4152-806C-F2DEEF86E0CA.jpeg | 2024-08-13 17:05 | 123K | |
| 1688039A129-1EFD-4F6E-BE66-6B3A2B8A4072.jpeg | 2024-08-13 17:05 | 226K | |
| 1817428_Jameson_18_Year_Old_Limited_Reserve-1.jpg | 2024-08-13 17:05 | 168K | |
| 1817825_Bushmills_Causeway_Collection_12_Year_Old_Douro_Cask-1.jpg | 2024-08-13 17:05 | 198K | |
| 1817892_Killowen_10_Year_old_Peated_Malt_Islay_Influence-1.jpg | 2024-08-13 17:05 | 211K | |
| 1818611_Tipperary_Single_Cask_Release-1.jpg | 2024-08-13 17:05 | 153K | |
| 3553354_1.jpg | 2024-08-13 17:06 | 110K | |
| 9189900-1.JPG | 2024-08-13 17:06 | 837K | |
| 9327875-big.jpg | 2024-08-13 17:06 | 103K | |
| 9404974E5-74B6-4BAC-8A8A-288F4D7DBDAC.png | 2024-08-13 17:06 | 128K | |
| 9677031EA-E7A7-4986-8302-B296D0D12D5B.png | 2024-08-13 17:06 | 245K | |
| 20190613_203523.jpg | 2024-08-13 17:06 | 2.4M | |
| 20200217_202744.jpg | 2024-08-13 17:06 | 1.8M | |
| 20200223_224419.jpg | 2024-08-13 17:06 | 1.1M | |
| 20200226_201451.jpg | 2024-08-13 17:06 | 1.7M | |
| 20200226_201610.jpg | 2024-08-13 17:06 | 1.8M | |
| 20200304_190110.jpg | 2024-08-13 17:06 | 2.1M | |
| 20200305_191637.jpg | 2024-08-13 17:06 | 2.3M | |
| 20200305_191644.jpg | 2024-08-13 17:06 | 2.5M | |
| 20200305_191647.jpg | 2024-08-13 17:06 | 2.5M | |
| 20200305_191653.jpg | 2024-08-13 17:06 | 2.5M | |
| 20200306_225204.jpg | 2024-08-13 17:06 | 1.5M | |
| 20200314_192434.jpg | 2024-08-13 17:06 | 1.9M | |
| 20200314_194653.jpg | 2024-08-13 17:06 | 1.7M | |
| 20200314_202644.jpg | 2024-08-13 17:06 | 1.6M | |
| 20200314_205825.jpg | 2024-08-13 17:06 | 1.6M | |
| 20200516_203951.jpg | 2024-08-13 17:06 | 1.9M | |
| 20200528_201213.jpg | 2024-08-13 17:06 | 1.6M | |
| 20200528_202854.jpg | 2024-08-13 17:06 | 1.7M | |
| 20200905_161157.jpg | 2024-08-13 17:06 | 2.9M | |
| 20201008_210912.jpg | 2024-08-13 17:06 | 2.5M | |
| 20201017_194734.jpg | 2024-08-13 17:06 | 2.1M | |
| 20201019_195428.jpg | 2024-08-13 17:06 | 2.7M | |
| 20201019_195626.jpg | 2024-08-13 17:06 | 2.3M | |
| 20201019_195727.jpg | 2024-08-13 17:06 | 2.5M | |
| 20201019_200105.jpg | 2024-08-13 17:06 | 2.8M | |
| 20201019_200148.jpg | 2024-08-13 17:06 | 2.1M | |
| 20201019_200401.jpg | 2024-08-13 17:06 | 2.1M | |
| 20201019_200439.jpg | 2024-08-13 17:06 | 2.2M | |
| 20201019_200839.jpg | 2024-08-13 17:06 | 2.1M | |
| 20201019_200928.jpg | 2024-08-13 17:06 | 2.2M | |
| 20201019_201102.jpg | 2024-08-13 17:06 | 2.8M | |
| 20201019_201507.jpg | 2024-08-13 17:06 | 2.2M | |
| 20201019_201728.jpg | 2024-08-13 17:06 | 2.5M | |
| 20201019_201900.jpg | 2024-08-13 17:06 | 2.4M | |
| 20201019_202004.jpg | 2024-08-13 17:06 | 2.3M | |
| 20201019_202431.jpg | 2024-08-13 17:06 | 2.1M | |
| 20201019_203039.jpg | 2024-08-13 17:06 | 3.3M | |
| 65596124_Powers_Aviation_Release_16_Year_Old_Cask_No__17100-1.jpg | 2024-08-13 17:06 | 180K | |
| 65603109_Killowen_10_Year_Old_Virgin_Oak_Cask-1.jpg | 2024-08-13 17:06 | 197K | |
| 65622283_Killowen_Oatmeal_Stout_10_Year_Old_Bottle_No__83_350-1.jpg | 2024-08-13 17:06 | 196K | |
| 65632973_Redbreast_Small_Batch_Cask_Strength-1.jpg | 2024-08-13 17:06 | 160K | |
| 320201019_203136.jpg | 2024-08-13 17:06 | 2.6M | |
| 849061610_1.jpg | 2024-08-13 17:06 | 180K | |
| 928233532-1F23-4E10-9363-A021453AADDD.png | 2024-08-13 17:06 | 169K | |
| 945923029-6A8B-4AF3-AA09-534450072A51.png | 2024-08-13 17:06 | 88K | |
| 1553076961IMG_0002.jpeg | 2024-08-13 17:05 | 336K | |
| 1595859912IMG-7438.jpeg | 2024-08-13 17:05 | 636K | |
| 3553318027-big.jpg | 2024-08-13 17:06 | 167K | |
| 355365651933_Redbreast_Oloroso_Sherry_Single_Cask_OBriens_Wine-1.jpg | 2024-08-13 17:06 | 162K | |
| 35532000440448_01.jpg | 2024-08-13 17:06 | 265K | |
| 16031324273453149113951434324280.jpg | 2024-08-13 17:05 | 2.4M | |
| 16258964762821961423965792974882.jpg | 2024-08-13 17:05 | 1.2M | |
| 31603132138462737465581561372466.jpg | 2024-08-13 17:06 | 2.1M | |
| 316031318375672634142735126519484.jpg | 2024-08-13 17:06 | 2.1M | |
| 316031334650894351235390710794059.jpg | 2024-08-13 17:06 | 1.8M | |
| 62316676053563846703977862090796588.jpg | 2024-08-13 17:06 | 113K | |
| 572717094057638266823211891772350288.jpg | 2024-08-13 17:06 | 145K | |
| ASW_Fiddler_Georgia_Heartwood_Single_Barrel_Cask_Strength_import.png | 2024-08-13 17:08 | 89K | |
| ASW_Tire_Fire_Cask_Strength_import.png | 2024-08-13 17:08 | 85K | |
| A_Christmas_Dram_2001_TCaWi_import.png | 2024-08-13 17:08 | 154K | |
| A_Highland_Distillery_37-year-old_CA_Original_Collection_import.png | 2024-08-13 17:08 | 149K | |
| A_Highland_Distillery_1985_CA_Cadenheads_club_import.png | 2024-08-13 17:08 | 117K | |
| A_Highland_Distillery_2000_CWCL_Watt_Whisky_import.png | 2024-08-13 17:08 | 92K | |
| A_Highland_Distillery_2010_TWBa_The_Founders_Collection_import.png | 2024-08-13 17:08 | 124K | |
| A_Highland_Distillery_2011_CWCL_Watt_Whisky_import.png | 2024-08-13 17:08 | 94K | |
| A_Highland_Distillery_2011_NSpS_Modernism_import.png | 2024-08-13 17:08 | 104K | |
| A_Highland_Distillery_2011_SkBr_import.png | 2024-08-13 17:08 | 252K | |
| A_Highland_Malt_2016_K23_what_if_BYOB-C_meant_something_else_import.png | 2024-08-13 17:08 | 114K | |
| A_Kentucky_Distillery_2018_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:08 | 115K | |
| A_Lowland_Distillery_2007_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:08 | 108K | |
| A_Lowland_Distillery_2012_DrHu_import.png | 2024-08-13 17:08 | 129K | |
| A_Secret_Canadian_Distillery_2015_MoM_import.png | 2024-08-13 17:08 | 88K | |
| A_Secret_Highland_Distillery_2008_AdF_Classic_import.png | 2024-08-13 17:08 | 203K | |
| A_Secret_Highland_Distillery_2008_TWA_import.png | 2024-08-13 17:08 | 98K | |
| A_Secret_Highland_Distillery_2013_MMM_Black_&_White_Series_import.png | 2024-08-13 17:08 | 129K | |
| A_Secret_Highland_Distillery_2013_MMM__Black_&_White_Series_import.png | 2024-08-13 17:08 | 129K | |
| A_Secret_Highland_Distillery_2013_MMM_import.png | 2024-08-13 17:08 | 16K | |
| A_Secret_Islay_Distillery_09-year-old_whic_Ragnarøkkr_Nr._1_-_Hati_import.png | 2024-08-13 17:08 | 143K | |
| A_Secret_Islay_Distillery_09-year-old_whic_Ragnarøkkr_Nr._2_-_Skøll_import.png | 2024-08-13 17:08 | 134K | |
| A_Secret_Islay_Distillery_09-year-old_whic_Ragnarøkkr_Nr._3_-_Níđhøggr_import.png | 2024-08-13 17:08 | 120K | |
| A_Secret_Islay_Distillery_1990_MoM_import.png | 2024-08-13 17:08 | 110K | |
| A_Secret_Islay_Distillery_1990_TWA_15_Years_TWA_China_Edition_import.png | 2024-08-13 17:08 | 110K | |
| A_Secret_Islay_Distillery_1990_TWA_import.png | 2024-08-13 17:08 | 117K | |
| A_Secret_Islay_Distillery_1991_UD_import.png | 2024-08-13 17:08 | 112K | |
| A_Secret_Islay_Distillery_2007_AdF_Classic_import.png | 2024-08-13 17:08 | 109K | |
| A_Secret_Islay_Distillery_2007_TWA_import.png | 2024-08-13 17:08 | 108K | |
| A_Secret_Islay_Distillery_2008_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:08 | 148K | |
| A_Secret_Islay_Distillery_2008_TWA_import.png | 2024-08-13 17:08 | 95K | |
| A_Secret_Islay_Distillery_2008_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 159K | |
| A_Secret_Islay_Distillery_2009_UD_import.png | 2024-08-13 17:08 | 203K | |
| A_Secret_Islay_Distillery_2017_DL_Single_Minded_-_World_of_Whisky_Trilogie_import.png | 2024-08-13 17:08 | 111K | |
| A_Secret_Islay_Distillery_2017_TWA_import.png | 2024-08-13 17:08 | 96K | |
| A_Secret_Lowland_Distillery_2010_A&G_Rare_Casks_import.png | 2024-08-13 17:08 | 107K | |
| A_Secret_Orkney_Distillery_2004_Sb_White_Label_import.png | 2024-08-13 17:08 | 115K | |
| A_Secret_Orkney_Distillery_2006_AdF_Classic_import.png | 2024-08-13 17:08 | 200K | |
| A_Secret_Orkney_Distillery_2006_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:08 | 112K | |
| A_Secret_Orkney_Distillery_2007_TWA_import.png | 2024-08-13 17:08 | 117K | |
| A_Secret_South_Islay_Distillery_2013_Sb_Colourful_Wildlife_import.png | 2024-08-13 17:08 | 109K | |
| A_Secret_Speyside_Distillery_1968_BR_Exceptional_Casks_import.png | 2024-08-13 17:08 | 156K | |
| A_Secret_Speyside_Distillery_2003_BR_Single_Cask_import.png | 2024-08-13 17:08 | 147K | |
| A_Secret_Speyside_Distillery_2007_BR_Single_Cask_import.png | 2024-08-13 17:08 | 138K | |
| A_Secret_Speyside_Distillery_2007_TWA_import.png | 2024-08-13 17:08 | 107K | |
| A_Secret_Speyside_Distillery_2010_UD_import.png | 2024-08-13 17:08 | 118K | |
| A_Speyside_Distillery_12-year-old_BW_Die_Whisky_Elfen_import.png | 2024-08-13 17:08 | 120K | |
| A_Speyside_Distillery_13-year-old_CA_Original_Collection_import.png | 2024-08-13 17:08 | 135K | |
| A_Speyside_Distillery_18-year-old_CA_Original_Collection_import.png | 2024-08-13 17:08 | 153K | |
| A_Speyside_Distillery_18-year-old_Original_Collection_import.png | 2024-08-13 17:08 | 148K | |
| A_Speyside_Distillery_1990_PST_import.png | 2024-08-13 17:08 | 101K | |
| A_Speyside_Distillery_1997_Nsps_Neoclassicism_import.png | 2024-08-13 17:08 | 94K | |
| A_Speyside_Distillery_1998_NSpS_Baroque_import.png | 2024-08-13 17:08 | 98K | |
| A_Speyside_Distillery_1998_NSpS_Modernism_import.png | 2024-08-13 17:08 | 261K | |
| A_Speyside_Distillery_2003_CA_Warehouse_Tasting_import.png | 2024-08-13 17:08 | 157K | |
| A_Speyside_Distillery_2003_CA__Warehouse_Tasting_import.png | 2024-08-13 17:08 | 157K | |
| A_Speyside_Distillery_2006_PST_import.png | 2024-08-13 17:08 | 87K | |
| A_Speyside_Distillery_2008_PD_´´Mahogany_Mahogany_9.1_Zero_Zero´´_import.png | 2024-08-13 17:08 | 171K | |
| A_Speyside_Distillery_2008_PD_An_Fheusag_Dàrna_Fear_import.png | 2024-08-13 17:08 | 157K | |
| A_Speyside_Distillery_2008_PD_Walking_The_Speyside_Way_import.png | 2024-08-13 17:08 | 166K | |
| A_Speyside_Distillery_2009_CWCL_Watt_Whisky_import.png | 2024-08-13 17:08 | 88K | |
| A_Speyside_Distillery_2009_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:08 | 112K | |
| A_Speyside_Malt_2010_UD_import.png | 2024-08-13 17:08 | 117K | |
| A_blend_of_very_old_Malt_Whiskys_22-year-old_VK_import.png | 2024-08-13 17:08 | 126K | |
| Aber_Falls_03-year-old_Draconological_Society_import.png | 2024-08-13 17:07 | 108K | |
| Aber_Falls_2020_KiW_Single_Cask_Collection_import.png | 2024-08-13 17:07 | 104K | |
| Aber_Falls_Single_Malt_Welsh_Whisky_2022_Release_-Limited_Edition_import.png | 2024-08-13 17:07 | 167K | |
| Aber_Falls_Single_Malt_Whisgi_Cymreig_Distillery_Exclusive_import.png | 2024-08-13 17:07 | 164K | |
| Aberfeldy 12.jpg | 2024-08-13 17:07 | 525K | |
| Aberfeldy_07-year-old_NSS_Cask_Series_019_import.png | 2024-08-13 17:07 | 166K | |
| Aberfeldy_12-year-old_Madeira_Cask_Finish_import.png | 2024-08-13 17:07 | 181K | |
| Aberfeldy_15-year-old_Limited_Edition_import.png | 2024-08-13 17:07 | 196K | |
| Aberfeldy_18-year-old_Limited_Edition_import.png | 2024-08-13 17:07 | 203K | |
| Aberfeldy_18-year-old_import.png | 2024-08-13 17:07 | 191K | |
| Aberfeldy_25-year-old_import.png | 2024-08-13 17:07 | 205K | |
| Aberfeldy_1999_Distillery_Only_-_Hand-Filled_import.png | 2024-08-13 17:07 | 163K | |
| Aberfeldy_1999_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:07 | 154K | |
| Aberfeldy_1999__Hand_filled_at_the_distillery_import.png | 2024-08-13 17:07 | 154K | |
| Aberfeldy_2002_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:07 | 169K | |
| Aberfeldy_2002_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:07 | 161K | |
| Aberfeldy_2009_GM_Connoisseurs_Choice_Cask_Strength_import.png | 2024-08-13 17:07 | 120K | |
| Aberfeldy_2009_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:07 | 260K | |
| Aberfeldy_2012_DL_Provenance_import.png | 2024-08-13 17:07 | 109K | |
| Aberfeldy_2013_DL_Provenance_import.png | 2024-08-13 17:07 | 243K | |
| Aberfeldy_2013_DeDr_Equinox_&_Solstice_Autumn_Edition_import.png | 2024-08-13 17:07 | 83K | |
| Aberfeldy_2013_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:07 | 150K | |
| Aberfeldy_2014_TWCe_Private_Cellars_Selection_Series_4_import.png | 2024-08-13 17:07 | 163K | |
| Aberlour 10.jpg | 2024-08-13 17:07 | 255K | |
| Aberlour 12 Non Chill Filtered.jpg | 2024-08-13 17:07 | 66K | |
| Aberlour16.jpg | 2024-08-13 17:07 | 455K | |
| Aberlour A'bunadh batch #40.jpg | 2024-08-13 17:07 | 25K | |
| Aberlour_10-year-old_Forest_Reserve_import.png | 2024-08-13 17:07 | 98K | |
| Aberlour_11-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:07 | 125K | |
| Aberlour_12-year-old_Non-Chillfiltered_import.png | 2024-08-13 17:07 | 124K | |
| Aberlour_12-year-old_Non_Chill-Filtered_import.png | 2024-08-13 17:07 | 140K | |
| Aberlour_14-year-old_Double_Cask_Matured_import.png | 2024-08-13 17:07 | 140K | |
| Aberlour_15-year-old_Distillery_Exclusive_Bottle_import.png | 2024-08-13 17:07 | 131K | |
| Aberlour_15-year-old_Limited_Release_2023_No._1.1_Crafted_Small_Batch_import.png | 2024-08-13 17:07 | 120K | |
| Aberlour_16-year-old_Double_Cask_Matured_import.png | 2024-08-13 17:07 | 146K | |
| Aberlour_18-year-old_Double_Sherry_Cask_Finish_import.png | 2024-08-13 17:07 | 142K | |
| Aberlour_21-year-old_Handcrafted_Small_Batch_import.png | 2024-08-13 17:07 | 143K | |
| Aberlour_1990_NSpS_Baroque_import.png | 2024-08-13 17:07 | 99K | |
| Aberlour_1991_Vintage_Edition_import.png | 2024-08-13 17:07 | 146K | |
| Aberlour_2003_Single_Cask_Selection_import.png | 2024-08-13 17:07 | 130K | |
| Aberlour_2005_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:07 | 131K | |
| Aberlour_2008_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:07 | 133K | |
| Aberlour_2008_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:07 | 195K | |
| Aberlour_2010_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:07 | 182K | |
| Aberlour_2011_CA_Wood_Range_-_Wine_Cask_import.png | 2024-08-13 17:07 | 102K | |
| Aberlour_2011_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:07 | 99K | |
| Aberlour_2011_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:07 | 146K | |
| Aberlour_2012_JE_import.png | 2024-08-13 17:07 | 107K | |
| Aberlour_2012_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:07 | 166K | |
| Aberlour_2012_WCh_import.png | 2024-08-13 17:07 | 171K | |
| Aberlour_2012_White_Oak_import.png | 2024-08-13 17:07 | 92K | |
| Aberlour_2013_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:07 | 107K | |
| Aberlour_2013_White_Oak_import.png | 2024-08-13 17:07 | 85K | |
| Aberlour_ABunadh_Batch_#76_Distillery_Bottling_import.png | 2024-08-13 17:07 | 209K | |
| Aberlour_Abunadh_Batch_#74_import.png | 2024-08-13 17:07 | 140K | |
| Aberlour_Abunadh_Batch_#75_import.png | 2024-08-13 17:07 | 139K | |
| Aberlour_Abunadh_batch_#73_import.png | 2024-08-13 17:07 | 130K | |
| Aberlour_Abunadh_batch_#77_import.png | 2024-08-13 17:07 | 132K | |
| Aberlour_Batch_10_TBWC_10th_Birthday_import.png | 2024-08-13 17:07 | 148K | |
| Aberlour_Casg_Annamh_Batch_Release_import.png | 2024-08-13 17:07 | 135K | |
| Abhag_II_2017_ICC_Gentlemans_Cask_import.png | 2024-08-13 17:07 | 124K | |
| Abhainn_Dearg_Rioja_import.png | 2024-08-13 17:07 | 146K | |
| Achill_Island_Distillers_Single_Malt_Bordeaux_Cask_Finish_import.png | 2024-08-13 17:07 | 123K | |
| Achill_Island_Distillers_Single_Malt_Irish_Whiskey_import.png | 2024-08-13 17:07 | 118K | |
| Achill_Island_Distillers_Single_Malt_Peated_Cask_Strength_Limited_Edition_import.png | 2024-08-13 17:07 | 120K | |
| Adictivo_Small_Batch_import.png | 2024-08-13 17:07 | 140K | |
| Adnams_6PM_Maggi_Hambling_X_import.png | 2024-08-13 17:07 | 193K | |
| Agitator_(US)_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:07 | 134K | |
| Agitator_2018_CV_Swedish_Single_Malt_Whisky_import.png | 2024-08-13 17:07 | 135K | |
| Agitator_2018_CV_Unfiltered_And_Untamed_import.png | 2024-08-13 17:07 | 128K | |
| Agitator_2018_CV__Unfiltered_And_Untamed_import.png | 2024-08-13 17:07 | 128K | |
| Agitator_2018_Private_bottling_import.png | 2024-08-13 17:07 | 135K | |
| Agitator_2018_SM_Private_Bottling_import.png | 2024-08-13 17:07 | 126K | |
| Agitator_2018_Td_import.png | 2024-08-13 17:07 | 148K | |
| Agitator_2018_WSla_Selected_Casks_by_Selected_Malts_import.png | 2024-08-13 17:07 | 115K | |
| Agitator_2019_SM_Private_Bottling_import.png | 2024-08-13 17:07 | 120K | |
| Agitator_2019_SM_Private_bottling_–_Magnus_Dram_Time_import.png | 2024-08-13 17:07 | 125K | |
| Agitator_2019_Td_Beathas_Vänner_import.png | 2024-08-13 17:07 | 146K | |
| Agitator_Bourbon_Cask_SM_3_Cask_Adventures_-_Selected_Swedes_import.png | 2024-08-13 17:07 | 121K | |
| Agitator_Collective_Series_Csks_Swedish_Four_Grain_Whisky_import.png | 2024-08-13 17:07 | 9.8K | |
| Agitator_Collective_Series_Csks_Swedish_Single_Malt_Whisky_import.png | 2024-08-13 17:07 | 9.8K | |
| Agitator_Collective_Series_Csks__Swedish_Four_Grain_Whisky_import.png | 2024-08-13 17:07 | 9.8K | |
| Agitator_Collective_Series_Csks__Swedish_Single_Malt_Whisky_import.png | 2024-08-13 17:07 | 9.8K | |
| Agitator_Islay_Cask_SM_3_Cask_Adventures_-_Selected_Swedes_import.png | 2024-08-13 17:07 | 119K | |
| Agitator_PX_Cask_SM_3_Cask_Adventures_-_Selected_Swedes_import.png | 2024-08-13 17:07 | 112K | |
| Agitator_SamuelWhisky_No1_import.png | 2024-08-13 17:07 | 195K | |
| Agitator_Sauternes_Evidens_import.png | 2024-08-13 17:07 | 154K | |
| Agitator_Single_Malt_Whisky_Rök_import.png | 2024-08-13 17:07 | 184K | |
| Agitator_Svartvete_import.png | 2024-08-13 17:07 | 167K | |
| Agitator_Sweden_Rock_23_import.png | 2024-08-13 17:07 | 212K | |
| Agitator_Sweden_Rock_2022_import.png | 2024-08-13 17:07 | 140K | |
| Agnes_On_The_Road_I._import.png | 2024-08-13 17:07 | 249K | |
| Agnes_On_The_Road_II._import.png | 2024-08-13 17:07 | 242K | |
| Agnes_On_The_Road_III._import.png | 2024-08-13 17:07 | 248K | |
| Akashi_2018_Ghost_Series_No.18_import.png | 2024-08-13 17:07 | 153K | |
| Akashi_2019_import.png | 2024-08-13 17:07 | 139K | |
| Akashi_Double_Distilleries_import.png | 2024-08-13 17:07 | 134K | |
| Alambik_Ommelander_Whisky_No.7_import.png | 2024-08-13 17:07 | 314K | |
| Alberta_Premium_Cask_Strength_Rye_4th_Release_import.png | 2024-08-13 17:07 | 113K | |
| Alberta_Premium_Reifel_Rye_import.png | 2024-08-13 17:07 | 146K | |
| Aleksé_2008_MCo_import.png | 2024-08-13 17:07 | 139K | |
| Alliage_Single_Malt_Whisky_import.png | 2024-08-13 17:07 | 138K | |
| Allt-a-Bhainne_1997_VWh_The_Constellation_series_import.png | 2024-08-13 17:07 | 98K | |
| Allt-a-Bhainne_2000_SV_Cask_Strength_Collection_-_LMDW_import.png | 2024-08-13 17:07 | 154K | |
| Allt-a-Bhainne_2000_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:07 | 173K | |
| Allt-a-Bhainne_2005_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:07 | 125K | |
| Allt-a-Bhainne_2005_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:07 | 136K | |
| Allt-a-Bhainne_2009_FibW_Permutations_Series_1_import.png | 2024-08-13 17:07 | 134K | |
| Allt-a-Bhainne_2009_UD_The_Whisky_Cellar_import.png | 2024-08-13 17:07 | 204K | |
| Allt-a-Bhainne_2013_DHGS_Connoisseurs_Dram_import.png | 2024-08-13 17:07 | 209K | |
| Allt-a-Bhainne_2013_DL_Provenance_import.png | 2024-08-13 17:07 | 252K | |
| Allt-a-Bhainne_2013_HB_Finest_Collection_import.png | 2024-08-13 17:07 | 253K | |
| Allt-a-Bhainne_2013_HB_import.png | 2024-08-13 17:07 | 106K | |
| Allt-a-Bhainne_2013_WhNa_import.png | 2024-08-13 17:07 | 90K | |
| Allt-a-Bhainne_2016_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:07 | 94K | |
| Alpenwhisky_2011_import.png | 2024-08-13 17:07 | 163K | |
| Altes_Tramdepot_2017_Nuns_Whisky_Sister_Abigail_Cask_Strength_import.png | 2024-08-13 17:07 | 171K | |
| Altes_Tramdepot_2017_Nuns_Whisky_Sister_Abigail_import.png | 2024-08-13 17:07 | 183K | |
| Amahagan_World_Malt_Metalic_Label_Edition_import.png | 2024-08-13 17:07 | 106K | |
| Amahagan_World_Malt_The_Maid_Dragon_of_Kobayashi-san_import.png | 2024-08-13 17:07 | 125K | |
| Amahagan_World_Malt_Winter_Edition_import.png | 2024-08-13 17:07 | 99K | |
| Amahagan_World_Malt__The_Maid_Dragon_of_Kobayashi-san_import.png | 2024-08-13 17:07 | 125K | |
| Amber_Lane_2019_Limited_PX_Cask_Expression_import.png | 2024-08-13 17:07 | 119K | |
| Amber_Lane_No._1_Sherry_Lane_Special_Release_import.png | 2024-08-13 17:07 | 120K | |
| Amber_Lane_Silk_Road_Small_Batch_import.png | 2024-08-13 17:07 | 128K | |
| Amber_Lane_Silk_Road_import.png | 2024-08-13 17:07 | 131K | |
| Amber_Lane_Sleigh_Bells_Exclusive_Christmas_Release_import.png | 2024-08-13 17:07 | 114K | |
| Amber_Lane_Sleigh_Bells_Handfilled_-_Premium_Amblers_import.png | 2024-08-13 17:07 | 117K | |
| Americana_2015_AmWh_import.png | 2024-08-13 17:07 | 105K | |
| Americana_2016_AmWh_import.png | 2024-08-13 17:07 | 107K | |
| Americana_2017_AmWh_import.png | 2024-08-13 17:07 | 116K | |
| Amrut Cask Strength.jpg | 2024-08-13 17:07 | 332K | |
| Amrut Fusion.jpg | 2024-08-13 17:07 | 280K | |
| Amrut Kadhambam.jpg | 2024-08-13 17:07 | 300K | |
| Amrut Portonova.jpg | 2024-08-13 17:07 | 322K | |
| Amrut_2014_Master_Distillers_Reserve_import.png | 2024-08-13 17:07 | 288K | |
| Amrut_2014_import.png | 2024-08-13 17:07 | 101K | |
| Amrut_2015_Single_Cask_import.png | 2024-08-13 17:07 | 117K | |
| Amrut_2015_import.png | 2024-08-13 17:07 | 103K | |
| Amrut_2016_XII_Ex-Rum_import.png | 2024-08-13 17:07 | 118K | |
| Amrut_2016_import.png | 2024-08-13 17:07 | 117K | |
| Amrut_2017_import.png | 2024-08-13 17:07 | 96K | |
| Amrut_Aatma_Collector_Series_Single_Cask_import.png | 2024-08-13 17:07 | 255K | |
| Amrut_Fusion_import.png | 2024-08-13 17:07 | 115K | |
| An_Cearcall_2006_MoS_Edition_2023_import.png | 2024-08-13 17:07 | 157K | |
| An_Fear_Grinn_Gullion_WhiF_import.png | 2024-08-13 17:07 | 141K | |
| An_Fear_Grinn_Móinteach_No._2_WhiF_Peated_Single_Malt_import.png | 2024-08-13 17:07 | 150K | |
| An_Fear_Grinn_Tides_In_WhiF_Cask_Strength_import.png | 2024-08-13 17:07 | 141K | |
| An_Iconic_Speyside_2010_DT_The_Octave_import.png | 2024-08-13 17:07 | 99K | |
| An_Iconic_Speyside_Distillery_2011_DT_The_Octave_import.png | 2024-08-13 17:07 | 109K | |
| An_Islay_Distillery_1990_NYW_The_Peninsula_Collection_import.png | 2024-08-13 17:07 | 113K | |
| An_Islay_Distillery_2007_CA_import.png | 2024-08-13 17:07 | 151K | |
| An_Islay_Distillery_2008_DT_Single_Cask_import.png | 2024-08-13 17:07 | 99K | |
| An_Islay_Distillery_2009_HWM_Dalgety_import.png | 2024-08-13 17:07 | 142K | |
| An_Islay_Distillery_2009_LotG_Rare_Cask_import.png | 2024-08-13 17:07 | 111K | |
| An_Islay_Distillery_2009_OXH_import.png | 2024-08-13 17:07 | 115K | |
| An_Islay_Distillery_2010_NSpS_Modernism_import.png | 2024-08-13 17:07 | 102K | |
| An_Islay_Distillery_2010_WhNa_Community_Release_2023#01_import.png | 2024-08-13 17:07 | 81K | |
| An_Islay_Distillery_2012_LsD_McCraes_import.png | 2024-08-13 17:07 | 127K | |
| An_Orkney_Distillery_06-year-old_CA_Original_Collection_import.png | 2024-08-13 17:07 | 167K | |
| An_Orkney_Distillery_1999_NYW_The_Peninsula_Collection_import.png | 2024-08-13 17:07 | 114K | |
| An_Orkney_Distillery_2000_TWEx_The_People_Series_import.png | 2024-08-13 17:07 | 99K | |
| An_Orkney_Distillery_2004_CA_Cadenhead_in_The_Courtyard_2023_import.png | 2024-08-13 17:07 | 234K | |
| An_Orkney_Distillery_2005_TDW_import.png | 2024-08-13 17:07 | 103K | |
| An_Orkney_Distillery_2006_SCC_The_Independent_Selection_import.png | 2024-08-13 17:07 | 99K | |
| An_Orkney_Distillery_2006_SCC__The_Independent_Selection_import.png | 2024-08-13 17:07 | 99K | |
| An_Orkney_Distillery_2006_TWEx_import.png | 2024-08-13 17:07 | 95K | |
| An_Orkney_Distillery_2007_Cl_Claxtons_Exclusives_import.png | 2024-08-13 17:07 | 100K | |
| An_Orkney_Distillery_2007_WhB_import.png | 2024-08-13 17:07 | 106K | |
| An_Orkney_Distillery_2008_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:07 | 92K | |
| An_Orkney_Distillery_2009_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:07 | 96K | |
| An_Orkney_Distillery_2012_CWCL_Watt_Whisky_import.png | 2024-08-13 17:07 | 146K | |
| An_Orkney_Distillery_2012_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:07 | 90K | |
| An_Trusadh_Cluaran_Mór_Allt-a-Port_Wh_DRT_2023_import.png | 2024-08-13 17:07 | 225K | |
| Angel's Envy Cask Strength.jpg | 2024-08-13 17:07 | 108K | |
| Angels_Envy_08-year-old_Limited_Edition_import.png | 2024-08-13 17:07 | 161K | |
| Angels_Envy_Caribbean_Rum_Casks_Finished_import.png | 2024-08-13 17:07 | 61K | |
| Angels_Envy_Carribean_Rum_Cask_Finished_import.png | 2024-08-13 17:07 | 61K | |
| Angels_Envy_Cask_Strength_import.png | 2024-08-13 17:07 | 187K | |
| Angels_Envy_Port_Cask_Finish_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:07 | 137K | |
| Angels_Envy_Port_Cask_Finished_Private_Selection_Single_Barrel_import.png | 2024-08-13 17:07 | 129K | |
| Annandale_08-year-old_Caledonian_Sleeper_import.png | 2024-08-13 17:07 | 108K | |
| Annandale_2015_BD_import.png | 2024-08-13 17:07 | 157K | |
| Annandale_2015_CA_Authentic_Collection_import.png | 2024-08-13 17:07 | 114K | |
| Annandale_2015_CA__Authentic_Collection_import.png | 2024-08-13 17:07 | 9.8K | |
| Annandale_2015_Man_O‘_Swords_-_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:07 | 123K | |
| Annandale_2015_Man_O‘_Words_-_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:07 | 128K | |
| Annandale_2015_NSS_Cask_Series_021_import.png | 2024-08-13 17:07 | 164K | |
| Annandale_2015_SCC_The_Independent_Selection_import.png | 2024-08-13 17:07 | 99K | |
| Annandale_2015_SCC__The_Independent_Selection_import.png | 2024-08-13 17:07 | 99K | |
| Annandale_2015_TWB_Portfolio_series_import.png | 2024-08-13 17:07 | 121K | |
| Annandale_2015_WCh_Hogmanay_Malt_import.png | 2024-08-13 17:07 | 201K | |
| Annandale_2015_WCh_import.png | 2024-08-13 17:07 | 165K | |
| Annandale_2015_WDM_Monasteria_import.png | 2024-08-13 17:07 | 146K | |
| Annandale_2015_WIN__peated_sherry_cask_import.png | 2024-08-13 17:07 | 170K | |
| Annandale_2015_WIN_peated_sherry_cask_import.png | 2024-08-13 17:07 | 170K | |
| Annandale_2017_HoMc_import.png | 2024-08-13 17:07 | 140K | |
| Annandale_2017_Man_OSWord_import.png | 2024-08-13 17:07 | 234K | |
| Annandale_2017_Man_OWords_import.png | 2024-08-13 17:07 | 114K | |
| Annandale_2017_Man_O_Sword_-_Founders_Selection_import.png | 2024-08-13 17:07 | 174K | |
| Annandale_2017_Man_O_Sword_import.png | 2024-08-13 17:07 | 104K | |
| Annandale_2017_Portfolio_-_Special_Release_import.png | 2024-08-13 17:07 | 100K | |
| Annandale_2017_TcaH_The_Deerhound_Collection_import.png | 2024-08-13 17:07 | 96K | |
| Annandale_2017_Walker_21_Portfolio_import.png | 2024-08-13 17:07 | 93K | |
| Annandale_2018_Portfolio_-_Special_Release_import.png | 2024-08-13 17:07 | 104K | |
| Annandale_2018_Private_Cask_Release_import.png | 2024-08-13 17:07 | 116K | |
| Annandale_2018_import.png | 2024-08-13 17:07 | 106K | |
| Annandale_2020_Special_Release_import.png | 2024-08-13 17:07 | 100K | |
| Annandale_Callum_import.png | 2024-08-13 17:07 | 112K | |
| Annandale_Storyman_First_Edition_import.png | 2024-08-13 17:07 | 144K | |
| Appoldro_2018_First_Edition_import.png | 2024-08-13 17:07 | 180K | |
| Aquila_12-year-old_import.png | 2024-08-13 17:07 | 138K | |
| Arbikie_05-year-old_1794_Highland_Rye_-_Cask_Strength_Edition_1_import.png | 2024-08-13 17:07 | 132K | |
| Arbikie_2019_Hand_bottled_-_available_only_at_the_distillery_import.png | 2024-08-13 17:07 | 204K | |
| Arbys_Smoked_Bourbon_import.png | 2024-08-13 17:07 | 160K | |
| Arcanum_Uisge_nan_Diathan_ArS_Whisky_Edition_No._5_import.png | 2024-08-13 17:07 | 142K | |
| Archie_Rose_Red_Gum_Smoked_Single_Malt_Whisky_Trials_and_Exceptions_07_import.png | 2024-08-13 17:07 | 127K | |
| Ardbeg Alligator.jpg | 2024-08-13 17:07 | 1.2M | |
| Ardbeg Auriverdes.jpg | 2024-08-13 17:07 | 371K | |
| Ardbeg Blasda.jpg | 2024-08-13 17:07 | 49K | |
| Ardbeg Day.jpg | 2024-08-13 17:07 | 46K | |
| Ardbeg Uigeadail.jpg | 2024-08-13 17:07 | 118K | |
| Ardbeg_10-year-old_JW_Whisky_Racing_Formel_Lau_import.png | 2024-08-13 17:07 | 119K | |
| Ardbeg_12-year-old_AtB_Darkness_import.png | 2024-08-13 17:07 | 123K | |
| Ardbeg_12-year-old_MoM_Darkness_import.png | 2024-08-13 17:07 | 141K | |
| Ardbeg_13-year-old_Anthology_–_The_Harpys_Tale_import.png | 2024-08-13 17:07 | 125K | |
| Ardbeg_13-year-old__Anthology_–_The_Harpys_Tale_import.png | 2024-08-13 17:07 | 9.8K | |
| Ardbeg_14-year-old_JW_Whisky_Racing_Formel_Lau_import.png | 2024-08-13 17:07 | 127K | |
| Ardbeg_15-year-old_Rare_Cask_import.png | 2024-08-13 17:07 | 119K | |
| Ardbeg_21-year-old_Private_Single_Cask_import.png | 2024-08-13 17:07 | 122K | |
| Ardbeg_26-year-old_The_Ultimate_Private_Single_Cask_import.png | 2024-08-13 17:07 | 111K | |
| Ardbeg_1975_Rare_Cask_import.png | 2024-08-13 17:07 | 301K | |
| Ardbeg_1991_LMDW_Artist_#13_import.png | 2024-08-13 17:07 | 90K | |
| Ardbeg_1993_CA_Authentic_Collection_import.png | 2024-08-13 17:07 | 218K | |
| Ardbeg_2001_Duty_Paid_Sample_import.png | 2024-08-13 17:07 | 82K | |
| Ardbeg_2002_Private_Reserve_import.png | 2024-08-13 17:07 | 119K | |
| Ardbeg_2002_Single_Cask_import.png | 2024-08-13 17:07 | 118K | |
| Ardbeg_2005_Single_Cask_import.png | 2024-08-13 17:07 | 110K | |
| Ardbeg_2006_Single_Cask_import.png | 2024-08-13 17:07 | 124K | |
| Ardbeg_2008_CYWL_import.png | 2024-08-13 17:07 | 115K | |
| Ardbeg_2010_Single_Cask_import.png | 2024-08-13 17:07 | 117K | |
| Ardbeg_2011_Single_Cask_import.png | 2024-08-13 17:07 | 126K | |
| Ardbeg_2013_JW_World_of_Orchids_import.png | 2024-08-13 17:07 | 116K | |
| Ardbeg_Anamorphic_Committee_Release_import.png | 2024-08-13 17:07 | 112K | |
| Ardbeg_Anamorphic__Committee_Release_import.png | 2024-08-13 17:07 | 9.8K | |
| Ardbeg_Ardcore_import.png | 2024-08-13 17:07 | 121K | |
| Ardbeg_BizarreBQ_import.png | 2024-08-13 17:07 | 115K | |
| Ardbeg_Christmas_Malt_WeWh_Christmas_Malt_import.png | 2024-08-13 17:07 | 103K | |
| Ardbeg_Fon_Fhoid_NFT_import.png | 2024-08-13 17:07 | 109K | |
| Ardbeg_Hypernova_Committee_HN2022_Release_import.png | 2024-08-13 17:07 | 117K | |
| Ardbeg_Smoketrails_Travellers_Exclusive_import.png | 2024-08-13 17:07 | 108K | |
| Ardbeg_Smoketrails_for_Travel_Retail_import.png | 2024-08-13 17:07 | 118K | |
| Ardbeg_Traigh_Bhan_Batch_4_Small_Batch_Release_import.png | 2024-08-13 17:07 | 121K | |
| Ardbeg_Traigh_Bhan_Small_Batch_Release_import.png | 2024-08-13 17:07 | 117K | |
| Ardenistle_Blended_Malt_Scotch_Whisky_Coilltean_Int._Co._LTD_import.png | 2024-08-13 17:07 | 118K | |
| Ardgowan_08-year-old_Discovery_Series_No._4_import.png | 2024-08-13 17:07 | 85K | |
| Ardgowan_18-year-old_Discovery_Series_No._5_import.png | 2024-08-13 17:07 | 83K | |
| Ardlair_2008_YoSp_Perkors_import.png | 2024-08-13 17:07 | 145K | |
| Ardlair_2010_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:07 | 99K | |
| Ardlair_2010_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:07 | 93K | |
| Ardlair_2010_PST_import.png | 2024-08-13 17:07 | 89K | |
| Ardlair_2010_TCaH_Special_Release_Shared_Cask_Exclusive_Bottling_import.png | 2024-08-13 17:07 | 137K | |
| Ardlair_2011_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:07 | 159K | |
| Ardlair_2011_SV__Cask_Strength_Collection_import.png | 2024-08-13 17:07 | 145K | |
| Ardlair_2011_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:07 | 114K | |
| Ardlair_2011_vW_import.png | 2024-08-13 17:07 | 114K | |
| Ardmore_11-year-old_CA_Original_Collection_import.png | 2024-08-13 17:07 | 140K | |
| Ardmore_1994_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:07 | 191K | |
| Ardmore_1997_ElD_Retro_Label_import.png | 2024-08-13 17:07 | 107K | |
| Ardmore_1997_GM_Connoisseurs_Choice_Cask_Strength_import.png | 2024-08-13 17:07 | 152K | |
| Ardmore_1997_SMWS_66.243_Direct_action_import.png | 2024-08-13 17:07 | 111K | |
| Ardmore_1997_SMWS_66.248_Sweet_Smoky_Dreams_Are_Made_Of_This_import.png | 2024-08-13 17:07 | 82K | |
| Ardmore_1997_WN_import.png | 2024-08-13 17:07 | 98K | |
| Ardmore_1997_WSP_Edition_No._76_import.png | 2024-08-13 17:07 | 100K | |
| Ardmore_1998_AdF_Acla_Selection_import.png | 2024-08-13 17:07 | 102K | |
| Ardmore_1998_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:07 | 96K | |
| Ardmore_1998_RM_import.png | 2024-08-13 17:07 | 102K | |
| Ardmore_1998_TWA_import.png | 2024-08-13 17:07 | 113K | |
| Ardmore_2000_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:07 | 118K | |
| Ardmore_2000_JE_Single_Cask_import.png | 2024-08-13 17:07 | 92K | |
| Ardmore_2000_WSP_Edition_No._69_import.png | 2024-08-13 17:07 | 114K | |
| Ardmore_2001_GCWL_Maltsev_Gallery_Art_Series_Single_Malt_import.png | 2024-08-13 17:07 | 107K | |
| Ardmore_2002_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:07 | 122K | |
| Ardmore_2002_HiSp_The_Poker_Face_Collection_import.png | 2024-08-13 17:07 | 131K | |
| Ardmore_2003_GM_Distillery_Labels_import.png | 2024-08-13 17:07 | 117K | |
| Ardmore_2004_TTOW_Friends_of_The_Taste_of_Whisky_import.png | 2024-08-13 17:07 | 166K | |
| Ardmore_2004_TTOW_Pin-up_Girls_import.png | 2024-08-13 17:07 | 108K | |
| Ardmore_2005_JW_Great_Ocean_Liners_import.png | 2024-08-13 17:07 | 107K | |
| Ardmore_2006_BR_import.png | 2024-08-13 17:07 | 122K | |
| Ardmore_2006_SMWS_66.221_An_evening_of_indulgence_import.png | 2024-08-13 17:07 | 109K | |
| Ardmore_2007_SMWS_66.229_Tarred_and_re-feathered_pheasants_import.png | 2024-08-13 17:07 | 264K | |
| Ardmore_2007_SMWS_66.239_Mouton_bouillie_import.png | 2024-08-13 17:07 | 104K | |
| Ardmore_2007_VK_15th_Anniversary_Bottling_import.png | 2024-08-13 17:07 | 216K | |
| Ardmore_2008_BD_import.png | 2024-08-13 17:07 | 152K | |
| Ardmore_2008_BR_Single_Cask_import.png | 2024-08-13 17:07 | 127K | |
| Ardmore_2008_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:07 | 130K | |
| Ardmore_2008_Swdr_import.png | 2024-08-13 17:07 | 106K | |
| Ardmore_2008_TWB_This_Is_Really_Spectacular_import.png | 2024-08-13 17:07 | 113K | |
| Ardmore_2009_BD_import.png | 2024-08-13 17:07 | 163K | |
| Ardmore_2009_BR_Single_Cask_import.png | 2024-08-13 17:07 | 126K | |
| Ardmore_2009_BR_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2009_CWCL_Watt_Whisky_import.png | 2024-08-13 17:07 | 90K | |
| Ardmore_2009_Cl_Claxtons_Exclusives_import.png | 2024-08-13 17:07 | 90K | |
| Ardmore_2009_Cl_Exploration_Series_import.png | 2024-08-13 17:07 | 122K | |
| Ardmore_2009_Cl_Malt_Monkeys_4th_Release_import.png | 2024-08-13 17:07 | 135K | |
| Ardmore_2009_Cl_Warehouse_No._1_import.png | 2024-08-13 17:07 | 245K | |
| Ardmore_2009_Cl_Warehouse_No._8_import.png | 2024-08-13 17:07 | 236K | |
| Ardmore_2009_DT_Single_Cask_import.png | 2024-08-13 17:07 | 113K | |
| Ardmore_2009_DT_The_Octave_import.png | 2024-08-13 17:07 | 200K | |
| Ardmore_2009_DoTh_import.png | 2024-08-13 17:07 | 120K | |
| Ardmore_2009_DrC_import.png | 2024-08-13 17:07 | 120K | |
| Ardmore_2009_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:07 | 94K | |
| Ardmore_2009_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:07 | 97K | |
| Ardmore_2009_F.dk_import.png | 2024-08-13 17:07 | 97K | |
| Ardmore_2009_HSC_Adventure_Travel_import.png | 2024-08-13 17:07 | 332K | |
| Ardmore_2009_HSC_Masters_Of_Magic_import.png | 2024-08-13 17:07 | 118K | |
| Ardmore_2009_KCC_Fragrant_Drops_import.png | 2024-08-13 17:07 | 160K | |
| Ardmore_2009_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:07 | 87K | |
| Ardmore_2009_LBDS_Single_Cask_import.png | 2024-08-13 17:07 | 138K | |
| Ardmore_2009_LotG_import.png | 2024-08-13 17:07 | 206K | |
| Ardmore_2009_MDB_Vintage_Casks_import.png | 2024-08-13 17:07 | 161K | |
| Ardmore_2009_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:07 | 106K | |
| Ardmore_2009_MSWD__Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:07 | 106K | |
| Ardmore_2009_PST_import.png | 2024-08-13 17:07 | 88K | |
| Ardmore_2009_SMDr_Single_Cask_import.png | 2024-08-13 17:07 | 100K | |
| Ardmore_2009_SV_Bourbon_After_Islay_import.png | 2024-08-13 17:07 | 117K | |
| Ardmore_2009_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:07 | 100K | |
| Ardmore_2009_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:07 | 108K | |
| Ardmore_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:07 | 110K | |
| Ardmore_2009_Sxwh_import.png | 2024-08-13 17:07 | 280K | |
| Ardmore_2009_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:07 | 111K | |
| Ardmore_2009_TCaH_Special_Release_Shared_Cask_Exclusive_Bottling_import.png | 2024-08-13 17:07 | 145K | |
| Ardmore_2009_TCaH_Tasting_Tour_import.png | 2024-08-13 17:07 | 105K | |
| Ardmore_2009_TnTC_Nikolaus_Futures_2021_Teil_3_import.png | 2024-08-13 17:07 | 134K | |
| Ardmore_2009_UD_import.png | 2024-08-13 17:07 | 104K | |
| Ardmore_2009_WDS_import.png | 2024-08-13 17:07 | 107K | |
| Ardmore_2009_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:07 | 231K | |
| Ardmore_2009_WSP_Exclusive_Edition_No._4_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2009_WhB_Cree_import.png | 2024-08-13 17:07 | 101K | |
| Ardmore_2009_WhB_import.png | 2024-08-13 17:07 | 98K | |
| Ardmore_2009_WhK_Lord_of_the_Highlands_import.png | 2024-08-13 17:07 | 81K | |
| Ardmore_2009_vW_The_Ultimate_import.png | 2024-08-13 17:07 | 112K | |
| Ardmore_2010_BA_Raw_Cask_import.png | 2024-08-13 17:07 | 94K | |
| Ardmore_2010_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:07 | 121K | |
| Ardmore_2010_CA_Authentic_Collection_import.png | 2024-08-13 17:07 | 122K | |
| Ardmore_2010_CA__Authentic_Collection_import.png | 2024-08-13 17:07 | 9.8K | |
| Ardmore_2010_DT_Sherry_Cask_Octave_Small_Batch_import.png | 2024-08-13 17:07 | 114K | |
| Ardmore_2010_DT_The_Octave_-_Peated_import.png | 2024-08-13 17:07 | 98K | |
| Ardmore_2010_DT_The_Octave_import.png | 2024-08-13 17:07 | 100K | |
| Ardmore_2010_DT__The_Octave_import.png | 2024-08-13 17:07 | 189K | |
| Ardmore_2010_ED_The_First_Editions_import.png | 2024-08-13 17:07 | 221K | |
| Ardmore_2010_GPP_import.png | 2024-08-13 17:07 | 82K | |
| Ardmore_2010_JE_Single_Cask_import.png | 2024-08-13 17:07 | 105K | |
| Ardmore_2010_NSpS_Modernism_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2010_SV_100_Proof_Edition_#4_import.png | 2024-08-13 17:07 | 102K | |
| Ardmore_2010_SV_Ink_#4_Collection_import.png | 2024-08-13 17:07 | 102K | |
| Ardmore_2010_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:07 | 97K | |
| Ardmore_2010_SV_Vintage_Collection_import.png | 2024-08-13 17:07 | 101K | |
| Ardmore_2010_Sb_Xaver_Bar_Choice_no._10_import.png | 2024-08-13 17:07 | 315K | |
| Ardmore_2010_TWC_import.png | 2024-08-13 17:07 | 112K | |
| Ardmore_2010_WM_Barrel_Selection_import.png | 2024-08-13 17:07 | 113K | |
| Ardmore_2011_ANHA_Anam_na_h-Alba_and_Friends_import.png | 2024-08-13 17:07 | 110K | |
| Ardmore_2011_BR_Scyfion_Choice_import.png | 2024-08-13 17:07 | 108K | |
| Ardmore_2011_BR_Single_Cask_import.png | 2024-08-13 17:07 | 123K | |
| Ardmore_2011_BR_import.png | 2024-08-13 17:07 | 9.8K | |
| Ardmore_2011_CA_Authentic_Collection_import.png | 2024-08-13 17:07 | 115K | |
| Ardmore_2011_FR_Romantic_Rhine_Collection_-_Edition_Klosterruine_Heisterbach_import.png | 2024-08-13 17:07 | 109K | |
| Ardmore_2011_HoMc_The_Vintage_Collection_import.png | 2024-08-13 17:07 | 256K | |
| Ardmore_2011_JE_Single_Cask_import.png | 2024-08-13 17:07 | 95K | |
| Ardmore_2011_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:07 | 232K | |
| Ardmore_2011_MM_Single_Malt_Journeys_import.png | 2024-08-13 17:07 | 145K | |
| Ardmore_2011_MrW_Spirit_of_Caledonia_import.png | 2024-08-13 17:07 | 115K | |
| Ardmore_2011_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:07 | 108K | |
| Ardmore_2011_SV_Whisky_Live_Paris_import.png | 2024-08-13 17:07 | 248K | |
| Ardmore_2011_UD_import.png | 2024-08-13 17:07 | 91K | |
| Ardmore_2012_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:07 | 134K | |
| Ardmore_2012_BR_Single_Cask_import.png | 2024-08-13 17:07 | 113K | |
| Ardmore_2012_CA_Warehouse_Tasting_import.png | 2024-08-13 17:07 | 140K | |
| Ardmore_2012_DoV_import.png | 2024-08-13 17:07 | 168K | |
| Ardmore_2012_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:07 | 95K | |
| Ardmore_2012_SMWS_66.231_Honey_in_the_grill_tray_import.png | 2024-08-13 17:07 | 112K | |
| Ardmore_2013_BD_import.png | 2024-08-13 17:07 | 159K | |
| Ardmore_2013_CA_Warehouse_Tasting_import.png | 2024-08-13 17:07 | 145K | |
| Ardmore_2013_Cl_Claxtons_Exclusives_import.png | 2024-08-13 17:07 | 207K | |
| Ardmore_2013_Cl_Exclusives_import.png | 2024-08-13 17:07 | 275K | |
| Ardmore_2013_DFRS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:07 | 107K | |
| Ardmore_2013_DR_Cask_Collection_import.png | 2024-08-13 17:07 | 70K | |
| Ardmore_2013_ED_The_First_Editions_import.png | 2024-08-13 17:07 | 105K | |
| Ardmore_2013_HiSp_10th_Anniversary_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2013_NSpS_Modernism_import.png | 2024-08-13 17:07 | 326K | |
| Ardmore_2013_SV_The_Un-Chillfiltered_Collection_-_Very_Cloudy_import.png | 2024-08-13 17:07 | 110K | |
| Ardmore_2013_SpLu_Collaboration_with_Artists_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2013_T&O_Single_Cask_Series_import.png | 2024-08-13 17:07 | 95K | |
| Ardmore_2013_TWM_import.png | 2024-08-13 17:07 | 101K | |
| Ardmore_2013_UD_Friends_of_the_Quaich_import.png | 2024-08-13 17:07 | 104K | |
| Ardmore_2013_UD_Maffia_Monkeys_import.png | 2024-08-13 17:07 | 119K | |
| Ardmore_2013_UWC_The_Hand_Drawn_Collection_-_Micro_Batch_Series_import.png | 2024-08-13 17:07 | 151K | |
| Ardmore_2013_WCh_import.png | 2024-08-13 17:07 | 169K | |
| Ardmore_2013_WhB_import.png | 2024-08-13 17:07 | 89K | |
| Ardmore_2014_Wh_Valinch_#4_import.png | 2024-08-13 17:07 | 90K | |
| Ardnamurchan_05-year-old_Hand_bottled_at_Distillery_import.png | 2024-08-13 17:07 | 214K | |
| Ardnamurchan_06-year-Old_Warehouse_Release_import.png | 2024-08-13 17:07 | 118K | |
| Ardnamurchan_06-year-old_WSP_Edition_No._48B_import.png | 2024-08-13 17:07 | 102K | |
| Ardnamurchan_06-year-old_Warehouse_Release_-_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:07 | 115K | |
| Ardnamurchan_2015_CA_Authentic_Collection_import.png | 2024-08-13 17:07 | 107K | |
| Ardnamurchan_2015_Duty_Paid_Sample_import.png | 2024-08-13 17:07 | 146K | |
| Ardnamurchan_2015_LBDS_A_Dram_For_Banksy_import.png | 2024-08-13 17:07 | 141K | |
| Ardnamurchan_2015_PST_import.png | 2024-08-13 17:07 | 97K | |
| Ardnamurchan_2015_SMWS_149.5_Fire_festival_import.png | 2024-08-13 17:07 | 124K | |
| Ardnamurchan_2015_WSP_Edition_No._48A_import.png | 2024-08-13 17:07 | 102K | |
| Ardnamurchan_2016_AD_Hororata_Highland_Games_2023_Release_import.png | 2024-08-13 17:07 | 107K | |
| Ardnamurchan_2016_AD_Selection_import.png | 2024-08-13 17:07 | 95K | |
| Ardnamurchan_2016_JE_import.png | 2024-08-13 17:07 | 94K | |
| Ardnamurchan_2016_NSS_Cask_Series_022_import.png | 2024-08-13 17:07 | 159K | |
| Ardnamurchan_2016_NSS_Obscurities_&_Curiosities_import.png | 2024-08-13 17:07 | 117K | |
| Ardnamurchan_2016_SMWS_149.3_A_walk_in_the_woods_import.png | 2024-08-13 17:07 | 120K | |
| Ardnamurchan_2016_Warehouse_Release_-_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:07 | 87K | |
| Ardnamurchan_2017_Warehouse_Release_-_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:07 | 107K | |
| Ardnamurchan_ArdnAmerica_import.png | 2024-08-13 17:07 | 138K | |
| Aristides_2019_import.png | 2024-08-13 17:07 | 71K | |
| Armorik_Édition_Originale_Whisky_Breton_import.png | 2024-08-13 17:07 | 93K | |
| Armorik_10-year-old_Édition_2022_import.png | 2024-08-13 17:07 | 121K | |
| Armorik_10-year-old_Edition_2023_import.png | 2024-08-13 17:07 | 112K | |
| Armorik_10-year-old__Edition_2023_import.png | 2024-08-13 17:07 | 227K | |
| Armorik_15-year-old_Chai_N°4_import.png | 2024-08-13 17:07 | 130K | |
| Armorik_15-year-old_Edition_Limitée_import.png | 2024-08-13 17:07 | 120K | |
| Armorik_2008_Single_Cask_import.png | 2024-08-13 17:07 | 109K | |
| Armorik_2012_Collection_Privée_import.png | 2024-08-13 17:07 | 122K | |
| Armorik_2012_Single_Cask_Armorik_Deiz_import.png | 2024-08-13 17:07 | 129K | |
| Armorik_2012_Vibrant_Stills_import.png | 2024-08-13 17:07 | 130K | |
| Armorik_2012_import.png | 2024-08-13 17:07 | 119K | |
| Armorik_2014_SMWS_157.1_Toasty,_Roasty_And_Oaky_import.png | 2024-08-13 17:07 | 107K | |
| Armorik_2014_Single_Cask_import.png | 2024-08-13 17:07 | 126K | |
| Armorik_2015_Zn09_Cyberpunk_import.png | 2024-08-13 17:07 | 91K | |
| Armorik_2016_SpPa_Natural_Stremgth_import.png | 2024-08-13 17:07 | 125K | |
| Armorik_2016_Yeun_Elez_import.png | 2024-08-13 17:07 | 150K | |
| Armorik_2017_SpPa_Natural_Stremgth_import.png | 2024-08-13 17:07 | 128K | |
| Armorik_2018_Yeun_Elez_import.png | 2024-08-13 17:07 | 233K | |
| Armorik_2018__Yeun_Elez_import.png | 2024-08-13 17:07 | 9.8K | |
| Armorik_Batch_3_TBWC_10th_Anniversary_import.png | 2024-08-13 17:07 | 159K | |
| Armorik_La_Nef_D_Fous_Edition_exclusive_import.png | 2024-08-13 17:07 | 148K | |
| Armorik_Maître_de_Chai_import.png | 2024-08-13 17:07 | 137K | |
| Armorik_Sherry_Finish_Whisky_Breton_import.png | 2024-08-13 17:07 | 91K | |
| Arran 10.jpg | 2024-08-13 17:07 | 1.0M | |
| Arran Port Cask Finish.jpg | 2024-08-13 17:07 | 706K | |
| Arran_10-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:07 | 169K | |
| Arran_10-year-old_Small_Batch_import.png | 2024-08-13 17:07 | 137K | |
| Arran_11-year-old_Private_Cask_import.png | 2024-08-13 17:07 | 130K | |
| Arran_13-year-old_Small_Batch_import.png | 2024-08-13 17:07 | 265K | |
| Arran_17-year-old_Rare_Batch_import.png | 2024-08-13 17:07 | 126K | |
| Arran_17-year-old_import.png | 2024-08-13 17:07 | 125K | |
| Arran_1995_Single_Cask_import.png | 2024-08-13 17:07 | 133K | |
| Arran_1996_Cl_Genuss_am_Gaumen_import.png | 2024-08-13 17:07 | 357K | |
| Arran_1996_DL_XOP_-_The_Black_Series_import.png | 2024-08-13 17:07 | 132K | |
| Arran_1996_Single_Cask_import.png | 2024-08-13 17:07 | 131K | |
| Arran_1996_StmD_Maria_Stuart_XV._Edition_import.png | 2024-08-13 17:07 | 99K | |
| Arran_1997_HL_Old_&_Rare_import.png | 2024-08-13 17:07 | 156K | |
| Arran_1997_Premium_Cask_import.png | 2024-08-13 17:07 | 148K | |
| Arran_1997_Single_Cask_import.png | 2024-08-13 17:07 | 134K | |
| Arran_1997_VBtl_Vintage_Series_import.png | 2024-08-13 17:07 | 95K | |
| Arran_1997_WhB_import.png | 2024-08-13 17:07 | 107K | |
| Arran_1997_import.png | 2024-08-13 17:07 | 242K | |
| Arran_1998_HL_import.png | 2024-08-13 17:07 | 103K | |
| Arran_1998_Premium_Cask_import.png | 2024-08-13 17:07 | 138K | |
| Arran_1999_Premium_Cask_import.png | 2024-08-13 17:07 | 139K | |
| Arran_2001_Distillery_Exclusive_import.png | 2024-08-13 17:07 | 275K | |
| Arran_2001_Premium_Cask_import.png | 2024-08-13 17:07 | 140K | |
| Arran_2004_Premium_Cask_import.png | 2024-08-13 17:07 | 130K | |
| Arran_2005_Premium_Cask_import.png | 2024-08-13 17:07 | 138K | |
| Arran_2005_WhB_Cree_import.png | 2024-08-13 17:07 | 96K | |
| Arran_2005_import.png | 2024-08-13 17:07 | 131K | |
| Arran_2006_Premium_Cask_import.png | 2024-08-13 17:07 | 140K | |
| Arran_2006_The_Ambassadors_Dram_Release_4_import.png | 2024-08-13 17:07 | 123K | |
| Arran_2006_import.png | 2024-08-13 17:07 | 147K | |
| Arran_2007_SE_Cat_Label_Serie_import.png | 2024-08-13 17:07 | 124K | |
| Arran_2009_LBDS_import.png | 2024-08-13 17:07 | 143K | |
| Arran_2009_NMWL_no._12_import.png | 2024-08-13 17:07 | 128K | |
| Arran_2009_Private_Cask_import.png | 2024-08-13 17:07 | 130K | |
| Arran_2009_The_Festival_Single_Cask_import.png | 2024-08-13 17:07 | 127K | |
| Arran_2009_import.png | 2024-08-13 17:07 | 140K | |
| Arran_2010_Private_Cask_-_Distillery_Exclusive_import.png | 2024-08-13 17:07 | 160K | |
| Arran_2010_Private_Cask_import.png | 2024-08-13 17:08 | 137K | |
| Arran_2011_LMDW_import.png | 2024-08-13 17:08 | 133K | |
| Arran_2012_Private_Cask_import.png | 2024-08-13 17:08 | 131K | |
| Arran_2012_Single_Sherry_Cask_import.png | 2024-08-13 17:08 | 133K | |
| Arran_2012_The_Festival_Single_Cask_import.png | 2024-08-13 17:08 | 149K | |
| Arran_2012_WhB_import.png | 2024-08-13 17:08 | 133K | |
| Arran_2012_import.png | 2024-08-13 17:08 | 123K | |
| Arran_2012_myBar_import.png | 2024-08-13 17:08 | 239K | |
| Arran_2012_white_stag_dinner_2022_import.png | 2024-08-13 17:08 | 132K | |
| Arran_2013_DL_Old_Particular_import.png | 2024-08-13 17:08 | 214K | |
| Arran_2013_DL_Provenance_-_Coastal_Collection_import.png | 2024-08-13 17:08 | 302K | |
| Arran_2013_GtDr_Single_Cask_Series_import.png | 2024-08-13 17:08 | 116K | |
| Arran_2013_Private_Cask_import.png | 2024-08-13 17:08 | 122K | |
| Arran_2013_Small_Batch_import.png | 2024-08-13 17:08 | 134K | |
| Arran_2013_import.png | 2024-08-13 17:08 | 149K | |
| Arran_2014_DL_Old_Particular_import.png | 2024-08-13 17:08 | 113K | |
| Arran_2014_DL_Provenance_import.png | 2024-08-13 17:08 | 248K | |
| Arran_2014_Private_Cask_import.png | 2024-08-13 17:08 | 126K | |
| Arran_2015_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 135K | |
| Arran_2015_F.dk_Peated_import.png | 2024-08-13 17:08 | 111K | |
| Arran_2015_Small_Batch_import.png | 2024-08-13 17:08 | 128K | |
| Arran_2016_Private_Cask_import.png | 2024-08-13 17:08 | 137K | |
| Arran_2017_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 64K | |
| Arran_2017_DR__Cask_Collection_import.png | 2024-08-13 17:08 | 9.8K | |
| Arran_2017_DR__Distillery_Bottling_import.png | 2024-08-13 17:08 | 9.8K | |
| Arran_Arranach_Bottled_by_hand_at_the_distillery_import.png | 2024-08-13 17:08 | 146K | |
| Arran_Distillery_Exclusive_Hand_bottled_-_available_only_at_the_distillery_import.png | 2024-08-13 17:08 | 125K | |
| Arran_Malt_&_Music_Festival_2022_The_Arran_Harmony_Edition_Volume_5_import.png | 2024-08-13 17:08 | 133K | |
| Arran_Malt_&_Music_Festival_2023_The_Arran_Harmony_Edition_Volume_6_import.png | 2024-08-13 17:08 | 143K | |
| Arran_Peated_Sherry_&_Bourbon_Cask_Small_Batch_BeLux_import.png | 2024-08-13 17:08 | 126K | |
| Arran_Peated_Sherry_Cask_Peated_import.png | 2024-08-13 17:08 | 129K | |
| Arran_Remnant_Renegade_The_Signature_Series_-_Edition_1_import.png | 2024-08-13 17:08 | 121K | |
| Arran_Single_Malt_Scotch_Whisky_White_Stag_-_Eighth_Release_import.png | 2024-08-13 17:08 | 144K | |
| Arran_Single_Malt_Scotch_Whisky_White_Stag_-_Seventh_Release_import.png | 2024-08-13 17:08 | 128K | |
| Art_in_the_Barrel_2018_Alita_import.png | 2024-08-13 17:08 | 173K | |
| Artesia_Limited_Edition_Porto_import.png | 2024-08-13 17:08 | 244K | |
| Artist_Blend_Scotch_Whisky_CB_Single_Marrying_Cask_import.png | 2024-08-13 17:08 | 125K | |
| Artist_Blend_Single_Marrying_Cask_CB_import.png | 2024-08-13 17:08 | 119K | |
| As_We_Get_It_NAS_IM_Highland_Single_Malt_import.png | 2024-08-13 17:08 | 115K | |
| As_We_Get_It_NAS_IM_Islay_Single_Malt_import.png | 2024-08-13 17:08 | 111K | |
| Assassins_Creed_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:08 | 159K | |
| Athrú_2004_LGDi_Single_Cask_Release_import.png | 2024-08-13 17:08 | 169K | |
| Athrú_2015_LGDi_Single_Cask_Release_import.png | 2024-08-13 17:08 | 154K | |
| Athyr_2014_Distillery_Exclusive_import.png | 2024-08-13 17:08 | 153K | |
| Atlungstad_13-year-old_Finest_Blend_import.png | 2024-08-13 17:08 | 102K | |
| Atlungstad_16-year-old_Finest_Blend_import.png | 2024-08-13 17:08 | 107K | |
| Auchentoshan_1991_HL_Old_&_Rare_Platinum_import.png | 2024-08-13 17:08 | 159K | |
| Auchentoshan_1991_WSP_Edition_No._84_import.png | 2024-08-13 17:08 | 126K | |
| Auchentoshan_1992_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:08 | 123K | |
| Auchentoshan_1992_SMWS_5.130_Chocolate_mice_nibbling_rhubarb_import.png | 2024-08-13 17:08 | 154K | |
| Auchentoshan_1995_VWh_The_Constellation_series_import.png | 2024-08-13 17:08 | 99K | |
| Auchentoshan_1997_200th_Anniversary_Limited_Edition_import.png | 2024-08-13 17:08 | 106K | |
| Auchentoshan_1997_FibW_Permutations_Series_1_import.png | 2024-08-13 17:08 | 122K | |
| Auchentoshan_1998_AM_Heritage_import.png | 2024-08-13 17:08 | 94K | |
| Auchentoshan_1998_DR_Vintage_Cask_Collection_import.png | 2024-08-13 17:08 | 189K | |
| Auchentoshan_1998_G&P_import.png | 2024-08-13 17:08 | 92K | |
| Auchentoshan_1998_PST_import.png | 2024-08-13 17:08 | 109K | |
| Auchentoshan_1998_Sb_Jens_Drewitz´_Personal_Choice_No._6_import.png | 2024-08-13 17:08 | 133K | |
| Auchentoshan_1998_TWf_The_Cat_Gallery_import.png | 2024-08-13 17:08 | 174K | |
| Auchentoshan_1999_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 162K | |
| Auchentoshan_2002_Distillery_Cask_import.png | 2024-08-13 17:08 | 107K | |
| Auchentoshan_2002__Distillery_Cask_import.png | 2024-08-13 17:08 | 107K | |
| Auchentoshan_2003_SMWS_5.102_Hang_loose_import.png | 2024-08-13 17:08 | 106K | |
| Auchentoshan_2003_SMWS_5.103_Fruity_floral_fantasy_import.png | 2024-08-13 17:08 | 121K | |
| Auchentoshan_2003_SMWS_5.129_Cava_cocktail_import.png | 2024-08-13 17:08 | 111K | |
| Auchentoshan_2007_HMcD_The_Golden_Cask_-_Reserve_import.png | 2024-08-13 17:08 | 113K | |
| Auchentoshan_2007_LotG_Rare_Cask_import.png | 2024-08-13 17:08 | 302K | |
| Auchentoshan_2007_LotG_import.png | 2024-08-13 17:08 | 113K | |
| Auchentoshan_2007_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:08 | 156K | |
| Auchentoshan_2010_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:08 | 119K | |
| Auchentoshan_2010_BR_Single_Cask_import.png | 2024-08-13 17:08 | 134K | |
| Auchentoshan_2011_Distillery_Cask_import.png | 2024-08-13 17:08 | 111K | |
| Auchentoshan_2011_import.png | 2024-08-13 17:08 | 189K | |
| Auchentoshan_2012_TCaWi_import.png | 2024-08-13 17:08 | 157K | |
| Auchentoshan_2012_The_Distillery_Cask_import.png | 2024-08-13 17:08 | 114K | |
| Auchentoshan_2013_Handfilled_-_Distillery_Cask_import.png | 2024-08-13 17:08 | 183K | |
| Auchentoshan_2013_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:08 | 106K | |
| Auchentoshan_2013__Handfilled_-_Distillery_only_import.png | 2024-08-13 17:08 | 106K | |
| Auchentoshan_2013___Handfilled_-_Distillery_Cask_import.png | 2024-08-13 17:08 | 9.8K | |
| Auchentoshan_2013_vW_The_Ultimate_import.png | 2024-08-13 17:08 | 114K | |
| Auchentoshan_2014_DL_Old_Particular_import.png | 2024-08-13 17:08 | 108K | |
| Auchentoshan_2014_Distillery_Cask_-_Hand_Bottled_import.png | 2024-08-13 17:08 | 129K | |
| Auchindoran_2008_TWCC_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_08-year-old_AcL_Balmore_Dru_import.png | 2024-08-13 17:08 | 105K | |
| Auchroisk_13-year-old_vF_import.png | 2024-08-13 17:08 | 263K | |
| Auchroisk_1996_ED_The_First_Editions_import.png | 2024-08-13 17:08 | 105K | |
| Auchroisk_1996_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:08 | 99K | |
| Auchroisk_1996_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 147K | |
| Auchroisk_1997_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 114K | |
| Auchroisk_2006_SMWS_95.63_Cherries_from_the_neighbours_garden_import.png | 2024-08-13 17:08 | 119K | |
| Auchroisk_2007_DL_Old_Particular_import.png | 2024-08-13 17:08 | 113K | |
| Auchroisk_2007_ED_The_First_Editions_import.png | 2024-08-13 17:08 | 172K | |
| Auchroisk_2008_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:08 | 124K | |
| Auchroisk_2008_CWCL_Watt_Whisky_import.png | 2024-08-13 17:08 | 92K | |
| Auchroisk_2008_HiSp_Highproof_import.png | 2024-08-13 17:08 | 128K | |
| Auchroisk_2008_MBl_The_maltman_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_2008_SMWS_95.83_Cask-strength_lapsang_souchong_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_2008_TSCL_Family_Series_import.png | 2024-08-13 17:08 | 159K | |
| Auchroisk_2008_TSCL_German_Winter_Edition_2022_import.png | 2024-08-13 17:08 | 147K | |
| Auchroisk_2008_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 241K | |
| Auchroisk_2009_GM_Connoisseurs_Choice_-_Wood_Finished_import.png | 2024-08-13 17:08 | 129K | |
| Auchroisk_2009_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:08 | 200K | |
| Auchroisk_2009_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 114K | |
| Auchroisk_2009_JE_Sherry_Cask_Finish_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_2009_SV_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_2010_HL_Hepburns_Choice_import.png | 2024-08-13 17:08 | 254K | |
| Auchroisk_2010_LoDz_Rambler_import.png | 2024-08-13 17:08 | 115K | |
| Auchroisk_2010_TWCC_Standard_Bottling_import.png | 2024-08-13 17:08 | 117K | |
| Auchroisk_2010_VM_The_Coopers_Choice_import.png | 2024-08-13 17:08 | 124K | |
| Auchroisk_2011_HL_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 115K | |
| Auchroisk_2011_LT_Autumn_Edition_2022_import.png | 2024-08-13 17:08 | 110K | |
| Auchroisk_2011_WITL_import.png | 2024-08-13 17:08 | 127K | |
| Auchroisk_2011_WUA_CharacterUA_import.png | 2024-08-13 17:08 | 111K | |
| Auchroisk_2011_WhB_Single_Cask_Bottling_import.png | 2024-08-13 17:08 | 95K | |
| Auchroisk_2012_Cl_import.png | 2024-08-13 17:08 | 122K | |
| Auchroisk_2013_Cl_Warehouse_No._1_import.png | 2024-08-13 17:08 | 230K | |
| Auchroisk_Bourbon_Finish_MM_Cask_Craft_import.png | 2024-08-13 17:08 | 105K | |
| August_17th_09-year-old_Rare_Cask_Edition_W.11_import.png | 2024-08-13 17:08 | 207K | |
| August_17th_10-year-old_Rare_Cask_Edition_W.12_import.png | 2024-08-13 17:08 | 208K | |
| August_17th_11-year-old_Rare_Cask_Edition_W.13_import.png | 2024-08-13 17:08 | 241K | |
| August_17th_2012_Titus_import.png | 2024-08-13 17:08 | 302K | |
| August_17th_2015_Julius_import.png | 2024-08-13 17:08 | 121K | |
| Auld_Alfords_52-year-old_Too_Late_import.png | 2024-08-13 17:08 | 125K | |
| Auld_Alfords_Batch_2_TBWC_The_Scotch_Collection_import.png | 2024-08-13 17:08 | 133K | |
| Aultmore_10-year-old_SMWS_SC73_import.png | 2024-08-13 17:08 | 9.8K | |
| Aultmore_12-year-old_CA_Original_Collection_import.png | 2024-08-13 17:08 | 139K | |
| Aultmore_12-year-old_CA__Original_Collection_import.png | 2024-08-13 17:08 | 139K | |
| Aultmore_13-year-old_82NC_Creatures_of_Cask_Strength_import.png | 2024-08-13 17:08 | 102K | |
| Aultmore_1990_Joy_Connoisseur_Selection_-_No.25_import.png | 2024-08-13 17:08 | 119K | |
| Aultmore_1990_TWA_Sequences_import.png | 2024-08-13 17:08 | 125K | |
| Aultmore_1993_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:08 | 127K | |
| Aultmore_2006_BD_import.png | 2024-08-13 17:08 | 154K | |
| Aultmore_2006_CA_Cadenheads_Club_import.png | 2024-08-13 17:08 | 119K | |
| Aultmore_2006_DL_Old_Particular_import.png | 2024-08-13 17:08 | 118K | |
| Aultmore_2007_TWA_import.png | 2024-08-13 17:08 | 105K | |
| Aultmore_2008_DL_Old_Particular_-_The_Spirit_Animal_Series_import.png | 2024-08-13 17:08 | 215K | |
| Aultmore_2008_DT_The_Octave_import.png | 2024-08-13 17:08 | 105K | |
| Aultmore_2008_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:08 | 82K | |
| Aultmore_2009_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 77K | |
| Aultmore_2009_FegG_The_Refiners_import.png | 2024-08-13 17:08 | 135K | |
| Aultmore_2009_GM_Connoisseurs_Choice_-_Wood_Finished_import.png | 2024-08-13 17:08 | 128K | |
| Aultmore_2009_LotG_import.png | 2024-08-13 17:08 | 111K | |
| Aultmore_2009_MDB_Vintage_Casks_import.png | 2024-08-13 17:08 | 149K | |
| Aultmore_2009_MM_SBWAS_Deployment_6_import.png | 2024-08-13 17:08 | 128K | |
| Aultmore_2009_MoM_import.png | 2024-08-13 17:08 | 93K | |
| Aultmore_2009_PST_Error_502_Series_import.png | 2024-08-13 17:08 | 84K | |
| Aultmore_2009_PST_Redacted_Bros._import.png | 2024-08-13 17:08 | 94K | |
| Aultmore_2009_PST_import.png | 2024-08-13 17:08 | 102K | |
| Aultmore_2009_SV_Vintage_Collection_import.png | 2024-08-13 17:08 | 109K | |
| Aultmore_2009_TCaH_The_Deerhound_Collection_import.png | 2024-08-13 17:08 | 110K | |
| Aultmore_2009_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 162K | |
| Aultmore_2009_TWCe__Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 9.8K | |
| Aultmore_2010_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:08 | 141K | |
| Aultmore_2010_BR_Scyfion_Special_Selection_import.png | 2024-08-13 17:08 | 120K | |
| Aultmore_2010_CA_Sherry_Cask_import.png | 2024-08-13 17:08 | 123K | |
| Aultmore_2010_HL_Hepburns_Choice_import.png | 2024-08-13 17:08 | 110K | |
| Aultmore_2010_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 111K | |
| Aultmore_2010_TSS_import.png | 2024-08-13 17:08 | 103K | |
| Aultmore_2010_VAME_Cavity_Face_import.png | 2024-08-13 17:08 | 107K | |
| Aultmore_2010_WhB_Cree_import.png | 2024-08-13 17:08 | 98K | |
| Aultmore_2010_vw_The_Ultimate_import.png | 2024-08-13 17:08 | 118K | |
| Aultmore_2011_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:08 | 95K | |
| Aultmore_2011_LoDz_Christmas_Dram_import.png | 2024-08-13 17:08 | 165K | |
| Aultmore_2011_SMWS_73.149_A_contemplative_drop_import.png | 2024-08-13 17:08 | 305K | |
| Aultmore_2011_TWEx_import.png | 2024-08-13 17:08 | 96K | |
| Aultmore_2011_WhB_Cree_import.png | 2024-08-13 17:08 | 101K | |
| Aultmore_2011_WhDr_import.png | 2024-08-13 17:08 | 118K | |
| Aultmore_2012_HI_Maggies_Collection_import.png | 2024-08-13 17:08 | 113K | |
| Aultmore_2012_HL_Hepburns_Choice_import.png | 2024-08-13 17:08 | 121K | |
| Aultmore_2012_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:08 | 134K | |
| Aultmore_2013_GlSp_import.png | 2024-08-13 17:08 | 140K | |
| Aultmore_Batch_18_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:08 | 132K | |
| Ayrers_2017_Mastercut_import.png | 2024-08-13 17:08 | 171K | |
| Ayrers_2019_Organic_Single_Malt_import.png | 2024-08-13 17:08 | 210K | |
| Ayrers_Amarone_import.png | 2024-08-13 17:08 | 303K | |
| Ayrers_Martinique_Organic_Single_Malt_Whisky_import.png | 2024-08-13 17:08 | 133K | |
| Bårelegs_Battle_Axe_import.png | 2024-08-13 17:10 | 120K | |
| Bårelegs_Islay_Single_Malt_Small_Batch_import.png | 2024-08-13 17:10 | 107K | |
| Békési_Manufaktúra_2003_Single_Barrel_import.png | 2024-08-13 17:10 | 143K | |
| Bòidhchead_Luath_2013_TCaH_The_Fast_Beauty_import.png | 2024-08-13 17:10 | 147K | |
| BRBON_BAL15.jpg | 2024-08-13 17:09 | 240K | |
| Baby_-_Brook_Cask_6_import.png | 2024-08-13 17:08 | 156K | |
| Backwoods_Distilling_2018_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:08 | 245K | |
| Backwoods_Distilling_Rye_Whiskey_import.png | 2024-08-13 17:08 | 164K | |
| Backwoods_Distilling_Rye_Whisky_import.png | 2024-08-13 17:08 | 181K | |
| Backwoods_Distilling_Single_Malt_Whisky_import.png | 2024-08-13 17:08 | 187K | |
| Bad_Homburger_Landgrafen_Whisky_Triple_Barrel_import.png | 2024-08-13 17:08 | 219K | |
| Bad_na_h-Achlaise_Highland_Single_Malt_Scotch_Whisky_BaDi_Cask_Strength_import.png | 2024-08-13 17:08 | 102K | |
| Bad_na_h-Achlaise_Highland_Single_Malt_Scotch_Whisky_BaDi_Single_Cask_import.png | 2024-08-13 17:08 | 94K | |
| Bad_na_h-Achlaise_Highland_Single_Malt_Scotch_Whisky_BaDi_The_BAD_NA_H-ACHLAISE_Collection_import.png | 2024-08-13 17:08 | 160K | |
| Bad_na_h-Achlaise_Highland_Single_Malt_Scotch_Whisky_BaDi_import.png | 2024-08-13 17:08 | 96K | |
| Badmils_Black_2018_Madeira_import.png | 2024-08-13 17:08 | 148K | |
| Badmils_Black_2018_Port_import.png | 2024-08-13 17:08 | 148K | |
| Bains_10-year-old_10th_Anniversary_Exclusive_import.png | 2024-08-13 17:08 | 112K | |
| Bains_10-year-old_Travel_Retail_Exclusive_import.png | 2024-08-13 17:08 | 118K | |
| Baker's 107.jpg | 2024-08-13 17:08 | 54K | |
| Bakery_Hill_2010_High_Seas_import.png | 2024-08-13 17:08 | 92K | |
| Bakery_Hill_2014_The_Blunderbuss_import.png | 2024-08-13 17:08 | 92K | |
| Bakery_Hill_2015_Prospectors_Drop_import.png | 2024-08-13 17:08 | 80K | |
| Bakery_Hill_2019_Private_Cask_#2_import.png | 2024-08-13 17:08 | 93K | |
| Balblair_21-year-old_import.png | 2024-08-13 17:08 | 175K | |
| Balblair_1995_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:08 | 123K | |
| Balblair_1997_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:08 | 130K | |
| Balblair_1997_GM__Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:08 | 9.8K | |
| Balblair_1997_KCC_Fragrant_Drops_import.png | 2024-08-13 17:08 | 190K | |
| Balblair_1997_MaUn_Cultural_Series_import.png | 2024-08-13 17:08 | 120K | |
| Balblair_2005_Single_Cask_import.png | 2024-08-13 17:08 | 173K | |
| Balblair_2006_Hand_bottling_import.png | 2024-08-13 17:08 | 174K | |
| Balblair_2006_Single_Cask_import.png | 2024-08-13 17:08 | 228K | |
| Balblair_2007_Distillery_Hand_Bottling_import.png | 2024-08-13 17:08 | 161K | |
| Balblair_2007_Hand_bottled_at_the_distillery_import.png | 2024-08-13 17:08 | 182K | |
| Balblair_2007_Handfilled_at_Distillery_import.png | 2024-08-13 17:08 | 168K | |
| Balblair_2008_DeDr_Equinox_&_Solstice_Summer_Edition_import.png | 2024-08-13 17:08 | 91K | |
| Balblair_2008_DeDr_Whisky_Sponge_import.png | 2024-08-13 17:08 | 102K | |
| Balblair_2008_Distillery_Hand_Bottling_import.png | 2024-08-13 17:08 | 180K | |
| Balblair_2008_Handbottling_import.png | 2024-08-13 17:08 | 187K | |
| Balblair_2008_SMWS_70.47_Nanas_squeaking_toy_chest_import.png | 2024-08-13 17:08 | 109K | |
| Balblair_2008_SMWS_70.59_Rum_n_raisin_spice_cream_import.png | 2024-08-13 17:08 | 109K | |
| Balblair_2008__Distillery_Hand_Bottling_import.png | 2024-08-13 17:08 | 180K | |
| Balblair_2011_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 121K | |
| Balblair_2011_DL_Old_Particular_import.png | 2024-08-13 17:08 | 192K | |
| Balblair_2011_MBl_The_Maltman_import.png | 2024-08-13 17:08 | 111K | |
| Balblair_2011_MC_import.png | 2024-08-13 17:08 | 104K | |
| Balblair_2011_TSCL_Explorations_import.png | 2024-08-13 17:08 | 172K | |
| Balblair_2012_WCh_import.png | 2024-08-13 17:08 | 174K | |
| Balblair_2013_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 95K | |
| Balblair_2013_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:08 | 94K | |
| Balblair_2013_WW8_The_Warehouse_Collection_import.png | 2024-08-13 17:08 | 102K | |
| Balblair_2013_WhB_Cree_import.png | 2024-08-13 17:08 | 100K | |
| Balblair_Batch_3_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:08 | 131K | |
| Balcones_2018_SMWS_140.15_Walk-in_cigar_humidor_import.png | 2024-08-13 17:08 | 121K | |
| Balcones_Brimstone_Texas_Scrub_Oak_Smoked_import.png | 2024-08-13 17:08 | 141K | |
| Balcones_Cataleja_import.png | 2024-08-13 17:08 | 140K | |
| Balcones_Eclipse_Pot_Distilled_-_Straight_Rye_Whisky_import.png | 2024-08-13 17:08 | 149K | |
| Balcones_Peated_Texas_Single_Malt_Limited_Edition_2022_import.png | 2024-08-13 17:08 | 132K | |
| Balcones_Pilgrimage_import.png | 2024-08-13 17:08 | 154K | |
| Balcones_Texas_Pot_Still_Bourbon_import.png | 2024-08-13 17:08 | 145K | |
| Balcones_Texas_Single_Malt_Whisky_1_Classic_Edition_import.png | 2024-08-13 17:08 | 131K | |
| Balcones_Texas_Single_Malt_Whisky_1_Special_Release_import.png | 2024-08-13 17:08 | 141K | |
| Balcones_Texas_Single_Malt_Whisky_Single_Barrel_import.png | 2024-08-13 17:08 | 135K | |
| Balcones_Texas_Single_Malt_Whisky_Triple_Sherry_Finished_import.png | 2024-08-13 17:08 | 160K | |
| Balcones_ZZ-Top_Tres_Hombres_import.png | 2024-08-13 17:08 | 158K | |
| Balcones_ZZTop_Tres_Hombres_import.png | 2024-08-13 17:08 | 168K | |
| Ballantines_Finest_True_Music_Icons_-_Queen_import.png | 2024-08-13 17:08 | 171K | |
| Ballechin_13-year-old_Cask_Strength_Edition_import.png | 2024-08-13 17:08 | 161K | |
| Ballechin_15-year-old_Small_Batch_Cask_Strength_import.png | 2024-08-13 17:08 | 168K | |
| Ballechin_18-year-old_Small_Batch_Bottling_-_Cask_Strength_Edition_import.png | 2024-08-13 17:08 | 165K | |
| Ballechin_2003_WSP_Edition_No._47_import.png | 2024-08-13 17:08 | 107K | |
| Ballechin_2004_Madeira_Cask_Matured_import.png | 2024-08-13 17:08 | 151K | |
| Ballechin_2004_Port_Cask_Matured_import.png | 2024-08-13 17:08 | 163K | |
| Ballechin_2004_Small_Batch_import.png | 2024-08-13 17:08 | 152K | |
| Ballechin_2005_Burgundy_Cask_Matured_import.png | 2024-08-13 17:08 | 190K | |
| Ballechin_2005_Cigar_Malt_import.png | 2024-08-13 17:08 | 168K | |
| Ballechin_2005_Matured_In_Burgundy_Casks_import.png | 2024-08-13 17:08 | 147K | |
| Ballechin_2005_SV_import.png | 2024-08-13 17:08 | 121K | |
| Ballechin_2005_WSP_Exclusive_Edition_No._1_import.png | 2024-08-13 17:08 | 110K | |
| Ballechin_2007_SFTC_-_Madeira_Cask_Matured_import.png | 2024-08-13 17:08 | 197K | |
| Ballechin_2008_Grand_Arome_Rum_Cask_Matured_import.png | 2024-08-13 17:08 | 151K | |
| Ballechin_2008_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:08 | 115K | |
| Ballechin_2008_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:08 | 112K | |
| Ballechin_2009_Oloroso_Cask_Matured_import.png | 2024-08-13 17:08 | 161K | |
| Ballechin_2009_SFTC_-_Oloroso_Sherry_Cask_Matured_import.png | 2024-08-13 17:08 | 229K | |
| Ballechin_2010_Bourbon_Cask_Matured_import.png | 2024-08-13 17:08 | 160K | |
| Ballechin_2010_Vintage_import.png | 2024-08-13 17:08 | 146K | |
| Ballechin_2011_SFTC_-_Bourbon_Cask_Matured_import.png | 2024-08-13 17:08 | 223K | |
| Ballechin_2011_SFTC_-_Oloroso_Sherry_Cask_Matured_import.png | 2024-08-13 17:08 | 222K | |
| Ballechin_2013_CG_The_Greedy_Angels_import.png | 2024-08-13 17:08 | 289K | |
| Ballechin_2013_Double_Malt_-_Double_Cask_import.png | 2024-08-13 17:08 | 169K | |
| Ballechin_2013_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:08 | 172K | |
| Ballechin_2013_Vintage_import.png | 2024-08-13 17:08 | 157K | |
| Ballindalloch_07-Year-Old_Seven_Springs_Collection_-_Edition_No.1_import.png | 2024-08-13 17:08 | 107K | |
| Ballindalloch_2015_First_Release_-_Single_Cask_import.png | 2024-08-13 17:08 | 209K | |
| Ballindalloch_2015_import.png | 2024-08-13 17:08 | 200K | |
| Ballindalloch_2016_Distillery_Exclusive_import.png | 2024-08-13 17:08 | 195K | |
| Ballindalloch_2016_Inaugural_Release_import.png | 2024-08-13 17:08 | 207K | |
| Balmenach_16-year-old_AtB_Darkness_import.png | 2024-08-13 17:08 | 138K | |
| Balmenach_1988_WSP_Edition_No._51_import.png | 2024-08-13 17:08 | 106K | |
| Balmenach_1990_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:08 | 140K | |
| Balmenach_2005_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 102K | |
| Balmenach_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:08 | 123K | |
| Balmenach_2010_AI_The_Alba_Trail_import.png | 2024-08-13 17:08 | 121K | |
| Balmenach_2010_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 97K | |
| Balmenach_2011_BR_Single_Cask_import.png | 2024-08-13 17:08 | 130K | |
| Balmenach_2011_HB_import.png | 2024-08-13 17:08 | 101K | |
| Balmenach_2011_MoS_import.png | 2024-08-13 17:08 | 159K | |
| Balmenach_2012_Cl_Exclusives_import.png | 2024-08-13 17:08 | 89K | |
| Balmenach_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:08 | 214K | |
| Balmenach_2012_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 88K | |
| Balmenach_2012_JW_Caskman_no.2_import.png | 2024-08-13 17:08 | 124K | |
| Balmenach_2012_LT_Autumn_Edition_2022_import.png | 2024-08-13 17:08 | 109K | |
| Balmenach_2012_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:08 | 135K | |
| Balmenach_2012_SMWS_48.159_High_summer_high_jinks_import.png | 2024-08-13 17:08 | 101K | |
| Balmenach_2012_TWA_import.png | 2024-08-13 17:08 | 115K | |
| Balmenach_2012_TnTC_import.png | 2024-08-13 17:08 | 123K | |
| Balmenach_2012_WhB_import.png | 2024-08-13 17:08 | 99K | |
| Balmenach_2013_3W_import.png | 2024-08-13 17:08 | 87K | |
| Balmenach_2013_BD_import.png | 2024-08-13 17:08 | 157K | |
| Balmenach_2013_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 95K | |
| Balmenach_2013_DL_Provenance_import.png | 2024-08-13 17:08 | 121K | |
| Balmenach_2013_PST_import.png | 2024-08-13 17:08 | 95K | |
| Balmenach_2015_HB_Single_Cask_import.png | 2024-08-13 17:08 | 114K | |
| Balmenach_2015_HB__Single_Cask_import.png | 2024-08-13 17:08 | 9.8K | |
| Balmoral_18-Year-Old_Coronation_Edition_import.png | 2024-08-13 17:08 | 96K | |
| Balmoral_2000_Platinum_Edition_import.png | 2024-08-13 17:08 | 99K | |
| Balmoral_Highland_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:08 | 93K | |
| Baltach_05-year-old_Wismarian_Single_Malt_Whisky_import.png | 2024-08-13 17:08 | 141K | |
| Baltach_Wismarian_Peated_Singe_Malt_import.png | 2024-08-13 17:08 | 130K | |
| Baltach_Wismarian_Single_Malt_Whisky_import.png | 2024-08-13 17:08 | 138K | |
| Balvenie 10 Founder's Reserve.jpg | 2024-08-13 17:08 | 137K | |
| Balvenie 12 Doublewood.jpg | 2024-08-13 17:08 | 22K | |
| Balvenie 12 Single Barrel First Fill.jpg | 2024-08-13 17:08 | 84K | |
| Balvenie 14 Golden Cask.jpg | 2024-08-13 17:08 | 19K | |
| Balvenie 15 Single Barrel.jpg | 2024-08-13 17:08 | 36K | |
| Balvenie 17 Doublewood.jpg | 2024-08-13 17:08 | 20K | |
| Balvenie 17 Peated Cask.jpg | 2024-08-13 17:08 | 57K | |
| Balvenie 21 Portwood.jpg | 2024-08-13 17:08 | 3.5K | |
| Balvenie Tun 1401 Batch 3.jpg | 2024-08-13 17:08 | 3.4K | |
| Balvenie Tun 1401 Batch 5.jpg | 2024-08-13 17:08 | 3.4K | |
| Balvenie_11-year-old_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:08 | 128K | |
| Balvenie_12-year-old_Distillery_Only_-_Hand-Filled_import.png | 2024-08-13 17:08 | 126K | |
| Balvenie_12-year-old_Duty_Paid_Sample_-_Warehouse_No._24_import.png | 2024-08-13 17:08 | 119K | |
| Balvenie_12-year-old_Duty_Paid_Sample_import.png | 2024-08-13 17:08 | 104K | |
| Balvenie_12-year-old__Duty_Paid_Sample_-_Warehouse_No._24_import.png | 2024-08-13 17:08 | 119K | |
| Balvenie_14-year-old_Warehouse_No._24_import.png | 2024-08-13 17:08 | 180K | |
| Balvenie_15-year-old_Single_Barrel_-_Sherry_Cask_import.png | 2024-08-13 17:08 | 272K | |
| Balvenie_15-year-old_Single_Barrel_import.png | 2024-08-13 17:08 | 130K | |
| Balvenie_16-year-old_Duty_Paid_Sample_import.png | 2024-08-13 17:08 | 122K | |
| Balvenie_19-year-old_A_Revelation_Of_Cask_And_Character_import.png | 2024-08-13 17:08 | 126K | |
| Balvenie_19-year-old_Peated_import.png | 2024-08-13 17:08 | 92K | |
| Balvenie_21-year-old_Single_Barrel_-_Traditional_Oak_import.png | 2024-08-13 17:08 | 120K | |
| Balvenie_21-year-old_Single_Barrel_import.png | 2024-08-13 17:08 | 116K | |
| Bankhall_2020_First_Release_import.png | 2024-08-13 17:08 | 137K | |
| Bankhall_Rye_Rebellion__Rye_&_Malted_Barley_Recipe_import.png | 2024-08-13 17:08 | 9.8K | |
| Baoilleach_2020_The_Son_-_Donegal_Mountain_Dew_import.png | 2024-08-13 17:08 | 143K | |
| Baoilleach_2021_The_Father_-_Donegal_Mountain_Dew_import.png | 2024-08-13 17:08 | 147K | |
| Baoilleach_2021_The_Holy_Smoke_-_Donegal_Mountain_Dew_import.png | 2024-08-13 17:08 | 150K | |
| Baoilleach_The_First_Cut_-_The_Father_import.png | 2024-08-13 17:08 | 126K | |
| Barbarossa_No._7_import.png | 2024-08-13 17:08 | 153K | |
| Bardstown_Bourbon_Company_06-year-old_Origin_Series_import.png | 2024-08-13 17:08 | 120K | |
| Bardstown_Bourbon_Company_07-year-old_Collaborative_Series_-_Goose_Island_import.png | 2024-08-13 17:08 | 116K | |
| Bardstown_Bourbon_Company_7-year-old_Collaborative_Series_-_FourSquare_import.png | 2024-08-13 17:08 | 121K | |
| Bardstown_Bourbon_Company_10-year-old_Collaberative_Series-Plantation_Rum_edition_import.png | 2024-08-13 17:08 | 110K | |
| Bardstown_Bourbon_Company_12-year-old_Collaborative_Series_-_West_Virginia_Great_Barrel_Company_import.png | 2024-08-13 17:08 | 113K | |
| Bardstown_Bourbon_Company_2008_V&M_The_Spirit_of_Art_import.png | 2024-08-13 17:08 | 127K | |
| Bardstown_Bourbon_Company_Discovery_Series_#7_Blended_Whiskey_import.png | 2024-08-13 17:08 | 105K | |
| Bardstown_Bourbon_Company_Discovery_Series_#8_Blended_Whiskey_import.png | 2024-08-13 17:08 | 111K | |
| Bardstown_Bourbon_Company_Fercullen_edition_Collaborative_Series_-_Fercullen_import.png | 2024-08-13 17:08 | 131K | |
| Bardstown_Bourbon_Company_Founders_Brewing_Collaboration_Collaborative_Series_import.png | 2024-08-13 17:08 | 109K | |
| Bardstown_Bourbon_Company_Fusion_#7_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:08 | 114K | |
| Baron_2019_Organic_import.png | 2024-08-13 17:08 | 87K | |
| Barrell_Bourbon_06-year-old_Cask_Strength_import.png | 2024-08-13 17:08 | 154K | |
| Barrell_Bourbon_08-year-old_10th_Anniversary_Blend_import.png | 2024-08-13 17:08 | 142K | |
| Barrell_Bourbon_New_Year_2023_Cask_Strength_import.png | 2024-08-13 17:08 | 139K | |
| Barrell_Bourbon_New_Year_2024_Cask_Strength_import.png | 2024-08-13 17:08 | 163K | |
| Barrell_Bourbon_Private_Barrell_Release_import.png | 2024-08-13 17:08 | 142K | |
| Barrell_Bourbon_Private_Release_import.png | 2024-08-13 17:08 | 135K | |
| Barrell_Bourbon_Single_Barrel_import.png | 2024-08-13 17:08 | 150K | |
| Barrell_Bourbon_Vantage_import.png | 2024-08-13 17:08 | 156K | |
| Barrell_Rye_Private_Release_Rye_import.png | 2024-08-13 17:08 | 141K | |
| Barrell_Rye_Seagrass_import.png | 2024-08-13 17:08 | 169K | |
| Barrell_Whiskey_May_2022_Infinite_Barrel_Project_import.png | 2024-08-13 17:08 | 136K | |
| Basil Hayden.jpg | 2024-08-13 17:08 | 69K | |
| Bear_Fight_Limited_Release_American_Single_Malt_Whiskey_import.png | 2024-08-13 17:08 | 137K | |
| Bearface_Wilderness_Series_Edition_01_import.png | 2024-08-13 17:08 | 133K | |
| Beathan_2010_WM_Barrel_Selection_import.png | 2024-08-13 17:08 | 114K | |
| Beathan_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:08 | 96K | |
| Beautiful_Fruit_08-year-old_import.png | 2024-08-13 17:08 | 9.8K | |
| Beek_2018_import.png | 2024-08-13 17:08 | 99K | |
| Beek_Bourbon_Cask_Vintage_import.png | 2024-08-13 17:08 | 101K | |
| Belgian_Single_Malt_Whisky_Cask_Strength_import.png | 2024-08-13 17:08 | 132K | |
| Belgian_Single_Malt_Whisky_import.png | 2024-08-13 17:08 | 131K | |
| Belgrove_Wholly_Shit_Rye_Whisky_import.png | 2024-08-13 17:08 | 119K | |
| Bellevoye_Triple_Malt_Edition_Tourbèe_Peated_import.png | 2024-08-13 17:08 | 163K | |
| BenRiach 12.jpg | 2024-08-13 17:08 | 31K | |
| BenRiach 12 Importanticus Fumosus.jpg | 2024-08-13 17:08 | 31K | |
| BenRiach 12 Sherry Matured.jpg | 2024-08-13 17:08 | 473K | |
| BenRiach 16.jpg | 2024-08-13 17:08 | 209K | |
| BenRiach 17 Solstice.jpg | 2024-08-13 17:08 | 467K | |
| BenRiach 21 Authenticus Peated.jpg | 2024-08-13 17:08 | 37K | |
| BenRiach_08-year-old_whic_Amazing_Whiskies_import.png | 2024-08-13 17:08 | 123K | |
| BenRiach_11-year-old_SMWS_12.69_A_natural_green_and_purple_weave_import.png | 2024-08-13 17:08 | 122K | |
| BenRiach_12-year-old_CA_Original_Collection_import.png | 2024-08-13 17:08 | 146K | |
| BenRiach_12-year-old_CA__Original_Collection_import.png | 2024-08-13 17:08 | 146K | |
| BenRiach_16-year-old_The_Sixteen_import.png | 2024-08-13 17:08 | 115K | |
| BenRiach_22-year-old_Triple_Distilled_import.png | 2024-08-13 17:08 | 123K | |
| BenRiach_1991_BR_Exceptional_Casks_import.png | 2024-08-13 17:08 | 145K | |
| BenRiach_1991_LMDW_Artist_#13_import.png | 2024-08-13 17:08 | 105K | |
| BenRiach_1994_Cask_Edition_import.png | 2024-08-13 17:08 | 107K | |
| BenRiach_1996_MoM_import.png | 2024-08-13 17:08 | 88K | |
| BenRiach_1997_Cask_Edition_import.png | 2024-08-13 17:08 | 115K | |
| BenRiach_1997_TWBl_Exclusive_Bottling_Series_import.png | 2024-08-13 17:08 | 120K | |
| BenRiach_1997_TWBl_No._047_import.png | 2024-08-13 17:08 | 102K | |
| BenRiach_1998_Cask_Edition_import.png | 2024-08-13 17:08 | 113K | |
| BenRiach_2000_SCSM_import.png | 2024-08-13 17:08 | 115K | |
| BenRiach_2000_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 154K | |
| BenRiach_2001_HL_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 227K | |
| BenRiach_2001_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 140K | |
| BenRiach_2005_Distillery_Cask_import.png | 2024-08-13 17:08 | 110K | |
| BenRiach_2005_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:08 | 126K | |
| BenRiach_2008_AC_Special_Vintage_Selection_import.png | 2024-08-13 17:08 | 111K | |
| BenRiach_2008_AM_import.png | 2024-08-13 17:08 | 91K | |
| BenRiach_2008_BR_Scyfion_Choice_import.png | 2024-08-13 17:08 | 104K | |
| BenRiach_2008_BR_import.png | 2024-08-13 17:08 | 123K | |
| BenRiach_2008_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 100K | |
| BenRiach_2008_Distillery_Cask_import.png | 2024-08-13 17:08 | 111K | |
| BenRiach_2008_HB_Single_Cask_import.png | 2024-08-13 17:08 | 111K | |
| BenRiach_2008_MoS_WhiskyandArt_import.png | 2024-08-13 17:08 | 145K | |
| BenRiach_2008_PC_50th_Anniversary_import.png | 2024-08-13 17:08 | 149K | |
| BenRiach_2008_TCaH_import.png | 2024-08-13 17:08 | 173K | |
| BenRiach_2008_UD_Mans_Best_Friend_import.png | 2024-08-13 17:08 | 142K | |
| BenRiach_2008_Wy_A_Winters_Tale_import.png | 2024-08-13 17:08 | 213K | |
| BenRiach_2008_import.png | 2024-08-13 17:08 | 99K | |
| BenRiach_2009_LotG_Rare_Cask_import.png | 2024-08-13 17:08 | 111K | |
| BenRiach_2009_UD_The_Private_Cask_import.png | 2024-08-13 17:08 | 92K | |
| BenRiach_2009_UD__The_Private_Cask_import.png | 2024-08-13 17:08 | 203K | |
| BenRiach_2010_BD_import.png | 2024-08-13 17:08 | 154K | |
| BenRiach_2010_BR_Single_Cask_import.png | 2024-08-13 17:08 | 118K | |
| BenRiach_2010_F.dk_import.png | 2024-08-13 17:08 | 98K | |
| BenRiach_2010_JE_Marsala_Cask_Finish_import.png | 2024-08-13 17:08 | 96K | |
| BenRiach_2010_MDB_Vintage_Casks_import.png | 2024-08-13 17:08 | 139K | |
| BenRiach_2010_WCh_The_Private_Club_Collection_import.png | 2024-08-13 17:08 | 95K | |
| BenRiach_2010_WCh_import.png | 2024-08-13 17:08 | 152K | |
| BenRiach_2011_Cask_Edition_import.png | 2024-08-13 17:08 | 125K | |
| BenRiach_2011_DT_import.png | 2024-08-13 17:08 | 119K | |
| BenRiach_2011_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:08 | 137K | |
| BenRiach_2011_TCaH__Friends_of_Caskhound_import.png | 2024-08-13 17:08 | 9.8K | |
| BenRiach_2011_WKK_Single_Cask_import.png | 2024-08-13 17:08 | 142K | |
| BenRiach_2012_3W_import.png | 2024-08-13 17:08 | 105K | |
| BenRiach_2012_AD_Selection_import.png | 2024-08-13 17:08 | 80K | |
| BenRiach_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:08 | 226K | |
| BenRiach_2012_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 94K | |
| BenRiach_2012_DR_From_the_Cask_import.png | 2024-08-13 17:08 | 128K | |
| BenRiach_2012_DR__Cask_Collection_import.png | 2024-08-13 17:08 | 9.8K | |
| BenRiach_2012_K23_Bear_with_me_import.png | 2024-08-13 17:08 | 94K | |
| BenRiach_2012_MSWD_Càrn_Mòr_Strictly_Limited_Edition_import.png | 2024-08-13 17:08 | 139K | |
| BenRiach_2013_CsA_CaskAid_import.png | 2024-08-13 17:08 | 137K | |
| BenRiach_2013_Csks_Collective_Series_import.png | 2024-08-13 17:08 | 142K | |
| BenRiach_2013_DMor_import.png | 2024-08-13 17:08 | 99K | |
| BenRiach_2013_LFN_Taste_Five_Plus_Edition_002_import.png | 2024-08-13 17:08 | 129K | |
| BenRiach_2013_LFN__Taste_Five_Plus_Edition_import.png | 2024-08-13 17:08 | 9.8K | |
| BenRiach_2013_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:08 | 128K | |
| BenRiach_2013_SpC_import.png | 2024-08-13 17:08 | 115K | |
| BenRiach_2013_WhB_import.png | 2024-08-13 17:08 | 98K | |
| BenRiach_2014_DR_Individual_Cask_Bottling_import.png | 2024-08-13 17:08 | 68K | |
| BenRiach_2014_LsD_McCraes_import.png | 2024-08-13 17:08 | 245K | |
| BenRiach_2018_TCaH_import.png | 2024-08-13 17:08 | 107K | |
| BenRiach_AWWC_2011_Infrequent_Flyers_import.png | 2024-08-13 17:08 | 124K | |
| Ben_Bracken_12-year-old_CD_Peated_&_Smoky_import.png | 2024-08-13 17:08 | 92K | |
| Ben_Bracken_20-year-old_Cd_Peated_&_Smoky_import.png | 2024-08-13 17:08 | 79K | |
| Ben_Bracken_1991_Islay_Single_Malt_import.png | 2024-08-13 17:08 | 89K | |
| Ben_Bracken_2003_Cd_import.png | 2024-08-13 17:08 | 105K | |
| Ben_Holladay_2017_Soft_Red_Wheat_import.png | 2024-08-13 17:08 | 128K | |
| Ben_Nevis_09-year-old_DT_Battlehill_import.png | 2024-08-13 17:08 | 105K | |
| Ben_Nevis_09-year-old_DT_The_Octave_import.png | 2024-08-13 17:08 | 89K | |
| Ben_Nevis_1991_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:08 | 157K | |
| Ben_Nevis_1995_BR_Scyfion_Choice_import.png | 2024-08-13 17:08 | 109K | |
| Ben_Nevis_1995_BR_Single_Cask_import.png | 2024-08-13 17:08 | 122K | |
| Ben_Nevis_1995_BR__Single_Cask_import.png | 2024-08-13 17:08 | 9.8K | |
| Ben_Nevis_1995_TWBl_import.png | 2024-08-13 17:08 | 94K | |
| Ben_Nevis_1996_BA_Blackadder_Statement_Edition_No._41_import.png | 2024-08-13 17:08 | 223K | |
| Ben_Nevis_1996_CDuS_import.png | 2024-08-13 17:08 | 120K | |
| Ben_Nevis_1996_Cl_Genuss_am_Gaumen_import.png | 2024-08-13 17:08 | 140K | |
| Ben_Nevis_1996_Cl_Warehouse_No._1_import.png | 2024-08-13 17:08 | 229K | |
| Ben_Nevis_1996_SpSp_import.png | 2024-08-13 17:08 | 97K | |
| Ben_Nevis_1996_TGS_import.png | 2024-08-13 17:08 | 106K | |
| Ben_Nevis_1996_TSCL_Family_Series_import.png | 2024-08-13 17:08 | 145K | |
| Ben_Nevis_1996_TTOW_Pin-up_Girls_import.png | 2024-08-13 17:08 | 117K | |
| Ben_Nevis_1996_TWBl_No._036_import.png | 2024-08-13 17:08 | 116K | |
| Ben_Nevis_1996_TWJ_import.png | 2024-08-13 17:08 | 94K | |
| Ben_Nevis_1996_VBtl_Rare_Cask_Series_import.png | 2024-08-13 17:08 | 88K | |
| Ben_Nevis_1996_WAGE_No._0008_import.png | 2024-08-13 17:08 | 117K | |
| Ben_Nevis_1996_WB_15th_Anniversary_import.png | 2024-08-13 17:08 | 102K | |
| Ben_Nevis_1996_WSP_Edition_No._52_import.png | 2024-08-13 17:08 | 102K | |
| Ben_Nevis_1996_WSP_Edition_No._58A_import.png | 2024-08-13 17:08 | 106K | |
| Ben_Nevis_1997_EVWC_import.png | 2024-08-13 17:08 | 131K | |
| Ben_Nevis_1997_NSpS_Neoclassicism_import.png | 2024-08-13 17:08 | 103K | |
| Ben_Nevis_1997_NSpS_import.png | 2024-08-13 17:08 | 107K | |
| Ben_Nevis_1997_VBtl_The_Vintage_Series_import.png | 2024-08-13 17:08 | 90K | |
| Ben_Nevis_1997_WhB_I_see_the_day_of_my_return_import.png | 2024-08-13 17:08 | 100K | |
| Ben_Nevis_1997_YoSp_Noahs_Garden_import.png | 2024-08-13 17:08 | 135K | |
| Ben_Nevis_1998_MBl_The_Maltman_import.png | 2024-08-13 17:08 | 107K | |
| Ben_Nevis_1998_MBl__The_Maltman_import.png | 2024-08-13 17:08 | 107K | |
| Ben_Nevis_1998_NSpS_Neoclassicism_import.png | 2024-08-13 17:08 | 98K | |
| Ben_Nevis_1998_NYW_The_Peninsula_Collection_import.png | 2024-08-13 17:08 | 122K | |
| Ben_Nevis_1998_TTOW_import.png | 2024-08-13 17:08 | 90K | |
| Ben_Nevis_1998_UD_Puzzle_-_The_Financier_import.png | 2024-08-13 17:08 | 126K | |
| Ben_Nevis_1999_MBl_The_Maltman_import.png | 2024-08-13 17:08 | 112K | |
| Ben_Nevis_2001_UD_import.png | 2024-08-13 17:08 | 276K | |
| Ben_Nevis_2003_BA_Ingelred_import.png | 2024-08-13 17:08 | 107K | |
| Ben_Nevis_2004_BA_Ingelred_import.png | 2024-08-13 17:08 | 94K | |
| Ben_Nevis_2004_SE_Cat_Label_Serie_import.png | 2024-08-13 17:08 | 103K | |
| Ben_Nevis_2005_Private_Cask_Bottling_import.png | 2024-08-13 17:08 | 104K | |
| Ben_Nevis_2006_Cask_Owners_Club_No7_import.png | 2024-08-13 17:08 | 118K | |
| Ben_Nevis_2006_SE_Cat_Label_Serie_import.png | 2024-08-13 17:08 | 135K | |
| Ben_Nevis_2008_BA_Ingelred_import.png | 2024-08-13 17:08 | 97K | |
| Ben_Nevis_2009_BA_Friendship_Bottling_NO_1_import.png | 2024-08-13 17:08 | 98K | |
| Ben_Nevis_2010_BA_Ingelred_import.png | 2024-08-13 17:08 | 189K | |
| Ben_Nevis_2010_DMor_import.png | 2024-08-13 17:08 | 99K | |
| Ben_Nevis_2011_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:08 | 133K | |
| Ben_Nevis_2011_HL_Hepburns_Choice_import.png | 2024-08-13 17:08 | 105K | |
| Ben_Nevis_2011_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 135K | |
| Ben_Nevis_2011_LsD_Hepburns_Choice_import.png | 2024-08-13 17:08 | 250K | |
| Ben_Nevis_2011_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 168K | |
| Ben_Nevis_2012_AD_Selection_import.png | 2024-08-13 17:08 | 82K | |
| Ben_Nevis_2012_BA_Ingelred_import.png | 2024-08-13 17:08 | 157K | |
| Ben_Nevis_2012_BD_import.png | 2024-08-13 17:08 | 153K | |
| Ben_Nevis_2012_BR_import.png | 2024-08-13 17:08 | 128K | |
| Ben_Nevis_2012_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 101K | |
| Ben_Nevis_2012_CA_Cadenhead’s_Club_10th_Anniversary_import.png | 2024-08-13 17:08 | 139K | |
| Ben_Nevis_2012_CA_Warehouse_Tasting_import.png | 2024-08-13 17:08 | 150K | |
| Ben_Nevis_2012_CV_Privatfat_import.png | 2024-08-13 17:08 | 95K | |
| Ben_Nevis_2012_DL_Provenance_import.png | 2024-08-13 17:08 | 306K | |
| Ben_Nevis_2012_DR_Cask_Collection_import.png | 2024-08-13 17:08 | 71K | |
| Ben_Nevis_2012_DS_The_Wild_Scotland_Collection_import.png | 2024-08-13 17:08 | 108K | |
| Ben_Nevis_2012_DT_Private_Cask_Bottling_import.png | 2024-08-13 17:08 | 105K | |
| Ben_Nevis_2012_DT_The_Octave_import.png | 2024-08-13 17:08 | 94K | |
| Ben_Nevis_2012_DeDr_Equinox_&_Solstice_Spring_Edition_import.png | 2024-08-13 17:08 | 91K | |
| Ben_Nevis_2012_DeDr__Equinox_&_Solstice_Spring_Edition_import.png | 2024-08-13 17:08 | 9.8K | |
| Ben_Nevis_2012_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:08 | 100K | |
| Ben_Nevis_2012_JW_Great_Ocean_Liners_import.png | 2024-08-13 17:09 | 110K | |
| Ben_Nevis_2012_MDB_Vintage_Casks_import.png | 2024-08-13 17:09 | 158K | |
| Ben_Nevis_2012_MM_Limited_Release_import.png | 2024-08-13 17:09 | 116K | |
| Ben_Nevis_2012_McDI_The_Golden_Cask_import.png | 2024-08-13 17:09 | 100K | |
| Ben_Nevis_2012_MiSp_import.png | 2024-08-13 17:09 | 149K | |
| Ben_Nevis_2012_MoSp_Marble_collection_import.png | 2024-08-13 17:09 | 128K | |
| Ben_Nevis_2012_Soh_Soho_Selection_import.png | 2024-08-13 17:09 | 92K | |
| Ben_Nevis_2012_StmD_Máire_XIV._Edition_import.png | 2024-08-13 17:09 | 95K | |
| Ben_Nevis_2012_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:09 | 149K | |
| Ben_Nevis_2012_TWCe__Private_Cellars_Selection_import.png | 2024-08-13 17:09 | 9.8K | |
| Ben_Nevis_2012_V&M_The_Young_Masters_Edition_import.png | 2024-08-13 17:09 | 124K | |
| Ben_Nevis_2012_WCh_import.png | 2024-08-13 17:09 | 135K | |
| Ben_Nevis_2012_WhB_Cree_import.png | 2024-08-13 17:09 | 103K | |
| Ben_Nevis_2012_import.png | 2024-08-13 17:09 | 128K | |
| Ben_Nevis_2012_whic_whic_Amazing_Whiskies_Ep._22_import.png | 2024-08-13 17:09 | 113K | |
| Ben_Nevis_2013_Ch7_Monologue_import.png | 2024-08-13 17:09 | 143K | |
| Ben_Nevis_2013_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:09 | 108K | |
| Ben_Nevis_2013_MBl_The_Maltman_import.png | 2024-08-13 17:09 | 97K | |
| Ben_Nevis_2013_MBl__The_Maltman_import.png | 2024-08-13 17:09 | 9.8K | |
| Ben_Nevis_2013_SV_Limited_Animal_Edition_No._3_import.png | 2024-08-13 17:09 | 170K | |
| Ben_Nevis_2013_SV_Small_Batch_Edition_#11_import.png | 2024-08-13 17:09 | 103K | |
| Ben_Nevis_2013_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:09 | 125K | |
| Ben_Nevis_2013_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 95K | |
| Ben_Nevis_2013_W-F_import.png | 2024-08-13 17:09 | 132K | |
| Ben_Nevis_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:09 | 114K | |
| Ben_Nevis_2013_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:09 | 108K | |
| Ben_Nevis_2014_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:09 | 97K | |
| Ben_Nevis_2014_DL_Provenance_import.png | 2024-08-13 17:09 | 243K | |
| Ben_Nevis_2014_DeDr_Equinox_&_Solstice_Autumn_Edition_import.png | 2024-08-13 17:09 | 111K | |
| Ben_Nevis_2014_DeDr_Notable_Age_Statements_import.png | 2024-08-13 17:09 | 103K | |
| Ben_Nevis_2014_JE_import.png | 2024-08-13 17:09 | 105K | |
| Ben_Nevis_2014_MBl_The_Maltman_import.png | 2024-08-13 17:09 | 115K | |
| Ben_Nevis_2014_SMWS_78.73_A_maze_of_amazement_import.png | 2024-08-13 17:09 | 99K | |
| Ben_Nevis_2014_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:09 | 174K | |
| Ben_Nevis_2014_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:09 | 101K | |
| Ben_Nevis_2014_SV_The_Decanter_Collection_import.png | 2024-08-13 17:09 | 133K | |
| Ben_Nevis_2014_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 100K | |
| Ben_Nevis_2014_SV_Vintage_Collection_import.png | 2024-08-13 17:09 | 101K | |
| Ben_Nevis_2014_SV__Horsemen_&_Archangels_import.png | 2024-08-13 17:09 | 174K | |
| Ben_Nevis_2014_SV__The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 108K | |
| Ben_Nevis_2014_SV___The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 110K | |
| Ben_Nevis_2014_SV_import.png | 2024-08-13 17:09 | 112K | |
| Ben_Nevis_2015_LoDz_Rambler_import.png | 2024-08-13 17:09 | 107K | |
| Ben_Nevis_2015_MSWD_Càrn_Mòr_Strictly_Limited_Edition_import.png | 2024-08-13 17:09 | 107K | |
| Ben_Nevis_2015_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:09 | 109K | |
| Ben_Nevis_2015_RK_Black_Corbie_import.png | 2024-08-13 17:09 | 96K | |
| Ben_Nevis_2015_Soh_Soho_Selection_import.png | 2024-08-13 17:09 | 90K | |
| Ben_Nevis_2018_WhB_import.png | 2024-08-13 17:09 | 87K | |
| Ben_Nevis_Batch_16_TBWC_10th_Birthday_import.png | 2024-08-13 17:09 | 157K | |
| Ben_Nevis_Traditional_Peated_Malt_import.png | 2024-08-13 17:09 | 108K | |
| Benrinnes 14 Lady of the Glen 1999.jpg | 2024-08-13 17:08 | 272K | |
| Benrinnes 15 DARKNESS! Oloroso.jpg | 2024-08-13 17:08 | 272K | |
| Benrinnes 15 DARKNESS! Pedro Ximenez.jpg | 2024-08-13 17:08 | 23K | |
| Benrinnes_12-year-old_82NC_KEINE_Creatures_of_Cask_Strength_ABFÜLLUNG!!!_import.png | 2024-08-13 17:08 | 116K | |
| Benrinnes_12-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:08 | 127K | |
| Benrinnes_12-year-old_DMor_import.png | 2024-08-13 17:08 | 100K | |
| Benrinnes_1996_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 142K | |
| Benrinnes_1996_SV_Ink_#4_Collection_import.png | 2024-08-13 17:08 | 92K | |
| Benrinnes_1997_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 122K | |
| Benrinnes_1997_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 119K | |
| Benrinnes_2000_MBa_No._222_import.png | 2024-08-13 17:08 | 98K | |
| Benrinnes_2000_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2001_Stm_Cask_Selecttion_Nr._27_import.png | 2024-08-13 17:08 | 108K | |
| Benrinnes_2001_Stm__Cask_Selecttion_Nr._27_import.png | 2024-08-13 17:08 | 108K | |
| Benrinnes_2005_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 111K | |
| Benrinnes_2006_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:08 | 133K | |
| Benrinnes_2006_BA_Raw_Cask_import.png | 2024-08-13 17:08 | 240K | |
| Benrinnes_2006_CA_Authentic_Collection_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2006_DL_Old_Particular_import.png | 2024-08-13 17:08 | 117K | |
| Benrinnes_2006_ED_The_First_Editions_import.png | 2024-08-13 17:08 | 243K | |
| Benrinnes_2006_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:08 | 132K | |
| Benrinnes_2006_HL_Old_Malt_Cask_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2007_CL_Warehouse_No._1_import.png | 2024-08-13 17:08 | 241K | |
| Benrinnes_2007_HL_The_First_Editions_import.png | 2024-08-13 17:08 | 115K | |
| Benrinnes_2007_JE_import.png | 2024-08-13 17:08 | 105K | |
| Benrinnes_2007_MM_Benchmark_import.png | 2024-08-13 17:08 | 132K | |
| Benrinnes_2007_NSS_Cask_Series_019_import.png | 2024-08-13 17:08 | 158K | |
| Benrinnes_2007_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:08 | 105K | |
| Benrinnes_2008_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:08 | 109K | |
| Benrinnes_2008_MoS_import.png | 2024-08-13 17:08 | 176K | |
| Benrinnes_2008_Orc_import.png | 2024-08-13 17:08 | 87K | |
| Benrinnes_2008_SV_Vintage_Collection_import.png | 2024-08-13 17:08 | 108K | |
| Benrinnes_2008_V&M_The_Young_Masters_Edition_import.png | 2024-08-13 17:08 | 124K | |
| Benrinnes_2008_WhB_import.png | 2024-08-13 17:08 | 90K | |
| Benrinnes_2009_AD_Adelphi_Selection_import.png | 2024-08-13 17:08 | 82K | |
| Benrinnes_2009_AD__Adelphi_Selection_import.png | 2024-08-13 17:08 | 82K | |
| Benrinnes_2009_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:08 | 98K | |
| Benrinnes_2009_BNSp_The_Yellow_Edition_import.png | 2024-08-13 17:08 | 141K | |
| Benrinnes_2009_BR_Single_Cask_import.png | 2024-08-13 17:08 | 136K | |
| Benrinnes_2009_BR_import.png | 2024-08-13 17:08 | 118K | |
| Benrinnes_2009_Ch7_Monologue_import.png | 2024-08-13 17:08 | 144K | |
| Benrinnes_2009_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:08 | 94K | |
| Benrinnes_2009_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:08 | 145K | |
| Benrinnes_2009_RBTW_import.png | 2024-08-13 17:08 | 171K | |
| Benrinnes_2009_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:08 | 119K | |
| Benrinnes_2009_TDW_import.png | 2024-08-13 17:08 | 99K | |
| Benrinnes_2009_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 162K | |
| Benrinnes_2009_TWCe__Private_Cellars_Selection_import.png | 2024-08-13 17:08 | 9.8K | |
| Benrinnes_2009_TWEx_import.png | 2024-08-13 17:08 | 95K | |
| Benrinnes_2009_UWC_This_Must_be_The_Place_import.png | 2024-08-13 17:08 | 146K | |
| Benrinnes_2010_3W_import.png | 2024-08-13 17:08 | 95K | |
| Benrinnes_2010_BR_Single_Cask_import.png | 2024-08-13 17:08 | 137K | |
| Benrinnes_2010_BR_Small_Batch_import.png | 2024-08-13 17:08 | 119K | |
| Benrinnes_2010_BR_import.png | 2024-08-13 17:08 | 115K | |
| Benrinnes_2010_Cl_Claxtons_Exclusives_import.png | 2024-08-13 17:08 | 226K | |
| Benrinnes_2010_GWhL_Auld_Goonsys_import.png | 2024-08-13 17:08 | 219K | |
| Benrinnes_2010_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:08 | 130K | |
| Benrinnes_2010_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:08 | 91K | |
| Benrinnes_2010_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:08 | 155K | |
| Benrinnes_2010_MacA_import.png | 2024-08-13 17:08 | 106K | |
| Benrinnes_2010_MoM_Single_Cask_Series_import.png | 2024-08-13 17:08 | 97K | |
| Benrinnes_2010_MoM_import.png | 2024-08-13 17:08 | 95K | |
| Benrinnes_2010_PSL_Fable_Whisky_-_Chapter_Four_import.png | 2024-08-13 17:08 | 122K | |
| Benrinnes_2010_PST_import.png | 2024-08-13 17:08 | 93K | |
| Benrinnes_2010_SMWS_36.181_夏到来の予感_import.png | 2024-08-13 17:08 | 256K | |
| Benrinnes_2010_SMWS_36.191_Deli_delights_import.png | 2024-08-13 17:08 | 121K | |
| Benrinnes_2010_SMWS_36.193_Juggling_oranges_in_a_humidor_import.png | 2024-08-13 17:08 | 105K | |
| Benrinnes_2010_SM_Premium_Selection_import.png | 2024-08-13 17:08 | 135K | |
| Benrinnes_2010_SV_Art_Healing_Collection_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2010_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:08 | 100K | |
| Benrinnes_2010_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:08 | 99K | |
| Benrinnes_2010_SV___The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:08 | 98K | |
| Benrinnes_2010_SpLu_Old_School_Collection_import.png | 2024-08-13 17:08 | 170K | |
| Benrinnes_2010_WhB_Cree_import.png | 2024-08-13 17:08 | 99K | |
| Benrinnes_2011_FnTs_Private_Cask_Collection_import.png | 2024-08-13 17:08 | 107K | |
| Benrinnes_2011_Hhd_Hogshead_import.png | 2024-08-13 17:08 | 89K | |
| Benrinnes_2011_JB_Gifted_Stills_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2011_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:08 | 112K | |
| Benrinnes_2011_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:08 | 159K | |
| Benrinnes_2011_LMDW_Artist_#12_import.png | 2024-08-13 17:08 | 161K | |
| Benrinnes_2011_LotG_Rare_Cask_import.png | 2024-08-13 17:08 | 106K | |
| Benrinnes_2011_MoSp_Marble_collection_import.png | 2024-08-13 17:08 | 116K | |
| Benrinnes_2011_SV_Vintage_Collection_import.png | 2024-08-13 17:08 | 128K | |
| Benrinnes_2011_WM_Barrel_Selection_import.png | 2024-08-13 17:08 | 113K | |
| Benrinnes_2011_WhEs_import.png | 2024-08-13 17:08 | 91K | |
| Benrinnes_2012_DC_import.png | 2024-08-13 17:08 | 106K | |
| Benrinnes_2012_Hhd_import.png | 2024-08-13 17:08 | 84K | |
| Benrinnes_2012_LBDS_import.png | 2024-08-13 17:08 | 133K | |
| Benrinnes_2012_PDnl_Dolphin_43_import.png | 2024-08-13 17:08 | 148K | |
| Benrinnes_2012_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 154K | |
| Benrinnes_2012_SV__Cask_Strength_Collection_import.png | 2024-08-13 17:08 | 9.8K | |
| Benrinnes_2012_SltA_Private_Label_Collection_No.10_import.png | 2024-08-13 17:08 | 100K | |
| Benrinnes_2012_TSCL_Family_Series_import.png | 2024-08-13 17:08 | 156K | |
| Benrinnes_2012_TSCL_The_Single_Cask_import.png | 2024-08-13 17:08 | 145K | |
| Benrinnes_2012_WDS_import.png | 2024-08-13 17:08 | 106K | |
| Benrinnes_2012_WhB_Dutch_Agreement_import.png | 2024-08-13 17:08 | 126K | |
| Benrinnes_2012_vW_import.png | 2024-08-13 17:08 | 110K | |
| Benrinnes_2013_CV_import.png | 2024-08-13 17:08 | 91K | |
| Benrinnes_2013_Cl_Exploration_Series_import.png | 2024-08-13 17:08 | 112K | |
| Benrinnes_2013_Cl__Exploration_Series_import.png | 2024-08-13 17:08 | 112K | |
| Benrinnes_2013_DL_Provenance_import.png | 2024-08-13 17:08 | 235K | |
| Benrinnes_2013_DMor_import.png | 2024-08-13 17:08 | 90K | |
| Benrinnes_2013_IN2S_Release_05_import.png | 2024-08-13 17:08 | 100K | |
| Benrinnes_2013_LotG_Rare_Cask_import.png | 2024-08-13 17:08 | 238K | |
| Benrinnes_2013_TCaH_import.png | 2024-08-13 17:08 | 109K | |
| Benrinnes_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:08 | 94K | |
| Benrinnes_2014_DL_Exclusive_bottling_import.png | 2024-08-13 17:08 | 124K | |
| Benrinnes_2014_JE_import.png | 2024-08-13 17:08 | 241K | |
| Benrinnes_2014_WM_Barrel_Selection_import.png | 2024-08-13 17:08 | 111K | |
| Benrinnes_2014_WhB_Cree_import.png | 2024-08-13 17:08 | 105K | |
| Benrinnes_2015_DL_Old_Particular_import.png | 2024-08-13 17:08 | 118K | |
| Benrinnes_2015_DL__Old_Particular_import.png | 2024-08-13 17:08 | 118K | |
| Benrinnes_2016_WhB_import.png | 2024-08-13 17:08 | 155K | |
| Benrinnes_Ruthrie_The_Wanderer_...In_Bordeaux_A_Cask_Noir_Production_import.png | 2024-08-13 17:08 | 126K | |
| Benromach 10.jpg | 2024-08-13 17:08 | 1.5K | |
| Benromach 10 100 Proof.jpg | 2024-08-13 17:08 | 149K | |
| Benromach_12-year-old_Cask_Strength_import.png | 2024-08-13 17:08 | 127K | |
| Benromach_40-year-old_2022_Release_import.png | 2024-08-13 17:08 | 125K | |
| Benromach_2002_Collection_Antipodes_import.png | 2024-08-13 17:08 | 116K | |
| Benromach_2002_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:08 | 230K | |
| Benromach_2002_Single_Cask_import.png | 2024-08-13 17:08 | 117K | |
| Benromach_2002_import.png | 2024-08-13 17:08 | 124K | |
| Benromach_2003_Single_Cask_import.png | 2024-08-13 17:08 | 127K | |
| Benromach_2006_Distillery_Exclusive_import.png | 2024-08-13 17:08 | 113K | |
| Benromach_2007_Hilgering_Premium_Cask_Selection_import.png | 2024-08-13 17:08 | 132K | |
| Benromach_2009_Single_Cask_import.png | 2024-08-13 17:08 | 115K | |
| Benromach_2010_SWF_#36_import.png | 2024-08-13 17:08 | 110K | |
| Benromach_2011_Germany_Exclusive_import.png | 2024-08-13 17:08 | 129K | |
| Benromach_2011_Single_Cask_import.png | 2024-08-13 17:08 | 120K | |
| Benromach_2012_Cask_Strength_Miniature_import.png | 2024-08-13 17:08 | 124K | |
| Benromach_2012_Cask_Strength_import.png | 2024-08-13 17:08 | 116K | |
| Benromach_2012_Distillery_Exclusive_import.png | 2024-08-13 17:08 | 107K | |
| Benromach_2012_London_Bartender_Edition_import.png | 2024-08-13 17:08 | 114K | |
| Benromach_2012_Moray_Exclusive_2022_import.png | 2024-08-13 17:08 | 112K | |
| Benromach_2012_Single_Cask_import.png | 2024-08-13 17:08 | 132K | |
| Benromach_2012_Single_Sherry_Cask_import.png | 2024-08-13 17:08 | 101K | |
| Benromach_2013_Cask_Strength_import.png | 2024-08-13 17:08 | 122K | |
| Benromach_2013_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:08 | 118K | |
| Benromach_2013_Single_Cask_import.png | 2024-08-13 17:08 | 203K | |
| Bergslagens_10-year-old_Ber_Tanngrisnir_&_Tanngnjóstr_-The_Norse_Saga_II_import.png | 2024-08-13 17:09 | 138K | |
| Bergslagens_11-year-old_Ber_Nidhöggr_-_The_Norse_Saga_II_import.png | 2024-08-13 17:09 | 162K | |
| Bergslagens_Fenrir_Ber_Väsen_II_import.png | 2024-08-13 17:09 | 143K | |
| Bergslagens_Ratatoskr_2012_Ber_Väsen_II_import.png | 2024-08-13 17:09 | 146K | |
| Bergslagens_Särimner_Ber_The_Norse_Saga_import.png | 2024-08-13 17:09 | 129K | |
| Bergslagens_Santa_-22_Ber_import.png | 2024-08-13 17:09 | 137K | |
| Bergslagens_Santa_-23_Ber_import.png | 2024-08-13 17:09 | 137K | |
| Bergslagens_Sleipner_Ber_The_Norse_Saga_import.png | 2024-08-13 17:09 | 147K | |
| Bergslagens_Tanngrisnir_&_Tanngnjóstr_Ber__Väsen_II_import.png | 2024-08-13 17:09 | 9.8K | |
| Berlin_Distillery_05-year-old_Extrafass_#3_import.png | 2024-08-13 17:09 | 167K | |
| Bernheim_Original_07-year-old_Kentucky_Straight_Wheat_Whiskey_import.png | 2024-08-13 17:09 | 171K | |
| Best_Drinking_Friends_2017_IW_The_Friends_Collection_import.png | 2024-08-13 17:09 | 121K | |
| Beverbach_Tri-Cask_Single_malt_german_whisky_import.png | 2024-08-13 17:09 | 141K | |
| Bhakta_2013__Vintage_Bourbon_import.png | 2024-08-13 17:09 | 9.8K | |
| Big_Cocoa_08-year-old_import.png | 2024-08-13 17:09 | 137K | |
| Big_Peat_75th_Anniversary_DL_import.png | 2024-08-13 17:09 | 178K | |
| Big_Peat_Anniversary_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 169K | |
| Big_Peat_Beach_BBQ_Edition_Feis_Ile_2022_DL_Limited_Edition_import.png | 2024-08-13 17:09 | 151K | |
| Big_Peat_Christmas_Edition_DL_import.png | 2024-08-13 17:09 | 161K | |
| Big_Peat_Finest_2016_Old_Particular_import.png | 2024-08-13 17:09 | 240K | |
| Big_Peat_Global_Travellers_Edition_DL_Small_Batch_Release_import.png | 2024-08-13 17:09 | 163K | |
| Big_Peat_Sherry_Storm_Edition_DL_import.png | 2024-08-13 17:09 | 179K | |
| Big_Peat_Support_our_friends_in_Ukraine_DL_import.png | 2024-08-13 17:09 | 164K | |
| Big_Peat_The_2nd_Gall_&_Gall_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 172K | |
| Big_Peat_The_49th_Parallel_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 183K | |
| Big_Peat_The_2022_Vietnam_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 180K | |
| Big_Peat_The_Asaya_Edition_#1_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 196K | |
| Big_Peat_The_Bannermans_Bar_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 178K | |
| Big_Peat_The_Bar_Monroe_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 175K | |
| Big_Peat_The_Belarus_Edition_#2_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 190K | |
| Big_Peat_The_British_Columbia_1st_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 191K | |
| Big_Peat_The_Coburg_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 151K | |
| Big_Peat_The_Dailyshot_Chuseok_Edition_#1_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 184K | |
| Big_Peat_The_DrankDozijn_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 165K | |
| Big_Peat_The_East-Swiss_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 186K | |
| Big_Peat_The_Edinburgh_Edition_#2_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 171K | |
| Big_Peat_The_Kitakyushu_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 186K | |
| Big_Peat_The_Korean_Baseball_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 186K | |
| Big_Peat_The_Liege_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 157K | |
| Big_Peat_The_Mizunara_Edition_10-year-old_DL_Douglas_Laing’s_75th_anniversary_import.png | 2024-08-13 17:09 | 149K | |
| Big_Peat_The_Oni_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 160K | |
| Big_Peat_The_Onsen_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 179K | |
| Big_Peat_The_Peat_of_Art_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 168K | |
| Big_Peat_The_Rock_Edition_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 148K | |
| Big_Peat_The_Rugby_Edition_10-year-old_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 166K | |
| Big_Peat_The_Sakura_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 180K | |
| Big_Peat_The_Skateboard_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 202K | |
| Big_Peat_The_Smokehouse_Edition_DL_The_Smokehouse_Edition_import.png | 2024-08-13 17:09 | 134K | |
| Big_Peat_The_Tyrol_Edition_DL_Big_Peats_World_Tour_import.png | 2024-08-13 17:09 | 164K | |
| Big_Peat_Tyndrum_Gold_Edition_#2_DL_Limited_Edition_import.png | 2024-08-13 17:09 | 169K | |
| Big_Peat_Zeria_Edition_DL_Limited_Edition_import.png | 2024-08-13 17:09 | 195K | |
| Bimber_04-year-old_import.png | 2024-08-13 17:09 | 170K | |
| Bimber_2016_Poland_Edition_import.png | 2024-08-13 17:09 | 89K | |
| Bimber_2017_Single_Cask_Bottling_import.png | 2024-08-13 17:09 | 92K | |
| Bimber_2017_Single_Cask_series_import.png | 2024-08-13 17:09 | 100K | |
| Bimber_2017_import.png | 2024-08-13 17:09 | 71K | |
| Bimber_2018_CDuS_import.png | 2024-08-13 17:09 | 124K | |
| Bimber_2018_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:09 | 91K | |
| Bimber_2018_Small_Batch_import.png | 2024-08-13 17:09 | 83K | |
| Bimber_2018_import.png | 2024-08-13 17:09 | 96K | |
| Bimber_2019_Bulgaria_Edition_import.png | 2024-08-13 17:09 | 88K | |
| Bimber_2019_Cask_Reserve_import.png | 2024-08-13 17:09 | 188K | |
| Bimber_2019_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 100K | |
| Bimber_2019_Private_Cask_Reserve_import.png | 2024-08-13 17:09 | 80K | |
| Bimber_2019_import.png | 2024-08-13 17:09 | 82K | |
| Bimber_2019_the_1st_Peated_import.png | 2024-08-13 17:09 | 71K | |
| Bimber_2020_Private_Cask_Reserve_import.png | 2024-08-13 17:09 | 89K | |
| Bimber_2020_Private_Cask_import.png | 2024-08-13 17:09 | 80K | |
| Bimber_2021_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 87K | |
| Bimber_2022_import.png | 2024-08-13 17:09 | 91K | |
| Bimber_Bond_Street_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 86K | |
| Bimber_Camden_Town_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 85K | |
| Bimber_Canary_Wharf_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 80K | |
| Bimber_Christmas_Whisky_Special_import.png | 2024-08-13 17:09 | 93K | |
| Bimber_Covent_Garden_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 207K | |
| Bimber_Dunphail_Distillery_Commemorative_Release_import.png | 2024-08-13 17:09 | 89K | |
| Bimber_Ex-Bourbon_-_Peated_Whisky_Small_Batch_import.png | 2024-08-13 17:09 | 178K | |
| Bimber_Ex-Bourbon_Oak_Casks_Small_Batch_import.png | 2024-08-13 17:09 | 82K | |
| Bimber_Festival_Edition_2022_import.png | 2024-08-13 17:09 | 96K | |
| Bimber_Festival_Edition_2023_import.png | 2024-08-13 17:09 | 81K | |
| Bimber_Germany_Edition_2023_Peated_Single_Malt_London_Whisky_import.png | 2024-08-13 17:09 | 93K | |
| Bimber_Germany_Edition_2023_Single_Malt_London_Whisky_import.png | 2024-08-13 17:09 | 84K | |
| Bimber_Green_Park_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 111K | |
| Bimber_Klub_Edition_Release_No._3_import.png | 2024-08-13 17:09 | 87K | |
| Bimber_Klub_Edition_Release_No._4_import.png | 2024-08-13 17:09 | 92K | |
| Bimber_Legacy_Collection_2023_import.png | 2024-08-13 17:09 | 86K | |
| Bimber_Leicester_Square_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 89K | |
| Bimber_London_Single_Malt_Whisky_AbWh_The_Rare_Casks_import.png | 2024-08-13 17:09 | 107K | |
| Bimber_London_Single_Malt_Whisky_Fortnum_&_Mason_import.png | 2024-08-13 17:09 | 85K | |
| Bimber_Notting_Hill_Gate_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 84K | |
| Bimber_Piccadilly_Circus_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 83K | |
| Bimber_Regents_Park_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 89K | |
| Bimber_Santas_Edition_2023_Special_Limited_Edition_import.png | 2024-08-13 17:09 | 95K | |
| Bimber_Single_Malt_London_Whisky_Southport_Winter_Whisky_Festival_2022_import.png | 2024-08-13 17:09 | 88K | |
| Bimber_Single_Malt_London_Whisky_import.png | 2024-08-13 17:09 | 85K | |
| Bimber_The_Coronation_of_King_Charles_III_Edition_import.png | 2024-08-13 17:09 | 95K | |
| Bimber_The_Four_Elements_Air_import.png | 2024-08-13 17:09 | 77K | |
| Bimber_Tottenham_Court_Road_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 79K | |
| Bimber_Tower_Hill_The_Spirit_of_the_Underground_import.png | 2024-08-13 17:09 | 94K | |
| Bivrost_Alfheim_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 171K | |
| Bivrost_Asgard_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 167K | |
| Bivrost_Helheim_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 137K | |
| Bivrost_Vanaheim_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 173K | |
| Bivrost_Vanaheim__Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 9.8K | |
| Black Bottle.jpg | 2024-08-13 17:09 | 249K | |
| Black Grouse.jpg | 2024-08-13 17:09 | 230K | |
| Black Maple Hill.jpg | 2024-08-13 17:09 | 28K | |
| Black_Bottle_Andean_Oak_The_Alchemy_Series_import.png | 2024-08-13 17:09 | 139K | |
| Black_Bottle_Blended_Scotch_Whisky_import.png | 2024-08-13 17:09 | 9.8K | |
| Black_Bottle_Captains_Cask_The_Alchemy_Series_import.png | 2024-08-13 17:09 | 133K | |
| Black_Bottle_Smoke_&_Dagger_The_Alchemy_Series_import.png | 2024-08-13 17:09 | 130K | |
| Black_Bull_18-year-old_DT_Nick_Falco_Limited_Edition_import.png | 2024-08-13 17:09 | 120K | |
| Black_Bull_Kyloe_DT_import.png | 2024-08-13 17:09 | 122K | |
| Black_Bull_Kyloe_Peated_DT_import.png | 2024-08-13 17:09 | 126K | |
| Black_Button_2016_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:09 | 153K | |
| Black_Dirt_05-year-old_Single_Barrel_Bourbon_import.png | 2024-08-13 17:09 | 127K | |
| Black_Forest_08-year-old_vF_Triple_Wood_import.png | 2024-08-13 17:09 | 140K | |
| Black_Forest_2016_Sonderedition_2022_import.png | 2024-08-13 17:09 | 160K | |
| Black_Friday_15-year-old_ElD_2023_Edition_import.png | 2024-08-13 17:09 | 90K | |
| Black_Friday_16-year-old_ElD_2022_Edition_import.png | 2024-08-13 17:09 | 94K | |
| Black_Rock_(IRL)_05-year-old_IW_Batch_9_import.png | 2024-08-13 17:09 | 105K | |
| Black_Snake_Third_Venom_import.png | 2024-08-13 17:09 | 90K | |
| Blackened_X_Rabbit_Hole_Masters_of_Whiskey_Series_import.png | 2024-08-13 17:09 | 109K | |
| Blacks-Kinsale-whiskey.jpg | 2024-08-13 17:09 | 180K | |
| Blacks_08-year-old_Ace_of_Haze_import.png | 2024-08-13 17:09 | 127K | |
| Blacks_08-year-old_Blacks_Brewery_&_Distillery_import.png | 2024-08-13 17:09 | 119K | |
| Blacks_08-year-old_import.png | 2024-08-13 17:09 | 124K | |
| Blacks_Citrus_Galaxy_import.png | 2024-08-13 17:09 | 125K | |
| Blackwater_05-year-old_Velvet_Cap_import.png | 2024-08-13 17:09 | 227K | |
| Blackwater_Dirtgrain_Irish_Whisky_The_Manifesto_Release_-_Mash_Bill_#08_import.png | 2024-08-13 17:09 | 189K | |
| Blackwater_Dirtgrain_Irish_Whisky_The_Manifesto_Release_-_Mash_Bill_#15_import.png | 2024-08-13 17:09 | 178K | |
| Blackwater_Dirtgrain_Irish_Whisky_The_Manifesto_Release_-_Mash_Bill_#93_import.png | 2024-08-13 17:09 | 185K | |
| Blackwater_Dirtgrain_Irish_Whisky_The_Manifesto_Release_-_Mashbill_#38_import.png | 2024-08-13 17:09 | 174K | |
| Blackwater_Velvet_Cap_BLDI_Irish_Whiskey_import.png | 2024-08-13 17:09 | 115K | |
| Blackwater_Velvet_Cap_Irish_Single_Malt_Peated_import.png | 2024-08-13 17:09 | 117K | |
| Bladnoch_11-year-old_2022_Release_import.png | 2024-08-13 17:09 | 147K | |
| Bladnoch_11-year-old_2023_Release_import.png | 2024-08-13 17:09 | 142K | |
| Bladnoch_14-year-old_2022_Release_import.png | 2024-08-13 17:09 | 151K | |
| Bladnoch_14-year-old_2023_Release_import.png | 2024-08-13 17:09 | 180K | |
| Bladnoch_19-year-old_2022_Release_import.png | 2024-08-13 17:09 | 153K | |
| Bladnoch_30-year-old_Rare_Release_2022_import.png | 2024-08-13 17:09 | 213K | |
| Bladnoch_1990_WSP_Special_Edition_import.png | 2024-08-13 17:09 | 283K | |
| Bladnoch_1991_MoS_Rare_Casks_Range_import.png | 2024-08-13 17:09 | 157K | |
| Bladnoch_2001_Single_Cask_import.png | 2024-08-13 17:09 | 169K | |
| Bladnoch_2002_Single_Cask_import.png | 2024-08-13 17:09 | 162K | |
| Bladnoch_2005_Single_Cask_import.png | 2024-08-13 17:09 | 169K | |
| Bladnoch_2006_Single_Cask_import.png | 2024-08-13 17:09 | 169K | |
| Bladnoch_2007_Select_Cask_-_Exclusive_Release_import.png | 2024-08-13 17:09 | 188K | |
| Bladnoch_2007_Single_Cask_import.png | 2024-08-13 17:09 | 167K | |
| Bladnoch_2007_Vibrant_Stills_import.png | 2024-08-13 17:09 | 211K | |
| Bladnoch_2008_Single_Cask_import.png | 2024-08-13 17:09 | 195K | |
| Bladnoch_2008_The_Kings_Cask_import.png | 2024-08-13 17:09 | 186K | |
| Bladnoch_2009_Select_Cask_import.png | 2024-08-13 17:09 | 168K | |
| Bladnoch_2009_Single_Cask_import.png | 2024-08-13 17:09 | 184K | |
| Bladnoch_2017_Select_Cask_import.png | 2024-08-13 17:09 | 192K | |
| Bladnoch_2017__Select_Cask_import.png | 2024-08-13 17:09 | 9.8K | |
| Bladnoch_Alinta_Classic_Collection_import.png | 2024-08-13 17:09 | 160K | |
| Bladnoch_Alinta_Reserve_Peated_Collection_import.png | 2024-08-13 17:09 | 194K | |
| Bladnoch_Iteration_II_-_The_Spirit_The_Dragon_Series_import.png | 2024-08-13 17:09 | 182K | |
| Bladnoch_Iteration_IV_-_The_Ageing_The_Dragon_Series_import.png | 2024-08-13 17:09 | 204K | |
| Bladnoch_Iteration_I_-_The_Field_The_Dragon_Series_import.png | 2024-08-13 17:09 | 124K | |
| Bladnoch_Kirkcowan_import.png | 2024-08-13 17:09 | 178K | |
| Bladnoch_Peated_Spirit_Drink_Exclusive_Release_import.png | 2024-08-13 17:09 | 188K | |
| Bladnoch_Peated_Spirit_Drink__Exclusive_Release_import.png | 2024-08-13 17:09 | 9.8K | |
| Bladnoch_Talia_Rare_Release_import.png | 2024-08-13 17:09 | 183K | |
| Bladnoch_Waterfall_Edition_2022_import.png | 2024-08-13 17:09 | 206K | |
| Bladnoch_Waterfall_Edition_2023_import.png | 2024-08-13 17:09 | 194K | |
| Blair_Athol_08-year-old_DL_The_Speakeasy_import.png | 2024-08-13 17:09 | 115K | |
| Blair_Athol_11-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 91K | |
| Blair_Athol_11-year-old_Handfilled_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 108K | |
| Blair_Athol_11-year-old__Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 9.8K | |
| Blair_Athol_12-year-old_BNSp_Whisky_of_Voodoo_import.png | 2024-08-13 17:09 | 119K | |
| Blair_Athol_12-year-old_ChWh_La_Nouvelle_Vague_import.png | 2024-08-13 17:09 | 127K | |
| Blair_Athol_12-year-old_DL_Italian_Car_Series_import.png | 2024-08-13 17:09 | 129K | |
| Blair_Athol_12-year-old_PST_import.png | 2024-08-13 17:09 | 85K | |
| Blair_Athol_13-year-old_DL_Private_Stock_import.png | 2024-08-13 17:09 | 144K | |
| Blair_Athol_13-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 97K | |
| Blair_Athol_14-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:09 | 106K | |
| Blair_Athol_14-year-old_GWM_The_Goldfinch_-_Wine_Series_import.png | 2024-08-13 17:09 | 127K | |
| Blair_Athol_18-year-old_AtB_Darkness_import.png | 2024-08-13 17:09 | 143K | |
| Blair_Athol_1989_TWBl_No._026_import.png | 2024-08-13 17:09 | 120K | |
| Blair_Athol_1993_DL_Celebrating_75th_Anniversary_import.png | 2024-08-13 17:09 | 136K | |
| Blair_Athol_2006_NSS_Cask_Series_021_import.png | 2024-08-13 17:09 | 169K | |
| Blair_Athol_2007_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:09 | 171K | |
| Blair_Athol_2008_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:09 | 128K | |
| Blair_Athol_2008_BD_import.png | 2024-08-13 17:09 | 156K | |
| Blair_Athol_2008_BR_Single_Cask_import.png | 2024-08-13 17:09 | 122K | |
| Blair_Athol_2008_BR_import.png | 2024-08-13 17:09 | 130K | |
| Blair_Athol_2008_CWCL_Watt_Whisky_import.png | 2024-08-13 17:09 | 87K | |
| Blair_Athol_2008_SMDr_Single_Cask_import.png | 2024-08-13 17:09 | 101K | |
| Blair_Athol_2008_TSCL_Family_Series_import.png | 2024-08-13 17:09 | 160K | |
| Blair_Athol_2008_TSCL_The_Single_Cask_import.png | 2024-08-13 17:09 | 155K | |
| Blair_Athol_2008_WDS_import.png | 2024-08-13 17:09 | 121K | |
| Blair_Athol_2009_BR_Single_Cask_import.png | 2024-08-13 17:09 | 252K | |
| Blair_Athol_2009_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:09 | 120K | |
| Blair_Athol_2009_BiM_Allt_Dour_I_import.png | 2024-08-13 17:09 | 105K | |
| Blair_Athol_2009_CA_Original_Collection_import.png | 2024-08-13 17:09 | 142K | |
| Blair_Athol_2009_CA_Wood_Range_-_Sherry_Cask_import.png | 2024-08-13 17:09 | 117K | |
| Blair_Athol_2009_CQ_Happy_Loner_#1_-_Daydreaming_Café_import.png | 2024-08-13 17:09 | 117K | |
| Blair_Athol_2009_Ch7_Monologue_import.png | 2024-08-13 17:09 | 154K | |
| Blair_Athol_2009_DL_Old_Particular_import.png | 2024-08-13 17:09 | 102K | |
| Blair_Athol_2009_DR_Cask_Collection_import.png | 2024-08-13 17:09 | 76K | |
| Blair_Athol_2009_DR__Cask_Collection_import.png | 2024-08-13 17:09 | 9.8K | |
| Blair_Athol_2009_DST_Syrah_Edition_import.png | 2024-08-13 17:09 | 118K | |
| Blair_Athol_2009_DrC_W&M_2023_-_Festival_Bottling_import.png | 2024-08-13 17:09 | 126K | |
| Blair_Athol_2009_GWhL_Auld_Goonsys_import.png | 2024-08-13 17:09 | 101K | |
| Blair_Athol_2009_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:09 | 276K | |
| Blair_Athol_2009_NSpS_Modernism_import.png | 2024-08-13 17:09 | 118K | |
| Blair_Athol_2009_SMWS_68.96_Abundantly_exuded_charm_import.png | 2024-08-13 17:09 | 108K | |
| Blair_Athol_2009_TCaH_Crazy_Coos_Collection_import.png | 2024-08-13 17:09 | 100K | |
| Blair_Athol_2009_TFM_Flowers_import.png | 2024-08-13 17:09 | 101K | |
| Blair_Athol_2009_TWA_Cocktail_Gallery_Exclusive_import.png | 2024-08-13 17:09 | 129K | |
| Blair_Athol_2009_TWA_import.png | 2024-08-13 17:09 | 108K | |
| Blair_Athol_2009_VM_The_Coopers_Choice_import.png | 2024-08-13 17:09 | 270K | |
| Blair_Athol_2010_BR_Single_Cask_import.png | 2024-08-13 17:09 | 137K | |
| Blair_Athol_2010_BiM_Allt_Dour_II_import.png | 2024-08-13 17:09 | 109K | |
| Blair_Athol_2010_HL_Hepburns_Choice_import.png | 2024-08-13 17:09 | 232K | |
| Blair_Athol_2010_LsD_Distillers_Art_import.png | 2024-08-13 17:09 | 111K | |
| Blair_Athol_2010_TCW_Tales_of_Allt_Dour_import.png | 2024-08-13 17:09 | 150K | |
| Blair_Athol_2011_DL_Old_Particular_import.png | 2024-08-13 17:09 | 111K | |
| Blair_Athol_2011_DL_Provenance_import.png | 2024-08-13 17:09 | 98K | |
| Blair_Athol_2011_DMor_import.png | 2024-08-13 17:09 | 98K | |
| Blair_Athol_2011_ED_The_First_Editions_import.png | 2024-08-13 17:09 | 109K | |
| Blair_Athol_2011_HL_McCraes_import.png | 2024-08-13 17:09 | 218K | |
| Blair_Athol_2011_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:09 | 118K | |
| Blair_Athol_2011_HoMc_The_Vintage_Collection_import.png | 2024-08-13 17:09 | 137K | |
| Blair_Athol_2011_JE_Small_Batch_import.png | 2024-08-13 17:09 | 114K | |
| Blair_Athol_2011_JE_import.png | 2024-08-13 17:09 | 103K | |
| Blair_Athol_2011_MoS_Christmas_Bottling_2023_import.png | 2024-08-13 17:09 | 195K | |
| Blair_Athol_2011_PSL_Fable_Whisky_-_Chapter_Six_import.png | 2024-08-13 17:09 | 127K | |
| Blair_Athol_2011_PST_import.png | 2024-08-13 17:09 | 103K | |
| Blair_Athol_2011_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 109K | |
| Blair_Athol_2011_SV___The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:09 | 97K | |
| Blair_Athol_2011_WCR_Club_filling_import.png | 2024-08-13 17:09 | 135K | |
| Blair_Athol_2012_BR_Small_Batch_import.png | 2024-08-13 17:09 | 137K | |
| Blair_Athol_2012_HL_Hepburns_Choice_import.png | 2024-08-13 17:09 | 111K | |
| Blair_Athol_2012_LotG_Rare_Cask_import.png | 2024-08-13 17:09 | 108K | |
| Blair_Athol_2013_Cl_Exploration_Series_import.png | 2024-08-13 17:09 | 116K | |
| Blair_Athol_2013_Cl_Warehouse_No._1_import.png | 2024-08-13 17:09 | 212K | |
| Blair_Athol_2013_DL_Provenance_import.png | 2024-08-13 17:09 | 249K | |
| Blair_Athol_2013_FnTs_Private_Cask_Collection_import.png | 2024-08-13 17:09 | 106K | |
| Blair_Athol_2013_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:09 | 154K | |
| Blair_Athol_2013_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:09 | 150K | |
| Blair_Athol_2014_LotG_import.png | 2024-08-13 17:09 | 240K | |
| Blair_Athol_2014_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:09 | 110K | |
| Blair_Athol_2014_TCaH_Tasting_Tour_import.png | 2024-08-13 17:09 | 99K | |
| Blair_Athol_2014_TWCe_Private_Cellars_Selection_Series_4_import.png | 2024-08-13 17:09 | 156K | |
| Blair_Athol_2015_Cl_Exploration_Series_import.png | 2024-08-13 17:09 | 236K | |
| Blair_Athol_2015_Cl_Warehouse_No._8_import.png | 2024-08-13 17:09 | 273K | |
| Blair_Athol_2015_ICC_Finest_Wine_Cask_Series_import.png | 2024-08-13 17:09 | 64K | |
| Blair_Athol_2015_RbTW_Kinnaird_Burn_import.png | 2024-08-13 17:09 | 110K | |
| Blair_Athol_2015_RbTW__Kinnaird_Burn_import.png | 2024-08-13 17:09 | 110K | |
| Blair_Athol_2015_RhWh_M&M_Rheingau_Edition_import.png | 2024-08-13 17:09 | 130K | |
| Blair_Athol_2016_Drtm_The_Drams_Weve_Saved_import.png | 2024-08-13 17:09 | 91K | |
| Blair_Athol_ResistanceUA_WUA_import.png | 2024-08-13 17:09 | 113K | |
| Blantons_Gold_Edition_import.png | 2024-08-13 17:09 | 185K | |
| Blantons_Single_Barrel_Bourbon_Limited_Edition_2022_Collection_import.png | 2024-08-13 17:09 | 133K | |
| Blantons_Single_Barrel_Gold_Edition_import.png | 2024-08-13 17:09 | 156K | |
| Blantons_Single_Barrel_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 151K | |
| Blantons_Single_Barrel_River_Edition_import.png | 2024-08-13 17:09 | 179K | |
| Blantons_Single_Barrel_Select_import.png | 2024-08-13 17:09 | 188K | |
| Blantons_Single_Barrel_Special_Reserve_import.png | 2024-08-13 17:09 | 188K | |
| Blantons_Single_Barrel_import.png | 2024-08-13 17:09 | 140K | |
| Blantons_Straight_From_The_Barrel_import.png | 2024-08-13 17:09 | 160K | |
| Blantons_The_Original_Single_Barrel_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 181K | |
| Blantons_The_Original_import.png | 2024-08-13 17:09 | 129K | |
| Blaue_Maus_15-year-old_Jubiläums-Abfüllung_import.png | 2024-08-13 17:09 | 272K | |
| Blaue_Maus_30-year-old_Jubiläumsabfüllung_import.png | 2024-08-13 17:09 | 304K | |
| Blaue_Maus_35-year-old_Jubiläumsabfüllung_import.png | 2024-08-13 17:09 | 293K | |
| Blend_Scotch_Whisky_Synthesis_CB_Collection_Antipodes_import.png | 2024-08-13 17:09 | 127K | |
| Blend_Scotch_Whisky_The_Fool_NSS_Tarot_import.png | 2024-08-13 17:09 | 114K | |
| Blend_of_Islay_Malt_12-year-old_BW_A_Dream_of_Scotland_-_Lagason_import.png | 2024-08-13 17:09 | 119K | |
| Blend_of_Islay_Malt_Black_Madonna_Orchid_JW_World_of_Orchids_import.png | 2024-08-13 17:09 | 103K | |
| Blend_of_Islay_Malt_Dramfools_Jim_McEwan_Master_Blender_Edition_import.png | 2024-08-13 17:09 | 124K | |
| Blended_Grain_#1_Batch_3_TBWC_10th_Birthday_import.png | 2024-08-13 17:09 | 157K | |
| Blended_Grain_1987_3W_A_Grainy_Hog_import.png | 2024-08-13 17:09 | 93K | |
| Blended_Grain_1987_82NC_Creatures_of_Cask_Strength_import.png | 2024-08-13 17:09 | 108K | |
| Blended_Grain_1987_IN2S_import.png | 2024-08-13 17:09 | 103K | |
| Blended_Grain_A-side_CB_import.png | 2024-08-13 17:09 | 102K | |
| Blended_Grain_BGXX_MSWD_Man_with_the_Hat_import.png | 2024-08-13 17:09 | 110K | |
| Blended_Grain_Scotch_Whisky_30-Year-Old_TBWC_Core_Range_import.png | 2024-08-13 17:09 | 240K | |
| Blended_Grain_Scotch_Whisky_1987_Hhd_import.png | 2024-08-13 17:09 | 89K | |
| Blended_Highland_Malt_2013_TCaH_import.png | 2024-08-13 17:09 | 233K | |
| Blended_Islay_Malt_Blended_Malt_Scotch_Whisky_import.png | 2024-08-13 17:09 | 108K | |
| Blended_Malt_#3_Batch_3_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:09 | 288K | |
| Blended_Malt_07-year-old_NSS_Limited_Edition_No._18_import.png | 2024-08-13 17:09 | 159K | |
| Blended_Malt_20-year-old_BNCA_import.png | 2024-08-13 17:09 | 113K | |
| Blended_Malt_26-year-old_BW_The_Fine_Art_of_Whisky_import.png | 2024-08-13 17:09 | 296K | |
| Blended_Malt_2012_WhB_import.png | 2024-08-13 17:09 | 88K | |
| Blended_Malt_2013_ANHA_Beasty_Bessy_import.png | 2024-08-13 17:09 | 117K | |
| Blended_Malt_Auld_Lang_Syne_Edition_II_import.png | 2024-08-13 17:09 | 130K | |
| Blended_Malt_Belgian_Whisky_New_Oak_&_Sherry_Cask_Legendary_Cars_import.png | 2024-08-13 17:09 | 123K | |
| Blended_Malt_Scotch_Whisky_08-year-old_PST_Thompson_Bros._X_Campervan_import.png | 2024-08-13 17:09 | 113K | |
| Blended_Malt_Scotch_Whisky_12-year-old_CRN57°_Step_One_import.png | 2024-08-13 17:09 | 101K | |
| Blended_Malt_Scotch_Whisky_17-year-old_DeDr_Notable_Age_Statements_import.png | 2024-08-13 17:09 | 103K | |
| Blended_Malt_Scotch_Whisky_30-year-old_DeDr_Notable_Age_Statements_import.png | 2024-08-13 17:09 | 105K | |
| Blended_Malt_Scotch_Whisky_1979_BR_Exceptional_Casks_import.png | 2024-08-13 17:09 | 144K | |
| Blended_Malt_Scotch_Whisky_1988_SpSp_import.png | 2024-08-13 17:09 | 93K | |
| Blended_Malt_Scotch_Whisky_1989_MM_Mission_Gold_import.png | 2024-08-13 17:09 | 105K | |
| Blended_Malt_Scotch_Whisky_1994_TWf_Silent_Third_Kyoto_import.png | 2024-08-13 17:09 | 124K | |
| Blended_Malt_Scotch_Whisky_1994_TWf_The_Cat_Gallery_import.png | 2024-08-13 17:09 | 195K | |
| Blended_Malt_Scotch_Whisky_1999_BR_import.png | 2024-08-13 17:09 | 113K | |
| Blended_Malt_Scotch_Whisky_1999_EVWC_import.png | 2024-08-13 17:09 | 214K | |
| Blended_Malt_Scotch_Whisky_2001_3R_import.png | 2024-08-13 17:09 | 110K | |
| Blended_Malt_Scotch_Whisky_2001_BiM_Ochnagur_import.png | 2024-08-13 17:09 | 90K | |
| Blended_Malt_Scotch_Whisky_2001_NSS_import.png | 2024-08-13 17:09 | 198K | |
| Blended_Malt_Scotch_Whisky_2001_TWA_Cocktail_Gallery_Exclusive_import.png | 2024-08-13 17:09 | 112K | |
| Blended_Malt_Scotch_Whisky_2005_MM_Coastal_Embrace_-_The_Vatting_import.png | 2024-08-13 17:09 | 127K | |
| Blended_Malt_Scotch_Whisky_2009_TWCC_import.png | 2024-08-13 17:09 | 117K | |
| Blended_Malt_Scotch_Whisky_2009_WDS_The_Bastard_import.png | 2024-08-13 17:09 | 105K | |
| Blended_Malt_Scotch_Whisky_2010_PST_import.png | 2024-08-13 17:09 | 91K | |
| Blended_Malt_Scotch_Whisky_2010_TWC_Campbeltown_import.png | 2024-08-13 17:09 | 103K | |
| Blended_Malt_Scotch_Whisky_2010_TWC__Campbeltown_import.png | 2024-08-13 17:09 | 9.8K | |
| Blended_Malt_Scotch_Whisky_2010_WT_Survivor_import.png | 2024-08-13 17:09 | 102K | |
| Blended_Malt_Scotch_Whisky_2011_Smokus_Fruticosus_SMWS_import.png | 2024-08-13 17:09 | 109K | |
| Blended_Malt_Scotch_Whisky_2013_Cl_Exploration_Series_import.png | 2024-08-13 17:09 | 279K | |
| Blended_Malt_Scotch_Whisky_2013_Cl__Exploration_Series_import.png | 2024-08-13 17:09 | 279K | |
| Blended_Malt_Scotch_Whisky_2013_PST_import.png | 2024-08-13 17:09 | 116K | |
| Blended_Malt_Scotch_Whisky_2013_SMWS_Scarlett_Marzipan_import.png | 2024-08-13 17:09 | 119K | |
| Blended_Malt_Scotch_Whisky_2014_PST_SRV5_-_Extra_Special_2022_Glass_Shortage_Edition_import.png | 2024-08-13 17:09 | 164K | |
| Blended_Malt_Scotch_Whisky_2014_PST_SRV5_import.png | 2024-08-13 17:09 | 105K | |
| Blended_Malt_Scotch_Whisky_2017_TcaH_Coast_to_Coast_import.png | 2024-08-13 17:09 | 116K | |
| Blended_Malt_Scotch_Whisky_2017_TcaH__Coast_to_Coast_import.png | 2024-08-13 17:09 | 116K | |
| Blended_Malt_Scotch_Whisky_NAS_Ch7_Prologue_import.png | 2024-08-13 17:09 | 144K | |
| Blended_Malt_Scotch_Whisky_The_One_I_Love_CB_import.png | 2024-08-13 17:09 | 119K | |
| Blended_Malt_Scotch_Whisky_Unshaken_DL_Scyfion_Choice_import.png | 2024-08-13 17:09 | 91K | |
| Blended_Malt_Whisky_16-year-old_MNC_Sweet_Dreams_Tobacco_import.png | 2024-08-13 17:09 | 104K | |
| Blended_Malt_Whisky_2013_WFP_Call_of_the_Highlands_import.png | 2024-08-13 17:09 | 122K | |
| Blended_Malt_Whisky_Auld_Lang_Syne_import.png | 2024-08-13 17:09 | 127K | |
| Blended_Malt_Whisky_Edition_3_TWLi_The_Scozzie_import.png | 2024-08-13 17:09 | 135K | |
| Blended_Malt_Whisky_Fallen_Angels_whic_Caramel_Spice_Surprise_import.png | 2024-08-13 17:09 | 110K | |
| Blended_Malt_Whisky_Peat_Break_Vol.2_Wx_Fassmeister_Edition_import.png | 2024-08-13 17:09 | 172K | |
| Blended_Malt_Whisky_Super_Port_2_MNC_import.png | 2024-08-13 17:09 | 93K | |
| Blended_Malt_Whisky_Super_Port_MNC_import.png | 2024-08-13 17:09 | 86K | |
| Blended_Malt_Whisky_Talbeg_12-year-old_A_Dream_of_Scotland_import.png | 2024-08-13 17:09 | 152K | |
| Blended_Malt_Whisky_The_Phoenix_Charity_Bottling_import.png | 2024-08-13 17:09 | 130K | |
| Blended_Scotch_Whisky_#3_TBWC_Batch_2_import.png | 2024-08-13 17:09 | 123K | |
| Blended_Scotch_Whisky_05-year-old_CWCL_Watt_Whisky_import.png | 2024-08-13 17:09 | 99K | |
| Blended_Scotch_Whisky_06-year-old_PST_A_Wonderful_Serendipity_import.png | 2024-08-13 17:09 | 98K | |
| Blended_Scotch_Whisky_06-year-old_PST__A_Wonderful_Serendipity_import.png | 2024-08-13 17:09 | 9.8K | |
| Blended_Scotch_Whisky_06-year-old_PST_import.png | 2024-08-13 17:09 | 104K | |
| Blended_Scotch_Whisky_08-year-old_MoM_Burns_Night_Blend_import.png | 2024-08-13 17:09 | 99K | |
| Blended_Scotch_Whisky_08-year-old_MoM__Burns_Night_Blend_import.png | 2024-08-13 17:09 | 9.8K | |
| Blended_Scotch_Whisky_12-year-old_SCC_The_Independent_Selection_import.png | 2024-08-13 17:09 | 100K | |
| Blended_Scotch_Whisky_12-year-old_SCC__The_Independent_Selection_import.png | 2024-08-13 17:09 | 100K | |
| Blended_Scotch_Whisky_25-year-old_CA_Enigma_import.png | 2024-08-13 17:09 | 96K | |
| Blended_Scotch_Whisky_25-year-old_CA_Shop_Label_import.png | 2024-08-13 17:09 | 116K | |
| Blended_Scotch_Whisky_1999_Hhd_import.png | 2024-08-13 17:09 | 87K | |
| Blended_Scotch_Whisky_2002_Hhd_import.png | 2024-08-13 17:09 | 88K | |
| Blended_Scotch_Whisky_2003_LT_Christmas_2023_import.png | 2024-08-13 17:09 | 120K | |
| Blended_Scotch_Whisky_2003_TcaH_The_Thirsty_Piper_import.png | 2024-08-13 17:09 | 92K | |
| Blended_Scotch_Whisky_2005_Hhd_import.png | 2024-08-13 17:09 | 89K | |
| Blended_Scotch_Whisky_2010_NSS_The_Magician_-_Tarot_import.png | 2024-08-13 17:09 | 123K | |
| Blended_Scotch_Whisky_2011_LBDS_Drookit_Dug_import.png | 2024-08-13 17:09 | 135K | |
| Blended_Scotch_Whisky_2015_WhB_import.png | 2024-08-13 17:09 | 81K | |
| Blended_Scotch_Whisky_2016_PST_import.png | 2024-08-13 17:09 | 96K | |
| Blended_Scotch_Whisky_Amici_Ad_Vitam_import.png | 2024-08-13 17:09 | 99K | |
| Blended_Scotch_Whisky_Architectus_Sa_First_Release_import.png | 2024-08-13 17:09 | 123K | |
| Blended_Scotch_Whisky_B-Side_CB_New_Vibrations_import.png | 2024-08-13 17:09 | 105K | |
| Blended_Scotch_Whisky_Boutique-y_Birthday_Blend_Batch_1_TBWC_10th_Anniversary_import.png | 2024-08-13 17:09 | 149K | |
| Blended_Scotch_Whisky_Lowrie’s_Reserve_PST_import.png | 2024-08-13 17:09 | 107K | |
| Blended_Scotch_Whisky_Meadowside_Blend_MBl_Batch_Strength_import.png | 2024-08-13 17:09 | 113K | |
| Blended_Spirit_Drink_6-year-old_PST_import.png | 2024-08-13 17:09 | 124K | |
| Blended_Whisky_1980_MoM_import.png | 2024-08-13 17:09 | 95K | |
| Blended_Whisky_1990_MoM_import.png | 2024-08-13 17:09 | 96K | |
| Blended_Whisky_Coronation_Blend_GtDr_Blended_Cask_Series_import.png | 2024-08-13 17:09 | 143K | |
| Blood_Moon_06-year-old_Finest_German_Single_Rye_Whisky_import.png | 2024-08-13 17:09 | 173K | |
| Blood_Oath_Pact_No._8_Sour_Mash_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 193K | |
| Blood_Oath_Pact_No._9_Sour_Mash_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 187K | |
| Blossoming_Auld_Sherried_Single_Malt_Whisky_MCo_Collectors_Selection_N°_3_import.png | 2024-08-13 17:09 | 100K | |
| Blossoming_Auld_Sherried_Single_Malt_Whisky_MCo_import.png | 2024-08-13 17:09 | 111K | |
| BlueWhite_Mil_Fhluraichean_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:09 | 188K | |
| Blue_Run_07-year-old_Chosen_import.png | 2024-08-13 17:09 | 147K | |
| Blue_Run_Lahaina_Luau_import.png | 2024-08-13 17:09 | 142K | |
| Blue_Run_Reflection_1_Small_Batch_Bourbon_import.png | 2024-08-13 17:09 | 136K | |
| Blue_Spot_07-year-old_Cask_Strength_import.png | 2024-08-13 17:09 | 109K | |
| Boann_Winter_Solstice_2023.png | 2025-01-30 21:00 | 221K | |
| Bolds_04-year-old_Rhöner_BIO_Rye_Whisky_import.png | 2024-08-13 17:09 | 129K | |
| Bombergers_Declaration_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 100K | |
| Bombergers_Declaration_Small_Batch_-_Kentucky_Straight_Bourbon_import.png | 2024-08-13 17:09 | 92K | |
| Bonailie_Blended_Malt_Scotch_Whisky_import.png | 2024-08-13 17:09 | 156K | |
| Bonnington_2020_Inaugural_Release_import.png | 2024-08-13 17:09 | 192K | |
| Bookers2019-01TheresasBatch.jpg | 2024-08-13 17:09 | 1.0M | |
| Bookers_06_+_10_months_+_10_days_Pinkies_Batch_import.png | 2024-08-13 17:09 | 111K | |
| Bookers_06_+_11_months_+_22_days_Ronnies_Batch_import.png | 2024-08-13 17:09 | 101K | |
| Bookers_07-year-old_Apprentice_Batch_import.png | 2024-08-13 17:09 | 113K | |
| Bookers_07_+_1_month_+_2_days_Apprentice_Batch_import.png | 2024-08-13 17:09 | 114K | |
| Bookers_07_+_1_month_+_7_days_The_Lumberyard_Batch_import.png | 2024-08-13 17:09 | 117K | |
| Bookers_07_+_1_month_+_10_days_Mighty_Fine_Batch_import.png | 2024-08-13 17:09 | 112K | |
| Bookers_07_+_1_month_Charlies_Batch_import.png | 2024-08-13 17:09 | 105K | |
| Bookers_07_+_1month_Export_import.png | 2024-08-13 17:09 | 101K | |
| Bookers_07_+_4_months_+_14_days_Kentucky_Tea_Batch_import.png | 2024-08-13 17:09 | 112K | |
| Boomsma_07-year-old_Inaugural_Release_import.png | 2024-08-13 17:09 | 147K | |
| Born_in_a_Storm_13-year-old_import.png | 2024-08-13 17:09 | 119K | |
| Both_Barrels_Blended_Malt_Scotch_Whisky_01_import.png | 2024-08-13 17:09 | 142K | |
| Boulder_Spirits_04-year-old_Straight_Bourbon_Whiskey_-_Bottled_In_Bond_import.png | 2024-08-13 17:09 | 141K | |
| Boulder_Spirits_2016_Peated_Malt_import.png | 2024-08-13 17:09 | 121K | |
| Bourbon_Whiskey_2012_MoS_Sweet_Caroline_-_South_Carolina_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 142K | |
| Bowmore 18.jpg | 2024-08-13 17:09 | 191K | |
| Bowmore Devil's Cask.jpg | 2024-08-13 17:09 | 29K | |
| Bowmore_07-year-old_JW_Whisky_Racing_Formel_Lau_import.png | 2024-08-13 17:09 | 115K | |
| Bowmore_10-year-old_Aston_Martin_Edition_Dark_&_Intense_import.png | 2024-08-13 17:09 | 100K | |
| Bowmore_10-year-old_Dark_&_Intense_-_Aston_Martin_Edition_import.png | 2024-08-13 17:09 | 90K | |
| Bowmore_15-year-old_Fèis_Ìle_Limited_Edition_import.png | 2024-08-13 17:09 | 117K | |
| Bowmore_15-year-old_Golden_&_Elegant_-_Aston_Martin_Edition_import.png | 2024-08-13 17:09 | 89K | |
| Bowmore_18-year-old_Deep_&_Complex_-_Aston_Martin_Edition_import.png | 2024-08-13 17:09 | 91K | |
| Bowmore_18-year-old_SMWS_3.347_An_Ode_to_Intensity_import.png | 2024-08-13 17:09 | 108K | |
| Bowmore_19-year-old_RbTW_Ronnachmore_import.png | 2024-08-13 17:09 | 84K | |
| Bowmore_22-year-old_Masters_Selection_-_Edition_3_import.png | 2024-08-13 17:09 | 83K | |
| Bowmore_22-year-old_Masters_Selection_import.png | 2024-08-13 17:09 | 103K | |
| Bowmore_22-year-old_The_Changeling_import.png | 2024-08-13 17:09 | 116K | |
| Bowmore_22-year-old_import.png | 2024-08-13 17:09 | 101K | |
| Bowmore_23-year-old_Frank_Quitely_-_Lovers_Transformed_import.png | 2024-08-13 17:09 | 86K | |
| Bowmore_29-year-old_Timeless_Series_import.png | 2024-08-13 17:09 | 82K | |
| Bowmore_33-year-old_HL_The_Kinship_-_Edition_No._1_import.png | 2024-08-13 17:09 | 122K | |
| Bowmore_1996_DL_XOP_-_The_Black_Series_import.png | 2024-08-13 17:09 | 130K | |
| Bowmore_1996_DL_XOP_-_Xtra_Old_Particular_-_Seasonal_Curiosities_import.png | 2024-08-13 17:09 | 238K | |
| Bowmore_1996_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:09 | 268K | |
| Bowmore_1996_Fèis_Ìle_Limited_Edition_import.png | 2024-08-13 17:09 | 105K | |
| Bowmore_1996_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:09 | 111K | |
| Bowmore_1996_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:09 | 107K | |
| Bowmore_1996_MoS_Rare_Casks_Range_import.png | 2024-08-13 17:09 | 163K | |
| Bowmore_1996_MoS_Rare_Casks_import.png | 2024-08-13 17:09 | 187K | |
| Bowmore_1996_TWA_Sequences_import.png | 2024-08-13 17:09 | 116K | |
| Bowmore_1997_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:09 | 135K | |
| Bowmore_1997_BR_import.png | 2024-08-13 17:09 | 124K | |
| Bowmore_1997_CYWL_Cut_The_Leftover_Loose_import.png | 2024-08-13 17:09 | 121K | |
| Bowmore_1997_GlMo_A_Rare_Find_import.png | 2024-08-13 17:09 | 85K | |
| Bowmore_1997_Joy_Connoisseur_Selection_-_No.26_import.png | 2024-08-13 17:09 | 118K | |
| Bowmore_1997_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:09 | 144K | |
| Bowmore_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:09 | 144K | |
| Bowmore_1997_SV__Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:09 | 144K | |
| Bowmore_1997_WM_Barrel_Selection_-_Decanter_Collection_import.png | 2024-08-13 17:09 | 190K | |
| Bowmore_1997_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:09 | 143K | |
| Bowmore_1999_No._1_Vaults_Secrets_Tour_-_Handfilled_Cask_Sample_import.png | 2024-08-13 17:09 | 173K | |
| Bowmore_2000_DT_The_Octave_Premium_import.png | 2024-08-13 17:09 | 95K | |
| Bowmore_2000_DT_The_Octave_import.png | 2024-08-13 17:09 | 105K | |
| Bowmore_2001_BWpl_Paradigm_Malts_import.png | 2024-08-13 17:09 | 185K | |
| Bowmore_2001_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:09 | 112K | |
| Bowmore_2001_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:09 | 146K | |
| Bowmore_2001_HiSp_The_Poker_Face_Collection_import.png | 2024-08-13 17:09 | 122K | |
| Bowmore_2001_LMDW_Artist_#12_import.png | 2024-08-13 17:09 | 145K | |
| Bowmore_2001_No._1_Vaults_Secrets_Tour_-_Handfilled_Cask_Sample_import.png | 2024-08-13 17:09 | 126K | |
| Bowmore_2001_TWC_import.png | 2024-08-13 17:09 | 100K | |
| Bowmore_2003_CA_Authentic_Collection_import.png | 2024-08-13 17:09 | 104K | |
| Bowmore_2003_WSP_Edition_No._50_import.png | 2024-08-13 17:09 | 99K | |
| Bowmore_2004_Hand_Filled_at_the_Distillery_import.png | 2024-08-13 17:09 | 107K | |
| Bowmore_2004_SMWS_3.341_Spirit_of_gratitude_and_benevolence_import.png | 2024-08-13 17:09 | 108K | |
| Bowmore_2004_SMWS_3.343_A_welcome_home_hug_import.png | 2024-08-13 17:09 | 122K | |
| Bowmore_2004_SMWS_3.350_Gladrags_of_yesteryear_import.png | 2024-08-13 17:09 | 113K | |
| Bowmore_2007_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:09 | 94K | |
| Bowmore_2012_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:09 | 97K | |
| Bowmore_2013_DL_Scyfion_Choice_import.png | 2024-08-13 17:09 | 120K | |
| Bowmore_2013_DL_Single_Minded_-_World_of_Whisky_Trilogie_import.png | 2024-08-13 17:09 | 119K | |
| Bowmore_2016_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:09 | 118K | |
| Bowmore_ARC-52_Aston_Martin_import.png | 2024-08-13 17:09 | 81K | |
| Box_2015_SM_Private_Bottling_import.png | 2024-08-13 17:09 | 125K | |
| Box_2016_HCD_Private_Bottling_import.png | 2024-08-13 17:09 | 113K | |
| Box_2016_Private_Bottling_import.png | 2024-08-13 17:09 | 117K | |
| Box_2016_WSla_A_Box_Full_of_Rum_import.png | 2024-08-13 17:09 | 101K | |
| Box_2016_WSla_Private_Bottling_import.png | 2024-08-13 17:09 | 108K | |
| Box_2016_WSla_Whiskyklubben_Slainte_import.png | 2024-08-13 17:09 | 106K | |
| Box_2016_WSla_import.png | 2024-08-13 17:09 | 105K | |
| Box_2016__Private_Bottling_import.png | 2024-08-13 17:09 | 103K | |
| Box_2017_HCD_Private_Bottling_import.png | 2024-08-13 17:09 | 108K | |
| Box_2017_Private_Bottling_import.png | 2024-08-13 17:09 | 95K | |
| Box_2017_WSla_PX_Rök_import.png | 2024-08-13 17:09 | 111K | |
| Box_2017_WSla_PX_import.png | 2024-08-13 17:09 | 104K | |
| Box_2017_WSla_Private_Bottling_import.png | 2024-08-13 17:09 | 112K | |
| Box_2017_WSla_Whiskyklubben_Slainte_import.png | 2024-08-13 17:09 | 105K | |
| Box_2017_WSla_import.png | 2024-08-13 17:09 | 97K | |
| Box_2018_Private_Bottling_import.png | 2024-08-13 17:09 | 98K | |
| Box_2018_WSla_Ungersk_Ek_import.png | 2024-08-13 17:09 | 114K | |
| Box_2018_WSla_Whiskyklubben_Slainte_import.png | 2024-08-13 17:09 | 103K | |
| Bräntings_Bränneri_Three_Oaks_Whisky_01_import.png | 2024-08-13 17:09 | 117K | |
| Braeckman_Distillers_2010_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:09 | 135K | |
| Braeckman_Distillers_2018_Limited_2022_Edition_import.png | 2024-08-13 17:09 | 141K | |
| Braeckman_Distillers_2019_Limited_2023_Edition_import.png | 2024-08-13 17:09 | 148K | |
| Braeckman_Distillers_2020_Single_Barrel_-_Cask_Strength_import.png | 2024-08-13 17:09 | 131K | |
| Braeckman_Distillers_Double_Cask_import.png | 2024-08-13 17:09 | 139K | |
| Braes_of_Glenlivet_1989_HL_Old_&_Rare_Platinum_import.png | 2024-08-13 17:09 | 146K | |
| Braes_of_Glenlivet_1989_WhB_import.png | 2024-08-13 17:09 | 96K | |
| Braes_of_Glenlivet_1990_Vintage_Edition_import.png | 2024-08-13 17:09 | 98K | |
| Braes_of_Glenlivet_1994_GlMo_A_Rare_Find_import.png | 2024-08-13 17:09 | 118K | |
| Braes_of_Glenlivet_1994_WroE_Warehouse_Reserve_import.png | 2024-08-13 17:09 | 110K | |
| Braes_of_Glenlivet_1994_WroE__Warehouse_Reserve_import.png | 2024-08-13 17:09 | 9.8K | |
| Braeval_1991_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:09 | 252K | |
| Braeval_1996_WAGE_No._0014_import.png | 2024-08-13 17:09 | 129K | |
| Braeval_2000_DT_import.png | 2024-08-13 17:09 | 102K | |
| Braeval_2009_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:09 | 129K | |
| Braeval_2009_ED_The_First_Editions_import.png | 2024-08-13 17:09 | 219K | |
| Braeval_2009_NSS_Cask_Series_018_import.png | 2024-08-13 17:09 | 154K | |
| Braeval_2009_TWA_import.png | 2024-08-13 17:09 | 73K | |
| Braeval_2009_W-F_Duck_Edition_import.png | 2024-08-13 17:09 | 105K | |
| Braeval_2013_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:09 | 111K | |
| Braeval_2013_HB__Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:09 | 9.8K | |
| Braeval_2014_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:09 | 119K | |
| Brand_Marke_Whisky_Projekt_No._4_import.png | 2024-08-13 17:09 | 116K | |
| Braon_Peat_NAS_WW8_Sherry_Edition_1_import.png | 2024-08-13 17:09 | 113K | |
| Braon_Peat_NAS_WW8__Sherry_Edition_1_import.png | 2024-08-13 17:09 | 113K | |
| Braon_Peat_Port_Edition_1_import.png | 2024-08-13 17:09 | 134K | |
| Brauerei_Grasser_Franken_Bier_Whisky_import.png | 2024-08-13 17:09 | 216K | |
| Braunstein_2009_Private_Collection_import.png | 2024-08-13 17:09 | 133K | |
| Braunstein_Cask_Edition_no.14_import.png | 2024-08-13 17:09 | 123K | |
| Braunstein_Ohlssons_sublimity_Private_Cask_Collection_import.png | 2024-08-13 17:09 | 128K | |
| Breac_2017_SpSw_import.png | 2024-08-13 17:09 | 249K | |
| Breath_of_Islay_2010_AD_import.png | 2024-08-13 17:09 | 94K | |
| Breath_of_Speyside_1992_AD_import.png | 2024-08-13 17:09 | 96K | |
| Breath_of_the_Highlands_2009_AD_Selection_import.png | 2024-08-13 17:09 | 94K | |
| Breath_of_the_Isles_2007_AD_import.png | 2024-08-13 17:09 | 90K | |
| Breckenridge_Two_Clans_import.png | 2024-08-13 17:09 | 187K | |
| Brennevinsgrova_2019_import.png | 2024-08-13 17:09 | 183K | |
| Brigantia_04-year-old_Classic_import.png | 2024-08-13 17:09 | 184K | |
| Brigantia_12-year-old_Edition_Constantia_import.png | 2024-08-13 17:09 | 221K | |
| Brigantia_2015_Lake_Side_Edition_import.png | 2024-08-13 17:09 | 211K | |
| Brigantia_2016_Exclusive_import.png | 2024-08-13 17:09 | 185K | |
| Brigantia_2016__Exclusive_import.png | 2024-08-13 17:09 | 9.8K | |
| Brigantia_2017_Edition_Knecht_Ruprecht_import.png | 2024-08-13 17:09 | 220K | |
| Brigantia_2017_Edition_Nikolaus_import.png | 2024-08-13 17:09 | 213K | |
| Brigantia_2018_Islay_Single_Cask_-_Limited_Edition_import.png | 2024-08-13 17:09 | 189K | |
| Brigantia_2018_Islay_Single_Cask_import.png | 2024-08-13 17:09 | 197K | |
| Brigantia_Schwaben_Whisky_import.png | 2024-08-13 17:09 | 174K | |
| Broger_Batch_1_TBWC_import.png | 2024-08-13 17:09 | 146K | |
| Broken_Bones_Whisky_04-year-old_Peated_import.png | 2024-08-13 17:09 | 132K | |
| Broken_Bones_Whisky_04-year-old_import.png | 2024-08-13 17:09 | 145K | |
| Bruges_Whisky_Company_03-year-old_BaSec_import.png | 2024-08-13 17:09 | 114K | |
| Bruges_Whisky_Company_2019_Het_Venetië_van_het_Noorden_import.png | 2024-08-13 17:09 | 180K | |
| Bruges_Whisky_Company_2019_Rogia_Canasta_import.png | 2024-08-13 17:09 | 156K | |
| Bruges_Whisky_Company_2019_Rogia_Champagne_import.png | 2024-08-13 17:09 | 165K | |
| Bruges_Whisky_Company_2019_Rogia_Tawny_Port_import.png | 2024-08-13 17:09 | 166K | |
| Bruges_Whisky_Company_2019_Ryggia_-_Inaugural_release_import.png | 2024-08-13 17:09 | 122K | |
| Bruges_Whisky_Company_2019_import.png | 2024-08-13 17:09 | 147K | |
| Bruges_Whisky_Company_Belgian_Single_Malt_Whisky_import.png | 2024-08-13 17:09 | 148K | |
| Bruges_Whisky_Company_Part_One_40_Bottles_import.png | 2024-08-13 17:09 | 170K | |
| Bruges_Whisky_Company_Part_Two_40_Bottles_import.png | 2024-08-13 17:09 | 152K | |
| Bruges_Whisky_Company_Ryggia_-_Almost_there_import.png | 2024-08-13 17:09 | 123K | |
| Bruges_Whisky_Company_Ryggia_Unleashed_Red_Pepper_Finish_import.png | 2024-08-13 17:09 | 164K | |
| Bruges_Whisky_Company_Single_Cask_For_Au_Diamant_Noir_import.png | 2024-08-13 17:09 | 148K | |
| Bruichladdich Bere Barley 2006.jpg | 2024-08-13 17:09 | 76K | |
| Bruichladdich Port Charlotte The Peat Project.jpg | 2024-08-13 17:09 | 2.6K | |
| Bruichladdich Rocks.jpg | 2024-08-13 17:09 | 40K | |
| Bruichladdich The Laddie Ten.jpg | 2024-08-13 17:09 | 3.1M | |
| Bruichladdich_10-year-old_Conversation_Starter_import.png | 2024-08-13 17:09 | 245K | |
| Bruichladdich_11-year-old_Ballymeanch_Nightcap_import.png | 2024-08-13 17:09 | 97K | |
| Bruichladdich_13-year-old_SpFi_Mythical_Beasts_import.png | 2024-08-13 17:09 | 154K | |
| Bruichladdich_16-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:09 | 122K | |
| Bruichladdich_31-year-old_HL_The_Kinship_-_Edition_No._2_import.png | 2024-08-13 17:09 | 127K | |
| Bruichladdich_1991_SmBB_import.png | 2024-08-13 17:09 | 186K | |
| Bruichladdich_1991_VCLV_Queen_Elizabeth_II_import.png | 2024-08-13 17:09 | 136K | |
| Bruichladdich_1993_MoS_Rare_Casks_Range_import.png | 2024-08-13 17:09 | 168K | |
| Bruichladdich_1993_MoS_Rare_Casks_import.png | 2024-08-13 17:09 | 180K | |
| Bruichladdich_2002_Df_55th_release_import.png | 2024-08-13 17:09 | 110K | |
| Bruichladdich_2002_RBTW_import.png | 2024-08-13 17:09 | 171K | |
| Bruichladdich_2002_UD_import.png | 2024-08-13 17:09 | 273K | |
| Bruichladdich_2003_GlMo_A_Rare_Find_import.png | 2024-08-13 17:09 | 117K | |
| Bruichladdich_2003_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:09 | 86K | |
| Bruichladdich_2003_Private_Cask_Bottling_import.png | 2024-08-13 17:09 | 102K | |
| Bruichladdich_2003_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:09 | 126K | |
| Bruichladdich_2004_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 118K | |
| Bruichladdich_2004_RBTW_import.png | 2024-08-13 17:09 | 170K | |
| Bruichladdich_2004_Rockndaal_Feis_Ile_import.png | 2024-08-13 17:09 | 170K | |
| Bruichladdich_2004_SE_Cat_Label_Serie_import.png | 2024-08-13 17:09 | 105K | |
| Bruichladdich_2004_TGSC_Ralfy.com_Bottling_004_import.png | 2024-08-13 17:09 | 124K | |
| Bruichladdich_2005_Friends_of_Bruichladdich_import.png | 2024-08-13 17:09 | 145K | |
| Bruichladdich_2005_UD_Nickolls_&_Perks_Inaugural_Casks_import.png | 2024-08-13 17:09 | 88K | |
| Bruichladdich_2006_Dar_Private_Barrel_-_Single_Cask_import.png | 2024-08-13 17:09 | 84K | |
| Bruichladdich_2006_RBTW_import.png | 2024-08-13 17:09 | 182K | |
| Bruichladdich_2007_CA_Campbeltown_Malts_Festival_2023_import.png | 2024-08-13 17:09 | 95K | |
| Bruichladdich_2007_Df_Jim_McEwan_Signature_Collection_7_import.png | 2024-08-13 17:09 | 165K | |
| Bruichladdich_2007_MoS_Robin’s_Corona_Inspiration_„BUILDING_BRIDGES“_import.png | 2024-08-13 17:09 | 156K | |
| Bruichladdich_2007_UD_import.png | 2024-08-13 17:09 | 202K | |
| Bruichladdich_2007_import.png | 2024-08-13 17:09 | 165K | |
| Bruichladdich_2008_Df_Jim_McEwan_Signature_Collection_6.1_import.png | 2024-08-13 17:09 | 161K | |
| Bruichladdich_2008_Df__Jim_McEwan_Signature_Collection_6.1_import.png | 2024-08-13 17:09 | 9.8K | |
| Bruichladdich_2008_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 116K | |
| Bruichladdich_2008_SMWS_23.81_Fatberg_ahead!_import.png | 2024-08-13 17:09 | 104K | |
| Bruichladdich_2008_WhB_The_Laddie_Show_import.png | 2024-08-13 17:09 | 113K | |
| Bruichladdich_2009_Crew_Valinch_69_-_Paul_Beckett_import.png | 2024-08-13 17:09 | 146K | |
| Bruichladdich_2009_Df_Dramfools_middle_cut_import.png | 2024-08-13 17:09 | 139K | |
| Bruichladdich_2009_MBl_The_Maltman_import.png | 2024-08-13 17:09 | 115K | |
| Bruichladdich_2009_RBTW_import.png | 2024-08-13 17:09 | 174K | |
| Bruichladdich_2009_WB_220.000_bottles_in_Whiskybase_import.png | 2024-08-13 17:09 | 101K | |
| Bruichladdich_2010_Crew_Valinch_68_-_Abi_Clephane_import.png | 2024-08-13 17:09 | 145K | |
| Bruichladdich_2010_Df_51st_release_import.png | 2024-08-13 17:09 | 96K | |
| Bruichladdich_2010_ICC_Signature_&_01_import.png | 2024-08-13 17:09 | 94K | |
| Bruichladdich_2010_KotS_12Y7M2D_import.png | 2024-08-13 17:09 | 139K | |
| Bruichladdich_2010_Laddie_Crew_Cask_import.png | 2024-08-13 17:09 | 137K | |
| Bruichladdich_2010_Laddie_Crew_Valinch_59_-_Robert_McEachern_import.png | 2024-08-13 17:09 | 150K | |
| Bruichladdich_2010_Laddie_Crew_Valinch_66_Rosaline_Boyle_import.png | 2024-08-13 17:09 | 156K | |
| Bruichladdich_2010_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 115K | |
| Bruichladdich_2010_Micro_Provenance_Series_import.png | 2024-08-13 17:09 | 193K | |
| Bruichladdich_2010_MoS_Robins_Spanish_Inspiration_import.png | 2024-08-13 17:09 | 178K | |
| Bruichladdich_2010_TWA_15_Years_TWA_China_Edition_import.png | 2024-08-13 17:09 | 109K | |
| Bruichladdich_2010_TWA_import.png | 2024-08-13 17:09 | 108K | |
| Bruichladdich_2011_Cask_Evolution_Exploration_import.png | 2024-08-13 17:09 | 110K | |
| Bruichladdich_2011_Df_Jim_McEwan_Signature_Collection_5.1_import.png | 2024-08-13 17:09 | 146K | |
| Bruichladdich_2011_Laddie_Crew_Valinch_65_-_Katie_Smith_import.png | 2024-08-13 17:09 | 113K | |
| Bruichladdich_2011_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 124K | |
| Bruichladdich_2011_Micro_Provenance_Series_import.png | 2024-08-13 17:09 | 114K | |
| Bruichladdich_2011_NSS_Cask_Series_022_import.png | 2024-08-13 17:09 | 167K | |
| Bruichladdich_2011_NSS_Obscurities_&_Curiosities_import.png | 2024-08-13 17:09 | 356K | |
| Bruichladdich_2011_SE_Cat_Label_Serie_import.png | 2024-08-13 17:09 | 111K | |
| Bruichladdich_2011_TFR_Edition_9_import.png | 2024-08-13 17:09 | 93K | |
| Bruichladdich_2011_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:09 | 86K | |
| Bruichladdich_2011_The_Organic_import.png | 2024-08-13 17:09 | 161K | |
| Bruichladdich_2011_WhB_Single_Cask_Bottling_import.png | 2024-08-13 17:09 | 140K | |
| Bruichladdich_2012_Bere_Barley_import.png | 2024-08-13 17:09 | 169K | |
| Bruichladdich_2012_Laddie_Crew_Valinch_58_-_Heather_Leslie_import.png | 2024-08-13 17:09 | 176K | |
| Bruichladdich_2012_Laddie_Crew_Valinch_63_-_Gregory_Joannes_import.png | 2024-08-13 17:09 | 138K | |
| Bruichladdich_2012_Laddie_Crew_Valinch_64_-_Shaun_Cameron_import.png | 2024-08-13 17:09 | 137K | |
| Bruichladdich_2012_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 130K | |
| Bruichladdich_2012_Micro_Provenance_Series_import.png | 2024-08-13 17:09 | 127K | |
| Bruichladdich_2012_MoS_Dr._Jekyll_import.png | 2024-08-13 17:09 | 166K | |
| Bruichladdich_2012_Organic_Barley_import.png | 2024-08-13 17:09 | 167K | |
| Bruichladdich_2012_TFM_Flowers_import.png | 2024-08-13 17:09 | 99K | |
| Bruichladdich_2012_TWBa_The_Founders_Collection_import.png | 2024-08-13 17:09 | 123K | |
| Bruichladdich_2012__Laddie_Crew_Valinch_64_-__Shaun_Cameron_import.png | 2024-08-13 17:09 | 137K | |
| Bruichladdich_2013_Crew_Valinch_67_-_Stuart_Cambridge_import.png | 2024-08-13 17:09 | 137K | |
| Bruichladdich_2013_Friends_of_Bruichladdich_import.png | 2024-08-13 17:09 | 133K | |
| Bruichladdich_2013_Laddie_Crew_Valinch_61_-_Kevin_Johansson_import.png | 2024-08-13 17:09 | 139K | |
| Bruichladdich_2013_Laddie_Crew_Valinch_62_-_Rona_Anderson_import.png | 2024-08-13 17:09 | 149K | |
| Bruichladdich_2013_Micro-Provenance_Series_import.png | 2024-08-13 17:09 | 112K | |
| Bruichladdich_2013_Micro_Provenance_Series_import.png | 2024-08-13 17:09 | 116K | |
| Bruichladdich_2014_Islay_Barley_import.png | 2024-08-13 17:09 | 175K | |
| Bruichladdich_2017_The_Regeneration_Project_import.png | 2024-08-13 17:09 | 157K | |
| Bruichladdich_Black_Art_10.1_import.png | 2024-08-13 17:09 | 113K | |
| Bruichladdich_Black_Art_11.1_import.png | 2024-08-13 17:09 | 113K | |
| Bruichladdich_ROCKNDAAL_01.1_Feis_Ile_2022_import.png | 2024-08-13 17:09 | 160K | |
| Bruichladdich_ROCKNDAAL_01.2_Feis_Ile_2022_import.png | 2024-08-13 17:09 | 131K | |
| Bruichladdich_The_Classic_Laddie_Scottish_Barley_import.png | 2024-08-13 17:09 | 122K | |
| Buffalo Trace.jpg | 2024-08-13 17:09 | 143K | |
| Buffalo_Trace_Kentucky_Straight_Bourbon_import.png | 2024-08-13 17:09 | 143K | |
| Buffalo_Trace_Single_Barrel_Select_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:09 | 126K | |
| Bull_Run_14-year-old_Single_Barrel_-_Barrel_Strength_import.png | 2024-08-13 17:09 | 147K | |
| Bulleit Bourbon.jpg | 2024-08-13 17:09 | 66K | |
| Bulleit Rye.jpg | 2024-08-13 17:09 | 66K | |
| Bulleit_Bourbon_Frontier_Whiskey_import.png | 2024-08-13 17:09 | 146K | |
| Bunnahabhain 12.jpg | 2024-08-13 17:09 | 134K | |
| Bunnahabhain 18.jpg | 2024-08-13 17:09 | 124K | |
| Bunnahabhain Toiteach.jpg | 2024-08-13 17:09 | 43 | |
| Bunnahabhain_06-year-old_Warehouse_9_-_Hand-Filled_Exclusive_import.png | 2024-08-13 17:09 | 134K | |
| Bunnahabhain_07-year-old_CA_Original_Collection_import.png | 2024-08-13 17:09 | 155K | |
| Bunnahabhain_09-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:09 | 122K | |
| Bunnahabhain_09-year-old_CA_Authentic_Collection_import.png | 2024-08-13 17:09 | 110K | |
| Bunnahabhain_11-year-old_GM_Discovery_import.png | 2024-08-13 17:09 | 139K | |
| Bunnahabhain_12-year-old_Cask_Strength_Edition_2022_import.png | 2024-08-13 17:09 | 145K | |
| Bunnahabhain_12-year-old_Cask_Strength_Edition_2023_import.png | 2024-08-13 17:09 | 138K | |
| Bunnahabhain_12-year-old_DL_Private_Stock_import.png | 2024-08-13 17:09 | 127K | |
| Bunnahabhain_12-year-old_JW_Whisky_Racing_Formel_Lau_import.png | 2024-08-13 17:09 | 120K | |
| Bunnahabhain_13-year-old_JW_Whisky_Racing_Formel_Lau_import.png | 2024-08-13 17:09 | 375K | |
| Bunnahabhain_16-year-old_BW_A_Dream_of_Scotland_-_Fairytale_Series_import.png | 2024-08-13 17:09 | 125K | |
| Bunnahabhain_17-year-old_Mòine_Feis_Ile_2023_import.png | 2024-08-13 17:09 | 123K | |
| Bunnahabhain_32-year-old_HL_The_Kinship_-_Edition_No._3_import.png | 2024-08-13 17:10 | 126K | |
| Bunnahabhain_33-year-old_HL_The_Kinship_import.png | 2024-08-13 17:10 | 122K | |
| Bunnahabhain_1977_LMDW_Artist_#12_import.png | 2024-08-13 17:09 | 160K | |
| Bunnahabhain_1987_NSpS_Jazz_Trilogy_import.png | 2024-08-13 17:09 | 287K | |
| Bunnahabhain_1988_DL_XOP_-_Xtra_Old_Particular_-_Year_of_The_Dragon_import.png | 2024-08-13 17:09 | 153K | |
| Bunnahabhain_1988_SS_Special_Reserve_import.png | 2024-08-13 17:09 | 232K | |
| Bunnahabhain_1989_Feis_Ile_2022_import.png | 2024-08-13 17:09 | 122K | |
| Bunnahabhain_1989_Skn_import.png | 2024-08-13 17:09 | 168K | |
| Bunnahabhain_1991_DL_Private_Stock_import.png | 2024-08-13 17:09 | 112K | |
| Bunnahabhain_1991_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:10 | 177K | |
| Bunnahabhain_1991_MM_Mission_Gold_-_Limited_Release_import.png | 2024-08-13 17:10 | 272K | |
| Bunnahabhain_1998_AD_Limited_import.png | 2024-08-13 17:10 | 91K | |
| Bunnahabhain_1998_AD_Nightcap_2022_import.png | 2024-08-13 17:10 | 146K | |
| Bunnahabhain_1998_Feis_Ile_2022_import.png | 2024-08-13 17:10 | 122K | |
| Bunnahabhain_1999_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 123K | |
| Bunnahabhain_1999_RM_Single_Cask_import.png | 2024-08-13 17:10 | 113K | |
| Bunnahabhain_2002_DT_Single_Cask_import.png | 2024-08-13 17:10 | 97K | |
| Bunnahabhain_2002_DT_import.png | 2024-08-13 17:10 | 100K | |
| Bunnahabhain_2003_Moine_Hand-filled_at_Warehouse_#9_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2003_Warehouse_9_-_Hand-Filled_Exclusive_import.png | 2024-08-13 17:10 | 168K | |
| Bunnahabhain_2004_DL_Old_Particular_-_The_Midnight_Series_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2004_DL_Old_Particular_import.png | 2024-08-13 17:10 | 106K | |
| Bunnahabhain_2004_Distillery_Exclusive_Bottling_import.png | 2024-08-13 17:10 | 131K | |
| Bunnahabhain_2004_Feis_Ile_2022_import.png | 2024-08-13 17:10 | 131K | |
| Bunnahabhain_2004_Kb_import.png | 2024-08-13 17:10 | 101K | |
| Bunnahabhain_2004_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:10 | 110K | |
| Bunnahabhain_2004_Warehouse_9_-_Handfilled_Exclusive_import.png | 2024-08-13 17:10 | 133K | |
| Bunnahabhain_2005_AD_Selection_import.png | 2024-08-13 17:10 | 84K | |
| Bunnahabhain_2005_BA_Raw_Cask_import.png | 2024-08-13 17:10 | 101K | |
| Bunnahabhain_2005_Moine_Warehouse_9_-_Hand-Filled_Exclusive_import.png | 2024-08-13 17:10 | 148K | |
| Bunnahabhain_2005_Moine_Warehouse_Handfilled_Exclusive_import.png | 2024-08-13 17:10 | 137K | |
| Bunnahabhain_2005_Warehouse_9_-_Hand-Filled_Exclusive_import.png | 2024-08-13 17:10 | 144K | |
| Bunnahabhain_2006_DL_Old_Particular_import.png | 2024-08-13 17:10 | 209K | |
| Bunnahabhain_2006_Hand-Filled_Warehouse_Exclusive_import.png | 2024-08-13 17:10 | 128K | |
| Bunnahabhain_2006_RM_import.png | 2024-08-13 17:10 | 110K | |
| Bunnahabhain_2006_WSP_Moine_-_Islay_Sponge_-_Part_2_import.png | 2024-08-13 17:10 | 107K | |
| Bunnahabhain_2007_AL&C_Single_Cask_import.png | 2024-08-13 17:10 | 89K | |
| Bunnahabhain_2007_BA_Raw_Cask_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2007_DL_Old_Particular_-_The_Dutch_Dram_Masters_import.png | 2024-08-13 17:10 | 106K | |
| Bunnahabhain_2007_DMA_import.png | 2024-08-13 17:10 | 109K | |
| Bunnahabhain_2007_ED_The_First_Editions_import.png | 2024-08-13 17:10 | 227K | |
| Bunnahabhain_2007_HL_The_First_Editions_import.png | 2024-08-13 17:10 | 115K | |
| Bunnahabhain_2007_MoS_import.png | 2024-08-13 17:10 | 179K | |
| Bunnahabhain_2007_Orc_import.png | 2024-08-13 17:10 | 86K | |
| Bunnahabhain_2007_Warehouse_9_-_Hand_Filled_Exclusive_import.png | 2024-08-13 17:10 | 122K | |
| Bunnahabhain_2008_DT_The_Octave_import.png | 2024-08-13 17:10 | 107K | |
| Bunnahabhain_2008_DT_The_Single_Cask_Collection_import.png | 2024-08-13 17:10 | 106K | |
| Bunnahabhain_2008_Df_66th_release_import.png | 2024-08-13 17:10 | 118K | |
| Bunnahabhain_2008_Fs_Sláinte_import.png | 2024-08-13 17:10 | 113K | |
| Bunnahabhain_2008_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:10 | 132K | |
| Bunnahabhain_2008_SMWS_10.249_Spectacular_horses_mane_waves_import.png | 2024-08-13 17:10 | 113K | |
| Bunnahabhain_2008_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 145K | |
| Bunnahabhain_2008_StmD_Isabel_XV._Edition_import.png | 2024-08-13 17:10 | 97K | |
| Bunnahabhain_2008_The_Coterie_Exclusive_import.png | 2024-08-13 17:10 | 137K | |
| Bunnahabhain_2009_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:10 | 133K | |
| Bunnahabhain_2009_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:10 | 147K | |
| Bunnahabhain_2009_Sb_Acla_Selection_import.png | 2024-08-13 17:10 | 86K | |
| Bunnahabhain_2009_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:10 | 143K | |
| Bunnahabhain_2009_TM5_import.png | 2024-08-13 17:10 | 130K | |
| Bunnahabhain_2009_TWA_Fhathast_a_lorg_an_uisge_naomh_import.png | 2024-08-13 17:10 | 91K | |
| Bunnahabhain_2009_The_Coterie_Exclusive_import.png | 2024-08-13 17:10 | 126K | |
| Bunnahabhain_2009_WJ_Art_Edition_No._4_import.png | 2024-08-13 17:10 | 103K | |
| Bunnahabhain_2009_Warehouse_No._9_import.png | 2024-08-13 17:10 | 140K | |
| Bunnahabhain_2009_White_Label_import.png | 2024-08-13 17:10 | 102K | |
| Bunnahabhain_2010_CA_Authentic_Collection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 117K | |
| Bunnahabhain_2010_CA_Authentic_Collection_import.png | 2024-08-13 17:10 | 102K | |
| Bunnahabhain_2010_LotG_Rare_Cask_import.png | 2024-08-13 17:10 | 108K | |
| Bunnahabhain_2010_MBl_The_Maltman_import.png | 2024-08-13 17:10 | 124K | |
| Bunnahabhain_2010_TWA_import.png | 2024-08-13 17:10 | 108K | |
| Bunnahabhain_2011_LotG_import.png | 2024-08-13 17:10 | 108K | |
| Bunnahabhain_2011_PST_Mòine_import.png | 2024-08-13 17:10 | 117K | |
| Bunnahabhain_2011_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:10 | 166K | |
| Bunnahabhain_2012_F.dk_Moine_import.png | 2024-08-13 17:10 | 230K | |
| Bunnahabhain_2012_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 173K | |
| Bunnahabhain_2012_SV_Natural_Colour_-_Non_Chill-Filtered_import.png | 2024-08-13 17:10 | 213K | |
| Bunnahabhain_2012_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 116K | |
| Bunnahabhain_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 100K | |
| Bunnahabhain_2012_SV_Vintage_Collection_import.png | 2024-08-13 17:10 | 131K | |
| Bunnahabhain_2012_SV_import.png | 2024-08-13 17:10 | 123K | |
| Bunnahabhain_2012_TWJ_Moine_import.png | 2024-08-13 17:10 | 107K | |
| Bunnahabhain_2012_WroE_Warehouse_Reserve_import.png | 2024-08-13 17:10 | 90K | |
| Bunnahabhain_2013_ADWC_import.png | 2024-08-13 17:10 | 192K | |
| Bunnahabhain_2013_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:10 | 128K | |
| Bunnahabhain_2013_BPCh_Heavily_Peated_import.png | 2024-08-13 17:10 | 158K | |
| Bunnahabhain_2013_BR_Staoisha_Single_Cask_import.png | 2024-08-13 17:10 | 135K | |
| Bunnahabhain_2013_BR_Staoisha_import.png | 2024-08-13 17:10 | 133K | |
| Bunnahabhain_2013_GlMo_import.png | 2024-08-13 17:10 | 141K | |
| Bunnahabhain_2013_Hhd_Staoisha_import.png | 2024-08-13 17:10 | 89K | |
| Bunnahabhain_2013_HiSp_Stoisha_10th_Anniversary_import.png | 2024-08-13 17:10 | 253K | |
| Bunnahabhain_2013_ICC_Casks,_Plants_and_Blossoms_import.png | 2024-08-13 17:10 | 106K | |
| Bunnahabhain_2013_IS&m_The_Islay_Whisky_Vault_import.png | 2024-08-13 17:10 | 95K | |
| Bunnahabhain_2013_LEG_Selection_XXXII_import.png | 2024-08-13 17:10 | 102K | |
| Bunnahabhain_2013_Limited_Release_import.png | 2024-08-13 17:10 | 118K | |
| Bunnahabhain_2013_NSS_Cask_Series_018_import.png | 2024-08-13 17:10 | 169K | |
| Bunnahabhain_2013_RK_Staoisha_Black_Corbie_import.png | 2024-08-13 17:10 | 97K | |
| Bunnahabhain_2013_SMWS_10.257_First_footer_import.png | 2024-08-13 17:10 | 112K | |
| Bunnahabhain_2013_SV_Staoisha_Artist_Collective_6.7_import.png | 2024-08-13 17:10 | 96K | |
| Bunnahabhain_2013_SV_Staoisha_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 245K | |
| Bunnahabhain_2013_SV_Staoisha_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2013_SV_Staoisha_The_War_of_the_Peat_import.png | 2024-08-13 17:10 | 116K | |
| Bunnahabhain_2013_SV_Staoisha_import.png | 2024-08-13 17:10 | 115K | |
| Bunnahabhain_2013_SV_The_Un-Chillfiltered_Collection_-_Heavily_Peated_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2013_SdS_Special_Series_01_import.png | 2024-08-13 17:10 | 143K | |
| Bunnahabhain_2013_TWJ_Staoisha_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2013_V&M_The_Young_Masters_Edition_import.png | 2024-08-13 17:10 | 126K | |
| Bunnahabhain_2013_Warehouse_9_-_Hand-Filled_Exclusive_import.png | 2024-08-13 17:10 | 140K | |
| Bunnahabhain_2013_WroE_Warehouse_Reserve_Staoisha_import.png | 2024-08-13 17:10 | 96K | |
| Bunnahabhain_2013_vW_Staoisha_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:10 | 111K | |
| Bunnahabhain_2014_BD_Staoisha_import.png | 2024-08-13 17:10 | 166K | |
| Bunnahabhain_2014_CA_Authentic_Collection_import.png | 2024-08-13 17:10 | 90K | |
| Bunnahabhain_2014_DD_Staoisha_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:10 | 109K | |
| Bunnahabhain_2014_DT_Dimensions_import.png | 2024-08-13 17:10 | 111K | |
| Bunnahabhain_2014_DT_Private_Cask_Bottling_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2014_DT_Single_Cask_import.png | 2024-08-13 17:10 | 105K | |
| Bunnahabhain_2014_DT_Staoisha_The_Octave_-_Peated_import.png | 2024-08-13 17:10 | 115K | |
| Bunnahabhain_2014_DT_Staoisha_The_Octave_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2014_DT_The_Octave_-_Peated_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2014_DT_The_Octave_import.png | 2024-08-13 17:10 | 95K | |
| Bunnahabhain_2014_Hand-filled_at_Warehouse_#9_import.png | 2024-08-13 17:10 | 138K | |
| Bunnahabhain_2014_Handfilled_at_Distillery_import.png | 2024-08-13 17:10 | 140K | |
| Bunnahabhain_2014_RS_Staoisha_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2014_RS_Stoisha_import.png | 2024-08-13 17:10 | 136K | |
| Bunnahabhain_2014_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 188K | |
| Bunnahabhain_2014_SV_Islay_Selection_import.png | 2024-08-13 17:10 | 91K | |
| Bunnahabhain_2014_SV_Staoisha_Heavily_Peated_import.png | 2024-08-13 17:10 | 114K | |
| Bunnahabhain_2014_SV_Staoisha_The_Un-Chillfiltered_Collection_-_Very_Cloudy_import.png | 2024-08-13 17:10 | 108K | |
| Bunnahabhain_2014_SV_Staoisha_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 113K | |
| Bunnahabhain_2014_SV_Staoisha_Unchill_Filtred_-_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 115K | |
| Bunnahabhain_2014_SV_The_war_of_the_Peat_import.png | 2024-08-13 17:10 | 104K | |
| Bunnahabhain_2014_SV_Trilogi_Moby_Dick_for_Brühler_Whiskyhaus_import.png | 2024-08-13 17:10 | 109K | |
| Bunnahabhain_2014_Staoisha_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:10 | 119K | |
| Bunnahabhain_2014_WCR_Clubabfüllung_import.png | 2024-08-13 17:10 | 138K | |
| Bunnahabhain_2014_WDS_Staoisha_Heavily_Peated_import.png | 2024-08-13 17:10 | 107K | |
| Bunnahabhain_2014_WroE_Staoisha_Warehouse_Reserve_import.png | 2024-08-13 17:10 | 94K | |
| Bunnahabhain_2016_UD_Spirit_of_Nauen_import.png | 2024-08-13 17:10 | 159K | |
| Bunnahabhain_2016_VAME_Mademoiselle_Pack-a-Day_import.png | 2024-08-13 17:10 | 109K | |
| Bunnahabhain_2016_VAME_Pegleg_Pete_import.png | 2024-08-13 17:10 | 111K | |
| Bunnahabhain_2018_Cl_Exploration_Series_import.png | 2024-08-13 17:10 | 123K | |
| Bunnahabhain_2018_WroE_Warehouse_Reserve_Moine_import.png | 2024-08-13 17:10 | 107K | |
| Bunnahabhain_2019_PDnl_Classics_of_Eyewear_-_Mr._Artist_-_Origin_import.png | 2024-08-13 17:10 | 147K | |
| Bunnahabhain_Abhainn_Araig_Feis_Ile_2022_import.png | 2024-08-13 17:10 | 122K | |
| Bunnahabhain_Batch_23_TBWC_import.png | 2024-08-13 17:10 | 130K | |
| Bunnahabhain_Bn10_ElD_Elements_of_Islay_import.png | 2024-08-13 17:10 | 180K | |
| Bunnahabhain_Feis_Ile_2023_Fèis_Ìle_import.png | 2024-08-13 17:10 | 134K | |
| Bunnahabhain_Honeyed_Smoke_Single_Cask_Release_import.png | 2024-08-13 17:10 | 122K | |
| Bunnahabhain_New_Acquaintance_Double_Wood_import.png | 2024-08-13 17:10 | 142K | |
| Bunnahabhain_Peat_&_Fruit_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 106K | |
| Bunnahabhain_Plum_Tobacco_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 136K | |
| Bunnahabhain_Smoke_&_Sherry_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 127K | |
| Bunnahabhain_Smoking_Sherry_Beast_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 123K | |
| Bunnahabhain_Staoisha_2013_TSCL_The_Single_Cask_import.png | 2024-08-13 17:10 | 174K | |
| Bunnahabhain_Staoisha_2014_SV_The_Un-Chillfiltered_Collection_-_Very_Cloudy_import.png | 2024-08-13 17:10 | 116K | |
| Bunnahabhain_Staoisha_2014_TSCL_The_Single_Cask_import.png | 2024-08-13 17:10 | 158K | |
| Bunnahabhain_Sultanas_&_Cigar_Smoke_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 125K | |
| Bunnahabhain_Sweet_&_Smoky_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 123K | |
| Burke_&_Wills_2018_No_2_-_Harold_Holt_import.png | 2024-08-13 17:10 | 136K | |
| Burns_Supper_Jubiläumswhisky_2023_Distillery_Bottling_import.png | 2024-08-13 17:10 | 125K | |
| Burnside_24-year-old_BW_The_Fine_Art_of_Whisky_import.png | 2024-08-13 17:10 | 127K | |
| Burnside_24-year-old_MOM_Forgotten_Gems_import.png | 2024-08-13 17:10 | 137K | |
| Burnside_1992_CDuS_import.png | 2024-08-13 17:10 | 115K | |
| Burnside_1993_TWf_The_Cat_Gallery_import.png | 2024-08-13 17:10 | 167K | |
| Burnside_1994_WPB_Emblem_05_import.png | 2024-08-13 17:10 | 220K | |
| Burnside_1999_BR_Single_Cask_import.png | 2024-08-13 17:10 | 134K | |
| Burnside_1999_BR_The_Single_Cask_import.png | 2024-08-13 17:10 | 114K | |
| Burnside_2011_CaG_import.png | 2024-08-13 17:10 | 161K | |
| Burnt_Ends_Supercharged_Blended_Whiskey_import.png | 2024-08-13 17:10 | 185K | |
| Bus_Whisky_2018_Batch_No._13_import.png | 2024-08-13 17:10 | 154K | |
| Bus_Whisky_2018_Special_Edition_Russian_Imperial_Stout_Finish_import.png | 2024-08-13 17:10 | 220K | |
| Bus_Whisky_2019_Batch_14_import.png | 2024-08-13 17:10 | 156K | |
| Bus_Whisky_2019_Batch_No._21_import.png | 2024-08-13 17:10 | 164K | |
| Bus_Whisky_2019_Single_Cask_import.png | 2024-08-13 17:10 | 148K | |
| Bus_Whisky_2019_import.png | 2024-08-13 17:10 | 253K | |
| Bus_Whisky_2020_Batch_No._26_import.png | 2024-08-13 17:10 | 153K | |
| Bus_Whisky_Single_Cask_Batch_No.20_import.png | 2024-08-13 17:10 | 157K | |
| Buscavidas_Whisky_from_Scotland_import.png | 2024-08-13 17:10 | 146K | |
| BushMuscatel2008.jpeg | 2024-08-13 17:10 | 93K | |
| Bushmills-Port-Cask-Steamship-776x1176.jpg | 2024-08-13 17:10 | 148K | |
| Bushmills-Steamship-Sherry-Cask-litre-776x1176.jpg | 2024-08-13 17:10 | 69K | |
| Bushmills 16.jpg | 2024-08-13 17:10 | 34K | |
| Bushmills Original.jpg | 2024-08-13 17:10 | 852K | |
| Bushmills_12-year-old_Causeway_Collection_import.png | 2024-08-13 17:10 | 276K | |
| Bushmills_25-year-old_import.png | 2024-08-13 17:10 | 152K | |
| Bushmills_30-year-old_import.png | 2024-08-13 17:10 | 171K | |
| Bushmills_1989_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 104K | |
| Bushmills_1996_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 119K | |
| Bushmills_1997_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 111K | |
| Bushmills_2002_SMWS_51.21_Delightful_Intervention_import.png | 2024-08-13 17:10 | 223K | |
| Bushmills_2002_TWBl_No._048_import.png | 2024-08-13 17:10 | 155K | |
| Bushmills_2002_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 133K | |
| Bushmills_2010_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 119K | |
| Bushmills_2011_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 120K | |
| Bushmills_2012_The_Causeway_Collection_import.png | 2024-08-13 17:10 | 119K | |
| Cadenheads_42-year-old_CA_Cambeltown_Malts_Festival_2023_import.png | 2024-08-13 17:10 | 113K | |
| Cadenheads_1824_CA_Oloroso_Matured_import.png | 2024-08-13 17:10 | 101K | |
| Cadenheads_1842_CA_Peated_import.png | 2024-08-13 17:10 | 83K | |
| Cadenheads_1842_CA_Sherry_cask_import.png | 2024-08-13 17:10 | 99K | |
| Cadenheads_Blended_Malt_Scotch_Whisky_CA_Oak_Cask_import.png | 2024-08-13 17:10 | 86K | |
| Cadenheads_Oak_Cask_CA_1842_-_Hand_filled_at_Cadenhead_Shop_Edinburgh_import.png | 2024-08-13 17:10 | 128K | |
| Cadenheads_Peated_Blended_Malt_CA_1842_-_Hand_filled_at_Cadenhead_Shop_Edinburgh_import.png | 2024-08-13 17:10 | 123K | |
| Cadenheads_Sherry_Cask_CA_1842_-_Hand_filled_at_Cadenhead_Shop_Edinburgh_import.png | 2024-08-13 17:10 | 127K | |
| Cadenheads_Vienna_Shop_Barrel_Blend_import.png | 2024-08-13 17:10 | 108K | |
| Café_Z_10-year-old_Peaty_&_Smoky_import.png | 2024-08-13 17:10 | 152K | |
| Caisteal_Chamuis_Blended_Malt_Scotch_Whisky_Island_import.png | 2024-08-13 17:10 | 148K | |
| Caledonian_1976_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 224K | |
| Caledonian_1987_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 143K | |
| Cambus_29-year-old_AtB_Darkness_import.png | 2024-08-13 17:10 | 144K | |
| Cambus_1976_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 127K | |
| Cambus_1982_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 144K | |
| Cambus_1988_DL_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 139K | |
| Cambus_1988_TWCe_Private_Cellars_Selection_Series_4_import.png | 2024-08-13 17:10 | 162K | |
| Cambus_1989_AC_Double_Matured_Selection_import.png | 2024-08-13 17:10 | 113K | |
| Cambus_1989_AC_Rare_&_Old_Selection_-_Miniature_import.png | 2024-08-13 17:10 | 132K | |
| Cambus_1989_AC_Rare_&_Old_Selection_import.png | 2024-08-13 17:10 | 104K | |
| Cambus_1991_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 250K | |
| Cambus_1991_HL_The_Sovereign_import.png | 2024-08-13 17:10 | 138K | |
| Cambus_1991_HL_import.png | 2024-08-13 17:10 | 127K | |
| Cambus_1991_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 145K | |
| Cameronbridge_09-year-old_FicW_Pictish_Beastie_Volume_1_import.png | 2024-08-13 17:10 | 168K | |
| Cameronbridge_13-year-old_BNSp_Whisky_of_Voodoo_import.png | 2024-08-13 17:10 | 116K | |
| Cameronbridge_26-year-old_Diageo_Special_Releases_2022_import.png | 2024-08-13 17:10 | 106K | |
| Cameronbridge_1975_PST_Error_502_Series_import.png | 2024-08-13 17:10 | 83K | |
| Cameronbridge_1976_MBl_The_Grainman_import.png | 2024-08-13 17:10 | 188K | |
| Cameronbridge_1978_DL_Celebrating_75th_Anniversary_import.png | 2024-08-13 17:10 | 128K | |
| Cameronbridge_1978_DL_import.png | 2024-08-13 17:10 | 127K | |
| Cameronbridge_1982_WhB_import.png | 2024-08-13 17:10 | 146K | |
| Cameronbridge_1984_DL_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 203K | |
| Cameronbridge_1984_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 142K | |
| Cameronbridge_1989_CA_Warehouse_Tasting_import.png | 2024-08-13 17:10 | 141K | |
| Cameronbridge_1991_DL_Old_Particular_import.png | 2024-08-13 17:10 | 119K | |
| Cameronbridge_1991_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 250K | |
| Cameronbridge_1992_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 92K | |
| Cameronbridge_1992_LBDS_Wee_Broon_Coo_import.png | 2024-08-13 17:10 | 148K | |
| Cameronbridge_1992_SCC_The_Independent_Selection_import.png | 2024-08-13 17:10 | 102K | |
| Cameronbridge_1992_VM_The_Cooper´s_Choice_import.png | 2024-08-13 17:10 | 115K | |
| Cameronbridge_1992_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 158K | |
| Cameronbridge_1998_JE_import.png | 2024-08-13 17:10 | 100K | |
| Cameronbridge_2006_Cl_Claxtons_Exclusive_import.png | 2024-08-13 17:10 | 225K | |
| Cameronbridge_2006_Cl_Exploration_Series_import.png | 2024-08-13 17:10 | 122K | |
| Cameronbridge_2006_DHGS_Connoisseurs_Dram_import.png | 2024-08-13 17:10 | 142K | |
| Cameronbridge_2006_FibW_The_Wee_Couper_of_Fife_import.png | 2024-08-13 17:10 | 132K | |
| Cameronbridge_2006_TWTC_Club_Members_Only_import.png | 2024-08-13 17:10 | 102K | |
| Cameronbridge_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 116K | |
| Cameronbridge_2010_ICC_Signature_Series_import.png | 2024-08-13 17:10 | 83K | |
| Campbeltown_2014_AtMy_Wasted_Wolf_Whisky_import.png | 2024-08-13 17:10 | 97K | |
| Campbeltown_2014_MoM_import.png | 2024-08-13 17:10 | 96K | |
| Campbeltown_2014_NSS_Cask_Series_021_import.png | 2024-08-13 17:10 | 160K | |
| Campbeltown_2014_NSS_Cask_Series_023_import.png | 2024-08-13 17:10 | 173K | |
| Campbeltown_2014_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 122K | |
| Campbeltown_2016_ED_The_First_Editions_import.png | 2024-08-13 17:10 | 126K | |
| Campbeltown_Batch_3_TBWC_import.png | 2024-08-13 17:10 | 286K | |
| Campbeltown_Blended_Malt_15-year-old_CA_Enigma_import.png | 2024-08-13 17:10 | 101K | |
| Campbeltown_Blended_Malt_2014_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 91K | |
| Campbeltown_Blended_Malt_2016_Cl_Historical_Switzerland_Postcard_Edition_2_import.png | 2024-08-13 17:10 | 99K | |
| Campbeltown_Blended_Malt_2017_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 85K | |
| Campbeltown_Blended_Malt_Scotch_Whisky_2014_NSS_Cask_Series_019_import.png | 2024-08-13 17:10 | 248K | |
| Campbeltown_Blended_Malt_Scotch_Whisky_2016_TCaH_Pat_Hock_Whisky_import.png | 2024-08-13 17:10 | 126K | |
| Campbeltown_Loch_Blended_Malt_Scotch_Whisky_100%_Campbeltown_Whiskies_import.png | 2024-08-13 17:10 | 140K | |
| Campbeltown_PBS_Cadenheads_1842_CA_import.png | 2024-08-13 17:10 | 107K | |
| Campbeltown_Region_2016_Cl_Exploration_Series_import.png | 2024-08-13 17:10 | 121K | |
| Canadian_Corn_Whisky_08-year-old_PST_import.png | 2024-08-13 17:10 | 97K | |
| Candid_Malt_Whisky_MCo_The_new_Disclosure_expression_import.png | 2024-08-13 17:10 | 126K | |
| Candlekitty_2010_WSP_Edition_No._78_import.png | 2024-08-13 17:10 | 96K | |
| Canmore_2009_import.png | 2024-08-13 17:10 | 271K | |
| Caol Ila 18.jpg | 2024-08-13 17:10 | 88K | |
| Caol_Ila_06-year-old_Tast_Cosmic_Casks_01_import.png | 2024-08-13 17:10 | 127K | |
| Caol_Ila_07-year-old_NSS_Periodical_import.png | 2024-08-13 17:10 | 179K | |
| Caol_Ila_08-year-old_PSL_import.png | 2024-08-13 17:10 | 209K | |
| Caol_Ila_10-year-old_CA_Original_Collection_import.png | 2024-08-13 17:10 | 143K | |
| Caol_Ila_10-year-old_Mr&S_Fine_&_Rare_import.png | 2024-08-13 17:10 | 99K | |
| Caol_Ila_11-year-old_BNSp_Whisky_of_Voodoo_import.png | 2024-08-13 17:10 | 117K | |
| Caol_Ila_11-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 119K | |
| Caol_Ila_11-year-old_CA_Original_Collection_import.png | 2024-08-13 17:10 | 141K | |
| Caol_Ila_11-year-old_ChWh_import.png | 2024-08-13 17:10 | 119K | |
| Caol_Ila_11-year-old_HL_Ardnahoe_Distillery_Warehouse_No._1_Tasting_import.png | 2024-08-13 17:10 | 127K | |
| Caol_Ila_11-year-old_TFWC_A_Firkin_Original_import.png | 2024-08-13 17:10 | 194K | |
| Caol_Ila_11-year-old_TWCe_Pintail_import.png | 2024-08-13 17:10 | 93K | |
| Caol_Ila_12-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_13-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 128K | |
| Caol_Ila_13-year-old_Feis_Ile_2023_import.png | 2024-08-13 17:10 | 85K | |
| Caol_Ila_13-year-old_SC&C_import.png | 2024-08-13 17:10 | 226K | |
| Caol_Ila_14-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 123K | |
| Caol_Ila_14-year-old_Four_Corners_of_Scotland_Collection_import.png | 2024-08-13 17:10 | 94K | |
| Caol_Ila_14-year-old_MoM_Black_Friday_2023_import.png | 2024-08-13 17:10 | 87K | |
| Caol_Ila_14-year-old_TSCL_import.png | 2024-08-13 17:10 | 191K | |
| Caol_Ila_15-year-old_Feis_Ile_2022_import.png | 2024-08-13 17:10 | 100K | |
| Caol_Ila_15-year-old_SMWS_53.467_Tongue_twisters_of_smoke_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_15-year_old_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 165K | |
| Caol_Ila_16-year-old_WDM_import.png | 2024-08-13 17:10 | 131K | |
| Caol_Ila_17-year-old_AtB_Darkness_import.png | 2024-08-13 17:10 | 140K | |
| Caol_Ila_20-year-old_Distillery_Exclusive_Handfilled_Single_Cask_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_31-year-old_CA_Campbeltown_Malts_Festival_2022_import.png | 2024-08-13 17:10 | 179K | |
| Caol_Ila_32-Year-old_HL_The_Kinship_-_Edition_No._4_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_33-year-old_HL_The_Kinship_-_Edition_No._4_import.png | 2024-08-13 17:10 | 127K | |
| Caol_Ila_1981_CA_Shop_Label_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_1982_GM_Private_Collection_import.png | 2024-08-13 17:10 | 178K | |
| Caol_Ila_1990_Cask_of_Distinction_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_1990_WCon_import.png | 2024-08-13 17:10 | 93K | |
| Caol_Ila_1991_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_1993_SMWS_53.461_Enthralling_Elegance_import.png | 2024-08-13 17:10 | 90K | |
| Caol_Ila_1996_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 121K | |
| Caol_Ila_2003_WSP_Edition_No._54_import.png | 2024-08-13 17:10 | 113K | |
| Caol_Ila_2003_WSP_Edition_No._55_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2004_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 140K | |
| Caol_Ila_2006_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:10 | 124K | |
| Caol_Ila_2006_CA_Authentic_Collection_import.png | 2024-08-13 17:10 | 110K | |
| Caol_Ila_2006_CA_Warehouse_Tasting_import.png | 2024-08-13 17:10 | 225K | |
| Caol_Ila_2006_ElD_The_Whisky_Trail-Earthy_import.png | 2024-08-13 17:10 | 89K | |
| Caol_Ila_2006_FnTs_Private_Cask_Collection_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2006_MW_They_Inspired_III_-_Whisky_Icons_import.png | 2024-08-13 17:10 | 102K | |
| Caol_Ila_2006_MoS_The_warehouse_dram_No._28_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2006_UD_import.png | 2024-08-13 17:10 | 223K | |
| Caol_Ila_2007_BD_import.png | 2024-08-13 17:10 | 156K | |
| Caol_Ila_2007_BR_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_2007_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:10 | 98K | |
| Caol_Ila_2007_DL_Old_Particular_-_The_Dutch_Dram_Masters_import.png | 2024-08-13 17:10 | 115K | |
| Caol_Ila_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2007_GlMo_A_Rare_Find_import.png | 2024-08-13 17:10 | 84K | |
| Caol_Ila_2007_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_2007_HiSp_Highproof_import.png | 2024-08-13 17:10 | 143K | |
| Caol_Ila_2007_JE_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2007_JW_Caskman_no_4_import.png | 2024-08-13 17:10 | 124K | |
| Caol_Ila_2007_K23_Dram_Brothers_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2007_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:10 | 85K | |
| Caol_Ila_2007_MBa_No._210_import.png | 2024-08-13 17:10 | 97K | |
| Caol_Ila_2007_RM_import.png | 2024-08-13 17:10 | 113K | |
| Caol_Ila_2007_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 149K | |
| Caol_Ila_2007_TSD_import.png | 2024-08-13 17:10 | 258K | |
| Caol_Ila_2007_V&M_The_Spirit_of_Art_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2007_WM_Barrel_Selection_-_30th_Anniversary_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2007_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2007_WhB_import.png | 2024-08-13 17:10 | 87K | |
| Caol_Ila_2008_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 86K | |
| Caol_Ila_2008_Cl_Warehouse_No._1_import.png | 2024-08-13 17:10 | 242K | |
| Caol_Ila_2008_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_2008_DT_The_Octave_Premium_import.png | 2024-08-13 17:10 | 95K | |
| Caol_Ila_2008_Df_Dramfools_middle_cut_import.png | 2024-08-13 17:10 | 137K | |
| Caol_Ila_2008_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:10 | 123K | |
| Caol_Ila_2008_GM_import.png | 2024-08-13 17:10 | 121K | |
| Caol_Ila_2008_GlMo_A_Rare_Find_import.png | 2024-08-13 17:10 | 93K | |
| Caol_Ila_2008_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_2008_HSC_Masters_Of_Magic_import.png | 2024-08-13 17:10 | 135K | |
| Caol_Ila_2008_Hhd_import.png | 2024-08-13 17:10 | 87K | |
| Caol_Ila_2008_LIQ_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_2008_NSpS_Modernism_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2008_RBTW_import.png | 2024-08-13 17:10 | 168K | |
| Caol_Ila_2008_Soh_Soho_Selection_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2008_TCaH_Tasting_Tour_import.png | 2024-08-13 17:10 | 106K | |
| Caol_Ila_2008_TSCL_Family_Series_import.png | 2024-08-13 17:10 | 179K | |
| Caol_Ila_2008_TSCL_German_Cigar_Malt_2022_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2008_TSCL_import.png | 2024-08-13 17:10 | 174K | |
| Caol_Ila_2008_TWC_import.png | 2024-08-13 17:10 | 108K | |
| Caol_Ila_2008_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 260K | |
| Caol_Ila_2008_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2008_cQs_import.png | 2024-08-13 17:10 | 108K | |
| Caol_Ila_2009_AD_Selection_import.png | 2024-08-13 17:10 | 96K | |
| Caol_Ila_2009_DL_Old_Particular_import.png | 2024-08-13 17:10 | 114K | |
| Caol_Ila_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 118K | |
| Caol_Ila_2009_GM_Connoisseurs_Choice_-_Wood_Finished_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_2009_HiSp_import.png | 2024-08-13 17:10 | 136K | |
| Caol_Ila_2009_IS&m_The_Islay_Whisky_Vault_import.png | 2024-08-13 17:10 | 87K | |
| Caol_Ila_2009_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2009_SMWS_53.434_Tarred_and_pickled_import.png | 2024-08-13 17:10 | 114K | |
| Caol_Ila_2009_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 163K | |
| Caol_Ila_2009_SV_van_der_Heijden_Selection_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2009_Sa_import.png | 2024-08-13 17:10 | 121K | |
| Caol_Ila_2009_TCaH_import.png | 2024-08-13 17:10 | 140K | |
| Caol_Ila_2009_TDW_import.png | 2024-08-13 17:10 | 93K | |
| Caol_Ila_2009_WM_Barrel_Selection_-_30th_Anniversary_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2009_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2009_WSP_Edition_No._66_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2010_AD_Selection_import.png | 2024-08-13 17:10 | 89K | |
| Caol_Ila_2010_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2010_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:10 | 123K | |
| Caol_Ila_2010_BNSp_The_Yellow_Edition_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2010_BR_Single_Cask_import.png | 2024-08-13 17:10 | 123K | |
| Caol_Ila_2010_BR_Small_Batch_import.png | 2024-08-13 17:10 | 137K | |
| Caol_Ila_2010_BR_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2010_BuBa_The_Sticky_Label_-_Vintage_War_Series_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2010_DC_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2010_DST_Syrah_Edition_import.png | 2024-08-13 17:10 | 117K | |
| Caol_Ila_2010_DST_Tulip_Edition_import.png | 2024-08-13 17:10 | 108K | |
| Caol_Ila_2010_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2010_GM_Connoisseurs_Choice_-_Wood_Finished_import.png | 2024-08-13 17:10 | 127K | |
| Caol_Ila_2010_GWM_Goldfinch_Bodega_Series_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_2010_GWM_Paloma_import.png | 2024-08-13 17:10 | 158K | |
| Caol_Ila_2010_GWM_The_Kilnsmans_Dram_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2010_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:10 | 136K | |
| Caol_Ila_2010_Hand_bottled_at_Distillery_import.png | 2024-08-13 17:10 | 102K | |
| Caol_Ila_2010_ImpEx_The_ImpEx_Collection_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2010_JE_Sherry_Cask_Finish_import.png | 2024-08-13 17:10 | 99K | |
| Caol_Ila_2010_JE_Small_Batch_import.png | 2024-08-13 17:10 | 99K | |
| Caol_Ila_2010_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:10 | 110K | |
| Caol_Ila_2010_LMDW_Artist_Collective_#6.8_import.png | 2024-08-13 17:10 | 154K | |
| Caol_Ila_2010_LT_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_2010_LsD_Hepburn’s_choice_import.png | 2024-08-13 17:10 | 251K | |
| Caol_Ila_2010_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 160K | |
| Caol_Ila_2010_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 107K | |
| Caol_Ila_2010_SV_Vintage_Collection_import.png | 2024-08-13 17:10 | 99K | |
| Caol_Ila_2010_SdS_Wonders_Of_The_World_import.png | 2024-08-13 17:10 | 163K | |
| Caol_Ila_2010_T&O_Smoke_Tales_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2010_TWB_Saturn_V_50th_Anniversary_Edition_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2010_UD_Puzzle_-_The_Navigator_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2010_WAGE_No._0022_import.png | 2024-08-13 17:10 | 106K | |
| Caol_Ila_2010_WCon_Op.6_-_Bonfire_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2010_WhB_Cree_import.png | 2024-08-13 17:10 | 105K | |
| Caol_Ila_2010_WhB_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2011_BR_Single_Cask_import.png | 2024-08-13 17:10 | 136K | |
| Caol_Ila_2011_BR_import.png | 2024-08-13 17:10 | 129K | |
| Caol_Ila_2011_Cl_Warehouse_No._8_import.png | 2024-08-13 17:10 | 209K | |
| Caol_Ila_2011_DHGS_Connoisseurs_Dram_import.png | 2024-08-13 17:10 | 132K | |
| Caol_Ila_2011_DL_Old_Particular_import.png | 2024-08-13 17:10 | 204K | |
| Caol_Ila_2011_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:10 | 100K | |
| Caol_Ila_2011_FnTs_Private_Cask_Collection_import.png | 2024-08-13 17:10 | 185K | |
| Caol_Ila_2011_Fs_Slainté_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2011_JE_import.png | 2024-08-13 17:10 | 105K | |
| Caol_Ila_2011_Joy_SPECIAL_RELEASES_-_NO.4_import.png | 2024-08-13 17:10 | 263K | |
| Caol_Ila_2011_KCC_Fragrant_Drops_import.png | 2024-08-13 17:10 | 168K | |
| Caol_Ila_2011_LoDz_Rambler_import.png | 2024-08-13 17:10 | 106K | |
| Caol_Ila_2011_PSL_Fable_Whisky_-_Chapter_One_import.png | 2024-08-13 17:10 | 122K | |
| Caol_Ila_2011_SCSM_import.png | 2024-08-13 17:10 | 212K | |
| Caol_Ila_2011_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 250K | |
| Caol_Ila_2011_ScRo_Naturally_in_High_Spirits_import.png | 2024-08-13 17:10 | 270K | |
| Caol_Ila_2011_TGSC_import.png | 2024-08-13 17:10 | 152K | |
| Caol_Ila_2011_WB_230.000_bottles_in_Whiskybase_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2011_WN_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2011_vW_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_2012_AD_Selection_import.png | 2024-08-13 17:10 | 81K | |
| Caol_Ila_2012_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2012_CA_Cadenhead’s_Club_10th_Anniversary_import.png | 2024-08-13 17:10 | 135K | |
| Caol_Ila_2012_CA_Warehouse_Tasting_import.png | 2024-08-13 17:10 | 145K | |
| Caol_Ila_2012_Ca88_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2012_DL_Old_Particular_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2012_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:10 | 93K | |
| Caol_Ila_2012_GWhL_Auld_Goonsys_import.png | 2024-08-13 17:10 | 168K | |
| Caol_Ila_2012_JE_Single_Cask_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_2012_LotG_Limited_Edition_import.png | 2024-08-13 17:10 | 120K | |
| Caol_Ila_2012_PST_import.png | 2024-08-13 17:10 | 98K | |
| Caol_Ila_2012_PotS_Inverdarach_Potstill_Editions_Trì_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2012_SC&C_50th_Anniversary_import.png | 2024-08-13 17:10 | 279K | |
| Caol_Ila_2012_SCC_The_Independent_Selection_import.png | 2024-08-13 17:10 | 96K | |
| Caol_Ila_2012_SMWS_53.425_Illeach_ceviche_import.png | 2024-08-13 17:10 | 101K | |
| Caol_Ila_2012_SMWS_53.427_Stir-fried_peat_import.png | 2024-08-13 17:10 | 231K | |
| Caol_Ila_2012_SMWS_53.436_Le_peat_reek,_cest_magnifique!_import.png | 2024-08-13 17:10 | 117K | |
| Caol_Ila_2012_SMWS_53.451_Particle_accelerator_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2012_SMWS_53.455_Plasticity_in_our_city_import.png | 2024-08-13 17:10 | 115K | |
| Caol_Ila_2012_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:10 | 161K | |
| Caol_Ila_2012_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:10 | 96K | |
| Caol_Ila_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 109K | |
| Caol_Ila_2012_Sxwh_Premium_Quality_import.png | 2024-08-13 17:10 | 201K | |
| Caol_Ila_2012_TFWC_The_Firkin_Islay_import.png | 2024-08-13 17:10 | 252K | |
| Caol_Ila_2012_WM_Barrel_Selection_-_30th_Anniversary_import.png | 2024-08-13 17:10 | 89K | |
| Caol_Ila_2012_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:10 | 91K | |
| Caol_Ila_2012_import.png | 2024-08-13 17:10 | 100K | |
| Caol_Ila_2013_BA_Raw_Cask_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2013_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 83K | |
| Caol_Ila_2013_Cl_Exploration_Series_import.png | 2024-08-13 17:10 | 124K | |
| Caol_Ila_2013_Cl_Warehouse_No._1_import.png | 2024-08-13 17:10 | 227K | |
| Caol_Ila_2013_Cl_Warehouse_No._8_import.png | 2024-08-13 17:10 | 154K | |
| Caol_Ila_2013_DL_Provenance_-_Special_Edition_import.png | 2024-08-13 17:10 | 240K | |
| Caol_Ila_2013_DL_Provenance_-_Special_Selection_import.png | 2024-08-13 17:10 | 240K | |
| Caol_Ila_2013_DL_Provenance_-_Year_of_the_Rabbit_import.png | 2024-08-13 17:10 | 247K | |
| Caol_Ila_2013_GWhL_Auld_Goonsys_Malt_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2013_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:10 | 151K | |
| Caol_Ila_2013_GtDr_Single_Cask_Series_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2013_HoM_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2013_JE_Cask_Strength_import.png | 2024-08-13 17:10 | 232K | |
| Caol_Ila_2013_LMDW_Artist_Collective_#6.1_import.png | 2024-08-13 17:10 | 165K | |
| Caol_Ila_2013_LotG_Rare_Cask_import.png | 2024-08-13 17:10 | 113K | |
| Caol_Ila_2013_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:10 | 106K | |
| Caol_Ila_2013_PST_Error_502_Bad_Gateway_import.png | 2024-08-13 17:10 | 85K | |
| Caol_Ila_2013_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 154K | |
| Caol_Ila_2013_SV_Limited_Animal_Edition_No._4_import.png | 2024-08-13 17:10 | 164K | |
| Caol_Ila_2013_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:10 | 102K | |
| Caol_Ila_2013_SV_Vintage_Collection_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_2013_Sa_Islay_Single_Malt_import.png | 2024-08-13 17:10 | 130K | |
| Caol_Ila_2013_Sa_import.png | 2024-08-13 17:10 | 121K | |
| Caol_Ila_2013_TWEx_import.png | 2024-08-13 17:10 | 87K | |
| Caol_Ila_2013_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:10 | 112K | |
| Caol_Ila_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:10 | 108K | |
| Caol_Ila_2013_WNT_Epitome_import.png | 2024-08-13 17:10 | 114K | |
| Caol_Ila_2013_WroE_Warehouse_Experiment_import.png | 2024-08-13 17:10 | 155K | |
| Caol_Ila_2014_3W_Holy_Smokes_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_2014_3W_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2014_BWM_Less_is_More_import.png | 2024-08-13 17:10 | 158K | |
| Caol_Ila_2014_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:10 | 92K | |
| Caol_Ila_2014_HWM_Dalgety_import.png | 2024-08-13 17:10 | 141K | |
| Caol_Ila_2014_ICC_Cask,_Plants_&_Blossoms_import.png | 2024-08-13 17:10 | 98K | |
| Caol_Ila_2014_ICC_Jubiläumsabfüllung_import.png | 2024-08-13 17:10 | 96K | |
| Caol_Ila_2014_LotG_UK_Festivals_and_Tastings_Exclusive_2023_import.png | 2024-08-13 17:10 | 110K | |
| Caol_Ila_2014_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:10 | 265K | |
| Caol_Ila_2014_MM_Benchmark_-_Versailles_2022_first_edition_import.png | 2024-08-13 17:10 | 134K | |
| Caol_Ila_2014_MM_Benchmark_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_2014_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:10 | 131K | |
| Caol_Ila_2014_NSS_Cask_Series_019_import.png | 2024-08-13 17:10 | 157K | |
| Caol_Ila_2014_NSS_Cask_Series_020_import.png | 2024-08-13 17:10 | 147K | |
| Caol_Ila_2014_PST_import.png | 2024-08-13 17:10 | 116K | |
| Caol_Ila_2014_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:10 | 114K | |
| Caol_Ila_2014_TCaH_Tasting_Tour_import.png | 2024-08-13 17:10 | 103K | |
| Caol_Ila_2014_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:10 | 113K | |
| Caol_Ila_2014_WM_Barrel_Selection_import.png | 2024-08-13 17:10 | 95K | |
| Caol_Ila_2015_LT_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2015_LotG_Rare_Cask_import.png | 2024-08-13 17:10 | 118K | |
| Caol_Ila_2015_NSS_Cask_Series_023_import.png | 2024-08-13 17:10 | 165K | |
| Caol_Ila_2015_SV_The_Un-Chillfiltered_Collection_-_Very_Cloudy_import.png | 2024-08-13 17:10 | 104K | |
| Caol_Ila_2015_SWW_Sieberts_Birthday_Dram_import.png | 2024-08-13 17:10 | 121K | |
| Caol_Ila_2015_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:10 | 113K | |
| Caol_Ila_2015_WM_Barrel_Selection_import.png | 2024-08-13 17:10 | 111K | |
| Caol_Ila_2015_WhB_Cree_import.png | 2024-08-13 17:10 | 97K | |
| Caol_Ila_2015_vW_The_Ultimate_import.png | 2024-08-13 17:10 | 108K | |
| Caol_Ila_2016_Cl_Exclusives_import.png | 2024-08-13 17:10 | 100K | |
| Caol_Ila_2016_G&P_Hirschenbrunner_Spirits_Edition_import.png | 2024-08-13 17:10 | 98K | |
| Caol_Ila_2016_Hisp_Region_Islay_import.png | 2024-08-13 17:10 | 130K | |
| Caol_Ila_2016_HoMc_Vintage_Collection_import.png | 2024-08-13 17:10 | 139K | |
| Caol_Ila_2016_IN2S_Release_03_import.png | 2024-08-13 17:10 | 102K | |
| Caol_Ila_2016_LoDz_Rambler_Stories_-_Baba_Jaga_import.png | 2024-08-13 17:10 | 135K | |
| Caol_Ila_2016_SV_Islay_Selection_import.png | 2024-08-13 17:10 | 90K | |
| Caol_Ila_2016_WhHD_import.png | 2024-08-13 17:10 | 110K | |
| Caol_Ila_2018_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:10 | 137K | |
| Caol_Ila_Batch_23_TBWC_import.png | 2024-08-13 17:10 | 137K | |
| Caol_Ila_Bonfires_&_Blackberries_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 114K | |
| Caol_Ila_Cl14_ElD_Elements_of_Islay_import.png | 2024-08-13 17:10 | 157K | |
| Caol_Ila_Creosote_&_Candied_Fruits_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 287K | |
| Caol_Ila_Peat_&_Fruit_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 105K | |
| Caol_Ila_Peat_&_Fruit_VM_The_Coopers_Choice_import.png | 2024-08-13 17:10 | 126K | |
| Caol_Ila_Stairsneach_AcL_import.png | 2024-08-13 17:10 | 218K | |
| Caol_Ila_The_Distillers_Edition_2022_import.png | 2024-08-13 17:10 | 96K | |
| Cape_Byron_Chardonnay_Cask_Australian_Single_Malt_Whisky_import.png | 2024-08-13 17:10 | 132K | |
| Cape_Byron_The_Original_import.png | 2024-08-13 17:10 | 175K | |
| Caperdonich_18-year-old_Peated_-_Small_Batch_Release_import.png | 2024-08-13 17:10 | 215K | |
| Caperdonich_21-year-old_import.png | 2024-08-13 17:10 | 129K | |
| Caperdonich_25-year-old_-_Peated_Small_Batch_Release_import.png | 2024-08-13 17:10 | 130K | |
| Caperdonich_25-year-old_Small_Batch_Release_import.png | 2024-08-13 17:10 | 138K | |
| Caperdonich_1972_GM_Private_Collection_import.png | 2024-08-13 17:10 | 164K | |
| Caperdonich_1979_GM_Private_Collection_import.png | 2024-08-13 17:10 | 272K | |
| Caperdonich_1994_TWC_import.png | 2024-08-13 17:10 | 109K | |
| Caperdonich_1997_The_Duchess_Game_&_Wildlife_series_import.png | 2024-08-13 17:10 | 117K | |
| Caperdonich_2000_SV_Cask_Strengh_Collection_import.png | 2024-08-13 17:10 | 148K | |
| Caperdonich_2000_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 144K | |
| Caperdonich_2000_SV_import.png | 2024-08-13 17:10 | 157K | |
| Cardhu_11-year-old_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:10 | 177K | |
| Cardhu_15-year-old_The_Cummings_of_Cardhu_import.png | 2024-08-13 17:10 | 168K | |
| Cardhu_16-year-old_Diageo_Special_Releases_2022_import.png | 2024-08-13 17:10 | 102K | |
| Cardhu_18-year-old_The_Cummings_of_Cardhu_import.png | 2024-08-13 17:10 | 168K | |
| Carlow_Counting_Days_Irish_Whiskey_import.png | 2024-08-13 17:10 | 136K | |
| Carp_2017_SpSw_import.png | 2024-08-13 17:10 | 261K | |
| Carpathian_Amarone_Italian_Wine_Cask_Collection_import.png | 2024-08-13 17:10 | 132K | |
| Carpathian_Fetească_Neagră_Romanian_Wine_Cask_Collection_import.png | 2024-08-13 17:10 | 141K | |
| Carpathian_Pedro_Ximénez_Spanish_&_Portuguese_Wine_Cask_Collection_import.png | 2024-08-13 17:10 | 139K | |
| Carpathian_Single_Malt_French_Cask_Collection_import.png | 2024-08-13 17:10 | 146K | |
| Carpathian_Tawny_Port_Spanish_&_Portuguese_Wine_Cask_Collection_import.png | 2024-08-13 17:10 | 141K | |
| Carpathian_Vradiano_Greek_&_Cypriot_Wine_Collection_import.png | 2024-08-13 17:10 | 120K | |
| Carsebridge_1976_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 251K | |
| Cask_Orkney_15-year-old_DR_import.png | 2024-08-13 17:10 | 136K | |
| Caskmatesdevilscraft.jpg | 2024-08-13 17:10 | 89K | |
| Castle_&_Key_Small_Batch_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:10 | 161K | |
| Castle_&_Key_Wheated_Bourbon_import.png | 2024-08-13 17:10 | 161K | |
| Catfish_2017_SpSw_import.png | 2024-08-13 17:10 | 255K | |
| Cawdor_Spring_2015_ElD_The_Whisky_Trail_import.png | 2024-08-13 17:10 | 101K | |
| Cedar_Ridge_No._9_Red_Cask_-_Strictly_Limited_Bottling_import.png | 2024-08-13 17:10 | 172K | |
| Ceibo_Original_Whisky_de_Manabí_import.png | 2024-08-13 17:10 | 107K | |
| Celtic_Cask_2001_-_Daichead_a_Haon_-_41_Single_Cask_import.png | 2024-08-13 17:10 | 160K | |
| Celtic_Cask_2002_-_Triocha_a_Naoi_-_39_Single_Cask_import.png | 2024-08-13 17:10 | 150K | |
| Celtic_Cask_2003_Single_Cask_import.png | 2024-08-13 17:10 | 123K | |
| Celtic_Cask_2009_-_Daichead_a_Do_-_42_Single_cask_import.png | 2024-08-13 17:10 | 166K | |
| Celtic_Cask_2014_Daichead_a_Ceathair_-_44_import.png | 2024-08-13 17:10 | 185K | |
| Celtic_Whisky_2016_SdS_Wonders_Of_The_World_import.png | 2024-08-13 17:10 | 140K | |
| ChapelgateLogoJPG.jpg | 2024-08-13 17:10 | 20K | |
| Charbay_08-year-old_Single_Barrel_import.png | 2024-08-13 17:10 | 123K | |
| Charbay_Single_Barrel_Barrel_Select_import.png | 2024-08-13 17:10 | 95K | |
| Charleys_French_Oak_Cask_Limited_Edition_import.png | 2024-08-13 17:10 | 136K | |
| Charlie_Parrys_03-year-old_Cask_Strength_Straight_Bourbon_import.png | 2024-08-13 17:10 | 103K | |
| Charlier_Esprit_de_Malt_des_Ardennes_import.png | 2024-08-13 17:10 | 160K | |
| Chattanooga_Whiskey_04-year-old_Experimental_Single_Batch_Series_import.png | 2024-08-13 17:10 | 159K | |
| Chattanooga_Whiskey_2017_Experimental_-_Single_Barrel_import.png | 2024-08-13 17:10 | 150K | |
| Chattanooga_Whiskey_2018_Bottled_in_Bond_Spring_import.png | 2024-08-13 17:10 | 141K | |
| Chattanooga_Whiskey_2018_Experimental_-_Single_Barrel_import.png | 2024-08-13 17:10 | 117K | |
| Chattanooga_Whiskey_Islay_Scotch_Cask_Finish_Barrel_Finishing_Series_import.png | 2024-08-13 17:10 | 158K | |
| Chichibu_52_Seats_of_Happiness_Ichiros_Malt_import.png | 2024-08-13 17:10 | 106K | |
| Chichibu_2009_Cask_Sample_Bottle_import.png | 2024-08-13 17:10 | 261K | |
| Chichibu_2010_Cask_Sample_Bottle_import.png | 2024-08-13 17:10 | 262K | |
| Chichibu_2010_import.png | 2024-08-13 17:10 | 241K | |
| Chichibu_2012_Cask_Sample_Bottle_import.png | 2024-08-13 17:10 | 306K | |
| Chichibu_2012_Cask_Sample_import.png | 2024-08-13 17:10 | 251K | |
| Chichibu_2012_import.png | 2024-08-13 17:10 | 139K | |
| Chichibu_2013_AD_Adelphi_Selection_import.png | 2024-08-13 17:10 | 77K | |
| Chichibu_2013_AD_Selection_import.png | 2024-08-13 17:10 | 77K | |
| Chichibu_2013_Glover_Collection_import.png | 2024-08-13 17:10 | 100K | |
| Chichibu_2013_Ichiros_Malt_import.png | 2024-08-13 17:10 | 274K | |
| Chichibu_2013_Malt_Dream_Cask_for_PEACE_import.png | 2024-08-13 17:10 | 120K | |
| Chichibu_2013_SMWS_130.6_While_away_the_hours_import.png | 2024-08-13 17:10 | 92K | |
| Chichibu_2013_import.png | 2024-08-13 17:10 | 120K | |
| Chichibu_2014_Chichibu_Stamp_Rally_import.png | 2024-08-13 17:10 | 355K | |
| Chichibu_2014_HBA_2022_import.png | 2024-08-13 17:10 | 176K | |
| Chichibu_2014_Ichiros_Malt_import.png | 2024-08-13 17:10 | 265K | |
| Chichibu_2014_New_Vibrations_import.png | 2024-08-13 17:10 | 96K | |
| Chichibu_2014_Specifiaction_import.png | 2024-08-13 17:10 | 106K | |
| Chichibu_2014_import.png | 2024-08-13 17:10 | 263K | |
| Chichibu_2015_Heavily_Peated_import.png | 2024-08-13 17:10 | 149K | |
| Chichibu_2015_Ichiros_Malt_import.png | 2024-08-13 17:10 | 111K | |
| Chichibu_2015_Kens_Choice_import.png | 2024-08-13 17:10 | 110K | |
| Chichibu_2015_import.png | 2024-08-13 17:10 | 99K | |
| Chichibu_2016_-_7EVEN_Gods_of_Fortune_Series_Edition_1_-_Ebisu_import.png | 2024-08-13 17:10 | 123K | |
| Chichibu_2016_-_7EVEN_Gods_of_Fortune_Series_Edition_2_-_Hotei_import.png | 2024-08-13 17:10 | 123K | |
| Chichibu_2016_7EVEN_Gods_of_Fortune_import.png | 2024-08-13 17:10 | 119K | |
| Chichibu_2016_Glover_Collection_import.png | 2024-08-13 17:10 | 107K | |
| Chichibu_2016_Ichiros_Malt_import.png | 2024-08-13 17:10 | 106K | |
| Chichibu_2016_import.png | 2024-08-13 17:10 | 97K | |
| Chichibu_2017_7EVEN_Gods_of_Fortune_import.png | 2024-08-13 17:10 | 113K | |
| Chichibu_2017_Flowers_Series_#_3_import.png | 2024-08-13 17:10 | 119K | |
| Chichibu_2017_Ichiros_Malt_import.png | 2024-08-13 17:10 | 117K | |
| Chichibu_2021_Ichiros_Malt_import.png | 2024-08-13 17:10 | 254K | |
| Chichibu_CECBL_2022_ElD_CECBL_XII_Encuentro_Anual_import.png | 2024-08-13 17:10 | 148K | |
| Chichibu_Paris_Edition_2022_Ichiros_Malt_import.png | 2024-08-13 17:10 | 117K | |
| Chichibu_Paris_Edition_2023_Ichiros_Malt_import.png | 2024-08-13 17:10 | 109K | |
| Chichibu_Red_Wine_Cask_2023_Ichiros_Malt_import.png | 2024-08-13 17:10 | 103K | |
| Chichibu_Silver_Oak_Cask_Finish_2022_Ichiros_Malt_import.png | 2024-08-13 17:10 | 117K | |
| Chichibu_The_Peated_Ichiros_Malt_-_The_Peated_import.png | 2024-08-13 17:10 | 113K | |
| Chichibu_The_US_Edition_2022_Ichiros_Malt_import.png | 2024-08-13 17:10 | 121K | |
| Chichibu_Travel_Exclusive_Ichiros_Malt_import.png | 2024-08-13 17:10 | 109K | |
| Chiefs_Son_Batch_1_TBWC_import.png | 2024-08-13 17:10 | 147K | |
| Chimera_Blended_Scotch_Malt_Whisky_BA_Raw_Cask_import.png | 2024-08-13 17:10 | 264K | |
| Chivas_Regal_12-year-old_XII_import.png | 2024-08-13 17:10 | 164K | |
| Chivas_Regal_13-year-old_-_Extra_Sherry_Cask_Selection_import.png | 2024-08-13 17:10 | 128K | |
| Chivas_Regal_13-year-old_Extra_import.png | 2024-08-13 17:10 | 163K | |
| Chivas_Regal_18-year-old_Wine_Cask_Series_import.png | 2024-08-13 17:10 | 175K | |
| Chivas_Regal_20-year-old_XX_Ultis_import.png | 2024-08-13 17:10 | 332K | |
| Christmas_Whisky_A_Good_Old-Fashioned_Christmas_Whisky_import.png | 2024-08-13 17:10 | 126K | |
| Cigar_Malt_15-year-old_BW_IX_Edition_-_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 122K | |
| Cigar_Malt_15-year-old_BW_VIII_Edition_-_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 128K | |
| Cigar_Malt_15-year-old_BW_VII_Edition_-_A_Dream_Of_Scotland_import.png | 2024-08-13 17:10 | 107K | |
| Cigarillo_Malt_17-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:10 | 125K | |
| Cill_Áirne_Cask_2016_Peated_Single_Malt_import.png | 2024-08-13 17:10 | 116K | |
| Cincinnati_Distilling_02-year-old_Limited_Release_import.png | 2024-08-13 17:10 | 161K | |
| Classic_of_Islay_Vintage_2022_JW_import.png | 2024-08-13 17:10 | 102K | |
| Classic_of_Islay_Vintage_2023_JW_import.png | 2024-08-13 17:10 | 106K | |
| Cley_Whisky_03-year-old_Dutch_Cask_Strength_Single_Malt_Whisky_import.png | 2024-08-13 17:10 | 200K | |
| Cley_Whisky_03-year-old_Dutch_Single_Malt_import.png | 2024-08-13 17:10 | 209K | |
| Cley_Whisky_03-year-old_import.png | 2024-08-13 17:10 | 191K | |
| Cley_Whisky_04-year-old_Cask_Friends_Whisky_import.png | 2024-08-13 17:10 | 200K | |
| Cley_Whisky_04-year-old_Limited_Edition_-_Oloroso_Cask_import.png | 2024-08-13 17:10 | 173K | |
| Cley_Whisky_04-year-old_Limited_Edition_-_PX_Cask_import.png | 2024-08-13 17:10 | 170K | |
| Cley_Whisky_04-year-old_Special_Edition_import.png | 2024-08-13 17:10 | 176K | |
| Cley_Whisky_04-year-old_import.png | 2024-08-13 17:10 | 177K | |
| Cley_Whisky_2017_Cask_Friends_Whisky_import.png | 2024-08-13 17:10 | 236K | |
| Cley_Whisky_2018_KiCa_Dynamic_Aged_import.png | 2024-08-13 17:10 | 114K | |
| Cley_Whisky_2018_Limited_Edition_import.png | 2024-08-13 17:10 | 204K | |
| Cley_Whisky_2018_PDnl_Dutch_Botanical_Pride_import.png | 2024-08-13 17:10 | 175K | |
| Cley_Whisky_2019_Cask_Friends_Whisky_import.png | 2024-08-13 17:10 | 172K | |
| Cley_Whisky_2019_import.png | 2024-08-13 17:10 | 166K | |
| Cley_Whisky_Cask_Friends_Whisky_import.png | 2024-08-13 17:10 | 187K | |
| Cley_Whisky_Dutch_Single_Malt_Whisky_Cask_Strength_import.png | 2024-08-13 17:10 | 195K | |
| Cley_Whisky_Dutch_Single_Malt_Whisky_import.png | 2024-08-13 17:10 | 187K | |
| Cley_Whisky_Malt_&_Rye_import.png | 2024-08-13 17:10 | 196K | |
| Clonakilty_Single_Malt_Irish_Whiskey_Cask_Finish_Series_import.png | 2024-08-13 17:10 | 121K | |
| Clonakilty_Single_Malt_Irish_Whiskey_import.png | 2024-08-13 17:10 | 228K | |
| Clynelish 14.jpg | 2024-08-13 17:10 | 920K | |
| Clynelish_10-year-old_-_The_Jazz_Crescendo_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:10 | 100K | |
| Clynelish_12-year-old_Diageo_Special_Releases_2022_import.png | 2024-08-13 17:10 | 105K | |
| Clynelish_12-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:10 | 86K | |
| Clynelish_13-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:10 | 92K | |
| Clynelish_1982_MoS_Warehouse_Diamonds_import.png | 2024-08-13 17:10 | 138K | |
| Clynelish_1989_BA_Statement_Edition_No._50_import.png | 2024-08-13 17:10 | 301K | |
| Clynelish_1990_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:10 | 113K | |
| Clynelish_1990_LMDW_Artist_#12_import.png | 2024-08-13 17:10 | 126K | |
| Clynelish_1990_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:10 | 164K | |
| Clynelish_1992_SMWS_26.211_Ambrosial_nectar_import.png | 2024-08-13 17:10 | 98K | |
| Clynelish_1993_ED_The_First_Editions_import.png | 2024-08-13 17:10 | 234K | |
| Clynelish_1993_HL_Hepburns_Choice_import.png | 2024-08-13 17:10 | 109K | |
| Clynelish_1993_Joy_Connoisseur_Selection_-_No.27_import.png | 2024-08-13 17:10 | 117K | |
| Clynelish_1995_DD_import.png | 2024-08-13 17:10 | 114K | |
| Clynelish_1995_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:10 | 102K | |
| Clynelish_1996_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:10 | 136K | |
| Clynelish_1996_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:10 | 157K | |
| Clynelish_1997_DL_XOP_-_The_Black_Series_import.png | 2024-08-13 17:10 | 132K | |
| Clynelish_1997_MoS_Rare_Casks_import.png | 2024-08-13 17:10 | 178K | |
| Clynelish_1997_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:10 | 143K | |
| Clynelish_2004_Joy_Special_Flavour_Series_NO.14_import.png | 2024-08-13 17:10 | 276K | |
| Clynelish_2006_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 138K | |
| Clynelish_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 115K | |
| Clynelish_2008_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 136K | |
| Clynelish_2009_GM_Cask_Strength_Connoisseurs_Choice_import.png | 2024-08-13 17:10 | 129K | |
| Clynelish_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:10 | 135K | |
| Clynelish_2010_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:10 | 101K | |
| Clynelish_2010_SMWS_26.216_Madeleine_a_la_plage_import.png | 2024-08-13 17:10 | 108K | |
| Clynelish_2011_CWCL_Watt_Whisky_import.png | 2024-08-13 17:10 | 87K | |
| Clynelish_2011_ElD_import.png | 2024-08-13 17:10 | 99K | |
| Clynelish_2011_TWEx_import.png | 2024-08-13 17:10 | 100K | |
| Clynelish_2013_HiSp_10th_Anniversary_import.png | 2024-08-13 17:10 | 123K | |
| Clynelish_Batch_11_TBWC_import.png | 2024-08-13 17:10 | 143K | |
| Clynelish_Distillery_Exclusive_Bottling_Exclusive_Release_Batch_02_import.png | 2024-08-13 17:10 | 83K | |
| Coachbuilt_Build_No._001_import.png | 2024-08-13 17:10 | 121K | |
| Coillmór_2012_import.png | 2024-08-13 17:10 | 127K | |
| Coillmór_2014_Distillers_Edition_-_Edition_Felix_import.png | 2024-08-13 17:10 | 166K | |
| Coillmór_2016_Bayrische_Weihnacht_2023_import.png | 2024-08-13 17:10 | 165K | |
| Colonel_E.H._Taylor,_Jr._Small_Batch_Bourbon.jpg | 2024-08-13 17:11 | 21K | |
| Colonel_E.H._Taylor_Single_Barrel_Bottled_in_Bond_import.png | 2024-08-13 17:11 | 88K | |
| Colonel_E.H._Taylor_Single_Barrel_Select_Bottled_in_Bond_import.png | 2024-08-13 17:11 | 105K | |
| Colpach_Earth_&_Spice_import.png | 2024-08-13 17:11 | 111K | |
| Connacht_Single_Malt_Single_Cask_Bottling_import.png | 2024-08-13 17:11 | 163K | |
| ConnemaraTurfMor.jpg | 2024-08-13 17:11 | 262K | |
| Convalmore_1982_GM_Private_Collection_import.png | 2024-08-13 17:11 | 144K | |
| Cooley_08-year-old_TWBl_No._045_import.png | 2024-08-13 17:11 | 91K | |
| Cooley_08-year-old_WAGE_No._0011_import.png | 2024-08-13 17:11 | 99K | |
| Cooley_2001_OXH_Year_of_the_Rabbit_import.png | 2024-08-13 17:11 | 163K | |
| Cooley_2001_TWBl_No._031_import.png | 2024-08-13 17:11 | 118K | |
| Cooley_2001_TWf_Chen_Uens_Romance_of_the_Three_Kingdoms_import.png | 2024-08-13 17:11 | 135K | |
| Cooley_2001_UD_Whisky_Lovers_Hong_Kong_import.png | 2024-08-13 17:11 | 162K | |
| Cooley_2001_WF_import.png | 2024-08-13 17:11 | 128K | |
| Cooley_2001_WPB_co-brand_02_import.png | 2024-08-13 17:11 | 125K | |
| Cooley_2002_Arc_Birds_from_the_Orient_import.png | 2024-08-13 17:11 | 107K | |
| Cooley_2002_WB_200.000_bottles_in_Whiskybase_import.png | 2024-08-13 17:11 | 102K | |
| Cooley_2008_ZhSp_import.png | 2024-08-13 17:11 | 113K | |
| Cooley_distillery_logo.jpg | 2024-08-13 17:11 | 12K | |
| Cooper_King_First_Edition_import.png | 2024-08-13 17:11 | 172K | |
| Cooper_King_Maturing_Malt_24_Months_import.png | 2024-08-13 17:11 | 173K | |
| CopelandDistilleryLogo.jpg | 2024-08-13 17:11 | 81K | |
| Copenhagen_Distillery_Rare_Edition_import.png | 2024-08-13 17:11 | 170K | |
| Copper_&_Cask_2005_Single_Barrel_Selection_import.png | 2024-08-13 17:11 | 105K | |
| Copper_&_Cask_2016_Single_Barrel_Selection_import.png | 2024-08-13 17:11 | 108K | |
| Coppercraft_2015_Single_Barrel_Straight_Bourbon_import.png | 2024-08-13 17:11 | 182K | |
| Copperfish_Oaked_Moonshine_import.png | 2024-08-13 17:11 | 159K | |
| Copperworks_2018_The_Black_Cat_Series_import.png | 2024-08-13 17:11 | 145K | |
| Corbin_Cash_Merced_Rye_Whiskey_Single_Barrel_import.png | 2024-08-13 17:11 | 176K | |
| Corowa_Distilling_Co._#1_TBWC_Batch_1_import.png | 2024-08-13 17:11 | 146K | |
| Corowa_Distilling_Co._Batch_1_TBWC_import.png | 2024-08-13 17:11 | 146K | |
| Corowa_Distilling_Co._Batch_2_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:11 | 131K | |
| Cotswolds_04-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 124K | |
| Cotswolds_2016_Cask_Collection_import.png | 2024-08-13 17:11 | 260K | |
| Cotswolds_2016_Single_Cask_import.png | 2024-08-13 17:11 | 124K | |
| Cotswolds_2017_Highgrove_Coronation_Vatting_Whisky_import.png | 2024-08-13 17:11 | 123K | |
| Cotswolds_2017_Highgrove_Coronation_import.png | 2024-08-13 17:11 | 115K | |
| Cotswolds_2017_import.png | 2024-08-13 17:11 | 100K | |
| Cotswolds_2018_Coronation_Cask_import.png | 2024-08-13 17:11 | 119K | |
| Cotswolds_2018_Single_Cask_import.png | 2024-08-13 17:11 | 135K | |
| Cotswolds_Banyuls_Cask_Matured_Hearts_&_Crafts_import.png | 2024-08-13 17:11 | 121K | |
| Cotswolds_Distillery_Exclusive_Hand_Filled_at_Distillery_import.png | 2024-08-13 17:11 | 116K | |
| Cotswolds_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 107K | |
| Cotswolds_Flaxen_Vale_import.png | 2024-08-13 17:11 | 126K | |
| Cotswolds_Golden_Wold_Harvest_Series_import.png | 2024-08-13 17:11 | 126K | |
| Cotswolds_Rum_Cask_Hearts_&_Crafts_import.png | 2024-08-13 17:11 | 123K | |
| Coureur_des_Bois_12-year-old_import.png | 2024-08-13 17:11 | 156K | |
| Couvreurs_Clearach_2020_MCo_import.png | 2024-08-13 17:11 | 102K | |
| Crabbie_2019_Chain_Pier_Edinburgh_Single_Malt_import.png | 2024-08-13 17:11 | 116K | |
| Crabbie_2019_JCrC_Chain_Pier_import.png | 2024-08-13 17:11 | 117K | |
| Cragganmore_1989_MOS_Rare_Casks_Range_import.png | 2024-08-13 17:11 | 161K | |
| Cragganmore_1995_ED_The_First_Editions_import.png | 2024-08-13 17:11 | 110K | |
| Cragganmore_1995_HL_Old_&_Rare_-_The_Platinum_Selection_import.png | 2024-08-13 17:11 | 172K | |
| Cragganmore_1995_HL_Old_and_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:11 | 163K | |
| Cragganmore_The_Distillers_Edition_import.png | 2024-08-13 17:11 | 111K | |
| Craigdarroch_07-year-old_import.png | 2024-08-13 17:11 | 152K | |
| Craigellachie_08-year-old_DL_Premier_Barrel_import.png | 2024-08-13 17:11 | 239K | |
| Craigellachie_08-year-old_MNC_import.png | 2024-08-13 17:11 | 86K | |
| Craigellachie_10-year-old_AtB_Darkness_import.png | 2024-08-13 17:11 | 146K | |
| Craigellachie_13-year-old_Exceptional_Cask_Series_import.png | 2024-08-13 17:11 | 157K | |
| Craigellachie_13-year-old_French_Bas-Armagnac_import.png | 2024-08-13 17:11 | 152K | |
| Craigellachie_15-year-old_CA_Original_Collection_import.png | 2024-08-13 17:11 | 144K | |
| Craigellachie_17-year-old_Batch_No._04-1936_import.png | 2024-08-13 17:11 | 146K | |
| Craigellachie_19-year-old_import.png | 2024-08-13 17:11 | 167K | |
| Craigellachie_23-year-old_import.png | 2024-08-13 17:11 | 164K | |
| Craigellachie_24-year-old_DL_XOP_-_Rare_import.png | 2024-08-13 17:11 | 143K | |
| Craigellachie_2005_SMWS_44.166_Fantasy_island,_daydream_inspiration_import.png | 2024-08-13 17:11 | 233K | |
| Craigellachie_2005_Spirit_of_Speyside_2023_Festival_Release_import.png | 2024-08-13 17:11 | 157K | |
| Craigellachie_2006_BA_Raw_Cask_import.png | 2024-08-13 17:11 | 133K | |
| Craigellachie_2006_BD_import.png | 2024-08-13 17:11 | 150K | |
| Craigellachie_2006_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 106K | |
| Craigellachie_2006_PST_import.png | 2024-08-13 17:11 | 91K | |
| Craigellachie_2006_RS_Moonshiners_Spirit_import.png | 2024-08-13 17:11 | 138K | |
| Craigellachie_2006_SV_import.png | 2024-08-13 17:11 | 144K | |
| Craigellachie_2007_AD_Selection_import.png | 2024-08-13 17:11 | 73K | |
| Craigellachie_2007_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:11 | 136K | |
| Craigellachie_2007_BR_Scyfion_import.png | 2024-08-13 17:11 | 101K | |
| Craigellachie_2007_CA_Sherry_Cask_import.png | 2024-08-13 17:11 | 107K | |
| Craigellachie_2007_DL_Old_Particular_import.png | 2024-08-13 17:11 | 210K | |
| Craigellachie_2007_Df_64th_release_import.png | 2024-08-13 17:11 | 114K | |
| Craigellachie_2007_ED_The_First_Editions_import.png | 2024-08-13 17:11 | 103K | |
| Craigellachie_2007_Exceptional_Cask_Series_import.png | 2024-08-13 17:11 | 160K | |
| Craigellachie_2007_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 117K | |
| Craigellachie_2007_LT_import.png | 2024-08-13 17:11 | 254K | |
| Craigellachie_2007_PST_import.png | 2024-08-13 17:11 | 100K | |
| Craigellachie_2007_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:11 | 165K | |
| Craigellachie_2007_SV_import.png | 2024-08-13 17:11 | 98K | |
| Craigellachie_2007_WT_Ikarus_import.png | 2024-08-13 17:11 | 167K | |
| Craigellachie_2007_WhB_import.png | 2024-08-13 17:11 | 97K | |
| Craigellachie_2007_Whb_The_Swan_Nose_Discovery_import.png | 2024-08-13 17:11 | 236K | |
| Craigellachie_2007_WoSM_import.png | 2024-08-13 17:11 | 112K | |
| Craigellachie_2008_DT_Sherry_Octave_Small_Batch_import.png | 2024-08-13 17:11 | 121K | |
| Craigellachie_2008_DT_The_Octave_import.png | 2024-08-13 17:11 | 92K | |
| Craigellachie_2008_ED_The_First_Editions_import.png | 2024-08-13 17:11 | 117K | |
| Craigellachie_2008_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:11 | 119K | |
| Craigellachie_2008_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 119K | |
| Craigellachie_2008_JE_Small_Batch_import.png | 2024-08-13 17:11 | 100K | |
| Craigellachie_2008_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:11 | 122K | |
| Craigellachie_2008_TWA_import.png | 2024-08-13 17:11 | 86K | |
| Craigellachie_2008_UD_import.png | 2024-08-13 17:11 | 206K | |
| Craigellachie_2009_DD_import.png | 2024-08-13 17:11 | 99K | |
| Craigellachie_2009_GM_import.png | 2024-08-13 17:11 | 121K | |
| Craigellachie_2009_HWM_Dalgety_import.png | 2024-08-13 17:11 | 141K | |
| Craigellachie_2009_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:11 | 114K | |
| Craigellachie_2009_MDB_Vintage_Casks_import.png | 2024-08-13 17:11 | 146K | |
| Craigellachie_2009_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:11 | 133K | |
| Craigellachie_2009_PST_Error_502_Bad_Gateway_import.png | 2024-08-13 17:11 | 82K | |
| Craigellachie_2009_PST_import.png | 2024-08-13 17:11 | 101K | |
| Craigellachie_2009_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:11 | 109K | |
| Craigellachie_2009_TCaH_The_Stillmanns_Gold_import.png | 2024-08-13 17:11 | 134K | |
| Craigellachie_2009_WAGE_No._0012_import.png | 2024-08-13 17:11 | 95K | |
| Craigellachie_2009_vW_The_Ultimate_import.png | 2024-08-13 17:11 | 112K | |
| Craigellachie_2010_MSWD_Càrn_Mòr_Strictly_Limited_Edition_import.png | 2024-08-13 17:11 | 117K | |
| Craigellachie_2011_DR_Cask_Collection_import.png | 2024-08-13 17:11 | 76K | |
| Craigellachie_2011_DT_Private_Cask_Bottling_import.png | 2024-08-13 17:11 | 114K | |
| Craigellachie_2011_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:11 | 100K | |
| Craigellachie_2011_F.dk_import.png | 2024-08-13 17:11 | 105K | |
| Craigellachie_2011_MM_Single_Malt_Journeys_import.png | 2024-08-13 17:11 | 144K | |
| Craigellachie_2011_WhB_import.png | 2024-08-13 17:11 | 86K | |
| Craigellachie_2012_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:11 | 137K | |
| Craigellachie_2012_BR_Single_Cask_import.png | 2024-08-13 17:11 | 233K | |
| Craigellachie_2012_DR_Cask_Collection_import.png | 2024-08-13 17:11 | 74K | |
| Craigellachie_2012_PST_import.png | 2024-08-13 17:11 | 97K | |
| Craigellachie_2012_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:11 | 161K | |
| Craigellachie_2012_WhB_import.png | 2024-08-13 17:11 | 157K | |
| Craigellachie_2013_BR_Single_Cask_import.png | 2024-08-13 17:11 | 162K | |
| Craigellachie_2013_DMor_import.png | 2024-08-13 17:11 | 99K | |
| Craigellachie_2013_MSWD_Càrn_Mòr_Strictly_Limited_Edition_import.png | 2024-08-13 17:11 | 109K | |
| Craigellachie_2013_WhB_import.png | 2024-08-13 17:11 | 110K | |
| Craigellachie_2013_whic_Amazing_Whiskies_import.png | 2024-08-13 17:11 | 104K | |
| Craigellachie_2014_CaG_import.png | 2024-08-13 17:11 | 162K | |
| Craigellachie_2014_Orc_import.png | 2024-08-13 17:11 | 86K | |
| Craigellachie_2014_VM_The_Coopers_Choice_import.png | 2024-08-13 17:11 | 170K | |
| Craigellachie_2016_CWCL_Watt_Whisky_import.png | 2024-08-13 17:11 | 96K | |
| Craigmills_2012_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:11 | 90K | |
| Crazy_Christmas_Edition_2010_Cboy_import.png | 2024-08-13 17:11 | 138K | |
| Crazy_Christmas_Edition_2022_Cboy_import.png | 2024-08-13 17:11 | 136K | |
| Crazy_Creature_Edition_10-year-old_Cboy_VOLQUIN_import.png | 2024-08-13 17:11 | 133K | |
| Crazy_Creature_Edition_Cagey_import.png | 2024-08-13 17:11 | 128K | |
| Creag_Dearg_2017_Grand_Opening_import.png | 2024-08-13 17:11 | 165K | |
| Creag_Dearg_2017_Once_upon_a_time_import.png | 2024-08-13 17:11 | 180K | |
| Creag_Dearg_2018_Lighthouse_Whisky_import.png | 2024-08-13 17:11 | 145K | |
| Creag_Dearg_2020_import.png | 2024-08-13 17:11 | 170K | |
| Croftengea_14-year-old_NSS_Periodical_import.png | 2024-08-13 17:11 | 207K | |
| Croftengea_15-year-old_UD_import.png | 2024-08-13 17:11 | 109K | |
| Croftengea_2005_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:11 | 149K | |
| Croftengea_2006_EVWC_import.png | 2024-08-13 17:11 | 122K | |
| Croftengea_2006_PST_import.png | 2024-08-13 17:11 | 88K | |
| Croftengea_2007_WSP_Edition_No._77_import.png | 2024-08-13 17:11 | 104K | |
| Croftengea_2016_SpSw_import.png | 2024-08-13 17:11 | 94K | |
| Croftengea_2017_Cl_Exploration_Series_import.png | 2024-08-13 17:11 | 97K | |
| Croftengea_2017_Exploration_Series_import.png | 2024-08-13 17:11 | 112K | |
| Croftengea_Apple_Smoke_VM_The_Coopers_Choice_import.png | 2024-08-13 17:11 | 129K | |
| Croftengea_Double_Finish_MM_Cask_Craft_import.png | 2024-08-13 17:11 | 103K | |
| Croftengea_Marsala_Finish_MM_Cask_Craft_import.png | 2024-08-13 17:11 | 112K | |
| Croithlí_Distillery_Exclusive_Distillery_Hand_Bottling_import.png | 2024-08-13 17:11 | 120K | |
| Cromlech_2019_Distillery_Bottling_import.png | 2024-08-13 17:11 | 122K | |
| Cromlech_2019_Dutch_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 122K | |
| Cromlech_2020_Dutch_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 123K | |
| Crown_2018_CrSp_Belgian_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 254K | |
| Crown_2018_CrSp_Crown_Double_Cask_second_edition_import.png | 2024-08-13 17:11 | 171K | |
| Crown_2018_CrSp_Crown_single_malt_second_edition_import.png | 2024-08-13 17:11 | 165K | |
| Crown_2018_CrSp_Double_Cask_Series_-_First_Release_import.png | 2024-08-13 17:11 | 195K | |
| Culdrain_2011_DT_The_Octave_import.png | 2024-08-13 17:11 | 101K | |
| Cult_of_Islay_1989_MM_Mission_Gold_import.png | 2024-08-13 17:11 | 101K | |
| Currach_2018_Atlantic_Wakame_Seaweed_Cask_import.png | 2024-08-13 17:11 | 133K | |
| Currach_Atlantic_Wakame_Seaweed_Cask_Sake_Cask_Edition_import.png | 2024-08-13 17:11 | 140K | |
| Currach_Atlantic_Wakame_Seaweed_Cask_import.png | 2024-08-13 17:11 | 173K | |
| Currach_Single_Malt_Irish_Whiskey_Atlantic_Kombu_Seaweed_Cask_import.png | 2024-08-13 17:11 | 143K | |
| Cut_Hill_Sexy_Samba_CtHD_The_Keystones_Series_-_Part_Two_import.png | 2024-08-13 17:11 | 278K | |
| Cutler_&_Stubbs_Batch_#1_TBWC_import.png | 2024-08-13 17:11 | 144K | |
| Cutty_Sark_12-year-old_Blended_Scotch_Whisky_import.png | 2024-08-13 17:11 | 141K | |
| DGs1SgZXoAI9uQ9.jpg | 2024-08-13 17:11 | 250K | |
| DS_Distillerie_Seetal_Single_Malt_import.png | 2024-08-13 17:11 | 233K | |
| Dads_Hat_Batch_1_TBWC_USA_Series_import.png | 2024-08-13 17:11 | 121K | |
| Daftmill_2006_Cask_Strength_import.png | 2024-08-13 17:11 | 81K | |
| Daftmill_2007_Fife_Strength_import.png | 2024-08-13 17:11 | 91K | |
| Daftmill_2007_Single_Cask_import.png | 2024-08-13 17:11 | 94K | |
| Daftmill_2009_Single_Cask_import.png | 2024-08-13 17:11 | 90K | |
| Daftmill_2010_Winter_Batch_Release_import.png | 2024-08-13 17:11 | 80K | |
| Dahomey_2018_-_Dutch_Whisky_Single_Estate_-_Batch_4_import.png | 2024-08-13 17:11 | 151K | |
| Dailuaine_08-year-old_DL_Premier_Barrel_import.png | 2024-08-13 17:11 | 239K | |
| Dailuaine_10-year-old_BNSp_Whisky_of_Voodoo_import.png | 2024-08-13 17:11 | 129K | |
| Dailuaine_10-year-old_ChWh_import.png | 2024-08-13 17:11 | 109K | |
| Dailuaine_13-year-old_DMor_import.png | 2024-08-13 17:11 | 99K | |
| Dailuaine_23-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:11 | 108K | |
| Dailuaine_1992_NSpS_Jazz_Trilogy_import.png | 2024-08-13 17:11 | 298K | |
| Dailuaine_1997_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:11 | 205K | |
| Dailuaine_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:11 | 146K | |
| Dailuaine_1997_WSP_Edition_No._64_import.png | 2024-08-13 17:11 | 115K | |
| Dailuaine_2005_DL_Old_Particular_import.png | 2024-08-13 17:11 | 135K | |
| Dailuaine_2006_Eld_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:11 | 97K | |
| Dailuaine_2006_HL_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 236K | |
| Dailuaine_2007_CWCL_Watt_Whisky_import.png | 2024-08-13 17:11 | 87K | |
| Dailuaine_2007_DL_Old_Particular_import.png | 2024-08-13 17:11 | 114K | |
| Dailuaine_2007_HL_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 99K | |
| Dailuaine_2007_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:11 | 105K | |
| Dailuaine_2008_CA_Original_Collection_import.png | 2024-08-13 17:11 | 133K | |
| Dailuaine_2008_ED_The_First_Editions_import.png | 2024-08-13 17:11 | 104K | |
| Dailuaine_2008_HL_Hepburns_Choice_import.png | 2024-08-13 17:11 | 126K | |
| Dailuaine_2008_LotG_import.png | 2024-08-13 17:11 | 112K | |
| Dailuaine_2008_MBl_The_Maltman_import.png | 2024-08-13 17:11 | 105K | |
| Dailuaine_2008_SS_Silver_Seal_Young_import.png | 2024-08-13 17:11 | 206K | |
| Dailuaine_2008_UD_import.png | 2024-08-13 17:11 | 119K | |
| Dailuaine_2009_AD_Selection_import.png | 2024-08-13 17:11 | 86K | |
| Dailuaine_2009_BR_Single_Cask_import.png | 2024-08-13 17:11 | 138K | |
| Dailuaine_2009_CA_Natural_Strength_import.png | 2024-08-13 17:11 | 107K | |
| Dailuaine_2009_CQ_Special_Joint_Bottling_2023_import.png | 2024-08-13 17:11 | 120K | |
| Dailuaine_2009_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:11 | 96K | |
| Dailuaine_2009_ElD_The_Whisky_Trail_import.png | 2024-08-13 17:11 | 117K | |
| Dailuaine_2009_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:11 | 141K | |
| Dailuaine_2009_HSD_Longvalley_Selection_import.png | 2024-08-13 17:11 | 119K | |
| Dailuaine_2009_HoMC_The_Vintage_Collection_import.png | 2024-08-13 17:11 | 140K | |
| Dailuaine_2009_JE_import.png | 2024-08-13 17:11 | 99K | |
| Dailuaine_2009_Joy_Special_Flavour_Series_NO.6_import.png | 2024-08-13 17:11 | 288K | |
| Dailuaine_2009_NSpS_import.png | 2024-08-13 17:11 | 121K | |
| Dailuaine_2009_PK_Cask_Series_import.png | 2024-08-13 17:11 | 131K | |
| Dailuaine_2009_PSL_Fable_Whisky_-_Chapter_Three_import.png | 2024-08-13 17:11 | 123K | |
| Dailuaine_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 111K | |
| Dailuaine_2009_TDW_import.png | 2024-08-13 17:11 | 110K | |
| Dailuaine_2009_TPWC_Scotch_&_Tattoos_import.png | 2024-08-13 17:11 | 157K | |
| Dailuaine_2009_vW_The_Ultimate_import.png | 2024-08-13 17:11 | 108K | |
| Dailuaine_2010_BR_Single_Cask_import.png | 2024-08-13 17:11 | 118K | |
| Dailuaine_2010_BR_Small_Batch_import.png | 2024-08-13 17:11 | 135K | |
| Dailuaine_2010_DL_Old_Particular_import.png | 2024-08-13 17:11 | 102K | |
| Dailuaine_2010_Joy_SPECIAL_RELEASES_-_NO.2_import.png | 2024-08-13 17:11 | 282K | |
| Dailuaine_2010_MoM_import.png | 2024-08-13 17:11 | 89K | |
| Dailuaine_2010_PST_import.png | 2024-08-13 17:11 | 108K | |
| Dailuaine_2010_VM_The_Coopers_Choice_import.png | 2024-08-13 17:11 | 119K | |
| Dailuaine_2011_AM_import.png | 2024-08-13 17:11 | 97K | |
| Dailuaine_2011_BD_import.png | 2024-08-13 17:11 | 141K | |
| Dailuaine_2011_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:11 | 124K | |
| Dailuaine_2011_Ch7_Monologue_import.png | 2024-08-13 17:11 | 152K | |
| Dailuaine_2011_DR_Cask_Collection_import.png | 2024-08-13 17:11 | 89K | |
| Dailuaine_2011_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:11 | 95K | |
| Dailuaine_2011_FnTs_Private_Cask_Collection_import.png | 2024-08-13 17:11 | 124K | |
| Dailuaine_2011_PDnl_import.png | 2024-08-13 17:11 | 164K | |
| Dailuaine_2011_UD_import.png | 2024-08-13 17:11 | 94K | |
| Dailuaine_2011_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:11 | 102K | |
| Dailuaine_2011_WM_Barrel_Selection_import.png | 2024-08-13 17:11 | 114K | |
| Dailuaine_2012_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:11 | 119K | |
| Dailuaine_2012_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:11 | 141K | |
| Dailuaine_2012_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:11 | 102K | |
| Dailuaine_2012_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:11 | 138K | |
| Dailuaine_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 99K | |
| Dailuaine_2012_TWFC_The_Firkin_Rare_import.png | 2024-08-13 17:11 | 140K | |
| Dailuaine_2012_WCR_Club_filling_import.png | 2024-08-13 17:11 | 141K | |
| Dailuaine_2013_82NC_Community_Exclusive_import.png | 2024-08-13 17:11 | 117K | |
| Dailuaine_2013_Cl_Exploration_Series_import.png | 2024-08-13 17:11 | 117K | |
| Dailuaine_2013_GWhL_Auld_Goonsys_Malt_import.png | 2024-08-13 17:11 | 104K | |
| Dailuaine_2013_LoDz_Rambler_import.png | 2024-08-13 17:11 | 134K | |
| Dailuaine_2013_Orc_import.png | 2024-08-13 17:11 | 87K | |
| Dailuaine_2013_UD_Bareiss_Second_Edition_import.png | 2024-08-13 17:11 | 108K | |
| Dailuaine_2013_UD_Ten_Years_Together_import.png | 2024-08-13 17:11 | 110K | |
| Dailuaine_2013_UD_To_The_10th_Anniversary!_import.png | 2024-08-13 17:11 | 113K | |
| Dailuaine_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:11 | 112K | |
| Dailuaine_2014_WM_Barrel_Selection_import.png | 2024-08-13 17:11 | 112K | |
| Dailuaine_2015_AD_Selection_import.png | 2024-08-13 17:11 | 168K | |
| Dailuaine_2015_Whb_CREE_import.png | 2024-08-13 17:11 | 91K | |
| Dailuaine_2016_Hhd_import.png | 2024-08-13 17:11 | 86K | |
| Dailuaine_2016_PST_import.png | 2024-08-13 17:11 | 130K | |
| Dailuaine_2016_TWf_Animal_Ladies_import.png | 2024-08-13 17:11 | 271K | |
| Dailuaine_2016_WhB_Dutch_Agreement_import.png | 2024-08-13 17:11 | 134K | |
| Dailuaine_Bourbon_Finish_MM_Cask_Craft_import.png | 2024-08-13 17:11 | 102K | |
| Dailuaine_Speyside_Single_Malt_Sxwh_import.png | 2024-08-13 17:11 | 105K | |
| Dalmore 15.jpg | 2024-08-13 17:11 | 21K | |
| Dalmore_12-year-old_Sherry_Cask_Select_import.png | 2024-08-13 17:11 | 153K | |
| Dalmore_15-year-old_Luminary_No.1_import.png | 2024-08-13 17:11 | 122K | |
| Dalmore_15-year-old_import.png | 2024-08-13 17:11 | 128K | |
| Dalmore_18-year-old_import.png | 2024-08-13 17:11 | 152K | |
| Dalmore_21-year-old_2023_Edition_import.png | 2024-08-13 17:11 | 145K | |
| Dalmore_21-year-old_import.png | 2024-08-13 17:11 | 134K | |
| Dalmore_1991_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:11 | 152K | |
| Dalmore_1991_HL_Old_&_Rare_-_The_Platinum_Selection_import.png | 2024-08-13 17:11 | 178K | |
| Dalmore_2003_Vintage_import.png | 2024-08-13 17:11 | 144K | |
| Dalmore_2005_Vintage_Collection_import.png | 2024-08-13 17:11 | 152K | |
| Dalmore_2006_DT_The_Octave_import.png | 2024-08-13 17:11 | 95K | |
| Dalmore_2007_Vintage_import.png | 2024-08-13 17:11 | 143K | |
| Dalmore_2008_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:11 | 130K | |
| Dalmore_2008_Vintage_Collection_import.png | 2024-08-13 17:11 | 145K | |
| Dalmore_2012_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:11 | 103K | |
| Dalmore_2012_HB_Single_Cask_import.png | 2024-08-13 17:11 | 111K | |
| Dalmore_2013_SMWS_13.103_Fruit_wallop_import.png | 2024-08-13 17:11 | 105K | |
| Dalmore_2013_SMWS_13.106_Stag_Wine_import.png | 2024-08-13 17:11 | 86K | |
| Dalmore_King_Alexander_III_import.png | 2024-08-13 17:11 | 135K | |
| Dalmunach_06-year-old_DMor_import.png | 2024-08-13 17:11 | 100K | |
| Dalmunach_2015_Cl_Exploration_Series_import.png | 2024-08-13 17:11 | 105K | |
| Dalmunach_2015_DT_Small_Batch_import.png | 2024-08-13 17:11 | 106K | |
| Dalmunach_2015_DT_The_Octave_import.png | 2024-08-13 17:11 | 95K | |
| Dalmunach_2015_Fs_Sláinte_import.png | 2024-08-13 17:11 | 115K | |
| Dalmunach_2015_JW_Great_Ocean_Liners_import.png | 2024-08-13 17:11 | 105K | |
| Dalmunach_2015_TCaH_Festive_Bottlings_-_Merry_Christmas_import.png | 2024-08-13 17:11 | 114K | |
| Dalmunach_2015_TCaH_The_Stillmanns_Gold_import.png | 2024-08-13 17:11 | 102K | |
| Dalmunach_2016_BD_import.png | 2024-08-13 17:11 | 153K | |
| Dalmunach_2016_CWCL_Watt_Whisky_import.png | 2024-08-13 17:11 | 94K | |
| Dalmunach_2016_DC_import.png | 2024-08-13 17:11 | 104K | |
| Dalmunach_2016_DT_Sherry_Cask_Octave_Small_Batch_import.png | 2024-08-13 17:11 | 102K | |
| Dalmunach_2016_DT_The_Octave_-_Cask_Strength_import.png | 2024-08-13 17:11 | 165K | |
| Dalmunach_2016_DT_The_Octave_import.png | 2024-08-13 17:11 | 104K | |
| Dalmunach_2016_MC_import.png | 2024-08-13 17:11 | 102K | |
| Dalmunach_2016_TCaH_The_Stillmanns_Gold_import.png | 2024-08-13 17:11 | 101K | |
| Dalmunach_2017_KCC_Fragrant_Drops_import.png | 2024-08-13 17:11 | 185K | |
| Dalmunach_Strawberries_&_Cream_VM_The_Coopers_Choice_import.png | 2024-08-13 17:11 | 115K | |
| Dalrymple_2010_Cl_Exploration_Series_import.png | 2024-08-13 17:11 | 110K | |
| Dalrymple_2012_TCaH_The_Stillmanns_Gold_import.png | 2024-08-13 17:11 | 163K | |
| Dalwhinnie_11-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 133K | |
| Dalwhinnie_11-year-old_Handfilled_import.png | 2024-08-13 17:11 | 156K | |
| Dalwhinnie_12-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 141K | |
| Dalwhinnie_17-year-old_125th_Anniversary_import.png | 2024-08-13 17:11 | 144K | |
| Dalwhinnie_2008_NSS_Cask_Series_021_import.png | 2024-08-13 17:11 | 166K | |
| Dalwhinnie_Distillery_Exclusive_Bottling_import.png | 2024-08-13 17:11 | 146K | |
| Dalwhinnie_The_Distillers_Edition_import.png | 2024-08-13 17:11 | 154K | |
| Dannes_12-year-old_Zwölf_Johr_Alt_import.png | 2024-08-13 17:11 | 197K | |
| Dark_Speyside_2002_SiSa_Single_Casks_import.png | 2024-08-13 17:11 | 179K | |
| De_IJsvogel_04-year-old_import.png | 2024-08-13 17:11 | 160K | |
| De_IJsvogel_2019_Single_Malt_Dutch_Whisky_import.png | 2024-08-13 17:11 | 156K | |
| Deadwood_Tumblin_Dice_06-year-old_import.png | 2024-08-13 17:11 | 123K | |
| Deanston 12.jpg | 2024-08-13 17:11 | 45K | |
| Deanston Virgin Oak.jpg | 2024-08-13 17:11 | 477K | |
| Deanston_08-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 126K | |
| Deanston_14-year-old_ChWh_import.png | 2024-08-13 17:11 | 109K | |
| Deanston_15-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 129K | |
| Deanston_15-year-old_Tequila_Cask_Finish_import.png | 2024-08-13 17:11 | 120K | |
| Deanston_1992_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:11 | 212K | |
| Deanston_1993_Handfilled_at_Distillery_import.png | 2024-08-13 17:11 | 110K | |
| Deanston_1995_GlMo_A_Rare_Find_import.png | 2024-08-13 17:11 | 111K | |
| Deanston_1996_LTDW_Drink_Limited_import.png | 2024-08-13 17:11 | 145K | |
| Deanston_1997_TWJ_import.png | 2024-08-13 17:11 | 90K | |
| Deanston_2000_Organic_import.png | 2024-08-13 17:11 | 121K | |
| Deanston_2001_Hand_Filled_Exclusive_Edition_import.png | 2024-08-13 17:11 | 127K | |
| Deanston_2002_TWhF_The_journey_import.png | 2024-08-13 17:11 | 112K | |
| Deanston_2004_Handfilled_Distillery_Exclusiv_import.png | 2024-08-13 17:11 | 131K | |
| Deanston_2006_Warehouse_4_import.png | 2024-08-13 17:11 | 129K | |
| Deanston_2007_Winter_Festival_2023_import.png | 2024-08-13 17:11 | 119K | |
| Deanston_2008_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:11 | 82K | |
| Deanston_2008_LBDS_Single_Cask_import.png | 2024-08-13 17:11 | 120K | |
| Deanston_2008_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:11 | 149K | |
| Deanston_2008_SV_Ink_#4_Collection_import.png | 2024-08-13 17:11 | 98K | |
| Deanston_2008_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:11 | 149K | |
| Deanston_2008_TCaH_import.png | 2024-08-13 17:11 | 147K | |
| Deanston_2008_WPB_co-brand_03_import.png | 2024-08-13 17:11 | 104K | |
| Deanston_2009_import.png | 2024-08-13 17:11 | 127K | |
| Deanston_2010_DL_Old_Particular_import.png | 2024-08-13 17:11 | 102K | |
| Deanston_2010_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:11 | 123K | |
| Deanston_2011SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 101K | |
| Deanston_2011_BD_import.png | 2024-08-13 17:11 | 153K | |
| Deanston_2012_Hand-Filled_Exclusive_import.png | 2024-08-13 17:11 | 130K | |
| Deanston_2012_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:11 | 94K | |
| Deanston_2012_SMWS_79.9_A_ramble_through_brambles_import.png | 2024-08-13 17:11 | 109K | |
| Deanston_2012_TWB_Magnificent_Desolation_import.png | 2024-08-13 17:11 | 131K | |
| Deanston_2012_WTF_Icons_of_WTF_Utrecht_import.png | 2024-08-13 17:11 | 116K | |
| Deanston_2013_DMor_import.png | 2024-08-13 17:11 | 101K | |
| Deanston_2013_FibW_Permutations_Series_1_import.png | 2024-08-13 17:11 | 124K | |
| Deanston_2014_VM_The_Coopers_Choice_import.png | 2024-08-13 17:11 | 259K | |
| Deanston_Virgin_Oak_Cask_Strength_import.png | 2024-08-13 17:11 | 120K | |
| Delos_Blended_Scotch_Whisky_CB_The_Extinct_Blends_Quartet_import.png | 2024-08-13 17:11 | 135K | |
| DenHool_2016_Drentse_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 151K | |
| Denali_Spirits_Whiskey_Small_Batch_import.png | 2024-08-13 17:11 | 314K | |
| Destillerie_Betz_2017_The_New_German_Art_import.png | 2024-08-13 17:11 | 129K | |
| Destillerie_Betz_2018_PX_Single_Cask_import.png | 2024-08-13 17:11 | 122K | |
| Destilleriet_Als_First_Release_import.png | 2024-08-13 17:11 | 126K | |
| Dewar's 12.jpg | 2024-08-13 17:11 | 2.0K | |
| Dewars_12-year-old_Double_Aged_import.png | 2024-08-13 17:11 | 113K | |
| Dewars_19-year-old_Special_Edition_122nd_U.S._Open_import.png | 2024-08-13 17:11 | 106K | |
| Didier_Barbe_&_Fils_2020_Single_Malt_Whisky_M_import.png | 2024-08-13 17:11 | 233K | |
| Dingle_10-year-old_import.png | 2024-08-13 17:11 | 146K | |
| Dingle_2014_Founding_Fathers_Bottling_import.png | 2024-08-13 17:11 | 119K | |
| Dingle_2014_Single_Cask_import.png | 2024-08-13 17:11 | 148K | |
| Dingle_2015_Single_Cask_import.png | 2024-08-13 17:11 | 211K | |
| Dingle_2018_Single_Cask_Single_Pot_Still_import.png | 2024-08-13 17:11 | 128K | |
| Dingle_Bealtaine_Wheel_of_the_Year_import.png | 2024-08-13 17:11 | 134K | |
| Dingle_Fifth_Single_Pot_Still_Release_Cask_Strength_import.png | 2024-08-13 17:11 | 131K | |
| Dingle_Fifth_Single_Pot_Still_Release_import.png | 2024-08-13 17:11 | 128K | |
| Dingle_Grianstad_an_Gheimhridh_Wheel_of_the_Year_import.png | 2024-08-13 17:11 | 129K | |
| Dingle_Lá_le_Bríde_Wheel_of_The_Year_import.png | 2024-08-13 17:11 | 125K | |
| Dingle_Lúnasa_Wheel_of_the_Year_import.png | 2024-08-13 17:11 | 130K | |
| Dingle_SM_b6.png | 2024-08-13 17:11 | 350K | |
| Dingle_Samhain_Wheel_of_The_Year_import.png | 2024-08-13 17:11 | 149K | |
| Dingle_Single_Cask_Single_Malt_Release_import.png | 2024-08-13 17:11 | 121K | |
| Dingle_Single_Malt_Cask_2-776x1176.jpg | 2024-08-13 17:11 | 80K | |
| Dingle_Supervalu-776x1176.jpg | 2024-08-13 17:11 | 55K | |
| Dingle_The_Long_Hall_Founding_Fathers_Bottling_import.png | 2024-08-13 17:11 | 134K | |
| Dinglelogo.jpg | 2024-08-13 17:11 | 27K | |
| Diony_03-year-old_Roasted_Malt_import.png | 2024-08-13 17:11 | 206K | |
| Distilled_at_Islay_1991_ImpEx_The_ImpEx_Collection_import.png | 2024-08-13 17:11 | 116K | |
| Distilled_at_Secret_Islay_Distillery_2002_Earl_Islay_Flush_-_Exceptional_Cask_import.png | 2024-08-13 17:11 | 114K | |
| Distilled_at_Secret_Islay_Distillery_2007_EVWC_import.png | 2024-08-13 17:11 | 121K | |
| Distilled_at_Secret_Islay_Distillery_2008_TWA_Disinfectant_Fluid_import.png | 2024-08-13 17:11 | 112K | |
| Distilled_at_Secret_Islay_Distillery_2011_TWA_Disinfectant_Fluid_import.png | 2024-08-13 17:11 | 114K | |
| Distilled_at_Secret_Islay_Distillery_2013_SpLu_Disinfectant_Fluid_import.png | 2024-08-13 17:11 | 122K | |
| Distilled_at_a_Campeltown_Distillery_2016_ICC_Signature_03_import.png | 2024-08-13 17:11 | 83K | |
| Distilled_at_a_Secret_Islay_Distillery_2008_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:11 | 96K | |
| Distilled_at_a_Secret_Islay_Distillery_2009_EVWC_Makes_My_Heart_Wreck_Once_Again_import.png | 2024-08-13 17:11 | 133K | |
| Distilled_at_a_Secret_Islay_Distillery_2009_EVWC_Makes_My_Heart_Wreck_import.png | 2024-08-13 17:11 | 112K | |
| Distilled_at_a_Secret_Islay_Distillery_2013_EVWC_import.png | 2024-08-13 17:11 | 117K | |
| Distilled_at_a_Secret_Speyside_Distillery_12-year-old_whic_Sirens_import.png | 2024-08-13 17:11 | 103K | |
| Distilled_at_a_Secret_Speyside_Distillery_2007_BR_import.png | 2024-08-13 17:11 | 162K | |
| Distilled_at_a_Secret_Speyside_Distillery_2008_SV_import.png | 2024-08-13 17:11 | 112K | |
| Distilled_at_a_Tennessee_Distillery_2003_UD_Very_Fine_Old_Tennessee_Bourbon_import.png | 2024-08-13 17:11 | 257K | |
| Distilled_at_an_Islay_Distillery_2008_DRFS_Wu_Dram_Clan_Community_import.png | 2024-08-13 17:11 | 106K | |
| Distilled_at_an_Islay_Distillery_2014_WSN_The_Collaboration_import.png | 2024-08-13 17:11 | 125K | |
| Distilled_at_an_Orkney_Distillery_2006_MoM_import.png | 2024-08-13 17:11 | 99K | |
| Distilled_in_Sutherland_05-year-old_PST_Highland_Blended_Malt_Scotch_Whisky_import.png | 2024-08-13 17:11 | 98K | |
| Distilled_in_Sutherland_2008_Sb_Colourful_Wildlife_import.png | 2024-08-13 17:11 | 101K | |
| Distilled_in_Sutherland_2011_UD_The_Black_Cat_Series_import.png | 2024-08-13 17:11 | 103K | |
| Distillery_291_Batch_2_TBWC_USA_Series_import.png | 2024-08-13 17:11 | 121K | |
| Distillery_291_Batch_3_TBWC_USA_Series_import.png | 2024-08-13 17:11 | 133K | |
| Distillery_291_Colorado_Whiskey_Rye_Barrel_Proof_Single_Barrel_import.png | 2024-08-13 17:11 | 119K | |
| Dithmarscher_Whisky_2018_Purer_Deutscher_Coastal_Malt_import.png | 2024-08-13 17:11 | 132K | |
| Dithmarscher_Whisky_2019_Warehouse_Only_Edition_import.png | 2024-08-13 17:11 | 147K | |
| Doc_Swinsons_Bossa_Nova_Exploratory_Cask_Series_import.png | 2024-08-13 17:11 | 105K | |
| Dollard_New_Make_Spirit_7_maanden_import.png | 2024-08-13 17:11 | 121K | |
| Domaine_des_Hautes_Glaces_2016_Secale_import.png | 2024-08-13 17:11 | 137K | |
| Domaine_des_Hautes_Glaces_2017_LGA_The_Fellowsip_import.png | 2024-08-13 17:11 | 124K | |
| Domaine_des_Hautes_Glaces_2019_Episteme_R18P23A_-_Yellow_Square_Malted_Rye_Whisky_import.png | 2024-08-13 17:11 | 178K | |
| Domaine_des_Hautes_Glaces_Indigene_import.png | 2024-08-13 17:11 | 175K | |
| Domaine_des_Hautes_Glaces_Vulson_Organic_Eau_de_Vie_import.png | 2024-08-13 17:11 | 198K | |
| Donvens_06-year-old_Gëlle_Fra_import.png | 2024-08-13 17:11 | 152K | |
| Dornoch_2017_PST_Blankenships_Reserve_import.png | 2024-08-13 17:11 | 98K | |
| Dornoch_2017_PST_Weisenberger’s_Reserve_import.png | 2024-08-13 17:11 | 270K | |
| Dornoch_2017_PST_import.png | 2024-08-13 17:11 | 89K | |
| Dornoch_2017_import.png | 2024-08-13 17:11 | 90K | |
| Dornoch_2018_PST_import.png | 2024-08-13 17:11 | 91K | |
| Dornoch_2018_import.png | 2024-08-13 17:11 | 264K | |
| Dornoch_2020_Private_Cask_import.png | 2024-08-13 17:11 | 86K | |
| Dortmunder_Whisky_import.png | 2024-08-13 17:11 | 170K | |
| Dresden_Old_Town_Whisky_2019_WGD_Heinrich_der_Erlauchte_import.png | 2024-08-13 17:11 | 182K | |
| Dresdner_Whisky_Edition_42_import.png | 2024-08-13 17:11 | 75K | |
| Drexler_2017_No.1_import.png | 2024-08-13 17:11 | 138K | |
| Driftless_Glen_05-year-old_Single_Barrel_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:11 | 181K | |
| Driftless_Glen_05-year-old_Single_Barrel_Straight_Rye_Whiskey_import.png | 2024-08-13 17:11 | 174K | |
| Drilling_2019_Single_Cask_Malt_-_Distillery_Bottling_import.png | 2024-08-13 17:11 | 116K | |
| Drilling_2019_Single_Malt_-_Single_Cask_import.png | 2024-08-13 17:11 | 116K | |
| Droppie_The_Flying_Dutchman_Pirate_Blood_Part_II_import.png | 2024-08-13 17:11 | 133K | |
| Drumshanbo_Single_Pot_Still_Irish_Whiskey_Small_Batch_import.png | 2024-08-13 17:11 | 170K | |
| Duality_Blended_Malt_Whisky_CB_import.png | 2024-08-13 17:11 | 103K | |
| Duality_Blended_Malt_Whisky_import.png | 2024-08-13 17:11 | 91K | |
| Dubh_Glas_Love_Lives_Here_import.png | 2024-08-13 17:11 | 120K | |
| Dubh_Glas_Rocks,_Darts_and_Fire_import.png | 2024-08-13 17:11 | 122K | |
| Duck_&_Co._Blended_Whisky_Piracaia_de_Bebidas_Ltda._import.png | 2024-08-13 17:11 | 137K | |
| Dufftown_1975_BR_import.png | 2024-08-13 17:11 | 153K | |
| Dufftown_1988_CQ_The_Gambler_import.png | 2024-08-13 17:11 | 114K | |
| Dufftown_1991_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 117K | |
| Dufftown_2007_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:11 | 120K | |
| Dufftown_2008_ADWC_import.png | 2024-08-13 17:11 | 215K | |
| Dufftown_2008_BR_Single_Cask_import.png | 2024-08-13 17:11 | 121K | |
| Dufftown_2008_NSS_Cask_Series_018_import.png | 2024-08-13 17:11 | 149K | |
| Dufftown_2008_Sxwh_Warrior_Girls_import.png | 2024-08-13 17:11 | 103K | |
| Dufftown_2008_WCh_The_Private_Club_Collection_import.png | 2024-08-13 17:11 | 98K | |
| Dufftown_2008_WCh_import.png | 2024-08-13 17:11 | 151K | |
| Dufftown_2008_WhB_import.png | 2024-08-13 17:11 | 88K | |
| Dufftown_2008_Wy_Lifes_a_Peach_import.png | 2024-08-13 17:11 | 181K | |
| Dufftown_2009_DR_Cask_Collection_import.png | 2024-08-13 17:11 | 81K | |
| Dufftown_2013_BD_import.png | 2024-08-13 17:11 | 163K | |
| Dumbarton_1989_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:11 | 110K | |
| Dumbarton_1992_MBl_The_Grainman_import.png | 2024-08-13 17:11 | 156K | |
| Dumbarton_2000_3W_import.png | 2024-08-13 17:11 | 88K | |
| Dumbarton_2000_BuBa_The_Sticky_Label_-_Vintage_War_Series_import.png | 2024-08-13 17:11 | 106K | |
| Dumbarton_2000_CWCL_Watt_Whisky_import.png | 2024-08-13 17:11 | 87K | |
| Dumbarton_2000_Cl_Warehouse_No._1_import.png | 2024-08-13 17:11 | 207K | |
| Dumbarton_2000_DL_Old_Particular_import.png | 2024-08-13 17:11 | 213K | |
| Dumbarton_2000_TCaH_import.png | 2024-08-13 17:11 | 142K | |
| Dumbarton_Rock_Blended_Malt_Scotch_Whisky_import.png | 2024-08-13 17:11 | 121K | |
| Dunóar_2019_import.png | 2024-08-13 17:11 | 138K | |
| Dun_Naomhaig_Bay_NAS_FR_Romantic_Rhine_Collection-2._Edition_Drachenfelsbahn_import.png | 2024-08-13 17:11 | 108K | |
| Dun_Naomhaig_Bay_NAS_FR_Romantic_Rhine_Collection_-_Edition_Drachenfelsbahn_import.png | 2024-08-13 17:11 | 115K | |
| Dundalgan_Blended_Irish_Whiskey_import.png | 2024-08-13 17:11 | 147K | |
| Dundalgan_Charred_Cask_Irish_Whiskey_import.png | 2024-08-13 17:11 | 141K | |
| Dundalgan_IPA_Cask_Finish_import.png | 2024-08-13 17:11 | 138K | |
| Dundalgan_Sherry_Cask_Finish_import.png | 2024-08-13 17:11 | 151K | |
| Dundalgan_Stout_Cask_Finish_import.png | 2024-08-13 17:11 | 154K | |
| Dunville 12 CS.jpg | 2024-08-13 17:11 | 143K | |
| Dunville_18_pc_1211.png | 2024-08-13 17:11 | 191K | |
| Dunville_VR18_port_mourant_190.png | 2024-08-13 17:11 | 143K | |
| Dunvilles-3-Crowns.jpg | 2024-08-13 17:11 | 46K | |
| Dunvilles_10-year-old_Very_Rare_import.png | 2024-08-13 17:11 | 142K | |
| Dunvilles_11-year-old_Ech_Single_Cask_Series_import.png | 2024-08-13 17:11 | 269K | |
| Dunvilles_11-year-old_Single_malt_import.png | 2024-08-13 17:11 | 135K | |
| Dunvilles_12-year-old_Ech_Cask_Strength_import.png | 2024-08-13 17:11 | 138K | |
| Dunvilles_12-year-old_Old_Irish_Whiskey_import.png | 2024-08-13 17:11 | 118K | |
| Dunvilles_20-year-old_Ech_The_Dark_Series_import.png | 2024-08-13 17:11 | 146K | |
| Dunvilles_20-year-old_Oloroso_Cask_Finish_import.png | 2024-08-13 17:11 | 314K | |
| Dunvilles_20-year-old_PX_Single_Cask_import.png | 2024-08-13 17:11 | 121K | |
| Dunvilles_21-year-old_The_Friend_at_Hand_import.png | 2024-08-13 17:11 | 132K | |
| Dunvilles_21-year-old_Very_Rare_Single_Malt_import.png | 2024-08-13 17:11 | 107K | |
| Dunvilles_Dead_Island_2_import.png | 2024-08-13 17:11 | 131K | |
| Dunvilles_PC1196-776x1176.jpg | 2024-08-13 17:11 | 96K | |
| Dunvilles_Three_Crowns_Peated_import.png | 2024-08-13 17:11 | 112K | |
| Dunvilles_Three_Crowns_Sherry_Finish_import.png | 2024-08-13 17:11 | 115K | |
| Dunvilles_Very_Rare_Single_Cask_import.png | 2024-08-13 17:11 | 130K | |
| Dusky_New_Zealand_Corn_Whisky_import.png | 2024-08-13 17:11 | 177K | |
| Dutch_Whisky_03-year-old_Limited_Edition_import.png | 2024-08-13 17:11 | 139K | |
| Duvel_Moortgat_10-year-old_Aged_to_perfection_import.png | 2024-08-13 17:11 | 181K | |
| Eagle_Rare_10-year-old_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:11 | 104K | |
| Eagle_Rare_10-year-old_Single_Barrel_Select_import.png | 2024-08-13 17:11 | 94K | |
| Eagle_Rare_10-year-old_import.png | 2024-08-13 17:11 | 96K | |
| Eagle_of_Spey_10-year-old_RS_import.png | 2024-08-13 17:11 | 135K | |
| Eagle_of_Spey_2012_RS_Moonshiners_Spirit_import.png | 2024-08-13 17:11 | 129K | |
| Eagle_of_Spey_2012_RS_import.png | 2024-08-13 17:11 | 128K | |
| Eaglesburn_04-year-old_import.png | 2024-08-13 17:11 | 151K | |
| Eaglesburn_2019_TDra_import.png | 2024-08-13 17:11 | 71K | |
| Early_Times_Kentucky_Straight_Bourbon_Whisky_Bottled-in-Bond_import.png | 2024-08-13 17:11 | 116K | |
| Easgann_2017_SpSw_import.png | 2024-08-13 17:11 | 268K | |
| East_London_2018_TWEx_The_People_Series_import.png | 2024-08-13 17:11 | 104K | |
| East_London_London_Rye_import.png | 2024-08-13 17:11 | 182K | |
| Eastmoor_2018_Moscatel_import.png | 2024-08-13 17:11 | 145K | |
| Eastmoor_2018_Oloroso_import.png | 2024-08-13 17:11 | 154K | |
| Eastmoor_2018_Special_limited_edition_import.png | 2024-08-13 17:11 | 150K | |
| Eastmoor_2019_American_Oak_import.png | 2024-08-13 17:11 | 154K | |
| Eastmoor_2019_Oloroso_Cask_import.png | 2024-08-13 17:11 | 241K | |
| Eastmoor_2019_import.png | 2024-08-13 17:11 | 164K | |
| Eddu_1999_-_Diamant_2022_Edition_Limitée_import.png | 2024-08-13 17:11 | 133K | |
| Eddu_2001_Graal_import.png | 2024-08-13 17:11 | 236K | |
| Eddu_2014_Whisky_Pur_Blé_Noir_import.png | 2024-08-13 17:11 | 145K | |
| Eddu_2015_Whisky_Pur_Blé_Noir_import.png | 2024-08-13 17:11 | 157K | |
| Eddu_2017_Collection_New_Vibrations_import.png | 2024-08-13 17:11 | 168K | |
| Eddu_2017_FK_100_ans_import.png | 2024-08-13 17:11 | 160K | |
| Eddu_Yes_We_Cam_!_Collection_Jean_Le_Cam_import.png | 2024-08-13 17:11 | 136K | |
| Edelbrände_Senft_2015_import.png | 2024-08-13 17:11 | 219K | |
| Eden_Mill_7-year-old_2023_Cask_Strength_Release_import.png | 2024-08-13 17:11 | 162K | |
| Eden_Mill_Fusion_import.png | 2024-08-13 17:11 | 138K | |
| Eden_Mill_Madeira_Cask_Matured_Cask_Mastery_Single_Malt_Collection_import.png | 2024-08-13 17:11 | 152K | |
| Eden_Mill_Port_Cask_Matured_Cask_Mastery_Single_Malt_Collection_import.png | 2024-08-13 17:11 | 152K | |
| Eden_Mill_Rum_Cask_Matured_Cask_Mastery_Single_Malt_Collection_import.png | 2024-08-13 17:11 | 158K | |
| Eden_Mill_St._Andrews_2022_Art_Of_St._Andrews_import.png | 2024-08-13 17:11 | 168K | |
| Eden_Mill_St._Andrews_2023_Art_of_St._Andrews_import.png | 2024-08-13 17:11 | 173K | |
| Eden_Mill_The_Guard_Bridge_import.png | 2024-08-13 17:11 | 169K | |
| Edinburgh_Festival_2022_SpD_import.png | 2024-08-13 17:11 | 118K | |
| Edinburgh_Festival_2023_SpD_import.png | 2024-08-13 17:11 | 121K | |
| Edradour_11-year-old_SV_Charity_Bottling_import.png | 2024-08-13 17:11 | 121K | |
| Edradour_1999_Vintage_-_Bordeaux_Cask_Finish_import.png | 2024-08-13 17:11 | 179K | |
| Edradour_2000_Vintage_Oloroso_Cask_Finish_import.png | 2024-08-13 17:11 | 157K | |
| Edradour_2001_Oloroso_Cask_Finish_import.png | 2024-08-13 17:11 | 147K | |
| Edradour_2001_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:11 | 159K | |
| Edradour_2006_Burgundy_Cask_Matured_import.png | 2024-08-13 17:11 | 150K | |
| Edradour_2006_import.png | 2024-08-13 17:11 | 152K | |
| Edradour_2007_Super_Tuscan_Cask_Matured_import.png | 2024-08-13 17:11 | 150K | |
| Edradour_2007_import.png | 2024-08-13 17:11 | 163K | |
| Edradour_2008_Grand_Arome_Rum_Cask_Matured_import.png | 2024-08-13 17:11 | 150K | |
| Edradour_2008_SFTC_-_Chardonnay_Cask_Matured_import.png | 2024-08-13 17:11 | 206K | |
| Edradour_2008_SFTC_-_Ribera_Del_Duero_Cask_Matured_import.png | 2024-08-13 17:11 | 205K | |
| Edradour_2008_SFTC_-_Sauternes_Cask_Matured_import.png | 2024-08-13 17:11 | 201K | |
| Edradour_2008_Sauternes_Cask_Matured_import.png | 2024-08-13 17:11 | 159K | |
| Edradour_2008_import.png | 2024-08-13 17:11 | 147K | |
| Edradour_2009_Natural_Cask_Strength_import.png | 2024-08-13 17:11 | 137K | |
| Edradour_2010_Natural_Cask_Strength_import.png | 2024-08-13 17:11 | 126K | |
| Edradour_2010_Pawis_Spätburgunder_Cask_Finish_import.png | 2024-08-13 17:11 | 157K | |
| Edradour_2010_SFTC_-_Chateauneuf_Du_Pape_Cask_Matured_import.png | 2024-08-13 17:11 | 215K | |
| Edradour_2010_SFTC_-_Madeira_Cask_Matured_import.png | 2024-08-13 17:11 | 199K | |
| Edradour_2010_SV_The_Un-Chillfiltered_Collection_-_LMDW_import.png | 2024-08-13 17:11 | 118K | |
| Edradour_2010_Super_Tuscan_Cask_Matured_import.png | 2024-08-13 17:11 | 166K | |
| Edradour_2011_Barbaresco_Cask_Matured_import.png | 2024-08-13 17:11 | 171K | |
| Edradour_2011_Burgundy_Cask_Matured_import.png | 2024-08-13 17:11 | 145K | |
| Edradour_2011_Chardonnay_Cask_Matured_import.png | 2024-08-13 17:11 | 163K | |
| Edradour_2011_Oloroso_Sherry_Butts_import.png | 2024-08-13 17:11 | 149K | |
| Edradour_2011_Pedro_Ximenez_Sherry_Cask_Matured_import.png | 2024-08-13 17:11 | 148K | |
| Edradour_2011_SFTC_-_Pedro_Ximenez_Cask_Matured_import.png | 2024-08-13 17:11 | 180K | |
| Edradour_2011_SV_Pirate_Series_import.png | 2024-08-13 17:11 | 127K | |
| Edradour_2011_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:11 | 114K | |
| Edradour_2011_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 99K | |
| Edradour_2011_Small_Batch_import.png | 2024-08-13 17:11 | 149K | |
| Edradour_2011_Straight_From_The_Cask_-_Sherry_Cask_Matured_import.png | 2024-08-13 17:11 | 212K | |
| Edradour_2011_WSP_Exclusive_Edition_No._8_import.png | 2024-08-13 17:11 | 108K | |
| Edradour_2011_import.png | 2024-08-13 17:11 | 167K | |
| Edradour_2012_Bordeaux_Cask_Matured_import.png | 2024-08-13 17:11 | 128K | |
| Edradour_2012_Madeira_Cask_Matured_import.png | 2024-08-13 17:11 | 150K | |
| Edradour_2012_Natural_Cask_Strength_import.png | 2024-08-13 17:11 | 259K | |
| Edradour_2012_Oloroso_Cask_Matured_import.png | 2024-08-13 17:11 | 158K | |
| Edradour_2012_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:11 | 164K | |
| Edradour_2012_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:11 | 126K | |
| Edradour_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 104K | |
| Edradour_2012_Sauternes_Cask_Matured_import.png | 2024-08-13 17:11 | 155K | |
| Edradour_2012_Straight_From_The_Cask_-_Sherry_Cask_Matured_import.png | 2024-08-13 17:11 | 224K | |
| Edradour_2012_Vintage_import.png | 2024-08-13 17:11 | 147K | |
| Edradour_2012_import.png | 2024-08-13 17:11 | 159K | |
| Edradour_2012_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:11 | 116K | |
| Edradour_2013_Natural_Cask_Strength_import.png | 2024-08-13 17:11 | 120K | |
| Edradour_2013_Oloroso_Sherry_Cask_Matured_import.png | 2024-08-13 17:11 | 146K | |
| Edradour_2013_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 111K | |
| Edradour_2013_Vintage_import.png | 2024-08-13 17:11 | 130K | |
| Edradour_2014_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:11 | 103K | |
| Eigashima_07-year-old_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:11 | 147K | |
| Eiktyrne_Fransk_Eik_Countdown_1_import.png | 2024-08-13 17:11 | 158K | |
| Eiktyrne_Kveik_og_Malt_import.png | 2024-08-13 17:11 | 153K | |
| Einöd_7_2019_Passion_import.png | 2024-08-13 17:11 | 174K | |
| Einars_2020_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 125K | |
| Einars_Single_Malt_Whisky_import.png | 2024-08-13 17:11 | 112K | |
| Elch_Whisky_07-year-old_Clyde_import.png | 2024-08-13 17:11 | 139K | |
| Elch_Whisky_07-year-old_Neustart_import.png | 2024-08-13 17:11 | 135K | |
| Elch_Whisky_2018_Gràdh_import.png | 2024-08-13 17:11 | 141K | |
| Elch_Whisky_2020_Porto_Elch_-_Handfilled_import.png | 2024-08-13 17:11 | 147K | |
| Elch_Whisky_Bamberg_Edition_c.s._import.png | 2024-08-13 17:11 | 141K | |
| Elch_Whisky_Edition_Bamberg_Limited_Edition_4.0_import.png | 2024-08-13 17:11 | 137K | |
| Elch_Whisky_S4P2_Einzelfassabfuellung_import.png | 2024-08-13 17:11 | 134K | |
| Elch_Whisky_Spirituals_Edition_04_import.png | 2024-08-13 17:11 | 144K | |
| Elch_Whisky_Torf_vom_Dorf_9._Auflage_import.png | 2024-08-13 17:11 | 124K | |
| Elch_Whisky_Torf_vom_Dorf_10._Auflage_import.png | 2024-08-13 17:11 | 141K | |
| Elchbräu_Whisky_2019_RbTW_Private_Cask_import.png | 2024-08-13 17:11 | 145K | |
| Elijah Craig 18.jpg | 2024-08-13 17:11 | 5.5M | |
| Elijah Craig Barrel Proof.jpg | 2024-08-13 17:11 | 682K | |
| Elijah_Craig_08-year-old_Private_Barrel_import.png | 2024-08-13 17:11 | 159K | |
| Elijah_Craig_08-year-old_Single_Barrel_-_Barrel_Proof_import.png | 2024-08-13 17:11 | 161K | |
| Elijah_Craig_09-year-old_Private_Barrel_import.png | 2024-08-13 17:11 | 138K | |
| Elijah_Craig_09-year-old_Single_Barrel_-_Private_Barrel_import.png | 2024-08-13 17:11 | 148K | |
| Elijah_Craig_8-year-old_Single_Barrel_-_Private_Barrel_import.png | 2024-08-13 17:11 | 161K | |
| Elijah_Craig_10-year-old_Caramel_Spice_import.png | 2024-08-13 17:11 | 153K | |
| Elijah_Craig_10-year-old_Private_Barrel_import.png | 2024-08-13 17:11 | 159K | |
| Elijah_Craig_10-year-old_Single_Barrel_-_Barrel_Proof_import.png | 2024-08-13 17:11 | 160K | |
| Elijah_Craig_12-year-old_Barrel_Proof_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:11 | 145K | |
| Elijah_Craig_12-year-old_Barrel_Proof_import.png | 2024-08-13 17:11 | 155K | |
| Elijah_Craig_18-year-old_Single_Barrel_import.png | 2024-08-13 17:11 | 204K | |
| Elijah_Craig_2012_Single_Barrel_-_Barrel_Proof_import.png | 2024-08-13 17:11 | 148K | |
| Elijah_Craig_2013_Single_Barrel_import.png | 2024-08-13 17:11 | 147K | |
| Elijah_Craig_2014_Private_Bottling_import.png | 2024-08-13 17:11 | 164K | |
| Elijah_Craig_2014_Single_Barrel_import.png | 2024-08-13 17:11 | 169K | |
| Elijah_Craig_Barrel_Proof_Bottle_Your_Own_import.png | 2024-08-13 17:11 | 146K | |
| Elijah_Craig_Barrel_Proof_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:11 | 154K | |
| Elijah_Craig_Barrel_Proof_import.png | 2024-08-13 17:11 | 151K | |
| Elijah_Craig_Ryder_Cup_Marco_Simone_2023_Small_Batch_import.png | 2024-08-13 17:11 | 139K | |
| Elijah_Craig_Single_Barrel_Barrel_Proof_import.png | 2024-08-13 17:11 | 159K | |
| Elijah_Craig_Single_Barrel_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:11 | 201K | |
| Elijah_Craig_Single_Barrel_Private_Barrel_import.png | 2024-08-13 17:11 | 133K | |
| Elijah_Craig_Toasted_Barrel_Small_Batch_Kentucky_Straight_Bourbon_Whiskey_Finished_in_European_Toasted_Oak_Barrels_import.png | 2024-08-13 17:11 | 158K | |
| ElsBurn_2011_Exceptional_Collection_import.png | 2024-08-13 17:11 | 137K | |
| ElsBurn_2011_Limited_Exclusive_Edition_-_Sherry_import.png | 2024-08-13 17:11 | 154K | |
| ElsBurn_2011_Limited_Exclusive_Edition_import.png | 2024-08-13 17:11 | 145K | |
| ElsBurn_2011_The_Distillery_Exclusive_-_Cask_Strength_import.png | 2024-08-13 17:11 | 157K | |
| ElsBurn_2012_Exceptional_Collection_import.png | 2024-08-13 17:11 | 224K | |
| ElsBurn_2013_Italian_Connection_import.png | 2024-08-13 17:11 | 152K | |
| ElsBurn_2013_The_Friendship_Edition_-_Trident_import.png | 2024-08-13 17:11 | 148K | |
| ElsBurn_2013_The_Friendship_Edition_import.png | 2024-08-13 17:11 | 147K | |
| ElsBurn_2014_The_Friendship_Edition_-_Twin_Peaks_import.png | 2024-08-13 17:11 | 148K | |
| ElsBurn_2017_The_Distillery_Exclusive_-_Cask_Strength_import.png | 2024-08-13 17:11 | 159K | |
| ElsBurn_2018_BW_Die_Whisky_Elfen_import.png | 2024-08-13 17:11 | 112K | |
| ElsBurn_2018_Exceptional_Collection_-_Poland_Exclusive_import.png | 2024-08-13 17:11 | 128K | |
| ElsBurn_2018_The_Distillery_Exclusive_-_Cask_Strength_import.png | 2024-08-13 17:11 | 138K | |
| ElsBurn_2018_The_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 121K | |
| ElsBurn_All_Hallows_Eve_2022_Full_Moon_import.png | 2024-08-13 17:11 | 139K | |
| ElsBurn_Amarone_Casks_Batch_No.1_import.png | 2024-08-13 17:11 | 153K | |
| ElsBurn_Batch_3_TBWC_10th_Anniversary_import.png | 2024-08-13 17:11 | 155K | |
| ElsBurn_CRONOS_Distillery_2023_Exclusive_import.png | 2024-08-13 17:11 | 130K | |
| ElsBurn_Cosy_Winter_IX_Special_2023_Release_import.png | 2024-08-13 17:11 | 139K | |
| ElsBurn_Cosy_Winter_VIII_Special_2022_Release_import.png | 2024-08-13 17:11 | 161K | |
| ElsBurn_Heinrich_2022_import.png | 2024-08-13 17:11 | 151K | |
| ElsBurn_Iberica_import.png | 2024-08-13 17:11 | 152K | |
| ElsBurn_Latex_2022_Mistress_of_Distilling_import.png | 2024-08-13 17:11 | 119K | |
| ElsBurn_Rivesaltes_Casks_import.png | 2024-08-13 17:11 | 163K | |
| ElsBurn_Ruby_Port_Cask_import.png | 2024-08-13 17:11 | 157K | |
| ElsBurn_The_Distillery_Edition_Sherry_Casks_import.png | 2024-08-13 17:11 | 143K | |
| ElsBurn_The_Distillery_Edition_import.png | 2024-08-13 17:11 | 161K | |
| ElsBurn_The_Distillery_Exclusive_Cask_Strength_import.png | 2024-08-13 17:11 | 155K | |
| ElsBurn_The_Journey_Edition_2022_import.png | 2024-08-13 17:11 | 131K | |
| ElsBurn_Wayfare_The_Cask_Strength_import.png | 2024-08-13 17:11 | 157K | |
| Elvis_The_King_Straight_Rye_Whiskey_import.png | 2024-08-13 17:11 | 108K | |
| Elvis_Tiger_Man_Straight_Tennessee_Whiskey_import.png | 2024-08-13 17:11 | 112K | |
| Emill_Feinwerk_import.png | 2024-08-13 17:11 | 281K | |
| Emill_Kraftwerk_Fasstärke_import.png | 2024-08-13 17:11 | 150K | |
| Emperors_Way_03-year-old_BW_A_Dream_of_Germany_import.png | 2024-08-13 17:11 | 108K | |
| Emperors_Way_03-year-old_BW_Die_Whisky_Elfen_-_Peace_&_Love_import.png | 2024-08-13 17:11 | 119K | |
| Emperors_Way_06-year-old_The_Distillery_Exclusive_import.png | 2024-08-13 17:11 | 127K | |
| Emperors_Way_2016_The_Distillery_Exclusive_-_Cask_Strength_import.png | 2024-08-13 17:11 | 131K | |
| Emperors_Way_2016_The_Distillery_Exclusive_2016_import.png | 2024-08-13 17:11 | 137K | |
| Emperors_Way_2016_The_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 139K | |
| Emperors_Way_2018_Distillery_Exceptional_import.png | 2024-08-13 17:12 | 261K | |
| Emperors_Way_2018_Very_Cloudy_import.png | 2024-08-13 17:12 | 129K | |
| Emperors_Way_2019_Distillery_Exceptional_import.png | 2024-08-13 17:12 | 131K | |
| Emperors_Way_2019_Mandelorien_import.png | 2024-08-13 17:12 | 150K | |
| Emperors_Way_The_Distillery_Exclusive_Cask_Strength_-_PX_Sherry_Octave_import.png | 2024-08-13 17:12 | 121K | |
| Emperors_Way_The_Distillery_Exclusive_Cask_Strength_import.png | 2024-08-13 17:12 | 141K | |
| Emperors_Way_The_Distillery_Exclusive_Distillery_Bottling_import.png | 2024-08-13 17:12 | 134K | |
| Emperors_Way_The_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 131K | |
| Emperors_Way_The_Imperial_Abbey_The_Imperial_Abbey_import.png | 2024-08-13 17:12 | 150K | |
| Epidion_10-year-old_import.png | 2024-08-13 17:12 | 102K | |
| Evan Williams Bottled in Bond.jpg | 2024-08-13 17:12 | 444K | |
| Evan Williams Single Barrel 2003.jpg | 2024-08-13 17:12 | 678K | |
| Evan Williams Single Barrel 2004.jpg | 2024-08-13 17:12 | 678K | |
| Evan_Williams_2014_Single_Barrel_Vintage_import.png | 2024-08-13 17:12 | 118K | |
| Evan_Williams_2014_import.png | 2024-08-13 17:12 | 109K | |
| Evermann_Theo_Double_Distilled_Blended_Whisky_import.png | 2024-08-13 17:12 | 147K | |
| Evermann_Wilhelm_Double_Distilled_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 138K | |
| Excalibur_1973_MBl_Blended_Scotch_Whisky_import.png | 2024-08-13 17:12 | 188K | |
| Ezra_Brooks_05-year-old_You_Got_Lucky_import.png | 2024-08-13 17:12 | 144K | |
| Ezra_Brooks_99_proof_import.png | 2024-08-13 17:12 | 300K | |
| Ezra_Brooks_2018_Distillers_Collection_import.png | 2024-08-13 17:12 | 135K | |
| Ezra_Brooks_Distillers_Collection_Hand_picked_import.png | 2024-08-13 17:12 | 133K | |
| F059DEFB-BFEE-40D2-862C-447A976BF240.jpeg | 2024-08-13 17:12 | 217K | |
| FAF9BE61-0667-4911-AB5C-0983202BB0BC.jpeg | 2024-08-13 17:12 | 109K | |
| FEW_2023_Single_Barrel_-_Bottled_in_Bond_import.png | 2024-08-13 17:12 | 250K | |
| FEW_Batch_5_TBWC_USA_Series_import.png | 2024-08-13 17:12 | 120K | |
| FINRIC_Smoke_&_Peat_import.png | 2024-08-13 17:12 | 152K | |
| Fable_07-year-old_PSL_Batch_Two_import.png | 2024-08-13 17:12 | 113K | |
| Fading_Hill_2016_16st_import.png | 2024-08-13 17:12 | 101K | |
| Fading_Hill_2016_Single_Cask_Warehouse_Selection_import.png | 2024-08-13 17:12 | 136K | |
| Fading_Hill_2017_Single_Cask_Warehouse_Selection_import.png | 2024-08-13 17:12 | 138K | |
| Fading_Hill_2018_Master_Edition_import.png | 2024-08-13 17:12 | 133K | |
| Fading_Hill_2019_Birkenhof_Master_Edition_import.png | 2024-08-13 17:12 | 297K | |
| Fading_Hill_Bourbon_and_Port_Casks_Master_Edition_import.png | 2024-08-13 17:12 | 135K | |
| Faemussach_21-year-old_ChWh_La_Nouvelle_Vague_import.png | 2024-08-13 17:12 | 112K | |
| Faer_Isles_New_Make_Single_Malt_Founders_Club_import.png | 2024-08-13 17:12 | 146K | |
| Fairy_Casks_2016_IW_Irish_Single_Cask_Whiskey_import.png | 2024-08-13 17:12 | 125K | |
| Falken_2015_Limited_Edition_import.png | 2024-08-13 17:12 | 128K | |
| Famous Grouse.jpg | 2024-08-13 17:12 | 1.2M | |
| Fannys_Bay_Single_Barrel_Port_Cask_import.png | 2024-08-13 17:12 | 187K | |
| Fannys_Bay_Tasmanian_Whisky_Single_Cask_import.png | 2024-08-13 17:12 | 188K | |
| Fary_Lochan_06-year-old_TBWC_import.png | 2024-08-13 17:12 | 137K | |
| Fary_Lochan_2010_Bourbon_Cask_import.png | 2024-08-13 17:12 | 148K | |
| Fary_Lochan_2011_XII_-_PX_#02_(12YO)_import.png | 2024-08-13 17:12 | 130K | |
| Fary_Lochan_2012_Cognac_cask_-_Batch_I_import.png | 2024-08-13 17:12 | 140K | |
| Fary_Lochan_2014_Sherry_&_Peat_#01_import.png | 2024-08-13 17:12 | 142K | |
| Fary_Lochan_2015_BLL_Travel_Edition_#_02_import.png | 2024-08-13 17:12 | 143K | |
| Fary_Lochan_2015_Port_&_Peat_No_1_import.png | 2024-08-13 17:12 | 143K | |
| Fary_Lochan_2015_Sweet_&_Spicy_Sauternes_#01_import.png | 2024-08-13 17:12 | 141K | |
| Fary_Lochan_2016_Private_Cask_Collection_import.png | 2024-08-13 17:12 | 166K | |
| Fary_Lochan_2016_Virtuel_Edition_-_Moscatel_Finish_-_Batch_#05_import.png | 2024-08-13 17:12 | 158K | |
| Fary_Lochan_2016_WhDr_import.png | 2024-08-13 17:12 | 146K | |
| Fary_Lochan_2018_Distillery_Edition_#_08_import.png | 2024-08-13 17:12 | 146K | |
| Fary_Lochan_2019_Sweet_&_Spicy_import.png | 2024-08-13 17:12 | 130K | |
| Fascadale_Release_No._10_AD_import.png | 2024-08-13 17:12 | 90K | |
| Fassmeister_Edition_23-year-old_Bevi_la_dolce_vita_import.png | 2024-08-13 17:12 | 211K | |
| Fassmeister_Edition_Delias_Single_Cask_Selection_import.png | 2024-08-13 17:12 | 150K | |
| Fassmeister_Edition_Finest_Whisky_Selection_No.1_Wx_import.png | 2024-08-13 17:12 | 169K | |
| Fassmeister_Edition_Smoky_Breeze_Volume_2_import.png | 2024-08-13 17:12 | 152K | |
| Feddie_2019_Cask_Sample_import.png | 2024-08-13 17:12 | 89K | |
| Feddie_2021_Cask_Sample_import.png | 2024-08-13 17:12 | 84K | |
| Feller_12-year-old_Signature_12_import.png | 2024-08-13 17:12 | 187K | |
| Feller_Corado_import.png | 2024-08-13 17:12 | 170K | |
| Fercullen_15-year-old_James_Fox_import.png | 2024-08-13 17:12 | 124K | |
| Fercullen_17-year-old_Pow_Distillery_Select_import.png | 2024-08-13 17:12 | 118K | |
| Fercullen_20-year-old_Pow_import.png | 2024-08-13 17:12 | 122K | |
| Fercullen_21-year-old_Pow_Single_Cask_import.png | 2024-08-13 17:12 | 124K | |
| Fercullen_21-year-old_Pow_import.png | 2024-08-13 17:12 | 117K | |
| Fercullen_21-year-old_Single_Cask_import.png | 2024-08-13 17:12 | 116K | |
| Fercullen_2001_Pow_Single_Cask_import.png | 2024-08-13 17:12 | 128K | |
| Fercullen_Cask_Select_Pow_import.png | 2024-08-13 17:12 | 122K | |
| Fercullen_Falls_Pow_Small_Batch_import.png | 2024-08-13 17:12 | 129K | |
| Fercullen_Italian_Gardens_Pow_The_Estate_Series_import.png | 2024-08-13 17:12 | 120K | |
| Fercullen_NAS_First_Release_import.png | 2024-08-13 17:12 | 114K | |
| Fettercairn_08-year-old_82NC_Whisky_Tour_Exclusive_import.png | 2024-08-13 17:12 | 244K | |
| Fettercairn_10-year-old_DL_Premier_Barrel_import.png | 2024-08-13 17:12 | 261K | |
| Fettercairn_12-year-old_Pedro_Ximenes_Sherry_Cask_Edetion_import.png | 2024-08-13 17:12 | 220K | |
| Fettercairn_15-year-old_CA_Original_Collection_import.png | 2024-08-13 17:12 | 133K | |
| Fettercairn_16-year-old_3rd_Release_2022_import.png | 2024-08-13 17:12 | 114K | |
| Fettercairn_16-year-old_4th_Release_2023_import.png | 2024-08-13 17:12 | 104K | |
| Fettercairn_18-year-old_import.png | 2024-08-13 17:12 | 123K | |
| Fettercairn_19-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:12 | 208K | |
| Fettercairn_22-year-old_import.png | 2024-08-13 17:12 | 110K | |
| Fettercairn_24-year-old_LF_Fynest_Series_-_Single_Cask_Limited_Edition_import.png | 2024-08-13 17:12 | 207K | |
| Fettercairn_1995_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:12 | 120K | |
| Fettercairn_1995_WSP_import.png | 2024-08-13 17:12 | 117K | |
| Fettercairn_2006_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:12 | 93K | |
| Fettercairn_2006_WhB_import.png | 2024-08-13 17:12 | 90K | |
| Fettercairn_2007_BR_Scyfion_Choice_import.png | 2024-08-13 17:12 | 109K | |
| Fettercairn_2007_BR_Single_Cask_import.png | 2024-08-13 17:12 | 135K | |
| Fettercairn_2007_CA_Natural_Strength_import.png | 2024-08-13 17:12 | 128K | |
| Fettercairn_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 122K | |
| Fettercairn_2007_OXH_Oxhead_Classic_Casks_import.png | 2024-08-13 17:12 | 113K | |
| Fettercairn_2007_UWC_Brown_Eyed_Girl_import.png | 2024-08-13 17:12 | 145K | |
| Fettercairn_2008_AI_The_Alba_Trail_import.png | 2024-08-13 17:12 | 129K | |
| Fettercairn_2008_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:12 | 106K | |
| Fettercairn_2008_BA_Raw_Cask_import.png | 2024-08-13 17:12 | 187K | |
| Fettercairn_2008_Cl_Warehouse_No._1_import.png | 2024-08-13 17:12 | 219K | |
| Fettercairn_2008_DoTh_import.png | 2024-08-13 17:12 | 124K | |
| Fettercairn_2008_ED_First_Editions_import.png | 2024-08-13 17:12 | 125K | |
| Fettercairn_2008_HL_McCraes_import.png | 2024-08-13 17:12 | 225K | |
| Fettercairn_2008_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:12 | 107K | |
| Fettercairn_2008_TWf_Freedom_Drinkers_Party_import.png | 2024-08-13 17:12 | 98K | |
| Fettercairn_2008_WW8_The_Warehouse_Collection_import.png | 2024-08-13 17:12 | 105K | |
| Fettercairn_2008_WhB_import.png | 2024-08-13 17:12 | 198K | |
| Fettercairn_2009_CA_Warehouse_Tasting_import.png | 2024-08-13 17:12 | 143K | |
| Fettercairn_2009_MSWD_Càrn_Mòr_Stricktly_Limited_Edition_-_Cask_Strength_import.png | 2024-08-13 17:12 | 128K | |
| Fettercairn_2009_SMWS_94.32_Sunshine_on_a_wedding_breakfast_import.png | 2024-08-13 17:12 | 118K | |
| Fettercairn_2009_SMWS_94.36_Plum_pistachio_ice_cream_import.png | 2024-08-13 17:12 | 110K | |
| Fettercairn_2009_WhB_Cree_import.png | 2024-08-13 17:12 | 100K | |
| Fettercairn_2009_Wy_Tête-À-Tête_import.png | 2024-08-13 17:12 | 123K | |
| Fettercairn_2010_SltA_Private_Label_Collection_No.7_import.png | 2024-08-13 17:12 | 99K | |
| Fettercairn_2011_BD_import.png | 2024-08-13 17:12 | 151K | |
| Fettercairn_2011_Fs_Slainté_import.png | 2024-08-13 17:12 | 109K | |
| Fettercairn_2011_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:12 | 113K | |
| Fettercairn_2011_SMWS_94.30_Spices_and_syrups_import.png | 2024-08-13 17:12 | 108K | |
| Fettercairn_2011_SMWS_94.37_Croissant_crumbs_in_Earl_Grey_tea_import.png | 2024-08-13 17:12 | 108K | |
| Fettercairn_2012_DL_Provenance_import.png | 2024-08-13 17:12 | 123K | |
| Fettercairn_2012_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:12 | 104K | |
| Fettercairn_2014_Warehouse_2_Batch_4_import.png | 2024-08-13 17:12 | 118K | |
| Fettercairn_2015_Cl_Warehouse_No._8_import.png | 2024-08-13 17:12 | 252K | |
| Fettercairn_2015_Warehouse_2_Batch_3_import.png | 2024-08-13 17:12 | 118K | |
| Fettercairn_2016_Warehouse_14_Batch_1_import.png | 2024-08-13 17:12 | 115K | |
| Fettercairn_Roussanne_Finish_Permutations_Series_1_import.png | 2024-08-13 17:12 | 133K | |
| Filey_Bay_2017_Single_Cask_-_Yorkshire_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 255K | |
| Filey_Bay_2017_Special_Release_import.png | 2024-08-13 17:12 | 124K | |
| Filey_Bay_2017_Spirit_of_Yorkshire_import.png | 2024-08-13 17:12 | 116K | |
| Filey_Bay_2017_Trio_of_Filey_Bay_import.png | 2024-08-13 17:12 | 119K | |
| Filey_Bay_2017_import.png | 2024-08-13 17:12 | 131K | |
| Filey_Bay_2018_import.png | 2024-08-13 17:12 | 141K | |
| Filey_Bay_Double_Oak_#1_Special_Release_import.png | 2024-08-13 17:12 | 121K | |
| Filey_Bay_Double_Oak_#2_import.png | 2024-08-13 17:12 | 130K | |
| Filey_Bay_Port_Finish_import.png | 2024-08-13 17:12 | 140K | |
| Filey_Bay_Sherry_Cask_Reserve_#3_import.png | 2024-08-13 17:12 | 110K | |
| Filey_Bay_Single_Malt_Whisky_Peated_Finish_import.png | 2024-08-13 17:12 | 128K | |
| Filey_Bay_Yorkshire_Day_2022_import.png | 2024-08-13 17:12 | 105K | |
| Filey_Bay_Yorkshire_Day_2023_import.png | 2024-08-13 17:12 | 126K | |
| Filey_Bay_Yorkshire_Single_Malt_Whisky_Germany_Exclusive_2023_import.png | 2024-08-13 17:12 | 122K | |
| Filey_Bay_Yorkshire_Single_Malt_Whisky_Moscatel_Finish_import.png | 2024-08-13 17:12 | 119K | |
| Filey_Bay_Yorkshire_Single_Malt_Whisky_STR_Finish_import.png | 2024-08-13 17:12 | 235K | |
| Filliers_05-year-old_Single_Rye_Whisky_import.png | 2024-08-13 17:12 | 115K | |
| Filliers_08-year-old_Single_Rye_Whisky_import.png | 2024-08-13 17:12 | 114K | |
| Finest_Irish_Whiskey_1988_UD_import.png | 2024-08-13 17:12 | 220K | |
| Finglassie_2017_RBTW_import.png | 2024-08-13 17:12 | 154K | |
| Finglassie_Lowland_Smoke_VM_The_Coopers_Choice_import.png | 2024-08-13 17:12 | 116K | |
| Finlaggan_Feis_Ile_2023_import.png | 2024-08-13 17:12 | 93K | |
| Finlaggan_Single_Cask_Release_VM_Fèis_Ile_2022_import.png | 2024-08-13 17:12 | 102K | |
| Finvara_The_Kings_Gambit_import.png | 2024-08-13 17:12 | 213K | |
| Fjørdram_Rauchig_3+4_Kieler_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 119K | |
| Flóki_03-year-old_Sheep_Dung_Smoked_Reserve_import.png | 2024-08-13 17:12 | 136K | |
| Flóki_03-year-old_Sherry_Cask_Finish_import.png | 2024-08-13 17:12 | 122K | |
| Flóki_07-year-old_Distillers_Choice_import.png | 2024-08-13 17:12 | 127K | |
| Flóki_Distillers_Choice_Icelandic_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 133K | |
| Flóki_Icelandic_Young_Malt_Sheep_Dung_Smoked_Reserve_import.png | 2024-08-13 17:12 | 149K | |
| Flaming_Heart_7th_Edition_CB_Limited_Edition_import.png | 2024-08-13 17:12 | 123K | |
| Fleurieu_Distillery_Batch_2_TBWC_import.png | 2024-08-13 17:12 | 146K | |
| Fleurieu_Distillery_The_Hunting_Of_The_Snark_import.png | 2024-08-13 17:12 | 128K | |
| Flo_og_Fjære_Grimstad_Edition_First_Norwegian_Blended_Malt_Whisky_import.png | 2024-08-13 17:12 | 128K | |
| Flo_og_Fjære_Myken_Edition_First_Norwegian_Blended_Malt_Whisky_import.png | 2024-08-13 17:12 | 130K | |
| Fontagard_CGNC_9918-5_import.png | 2024-08-13 17:12 | 112K | |
| Fontagard_DMGR_9918-11_serie_limitee_import.png | 2024-08-13 17:12 | 110K | |
| Fontagard_STEM_9920-2_import.png | 2024-08-13 17:12 | 109K | |
| Fontagard_STRN_9920-4_import.png | 2024-08-13 17:12 | 98K | |
| Forest_Whisky_Blend_No._26_import.png | 2024-08-13 17:12 | 234K | |
| Forest_Whisky_Blend_Number_27_import.png | 2024-08-13 17:12 | 142K | |
| Fort_Hamilton_04-year-old_Single_Cask_Rye_Whisky_import.png | 2024-08-13 17:12 | 143K | |
| Forty_Creek_Art_of_the_Blend_import.png | 2024-08-13 17:12 | 110K | |
| Found_North_18-year-old_Cask_Strength_Whisky_import.png | 2024-08-13 17:12 | 100K | |
| Found_North_20-year-old_Peregrine_-_Cask_Strength_Whisky_import.png | 2024-08-13 17:12 | 98K | |
| Four Roses.jpg | 2024-08-13 17:12 | 368K | |
| Four_Roses_09-Year-Old_Private_Selection_OBSK_import.png | 2024-08-13 17:12 | 146K | |
| Four_Roses_Limited_Edition_-_Small_Batch_135th_Anniversary_Edition_import.png | 2024-08-13 17:12 | 167K | |
| Four_Roses_Limited_Edition_-_Small_Batch_2022_Release_import.png | 2024-08-13 17:12 | 171K | |
| Four_Roses_Single_Barrel_Private_Selection_-_OBSF_import.png | 2024-08-13 17:12 | 127K | |
| Four_Roses_Single_Barrel_Private_Selection_-_OBSO_import.png | 2024-08-13 17:12 | 135K | |
| Four_Roses_Single_Barrel_Private_Selection_-_OBSV_import.png | 2024-08-13 17:12 | 145K | |
| Four_Roses_Single_Barrel_Private_Selection_-_OESF_import.png | 2024-08-13 17:12 | 163K | |
| Four_Roses_Single_Barrel_Private_Selection_OBSK_import.png | 2024-08-13 17:12 | 136K | |
| Four_Roses_Single_Barrel_Private_Selection_OESO_import.png | 2024-08-13 17:12 | 146K | |
| Four_Roses_Single_Barrel_Private_Selection_OESQ_import.png | 2024-08-13 17:12 | 132K | |
| Four_Roses_Single_Barrel_Private_Selection_OESV_import.png | 2024-08-13 17:12 | 146K | |
| Four_Roses_Single_Barrel_import.png | 2024-08-13 17:12 | 307K | |
| Fox_&_Oden_Double_Oaked_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:12 | 122K | |
| Fram_2019_import.png | 2024-08-13 17:12 | 113K | |
| Franconian_Highland_2016_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 194K | |
| Frey_Ranch_Straight_Bourbon_Whiskey_Single_Barrel_-_Barrel_Strength_import.png | 2024-08-13 17:12 | 158K | |
| Frysk_Hynder_2015_import.png | 2024-08-13 17:12 | 93K | |
| Frysk_Hynder_2017_import.png | 2024-08-13 17:12 | 272K | |
| Frysk_Hynder_2018_import.png | 2024-08-13 17:12 | 83K | |
| Fryske_Frijheid_Spirits_Ida_Whisky_Smooth_import.png | 2024-08-13 17:12 | 181K | |
| Fuji_Gotemba_Single_Blended_Japanese_Whisky_50th_Anniversary_Edition_import.png | 2024-08-13 17:12 | 125K | |
| Fuji_Gotemba_Single_Blended_Japanese_Whisky_import.png | 2024-08-13 17:12 | 123K | |
| Fuji_Gotemba_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:12 | 125K | |
| Fuji_Gotemba_Single_Malt_Whisky_50th_Anniversary_Edition_import.png | 2024-08-13 17:12 | 134K | |
| Fulltofta_Whisky_Cask_#1_import.png | 2024-08-13 17:12 | 141K | |
| Furneaux_03-year-old_FLINDERS_ISLAND_PEATED_SECOND_FILL_SHERRY_import.png | 2024-08-13 17:12 | 156K | |
| G._Rozelieures_2016_Cask_Strength_import.png | 2024-08-13 17:12 | 140K | |
| G._Rozelieures_2019_WHISKY_FÛT_UNIQUE_import.png | 2024-08-13 17:12 | 124K | |
| G._Rozelieures_2019_WITL_import.png | 2024-08-13 17:12 | 153K | |
| G._Rozelieures_Ex-Banyuls_fût_unique_collection_import.png | 2024-08-13 17:12 | 121K | |
| G._Rozelieures_Fût_Unique_import.png | 2024-08-13 17:12 | 106K | |
| G._Rozelieures_Le_Parcellaire_Les_Argilo-Calcaires_Mont_Poiroux_import.png | 2024-08-13 17:12 | 253K | |
| Galaad_À_La_Table_des_Chefs_Edition_#1_import.png | 2024-08-13 17:12 | 146K | |
| Galaad_2017_Origine_-_Edition_#1_import.png | 2024-08-13 17:12 | 146K | |
| Galahad_III_Wh_Islay_Blended_Malt_import.png | 2024-08-13 17:12 | 94K | |
| Gallery_3ptyk_import.png | 2024-08-13 17:12 | 140K | |
| Gammelstilla_05-year-old_Single_Cask_nr_1_import.png | 2024-08-13 17:12 | 120K | |
| Gammelstilla_2016_Private_Cask_-_Andra_Städet_import.png | 2024-08-13 17:12 | 130K | |
| Gammelstilla_2017_Private_Cask_-_Tredje_Städet_import.png | 2024-08-13 17:12 | 119K | |
| Gammelstilla_2017_Private_Cask_-_WHv_no5_import.png | 2024-08-13 17:12 | 113K | |
| Gammelstilla_2018_Private_Cask_-_EWK_21_import.png | 2024-08-13 17:12 | 126K | |
| Gammelstilla_2019_Private_Cask_-_Fjärde_Städet_import.png | 2024-08-13 17:12 | 131K | |
| Gammelstilla_2022_import.png | 2024-08-13 17:12 | 107K | |
| Gammelstilla_2023_import.png | 2024-08-13 17:12 | 113K | |
| Gammelstilla_Jern_Batch_2_import.png | 2024-08-13 17:12 | 121K | |
| Gammelstilla_Johan_Uhr_import.png | 2024-08-13 17:12 | 115K | |
| Gammelstilla_Jubileum_import.png | 2024-08-13 17:12 | 121K | |
| Gammelstilla_Single_cask_nr_1_import.png | 2024-08-13 17:12 | 120K | |
| Gammelstilla_Slagg_import.png | 2024-08-13 17:12 | 121K | |
| Gammelstilla_Smedjan_import.png | 2024-08-13 17:12 | 113K | |
| Garrison_Brothers_03-year-old_Texas_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:12 | 154K | |
| Garrison_Brothers_07-year-old_Ladybird_First_Release_import.png | 2024-08-13 17:12 | 170K | |
| Garrison_Brothers_2018_Single_Barrel_import.png | 2024-08-13 17:12 | 146K | |
| Garrison_Brothers_Balmorhea_Texas_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:12 | 158K | |
| Garrison_Brothers_Cowboy_Bourbon_Eights_Release_import.png | 2024-08-13 17:12 | 141K | |
| Garrison_Brothers_Cowboy_Bourbon_Ninth_Release_import.png | 2024-08-13 17:12 | 151K | |
| Garrison_Brothers_Guadalupe_Texas_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:12 | 165K | |
| Garrison_Brothers_Laguna_Madre_Second_Release_import.png | 2024-08-13 17:12 | 144K | |
| Garrison_Brothers_Laguna_Madre_Third_Release_import.png | 2024-08-13 17:12 | 156K | |
| Gemenc_0006-4_import.png | 2024-08-13 17:12 | 175K | |
| Gemenc_0046+B_Gold_import.png | 2024-08-13 17:12 | 179K | |
| Gemenc_0046_Single_Barrel_import.png | 2024-08-13 17:12 | 183K | |
| George T Stagg.jpg | 2024-08-13 17:12 | 118K | |
| George_Dickel_17-year-old_import.png | 2024-08-13 17:12 | 98K | |
| George_Dickel_2016_SMWS_B5.12_Cupcake_scented_candle_wax_import.png | 2024-08-13 17:12 | 112K | |
| George_Dickel_Single_Barrel_import.png | 2024-08-13 17:12 | 224K | |
| George_Remus_Repeal_Reserve_Series_VII_import.png | 2024-08-13 17:12 | 152K | |
| George_Remus_Repeal_Reserve_Series_VI_import.png | 2024-08-13 17:12 | 148K | |
| George_Remus_Straight_Bourbon_Whiskey_Single_Barrel_Select_import.png | 2024-08-13 17:12 | 151K | |
| George_Remus_Straight_Bourbon_Whiskey_Single_Barrel_import.png | 2024-08-13 17:12 | 140K | |
| George_T._Stagg_Barrel_Proof_Limited_Edition_import.png | 2024-08-13 17:12 | 76K | |
| Gerlachus_WiskiE_2019_import.png | 2024-08-13 17:12 | 144K | |
| Gerlachus_WiskiE_2020_De_eerste_Limburgse_import.png | 2024-08-13 17:12 | 171K | |
| Gileanne_2019_BYOB_pin_up_queen_import.png | 2024-08-13 17:12 | 102K | |
| Gilors_2016_Portwein_Fass_import.png | 2024-08-13 17:12 | 150K | |
| Gilors_No._1_Brauerei_Henrich_import.png | 2024-08-13 17:12 | 122K | |
| Girvan_1964_BR_Exceptional_Casks_import.png | 2024-08-13 17:12 | 175K | |
| Girvan_1989_ElD_The_Whisky_Trail_import.png | 2024-08-13 17:12 | 109K | |
| Girvan_1990_MoM_import.png | 2024-08-13 17:12 | 109K | |
| Girvan_1990_PST_import.png | 2024-08-13 17:12 | 96K | |
| Girvan_1991_TCaH_The_Thirsty_Piper_import.png | 2024-08-13 17:12 | 109K | |
| Girvan_1991_WDS_import.png | 2024-08-13 17:12 | 108K | |
| Girvan_1992_MrW_Spirit_of_Caledonia_import.png | 2024-08-13 17:12 | 114K | |
| Girvan_1993_VM_The_Coopers_Choice_import.png | 2024-08-13 17:12 | 128K | |
| Girvan_1995_TTBs_Limited_Single_Cask_Bottling_2022_import.png | 2024-08-13 17:12 | 122K | |
| Girvan_1996_GWhL_The_Red_Cask_Co._import.png | 2024-08-13 17:12 | 152K | |
| Girvan_1996_TWBl_import.png | 2024-08-13 17:12 | 89K | |
| Girvan_1997_TCaH_The_Grainhound_import.png | 2024-08-13 17:12 | 151K | |
| Girvan_2007_Df_Festival_Edition_import.png | 2024-08-13 17:12 | 102K | |
| Girvan_2007_LT_Autumn_Edition_2022_import.png | 2024-08-13 17:12 | 113K | |
| Girvan_2007_VK_15th_Anniversary_Bottling_import.png | 2024-08-13 17:12 | 102K | |
| Girvan_2007_WhB_import.png | 2024-08-13 17:12 | 188K | |
| Girvan_2009_CA_Authentic_Collection_import.png | 2024-08-13 17:12 | 107K | |
| Girvan_2009_DT_Sherry_Octave_Small_Batch_import.png | 2024-08-13 17:12 | 120K | |
| Girvan_2009_DT_The_Octave_import.png | 2024-08-13 17:12 | 105K | |
| Girvan_2011_MM_The_Art_of_Maturation_-_Select_Grain_import.png | 2024-08-13 17:12 | 130K | |
| Gjoleid_08-year-old_Mesterens_Utvalgte_import.png | 2024-08-13 17:12 | 153K | |
| Gjoleid_09-year-old_Mesterens_Utvalgte_import.png | 2024-08-13 17:12 | 155K | |
| Glacier_Single_Malt_Whisky_import.png | 2024-08-13 17:12 | 114K | |
| Glann_ar_Mor_2018_Santez_Azenor_import.png | 2024-08-13 17:12 | 271K | |
| Glann_ar_Mor_Cognac_Cask_Limited_Edition_import.png | 2024-08-13 17:12 | 150K | |
| Glann_ar_Mor_Fino_Cask_Double_Maturation_-_Limited_Edition_import.png | 2024-08-13 17:12 | 118K | |
| Glann_ar_Mor_Malt_Plumage_Archer_import.png | 2024-08-13 17:12 | 114K | |
| Glasgow_Distillery_2017_CWCL_Watt_Whisky_import.png | 2024-08-13 17:12 | 87K | |
| Glasgow_Distillery_2017_Cl_Warehouse_No._8_import.png | 2024-08-13 17:12 | 234K | |
| Glasgow_Distillery_2017_SCC_The_Independent_Selection_import.png | 2024-08-13 17:12 | 99K | |
| Glasgow_Distillery_2017_TWB_Portfolio_series_import.png | 2024-08-13 17:12 | 129K | |
| GlenDronach 18 Allardice.jpg | 2024-08-13 17:12 | 1.3M | |
| GlenDronach 21 Parliament.jpg | 2024-08-13 17:12 | 30K | |
| GlenDronach Cask Strength.jpg | 2024-08-13 17:12 | 94K | |
| Glen Garioch 12.jpg | 2024-08-13 17:12 | 624K | |
| Glen Garioch Founder's Reserve.jpg | 2024-08-13 17:12 | 617K | |
| GlenWyvis_2018_import.png | 2024-08-13 17:13 | 149K | |
| GlenWyvis_2019_import.png | 2024-08-13 17:13 | 132K | |
| Glen_Breton_Rare_10-year-old_import.png | 2024-08-13 17:13 | 152K | |
| Glen_Breton_Rare_2004_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 185K | |
| Glen_Buchenbach_Schwabian_Single_Malt_import.png | 2024-08-13 17:13 | 162K | |
| Glen_Elgin_12-year-old_CA_Original_Collection_import.png | 2024-08-13 17:13 | 160K | |
| Glen_Elgin_13-year-old_CA_Original_Collection_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Elgin_1992_AqV_Divine_Beasts_import.png | 2024-08-13 17:13 | 135K | |
| Glen_Elgin_1992_HL_Old_&_Rare_Platinum_import.png | 2024-08-13 17:13 | 139K | |
| Glen_Elgin_1995_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 155K | |
| Glen_Elgin_1998_GlMo_A_Rare_Find_import.png | 2024-08-13 17:13 | 82K | |
| Glen_Elgin_2004_LotG_Rare_Cask_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Elgin_2006_AD_Selection_import.png | 2024-08-13 17:13 | 89K | |
| Glen_Elgin_2006_MOM_Single_Cask_Series_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Elgin_2006_NSS_Cask_Series_018_import.png | 2024-08-13 17:13 | 155K | |
| Glen_Elgin_2007_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:13 | 127K | |
| Glen_Elgin_2007_JE_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Elgin_2007_SMWS_85.89_Worm_Tub_Magic_import.png | 2024-08-13 17:13 | 92K | |
| Glen_Elgin_2007_UD_Whisky_Wave_import.png | 2024-08-13 17:13 | 123K | |
| Glen_Elgin_2008_AD_Selection_import.png | 2024-08-13 17:13 | 85K | |
| Glen_Elgin_2008_BR_import.png | 2024-08-13 17:13 | 124K | |
| Glen_Elgin_2008_BW_Zodiac_Series_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Elgin_2008_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Elgin_2008_JE_import.png | 2024-08-13 17:13 | 97K | |
| Glen_Elgin_2008_LMDW_Artist_Collective_#6.5_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Elgin_2008_LotG_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Elgin_2008_TDW_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Elgin_2008_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Elgin_2009_BiM_Millbuies_Springs_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Elgin_2009_CA_Warehouse_Tasting_import.png | 2024-08-13 17:13 | 159K | |
| Glen_Elgin_2009_CQ_Happy_Loner_#2_-_Happy_Birthday_to_Me_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Elgin_2009_DST_Syrah_Edition_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Elgin_2009_DST_Tulip_Edition_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Elgin_2009_JW_Old_Passenger_Ships_import.png | 2024-08-13 17:13 | 119K | |
| Glen_Elgin_2009_MoS_Christmas_Bottling_import.png | 2024-08-13 17:13 | 170K | |
| Glen_Elgin_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Elgin_2009_TBBr_Emojis_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Elgin_2009_TWf_Hiten_Neko_import.png | 2024-08-13 17:13 | 216K | |
| Glen_Elgin_2009_TWf_The_Cat_Gallery_import.png | 2024-08-13 17:13 | 179K | |
| Glen_Elgin_2009_WW8_Exclusive_Messeabfüllung_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Elgin_2009_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:13 | 111K | |
| Glen_Elgin_2010_BR_Single_Cask_import.png | 2024-08-13 17:13 | 126K | |
| Glen_Elgin_2010_DST_Syrah_Edition_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Elgin_2010_JE_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Elgin_2010_SMWS_85.85_Those_arent_regulation_tyres_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Elgin_2010_SMWS_85.86_Semifreddo_al_torrone_e_amaretti_import.png | 2024-08-13 17:13 | 114K | |
| Glen_Elgin_2010_VM_The_Coopers_Choice_import.png | 2024-08-13 17:13 | 262K | |
| Glen_Elgin_2010_WCh_import.png | 2024-08-13 17:13 | 169K | |
| Glen_Elgin_2010_WhNa_import.png | 2024-08-13 17:13 | 90K | |
| Glen_Elgin_2011_CSJS_The_National_Choice_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:13 | 245K | |
| Glen_Elgin_2011_HiSp_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Elgin_2011_HoMc_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Elgin_2011_UWC_Killer_Queen_import.png | 2024-08-13 17:13 | 141K | |
| Glen_Elgin_2011_WhB_Cree_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Elgin_2011_WhB_import.png | 2024-08-13 17:13 | 87K | |
| Glen_Elgin_2012_CWCL_Watt_Whisky_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Elgin_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:13 | 249K | |
| Glen_Elgin_2012_PDnl_import.png | 2024-08-13 17:13 | 145K | |
| Glen_Elgin_2013_BR_Small_Batch_import.png | 2024-08-13 17:13 | 132K | |
| Glen_Elgin_2013_TCaH_Tasting_Tour_import.png | 2024-08-13 17:13 | 136K | |
| Glen_Elgin_2013_WKK_Single_Cask_import.png | 2024-08-13 17:13 | 175K | |
| Glen_Elgin_2014_BR_Speyside_Single_Malt_import.png | 2024-08-13 17:13 | 122K | |
| Glen_Elgin_2014_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:13 | 113K | |
| Glen_Elgin_2014_MM_Spirit_of_Speyside_2023_Festival_Release_import.png | 2024-08-13 17:13 | 112K | |
| Glen_Elgin_2016_Cl_Exploration_Series_import.png | 2024-08-13 17:13 | 134K | |
| Glen_Elgin_Batch_7_TBWC_import.png | 2024-08-13 17:13 | 152K | |
| Glen_Elgin_Peated_Finish_MM_Cask_Craft_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Garioch_10-year-old_DeDr_Equinox_&_Solstice_Summer_Edition_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Garioch_11-year-old_SmBB_import.png | 2024-08-13 17:13 | 270K | |
| Glen_Garioch_18-year-old_AtB_Darkness_import.png | 2024-08-13 17:13 | 144K | |
| Glen_Garioch_1988_BR_Exceptional_Casks_import.png | 2024-08-13 17:13 | 175K | |
| Glen_Garioch_1988_WSP_Edition_No.68_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Garioch_1991_Handfilled_at_Distillery_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Garioch_1991_WSP_Edition_No._65A_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Garioch_2003_SMWS_19.74_Dessert_mirage_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Garioch_2003_SMWS_19.95_Mascarpones_kitchen_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Garioch_2003_SMWS_19.96_Stick_a_wick_in_me_and_call_me_a_candle!_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Garioch_2007_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:13 | 138K | |
| Glen_Garioch_2008_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Garioch_2008_TWf_Bar_Talk_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Garioch_2009_WlRb_Pheasant_Castle_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Garioch_2010_DL_Old_Particular_import.png | 2024-08-13 17:13 | 193K | |
| Glen_Garioch_2010_MBa_No._211_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Garioch_2010_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:13 | 128K | |
| Glen_Garioch_2010_MoS_import.png | 2024-08-13 17:13 | 157K | |
| Glen_Garioch_2011_3W_Superbia_import.png | 2024-08-13 17:13 | 113K | |
| Glen_Garioch_2011_AD_Selection_import.png | 2024-08-13 17:13 | 91K | |
| Glen_Garioch_2011_ANHA_Anam_na_h-Alba_and_Friends_import.png | 2024-08-13 17:13 | 129K | |
| Glen_Garioch_2011_AdF_Classic_import.png | 2024-08-13 17:13 | 200K | |
| Glen_Garioch_2011_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Garioch_2011_BD_import.png | 2024-08-13 17:13 | 167K | |
| Glen_Garioch_2011_BR_Single_Cask_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Garioch_2011_BWM_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Garioch_2011_BiM_Gleann_Gaibheach_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Garioch_2011_Brd_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Garioch_2011_CA_Authentic_Collection_import.png | 2024-08-13 17:13 | 116K | |
| Glen_Garioch_2011_DC_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Garioch_2011_DR_Cask_Collection_import.png | 2024-08-13 17:13 | 76K | |
| Glen_Garioch_2011_DT_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Garioch_2011_ED_First_Editions_import.png | 2024-08-13 17:13 | 222K | |
| Glen_Garioch_2011_F.dk_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Garioch_2011_K23_Mobsters_on_Mopeds_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Garioch_2011_MW_They_Inspired_III_-_Whisky_Icons_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Garioch_2011_MrW_Spirit_of_Caledonia_import.png | 2024-08-13 17:13 | 256K | |
| Glen_Garioch_2011_SM_Mikes_Favorite_Cask_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Garioch_2011_SV_WFL_-_EASE_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Garioch_2011_Sb_Jens_Drewitz´_Personal_Choice_No._5_import.png | 2024-08-13 17:13 | 126K | |
| Glen_Garioch_2011_Sxwh_import.png | 2024-08-13 17:13 | 111K | |
| Glen_Garioch_2011_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:13 | 147K | |
| Glen_Garioch_2011_VK_15th_Anniversary_Bottling_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Garioch_2011_WAGE_No._0021_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Garioch_2011_WhB_import.png | 2024-08-13 17:13 | 86K | |
| Glen_Garioch_2012_CA_Warehouse_Tasting_import.png | 2024-08-13 17:13 | 148K | |
| Glen_Garioch_2012_CA_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Garioch_2012_DS_The_Wild_Scotland_Collection_import.png | 2024-08-13 17:13 | 206K | |
| Glen_Garioch_2012_DT_Single_Cask_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Garioch_2012_ElD_The_Single_Malts_of_Scotland_-_Reserve_Casks_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Garioch_2012_PST_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Garioch_2013_BD_import.png | 2024-08-13 17:13 | 161K | |
| Glen_Garioch_2013_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Garioch_2013_SDW_Cask_Strength_-_Limited_Edition_import.png | 2024-08-13 17:13 | 239K | |
| Glen_Garioch_2013_WhNa_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Garioch_2014_DL_Old_Particular_import.png | 2024-08-13 17:13 | 124K | |
| Glen_Garioch_2014_DL_Provenance_import.png | 2024-08-13 17:13 | 233K | |
| Glen_Garioch_2014_McG_Clan_Denny_import.png | 2024-08-13 17:13 | 127K | |
| Glen_Garioch_2014_NSS_Cask_Series_022_import.png | 2024-08-13 17:13 | 172K | |
| Glen_Garioch_2014_WhEs_import.png | 2024-08-13 17:13 | 89K | |
| Glen_Garioch_2015_AdF_10th_Anniversary_Serie_import.png | 2024-08-13 17:13 | 81K | |
| Glen_Garioch_2015_WMC_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Garioch_Batch_8_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:13 | 259K | |
| Glen_Grant_21-year-old_2023_Release_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Grant_21-year-old_Limited_Edition_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Grant_24-year-old_WSP_Edition_No._56_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Grant_1952_GM_Private_Collection_import.png | 2024-08-13 17:13 | 154K | |
| Glen_Grant_1994_ChM_The_Chess_Malt_Collection_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Grant_1994_HL_Old_&_Rare_-_The_Platinum_Selection_import.png | 2024-08-13 17:13 | 165K | |
| Glen_Grant_1994_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Grant_1994_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:13 | 193K | |
| Glen_Grant_1995_BR_import.png | 2024-08-13 17:13 | 121K | |
| Glen_Grant_1995_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:13 | 113K | |
| Glen_Grant_1995_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 139K | |
| Glen_Grant_1996_MSWD_Càrn_Mòr_Celebration_of_the_Cask_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Grant_1996_SMWS_9.271_Re-rack_to_the_future_import.png | 2024-08-13 17:13 | 207K | |
| Glen_Grant_1997_VWh_The_Constellation_series_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Grant_1998_CQ_Scary_Tale_Series_import.png | 2024-08-13 17:13 | 114K | |
| Glen_Grant_1998_CQ_Urban_Legends_of_Whisky_Lovers_Hong_Kong_-_C-JEY_Girl_Power_import.png | 2024-08-13 17:13 | 285K | |
| Glen_Grant_1998_Ch7_Monologue_import.png | 2024-08-13 17:13 | 136K | |
| Glen_Grant_1998_PST_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Grant_1998_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:13 | 146K | |
| Glen_Grant_1998_TWBl_Exclusive_Bottling_Series_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Grant_1998_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Grant_2000_SV_import.png | 2024-08-13 17:13 | 170K | |
| Glen_Grant_2003_SMWS_9.248_Sweets,_Cakes_and_Nettles!_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Grant_2003_SMWS_9.274_Toffee_apple_orchard_import.png | 2024-08-13 17:13 | 85K | |
| Glen_Grant_2003_SMWS_9.289_Break_The_Mould_import.png | 2024-08-13 17:13 | 88K | |
| Glen_Grant_2004_SMWS_9.281_Effortlessly_Elegant_import.png | 2024-08-13 17:13 | 267K | |
| Glen_Grant_2008_MSWD_Càrn_Mòr_Stricktly_Limited_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Grant_2008_WhNa_Illustration_Series_import.png | 2024-08-13 17:13 | 229K | |
| Glen_Grant_2009_CA_Wood_Range_-_Sherry_Cask_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Grant_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Keith_26-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:13 | 129K | |
| Glen_Keith_1992_MM_Mission_Gold_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Keith_1993_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 162K | |
| Glen_Keith_1993_TWC_import.png | 2024-08-13 17:13 | 124K | |
| Glen_Keith_1993_TWCe_Private_Cellars_Selection_Series_4_import.png | 2024-08-13 17:13 | 156K | |
| Glen_Keith_1993_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Keith_1993_WSP_Edition_No.62_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Keith_1995_BR_Private_Cask_Selection_WPB_import.png | 2024-08-13 17:13 | 127K | |
| Glen_Keith_1996_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 150K | |
| Glen_Keith_1997_NSpS_Baroque_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Keith_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 143K | |
| Glen_Keith_1997_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Keith_1997_WhNa_Illustration_Series_import.png | 2024-08-13 17:13 | 215K | |
| Glen_Keith_1998_CA_Authentic_Collection_import.png | 2024-08-13 17:13 | 133K | |
| Glen_Keith_2013_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Keith_2013_HB_Single_Cask_import.png | 2024-08-13 17:13 | 222K | |
| Glen_Keith_2013_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Keith_2013_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Keith_Distillery_Edition_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Marnoch_03-year-old_Highland_single_malt_scotch_whisky_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Marnoch_03-year-old_Islay_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Mhor_1982_GM_Private_Collection_import.png | 2024-08-13 17:13 | 146K | |
| Glen_Moray_10-year-old_Gently_Spiced_&_Fruity_import.png | 2024-08-13 17:13 | 119K | |
| Glen_Moray_15-year-old_NSS_Periodical_import.png | 2024-08-13 17:13 | 181K | |
| Glen_Moray_1988_DT_The_Octave_Premium_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Moray_1991_BR_import.png | 2024-08-13 17:13 | 122K | |
| Glen_Moray_1991_HiSp_Vintage_Reserve_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Moray_1991_TWB_Portfolio_series_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Moray_1991_WAGE_Phoenix_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Moray_1992_WSP_Edition_No._65b_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Moray_1995_Cl_Warehouse_No._1_import.png | 2024-08-13 17:13 | 209K | |
| Glen_Moray_1995_ED_The_First_Editions_import.png | 2024-08-13 17:13 | 121K | |
| Glen_Moray_1995_HI_Maggies_Collection_import.png | 2024-08-13 17:13 | 256K | |
| Glen_Moray_1998_VK_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Moray_2004_The_Private_Cask_Collection_import.png | 2024-08-13 17:13 | 132K | |
| Glen_Moray_2004_UD_QingChangs_Melody_import.png | 2024-08-13 17:13 | 179K | |
| Glen_Moray_2006_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Moray_2007_AqV_Le_carnaval_des_animaux_import.png | 2024-08-13 17:13 | 126K | |
| Glen_Moray_2007_BD_import.png | 2024-08-13 17:13 | 147K | |
| Glen_Moray_2007_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Moray_2007_CQ_Special_Joint_Bottling_2022_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Moray_2007_Cao_import.png | 2024-08-13 17:13 | 128K | |
| Glen_Moray_2007_DL_Old_Particular_import.png | 2024-08-13 17:13 | 248K | |
| Glen_Moray_2007_DT_Single_Cask_import.png | 2024-08-13 17:13 | 112K | |
| Glen_Moray_2007_DT_The_Octave_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Moray_2007_DrC_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Moray_2007_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:13 | 111K | |
| Glen_Moray_2007_MBl_The_Maltman_import.png | 2024-08-13 17:13 | 113K | |
| Glen_Moray_2007_MrW_Spirit_of_Caledonia_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Moray_2007_NSpS_Modernism_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Moray_2007_PST_import.png | 2024-08-13 17:13 | 92K | |
| Glen_Moray_2007_TFM_City_Landmarks_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Moray_2007_UD_Dreams_of_Gawain_import.png | 2024-08-13 17:13 | 88K | |
| Glen_Moray_2007_UD_Private_Club_Release_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Moray_2007_UD_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Moray_2007_VWh_import.png | 2024-08-13 17:13 | 238K | |
| Glen_Moray_2007_W&C_Jubiläumsabfüllung_25_Jahre_import.png | 2024-08-13 17:13 | 90K | |
| Glen_Moray_2007_WCh_import.png | 2024-08-13 17:13 | 146K | |
| Glen_Moray_2007_WhK_Lord_of_Speyside_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Moray_2008_125th_Anniversary_Bottling_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Moray_2008_Arc_Birds_from_the_Orient_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Moray_2008_BR_Single_Cask_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Moray_2008_BR_import.png | 2024-08-13 17:13 | 121K | |
| Glen_Moray_2008_DT_import.png | 2024-08-13 17:13 | 120K | |
| Glen_Moray_2008_Distillery_Edition_import.png | 2024-08-13 17:13 | 111K | |
| Glen_Moray_2008_JCWS_27th_Release_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Moray_2008_NSS_Cask_Series_018_import.png | 2024-08-13 17:13 | 161K | |
| Glen_Moray_2008_SMWS_35.322_Thousand_sheet_and_a_99_flake_import.png | 2024-08-13 17:13 | 111K | |
| Glen_Moray_2008_T&O_Single_Cask_Series_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Moray_2008_UD_BLACKNESS_import.png | 2024-08-13 17:13 | 212K | |
| Glen_Moray_2008_UD_Bottling_No._3_import.png | 2024-08-13 17:13 | 153K | |
| Glen_Moray_2008_WhB_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Moray_2009_UD_bank_notes_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Moray_2010_MaUn_Fantasy_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Moray_2010_NSS_Cask_Series_020_import.png | 2024-08-13 17:13 | 178K | |
| Glen_Moray_2010_Warehouse_1_import.png | 2024-08-13 17:13 | 137K | |
| Glen_Moray_2011_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:13 | 130K | |
| Glen_Moray_2011_Distillery_Edition_import.png | 2024-08-13 17:13 | 114K | |
| Glen_Moray_2011_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Moray_2012_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Moray_2012_JE_import.png | 2024-08-13 17:13 | 106K | |
| Glen_Moray_2012_TnTC_import.png | 2024-08-13 17:13 | 116K | |
| Glen_Moray_2013_DR_Cask_Collection_import.png | 2024-08-13 17:13 | 81K | |
| Glen_Moray_2013_Distillery_Hand_Bottling_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Moray_2013_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Moray_2013_Sxwh_Azure_Edition_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Moray_2013_Sxwh_Velvet_Edition_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Moray_2013_The_Private_Cask_Collection_import.png | 2024-08-13 17:13 | 123K | |
| Glen_Moray_2013_Warehouse_1_import.png | 2024-08-13 17:13 | 147K | |
| Glen_Moray_2013_WhB_import.png | 2024-08-13 17:13 | 88K | |
| Glen_Moray_2014_Duty_Paid_Sample_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Moray_2014_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 119K | |
| Glen_Moray_2014_The_Private_Cask_Collection_import.png | 2024-08-13 17:13 | 138K | |
| Glen_Moray_2014_Warehouse_1_import.png | 2024-08-13 17:13 | 148K | |
| Glen_Moray_2015_3W_Classics_of_Eyewear_-_Roger_-_Vesper_import.png | 2024-08-13 17:13 | 189K | |
| Glen_Moray_2015_3W_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Moray_2015_AtMy_Wasted_Wolf_Whisky_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Moray_2015_Hand_bottled_at_the_Distillery_import.png | 2024-08-13 17:13 | 127K | |
| Glen_Moray_2015_Wx_Spirit_&_Cask_Range_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Moray_Phoenix_Rising_import.png | 2024-08-13 17:13 | 245K | |
| Glen_Moray_Twisted_Vine_import.png | 2024-08-13 17:13 | 116K | |
| Glen_Mosset_2013_MBa_No._212_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Mosset_2013_MoS_import.png | 2024-08-13 17:13 | 162K | |
| Glen_Ord_2008_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Ord_2008_myBar_import.png | 2024-08-13 17:13 | 130K | |
| Glen_Ord_2009_AI_The_Alba_Trail_import.png | 2024-08-13 17:13 | 119K | |
| Glen_Ord_2009_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Ord_2009_HSD_Longvalley_Selection_import.png | 2024-08-13 17:13 | 118K | |
| Glen_Ord_2009_HiSp_Region_Highland_import.png | 2024-08-13 17:13 | 130K | |
| Glen_Ord_2009_SMWS_77.73_Waxy_McSherryface_import.png | 2024-08-13 17:13 | 289K | |
| Glen_Ord_2010_CA_Wood_Range_-_Wine_Cask_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Ord_2010_PST_Error_502_Bad_Gateway_import.png | 2024-08-13 17:13 | 85K | |
| Glen_Ord_2010_PST_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Ord_2011_JE_Sherry_Cask_Finish_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Ord_2011_JE_import.png | 2024-08-13 17:13 | 90K | |
| Glen_Ord_2011_MBl_The_Maltman_import.png | 2024-08-13 17:13 | 114K | |
| Glen_Ord_2012_AdF_Classic_import.png | 2024-08-13 17:13 | 109K | |
| Glen_Ord_2012_LMDW_Artist_Collective_#6.3_import.png | 2024-08-13 17:13 | 159K | |
| Glen_Ord_2012_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:13 | 121K | |
| Glen_Ord_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Ord_2012_TGSC_Ralfy.com_Bottling_005_import.png | 2024-08-13 17:13 | 130K | |
| Glen_Ord_2012_WhB_import.png | 2024-08-13 17:13 | 88K | |
| Glen_Ord_2012_vW_import.png | 2024-08-13 17:13 | 112K | |
| Glen_Ord_2013_HB_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Ord_2013_JE_Sherry_Cask_Finish_import.png | 2024-08-13 17:13 | 92K | |
| Glen_Ord_2014_3W_import.png | 2024-08-13 17:13 | 91K | |
| Glen_Ord_2015_BWM_Easter_Edition_2022_import.png | 2024-08-13 17:13 | 136K | |
| Glen_Scotia_08-year-old_Campbeltown_Malts_Festival_2022_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Scotia_10-year-old_Classic_Campbeltown_Malt_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Scotia_10-year-old_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Scotia_11-year-old_Campbeltown_Malts_Festival_2023_import.png | 2024-08-13 17:13 | 89K | |
| Glen_Scotia_12-year-old_Icons_of_Campbeltown_-_No._1,_The_Mermaid_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Scotia_12-year-old_Seasonal_Release_import.png | 2024-08-13 17:13 | 97K | |
| Glen_Scotia_15-year-old_Rich_&_Smooth_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Scotia_18-year-old_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Scotia_25-year-old_Classic_Campbeltown_Malt_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Scotia_1991_Exclusive_Cask_-_Dunnage_Warhouse_Series_import.png | 2024-08-13 17:13 | 238K | |
| Glen_Scotia_1991_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:13 | 140K | |
| Glen_Scotia_1991_MoS_Rare_Casks_Range_import.png | 2024-08-13 17:13 | 150K | |
| Glen_Scotia_1991_V&M_import.png | 2024-08-13 17:13 | 265K | |
| Glen_Scotia_1999_Distillery_of_the_year_2021_import.png | 2024-08-13 17:13 | 103K | |
| Glen_Scotia_1999_Dunnage_Tasting_import.png | 2024-08-13 17:13 | 186K | |
| Glen_Scotia_2002_Dunnage_Tasting_import.png | 2024-08-13 17:13 | 188K | |
| Glen_Scotia_2002_Single_Cask_-_Dunnage_Warhouse_Series_import.png | 2024-08-13 17:13 | 255K | |
| Glen_Scotia_2002_Single_Cask_Exclusive_Shop_Dunnage_Releases_import.png | 2024-08-13 17:13 | 89K | |
| Glen_Scotia_2003_Shop_Bottling_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Scotia_2004_Campbeltown_Malts_Festival_2022_import.png | 2024-08-13 17:13 | 93K | |
| Glen_Scotia_2005_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Scotia_2006_Single_Cask_-_Dunnage_Warhouse_Series_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Scotia_2009_Exclusive_Cask_-_Dunnage_Warhouse_Series_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Scotia_2009_SMWS_93.186_Fantasy_on_the_Rocks_import.png | 2024-08-13 17:13 | 121K | |
| Glen_Scotia_2013_Exclusive_Cask_import.png | 2024-08-13 17:13 | 108K | |
| Glen_Scotia_2013_Limited_Edition_-_Single_Cask_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Scotia_2013_SMWS_93.189_Reminiscing_and_daydreaming_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Scotia_2013_Single_Cask_-_Dunnage_Warhouse_Series_import.png | 2024-08-13 17:13 | 255K | |
| Glen_Scotia_2013_Single_Cask_Selection_Spring_2022_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Scotia_2013_Single_Cask_import.png | 2024-08-13 17:13 | 183K | |
| Glen_Scotia_2013_import.png | 2024-08-13 17:13 | 86K | |
| Glen_Scotia_2014_An_Epiphany_import.png | 2024-08-13 17:13 | 91K | |
| Glen_Scotia_2014_Exclusive_Cask_import.png | 2024-08-13 17:13 | 98K | |
| Glen_Scotia_2014_Limited_Edition_import.png | 2024-08-13 17:13 | 102K | |
| Glen_Scotia_2014_SMWS_93.205_Pebbles,_flowers_and_pickles_import.png | 2024-08-13 17:13 | 115K | |
| Glen_Scotia_2014_import.png | 2024-08-13 17:13 | 104K | |
| Glen_Scotia_2015_Distillery_Exclusive_import.png | 2024-08-13 17:13 | 225K | |
| Glen_Scotia_2015_Single_Cask_Selection_Spring_2022_import.png | 2024-08-13 17:13 | 97K | |
| Glen_Scotia_2015_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Scotia_2016_Campbeltown_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:13 | 91K | |
| Glen_Scotia_2016_Distillery_Exclusive_import.png | 2024-08-13 17:13 | 105K | |
| Glen_Scotia_2016_Korea_Single_Cask_import.png | 2024-08-13 17:13 | 225K | |
| Glen_Scotia_2016_Master_Cask_Collection_import.png | 2024-08-13 17:13 | 95K | |
| Glen_Scotia_2016_NMWL_no._10_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Scotia_2016_import.png | 2024-08-13 17:13 | 90K | |
| Glen_Scotia_2017_Distillery_Exclusive_import.png | 2024-08-13 17:13 | 92K | |
| Glen_Scotia_2017_Single_Cask_import.png | 2024-08-13 17:13 | 256K | |
| Glen_Scotia_Campbeltown_Harbour_Classic_Campbeltown_Malt_import.png | 2024-08-13 17:13 | 94K | |
| Glen_Scotia_Double_Cask_Rum_Cask_Finish_Classic_Campbeltown_Malt_import.png | 2024-08-13 17:13 | 88K | |
| Glen_Scotia_Victoriana_Cask_Strength_import.png | 2024-08-13 17:13 | 97K | |
| Glen_Shodnya_50_50_Months_Old_import.png | 2024-08-13 17:13 | 86K | |
| Glen_Spey_11-year-old_SlB_import.png | 2024-08-13 17:13 | 142K | |
| Glen_Spey_2006_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:13 | 132K | |
| Glen_Spey_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 135K | |
| Glen_Spey_2008_CWCL_Watt_Whisky_import.png | 2024-08-13 17:13 | 87K | |
| Glen_Spey_2010_BA_Raw_Cask_import.png | 2024-08-13 17:13 | 226K | |
| Glen_Spey_2010_JE_import.png | 2024-08-13 17:13 | 96K | |
| Glen_Spey_2010_Joy_SPECIAL_RELEASES_-_NO.5_import.png | 2024-08-13 17:13 | 257K | |
| Glen_Spey_2010_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Spey_2010_Sxwh_import.png | 2024-08-13 17:13 | 150K | |
| Glen_Spey_2010_TCaH_Special_Release_-_Single_Cask_import.png | 2024-08-13 17:13 | 158K | |
| Glen_Spey_2010_WhB_Cree_import.png | 2024-08-13 17:13 | 101K | |
| Glen_Spey_2011_JE_Small_Batch_import.png | 2024-08-13 17:13 | 100K | |
| Glen_Spey_2011_JE_import.png | 2024-08-13 17:13 | 119K | |
| Glen_Spey_2011_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 112K | |
| Glen_Spey_2011_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:13 | 112K | |
| Glen_Spey_2011_vW_The_Ultimate_import.png | 2024-08-13 17:13 | 110K | |
| Glen_Spey_2012_Cl_Exploration_Series_import.png | 2024-08-13 17:13 | 123K | |
| Glen_Spey_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:13 | 231K | |
| Glen_Spey_2012_JE_import.png | 2024-08-13 17:13 | 86K | |
| Glen_Spey_2012_LotG_Rare_Cask_import.png | 2024-08-13 17:13 | 107K | |
| Glen_Spey_2013_IN2S_Release_07_import.png | 2024-08-13 17:13 | 99K | |
| Glen_Spey_2013_IN2S_Release_08_import.png | 2024-08-13 17:13 | 98K | |
| Glenalba_19-year-old_Cd_import.png | 2024-08-13 17:12 | 97K | |
| Glenallachie_04-year-old_Future_Edition_import.png | 2024-08-13 17:12 | 140K | |
| Glenallachie_07-year-old_Virgin_Oak_Series_import.png | 2024-08-13 17:12 | 137K | |
| Glenallachie_08-year-old_Virgin_Oak_Series_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_08-year-old_import.png | 2024-08-13 17:12 | 136K | |
| Glenallachie_9-year-old_Wine_Series_-_Douro_Valley_Wine_import.png | 2024-08-13 17:12 | 133K | |
| Glenallachie_10-year-old_Cask_Strength_import.png | 2024-08-13 17:12 | 146K | |
| Glenallachie_10-year-old_Ruby_Wood_Finish_Series_-_Port_import.png | 2024-08-13 17:12 | 125K | |
| Glenallachie_10-year-old_Virgin_Oak_Series_-_Chinquapin_Oak_import.png | 2024-08-13 17:12 | 140K | |
| Glenallachie_10-year-old_Virgin_Oak_Series_-_French_Oak_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_10-year-old_Virgin_Oak_Series_-_Spanish_Oak_import.png | 2024-08-13 17:12 | 136K | |
| Glenallachie_10-year-old_Wine_Series_import.png | 2024-08-13 17:12 | 134K | |
| Glenallachie_11-year-old_Marsala_Wood_Finish_import.png | 2024-08-13 17:12 | 128K | |
| Glenallachie_11-year-old_Wine_Series_-_Premier_Cru_Classé_Wine_Cask_Finish_import.png | 2024-08-13 17:12 | 134K | |
| Glenallachie_12-year-old_Wood_Finish_Series_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_12-year-old_import.png | 2024-08-13 17:12 | 129K | |
| Glenallachie_13-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 138K | |
| Glenallachie_13-year-old_Oloroso_Wood_Finish_import.png | 2024-08-13 17:12 | 140K | |
| Glenallachie_15-year-old_Virgin_Oak_Series_-_Scottish_Oak_import.png | 2024-08-13 17:12 | 143K | |
| Glenallachie_15-year-old_import.png | 2024-08-13 17:12 | 128K | |
| Glenallachie_16-year-old_Past_Edition_import.png | 2024-08-13 17:12 | 136K | |
| Glenallachie_16-year-old_Present_Edition_import.png | 2024-08-13 17:12 | 140K | |
| Glenallachie_16-year-old_Year_of_the_Rabbit_import.png | 2024-08-13 17:12 | 181K | |
| Glenallachie_18.png | 2025-03-15 17:19 | 217K | |
| Glenallachie_21-year-old_Batch_Number_Four_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_21-year-old_Batch_Number_Three_import.png | 2024-08-13 17:12 | 137K | |
| Glenallachie_21-year-old_Batch_Number_Two_import.png | 2024-08-13 17:12 | 143K | |
| Glenallachie_30-year-old_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_2004_V&M_The_Spirit_of_Art_import.png | 2024-08-13 17:12 | 111K | |
| Glenallachie_2005_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:12 | 138K | |
| Glenallachie_2005_Single_Cask_import.png | 2024-08-13 17:12 | 148K | |
| Glenallachie_2006_Handfilled_at_Distillery_import.png | 2024-08-13 17:12 | 139K | |
| Glenallachie_2006_Single_Cask_for_Europe_-_Batch_5_import.png | 2024-08-13 17:12 | 137K | |
| Glenallachie_2006_Single_Cask_import.png | 2024-08-13 17:12 | 119K | |
| Glenallachie_2007_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 150K | |
| Glenallachie_2007_SV_Limited_Animal_Edition_No._2_import.png | 2024-08-13 17:12 | 147K | |
| Glenallachie_2007_Single_Cask_-_Hand_Filled_import.png | 2024-08-13 17:12 | 183K | |
| Glenallachie_2007_Single_Cask_for_Europe_-_Batch_5_import.png | 2024-08-13 17:12 | 131K | |
| Glenallachie_2007_Single_Cask_for_Europe_-_Batch_6_import.png | 2024-08-13 17:12 | 135K | |
| Glenallachie_2007_Single_Cask_import.png | 2024-08-13 17:12 | 122K | |
| Glenallachie_2007_import.png | 2024-08-13 17:12 | 92K | |
| Glenallachie_2008_BR_Single_Cask_import.png | 2024-08-13 17:12 | 268K | |
| Glenallachie_2008_BW_Die_Whisky_Elfen_import.png | 2024-08-13 17:12 | 111K | |
| Glenallachie_2008_DT_Sherry_Octave_Small_Batch_import.png | 2024-08-13 17:12 | 123K | |
| Glenallachie_2008_DT_Single_Cask_import.png | 2024-08-13 17:12 | 111K | |
| Glenallachie_2008_DT_The_Octave_import.png | 2024-08-13 17:12 | 201K | |
| Glenallachie_2008_Exclusive_Single_Cask_for_Sweden_import.png | 2024-08-13 17:12 | 133K | |
| Glenallachie_2008_GlMo_A_Rare_Find_import.png | 2024-08-13 17:12 | 123K | |
| Glenallachie_2008_MBl_The_Maltman_-_Single_Cask_import.png | 2024-08-13 17:12 | 107K | |
| Glenallachie_2008_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:12 | 134K | |
| Glenallachie_2008_MM_Benchmark_import.png | 2024-08-13 17:12 | 122K | |
| Glenallachie_2008_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 168K | |
| Glenallachie_2008_Single_Cask_for_Europe_-_Batch_5_import.png | 2024-08-13 17:12 | 143K | |
| Glenallachie_2008_Single_Cask_import.png | 2024-08-13 17:12 | 134K | |
| Glenallachie_2008_TWC_import.png | 2024-08-13 17:12 | 112K | |
| Glenallachie_2008_import.png | 2024-08-13 17:12 | 124K | |
| Glenallachie_2009_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:12 | 99K | |
| Glenallachie_2009_Handfilled_at_the_distillery_import.png | 2024-08-13 17:12 | 142K | |
| Glenallachie_2009_MM_Single_Malt_Journeys_import.png | 2024-08-13 17:12 | 144K | |
| Glenallachie_2009_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 149K | |
| Glenallachie_2009_SV_import.png | 2024-08-13 17:12 | 123K | |
| Glenallachie_2009_Single_Cask_for_Europe_-_Batch_6_import.png | 2024-08-13 17:12 | 135K | |
| Glenallachie_2009_Single_Cask_import.png | 2024-08-13 17:12 | 134K | |
| Glenallachie_2009_import.png | 2024-08-13 17:12 | 131K | |
| Glenallachie_2010_Single_Cask_for_Europe_-_Batch_5_import.png | 2024-08-13 17:12 | 136K | |
| Glenallachie_2010_Single_Cask_import.png | 2024-08-13 17:12 | 150K | |
| Glenallachie_2010_import.png | 2024-08-13 17:12 | 207K | |
| Glenallachie_2011_Cuvée_Cask_Finish_import.png | 2024-08-13 17:12 | 145K | |
| Glenallachie_2011_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:12 | 110K | |
| Glenallachie_2011_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:12 | 117K | |
| Glenallachie_2011_PST_import.png | 2024-08-13 17:12 | 100K | |
| Glenallachie_2011_Single_Cask_for_Europe_-_Batch_5_import.png | 2024-08-13 17:12 | 133K | |
| Glenallachie_2011_Single_Cask_for_Europe_-_Batch_6_import.png | 2024-08-13 17:12 | 135K | |
| Glenallachie_2011_Single_Cask_import.png | 2024-08-13 17:12 | 133K | |
| Glenallachie_2011_import.png | 2024-08-13 17:12 | 120K | |
| Glenallachie_2012_A&G_Rare_Casks_import.png | 2024-08-13 17:12 | 112K | |
| Glenallachie_2012_Cuvée_Cask_Finish_import.png | 2024-08-13 17:12 | 149K | |
| Glenallachie_2012_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 147K | |
| Glenallachie_2012_Single_Cask_import.png | 2024-08-13 17:12 | 132K | |
| Glenallachie_2012_WT_Joker_import.png | 2024-08-13 17:12 | 104K | |
| Glenallachie_2012_WhB_import.png | 2024-08-13 17:12 | 99K | |
| Glenallachie_2012_Wine_Series_-_Cuvée_Cask_Finish_import.png | 2024-08-13 17:12 | 136K | |
| Glenallachie_2013_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:12 | 108K | |
| Glenallachie_2013_WW8_The_Warehouse_Collection_import.png | 2024-08-13 17:12 | 116K | |
| Glenallachie_2014_JW_Fighting_Fish_import.png | 2024-08-13 17:12 | 99K | |
| Glenallachie_2014_MMM_Mythical_Series_import.png | 2024-08-13 17:12 | 129K | |
| Glenallachie_2014_Single_Cask_import.png | 2024-08-13 17:12 | 135K | |
| Glenallachie_2015_Cl_Claxtons_Exclusive_import.png | 2024-08-13 17:12 | 245K | |
| Glenallachie_2015_Cl_Warehouse_No._8_import.png | 2024-08-13 17:12 | 191K | |
| Glenallachie_2016_Dar_Private_Barrel_-_Single_Cask_import.png | 2024-08-13 17:12 | 161K | |
| Glenallachie_2016_WhAr_Nils_Forsberg_fils._import.png | 2024-08-13 17:12 | 154K | |
| Glenallachie_Summer_Fruits_VM_The_Coopers_Choice_import.png | 2024-08-13 17:12 | 118K | |
| Glenburgie_13-year-old_CA_Original_Collection_import.png | 2024-08-13 17:12 | 143K | |
| Glenburgie_13-year-old_DR_import.png | 2024-08-13 17:12 | 96K | |
| Glenburgie_17-year-old_import.png | 2024-08-13 17:12 | 113K | |
| Glenburgie_1988_HL_Old_&_Rare_import.png | 2024-08-13 17:12 | 149K | |
| Glenburgie_1995_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 122K | |
| Glenburgie_1995_LotG_Rare_Cask_import.png | 2024-08-13 17:12 | 108K | |
| Glenburgie_1995_NSPS_Neoclassicism_import.png | 2024-08-13 17:12 | 116K | |
| Glenburgie_1995_NSS_Cask_Series_020_import.png | 2024-08-13 17:12 | 180K | |
| Glenburgie_1995_PST_Redacted_Bros._import.png | 2024-08-13 17:12 | 116K | |
| Glenburgie_1995_PST_import.png | 2024-08-13 17:12 | 107K | |
| Glenburgie_1995_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 140K | |
| Glenburgie_1995_SV_import.png | 2024-08-13 17:12 | 161K | |
| Glenburgie_1995_TWA_import.png | 2024-08-13 17:12 | 123K | |
| Glenburgie_1995_TWf_The_Cat_Gallery_import.png | 2024-08-13 17:12 | 137K | |
| Glenburgie_1996_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 107K | |
| Glenburgie_2003_MBa_No._209_import.png | 2024-08-13 17:12 | 100K | |
| Glenburgie_2004_OXH_Shelter_import.png | 2024-08-13 17:12 | 108K | |
| Glenburgie_2005_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:12 | 125K | |
| Glenburgie_2008_BR_Scyfion_Choice_import.png | 2024-08-13 17:12 | 109K | |
| Glenburgie_2008_BR_Single_Cask_import.png | 2024-08-13 17:12 | 135K | |
| Glenburgie_2008_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 147K | |
| Glenburgie_2008_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:12 | 105K | |
| Glenburgie_2008_TSCL_Family_Series_import.png | 2024-08-13 17:12 | 164K | |
| Glenburgie_2010_DRFS_Wu_Dram_Clan_Lighthouse_series_import.png | 2024-08-13 17:12 | 110K | |
| Glenburgie_2010_DR_Cask_Collection_import.png | 2024-08-13 17:12 | 95K | |
| Glenburgie_2010_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:12 | 113K | |
| Glenburgie_2010_Sb_Spirits_Shop_Selection_import.png | 2024-08-13 17:12 | 233K | |
| Glenburgie_2011_CA_Port_Cask_import.png | 2024-08-13 17:12 | 114K | |
| Glenburgie_2011_CA_Warehouse_Tasting_import.png | 2024-08-13 17:12 | 144K | |
| Glenburgie_2011_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:12 | 109K | |
| Glenburgie_2011_TnTC_import.png | 2024-08-13 17:12 | 119K | |
| Glenburgie_2012_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:12 | 212K | |
| Glenburgie_2012_VM_The_Coopers_Choice_import.png | 2024-08-13 17:12 | 114K | |
| Glenburn_2016_DR_Cask_Collection_import.png | 2024-08-13 17:12 | 70K | |
| Glencadam_10-year-old_CA_Original_Collection_import.png | 2024-08-13 17:12 | 139K | |
| Glencadam_13-year-old_The_Re-awakening_-_Limited_Edition_import.png | 2024-08-13 17:12 | 110K | |
| Glencadam_18-year-old_import.png | 2024-08-13 17:12 | 94K | |
| Glencadam_1977_Joy_Connoisseur_Selection_-_NO.29_import.png | 2024-08-13 17:12 | 101K | |
| Glencadam_1995_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 130K | |
| Glencadam_1998_Single_Cask_import.png | 2024-08-13 17:12 | 101K | |
| Glencadam_1999_Single_Cask_import.png | 2024-08-13 17:12 | 105K | |
| Glencadam_2003_Single_Cask_The_Rather_Unique_import.png | 2024-08-13 17:12 | 281K | |
| Glencadam_2007_Reserva_de_Jerez_Oloroso_import.png | 2024-08-13 17:12 | 109K | |
| Glencadam_2007_Reserva_de_Jerez_import.png | 2024-08-13 17:12 | 98K | |
| Glencadam_2011_ANHA_import.png | 2024-08-13 17:12 | 115K | |
| Glencadam_2011_BA_Cask_Strength_import.png | 2024-08-13 17:12 | 113K | |
| Glencadam_2011_BR_Single_Cask_import.png | 2024-08-13 17:12 | 119K | |
| Glencadam_2011_SMWS_82.50_Savour_a_summer_sunset_import.png | 2024-08-13 17:12 | 105K | |
| Glencadam_2011_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:12 | 111K | |
| Glencadam_2011_TWB_Call_That_A_Grand_Prix_import.png | 2024-08-13 17:12 | 120K | |
| Glencadam_2011_TWEx_import.png | 2024-08-13 17:12 | 90K | |
| Glencadam_2011_vW_The_Ultimate_import.png | 2024-08-13 17:12 | 108K | |
| Glencadam_2012_BD_import.png | 2024-08-13 17:12 | 155K | |
| Glencadam_2012_CA_import.png | 2024-08-13 17:12 | 115K | |
| Glencadam_2012_DR_Cask_Collection_import.png | 2024-08-13 17:12 | 75K | |
| Glencadam_2012_EVWC_import.png | 2024-08-13 17:12 | 121K | |
| Glencadam_2012_HMcD_The_Golden_Cask_-_Reserve_import.png | 2024-08-13 17:12 | 102K | |
| Glencadam_2012_MM_Benchmark_import.png | 2024-08-13 17:12 | 124K | |
| Glencadam_2012_Single_Cask_import.png | 2024-08-13 17:12 | 121K | |
| Glencadam_2012_SpLu_League_of_Great_Bars_import.png | 2024-08-13 17:12 | 113K | |
| Glencadam_2012_WcL_10_Jahre_Whiskyclub_Lichtenstein_import.png | 2024-08-13 17:12 | 88K | |
| Glencadam_American_Oak_Reserve_Small_Batch_import.png | 2024-08-13 17:12 | 107K | |
| Glencadam_Reserva_PX_Small_Batch_import.png | 2024-08-13 17:12 | 111K | |
| Glencadam_Reserva_de_Porto_Tawny_Small_Batch_import.png | 2024-08-13 17:12 | 112K | |
| Glendalough_07-year-old_Mizunara_Finished_import.png | 2024-08-13 17:12 | 127K | |
| Glendalough_Grand_Cru_Burgundy_Cask_Finish_import.png | 2024-08-13 17:12 | 110K | |
| Glendalough_Madeira_Cask_Finish_Single_Cask_import.png | 2024-08-13 17:12 | 111K | |
| Glendalough_Single_Cask_Irish_Whisky_import.png | 2024-08-13 17:12 | 131K | |
| Glendronach_28-year-old_Grandeur_import.png | 2024-08-13 17:12 | 138K | |
| Glendronach_29-year-old_Grandeur_import.png | 2024-08-13 17:12 | 142K | |
| Glendronach_1991_NSS_Cask_Series_021_import.png | 2024-08-13 17:12 | 169K | |
| Glendronach_1993_Cask_Bottling_import.png | 2024-08-13 17:12 | 121K | |
| Glendronach_1993_Hand-filled_at_the_Distillery_import.png | 2024-08-13 17:12 | 104K | |
| Glendronach_1994_Cask_Bottling_import.png | 2024-08-13 17:12 | 104K | |
| Glendronach_1994_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:12 | 96K | |
| Glendronach_2010_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:12 | 121K | |
| Glendronach_2010_WCR_Club_Filling_import.png | 2024-08-13 17:12 | 149K | |
| Glendronach_2011_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:12 | 111K | |
| Glendronach_2011_Hand-Filled_at_the_Distillery_import.png | 2024-08-13 17:12 | 102K | |
| Glendronach_2011_Vintage_import.png | 2024-08-13 17:12 | 90K | |
| Glendronach_2012_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:12 | 118K | |
| Glendronach_2012_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 115K | |
| Glendronach_Cask_Strength_Batch_11_import.png | 2024-08-13 17:12 | 115K | |
| Glendronach_Cask_Strength_Batch_12_import.png | 2024-08-13 17:12 | 115K | |
| Glendullan_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 121K | |
| Glendullan_2009_GM_Connoisseurs_Choice_-_Wood_Finished_import.png | 2024-08-13 17:12 | 140K | |
| Glendullan_2009_JE_Single_Cask_import.png | 2024-08-13 17:12 | 110K | |
| Glendullan_2009_SV_Cask_Strength_import.png | 2024-08-13 17:12 | 103K | |
| Glendullan_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:12 | 112K | |
| Glendullan_2009_vW_import.png | 2024-08-13 17:12 | 103K | |
| Glendullan_2010_ANHA_import.png | 2024-08-13 17:12 | 129K | |
| Glendullan_2010_HL_Hepburns_Choice_import.png | 2024-08-13 17:12 | 113K | |
| Glendullan_2011_DS_The_Wild_Scotland_Collection_import.png | 2024-08-13 17:12 | 100K | |
| Glendullan_2011_JE_import.png | 2024-08-13 17:12 | 115K | |
| Glenfarclas 17.jpg | 2024-08-13 17:12 | 38K | |
| Glenfarclas 105 Cask Strength.jpg | 2024-08-13 17:12 | 159K | |
| Glenfarclas_09-year-old_import.png | 2024-08-13 17:12 | 122K | |
| Glenfarclas_10-year-old_100_Proof_import.png | 2024-08-13 17:12 | 121K | |
| Glenfarclas_10-year-old_Cask_Strength_import.png | 2024-08-13 17:12 | 158K | |
| Glenfarclas_10-year-old_Tyndrum_Gold_import.png | 2024-08-13 17:12 | 115K | |
| Glenfarclas_12-year-old_Cask_Strength_import.png | 2024-08-13 17:12 | 272K | |
| Glenfarclas_12-year-old_import.png | 2024-08-13 17:12 | 150K | |
| Glenfarclas_14-year-old_import.png | 2024-08-13 17:12 | 118K | |
| Glenfarclas_15-year-old_Cask_Strength_import.png | 2024-08-13 17:12 | 160K | |
| Glenfarclas_15-year-old_Jons_Utvalgte_import.png | 2024-08-13 17:12 | 142K | |
| Glenfarclas_15-year-old_import.png | 2024-08-13 17:12 | 108K | |
| Glenfarclas_25-year-old_Cask_Strength_-_Poland_Exclusive_-_Birds_import.png | 2024-08-13 17:12 | 142K | |
| Glenfarclas_25-year-old_Cask_Strength_import.png | 2024-08-13 17:12 | 147K | |
| Glenfarclas_26-year-old_import.png | 2024-08-13 17:12 | 126K | |
| Glenfarclas_35-year-old_import.png | 2024-08-13 17:12 | 118K | |
| Glenfarclas_50-year-old_import.png | 2024-08-13 17:12 | 115K | |
| Glenfarclas_105_import.png | 2024-08-13 17:12 | 139K | |
| Glenfarclas_1964_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 147K | |
| Glenfarclas_1967_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 155K | |
| Glenfarclas_1968_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 147K | |
| Glenfarclas_1969_Single_Cask_import.png | 2024-08-13 17:12 | 190K | |
| Glenfarclas_1973_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 136K | |
| Glenfarclas_1977_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 151K | |
| Glenfarclas_1977_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 119K | |
| Glenfarclas_1978_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 144K | |
| Glenfarclas_1978_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 128K | |
| Glenfarclas_1980_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 132K | |
| Glenfarclas_1985_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 137K | |
| Glenfarclas_1985_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 135K | |
| Glenfarclas_1986_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 135K | |
| Glenfarclas_1987_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 136K | |
| Glenfarclas_1988_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 177K | |
| Glenfarclas_1988_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 134K | |
| Glenfarclas_1989_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 125K | |
| Glenfarclas_1990_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 131K | |
| Glenfarclas_1992_The_Family_Casks_-_Special_Edition_import.png | 2024-08-13 17:12 | 138K | |
| Glenfarclas_1995_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 141K | |
| Glenfarclas_1995_The_Family_Casks_-_Special_Release_import.png | 2024-08-13 17:12 | 123K | |
| Glenfarclas_1997_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 140K | |
| Glenfarclas_1998_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 185K | |
| Glenfarclas_1999_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 133K | |
| Glenfarclas_1999_The_Family_Casks_-_Millennium_Cask_import.png | 2024-08-13 17:12 | 130K | |
| Glenfarclas_2000_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 132K | |
| Glenfarclas_2000_The_Family_Casks_(Release_S23)_import.png | 2024-08-13 17:12 | 138K | |
| Glenfarclas_2000_The_Family_Casks_-_Millennium_Cask_import.png | 2024-08-13 17:12 | 128K | |
| Glenfarclas_2001_CA_Authentic_Collection_import.png | 2024-08-13 17:12 | 117K | |
| Glenfarclas_2001_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 132K | |
| Glenfarclas_2002_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 137K | |
| Glenfarclas_2002_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 143K | |
| Glenfarclas_2003_CA_Authentic_Collection_import.png | 2024-08-13 17:12 | 140K | |
| Glenfarclas_2003_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 126K | |
| Glenfarclas_2003_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 131K | |
| Glenfarclas_2004_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 136K | |
| Glenfarclas_2004_The_Family_Casks_(Release_S23)_import.png | 2024-08-13 17:12 | 126K | |
| Glenfarclas_2005_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 134K | |
| Glenfarclas_2005_import.png | 2024-08-13 17:12 | 133K | |
| Glenfarclas_2006_The_Family_Casks_(Release_S22)_import.png | 2024-08-13 17:12 | 135K | |
| Glenfarclas_2006_The_Family_Casks_(Release_S23)_import.png | 2024-08-13 17:12 | 147K | |
| Glenfarclas_2006_The_Family_Casks_import.png | 2024-08-13 17:12 | 140K | |
| Glenfarclas_2007_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 140K | |
| Glenfarclas_2007_Visitor_Centre_Exclusive_import.png | 2024-08-13 17:12 | 122K | |
| Glenfarclas_2007_Warehouse_Select_-_Edition_#006_import.png | 2024-08-13 17:12 | 255K | |
| Glenfarclas_2008_CA_Authentic_Collection_import.png | 2024-08-13 17:12 | 104K | |
| Glenfarclas_2008_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 162K | |
| Glenfarclas_2008_SWF_#39_import.png | 2024-08-13 17:12 | 209K | |
| Glenfarclas_2010_Christmas_Edition_import.png | 2024-08-13 17:12 | 124K | |
| Glenfarclas_2010_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 145K | |
| Glenfarclas_2010_WCR_Club_Filling_import.png | 2024-08-13 17:12 | 151K | |
| Glenfarclas_2011_NSS_Cask_Serie_022_import.png | 2024-08-13 17:12 | 156K | |
| Glenfarclas_2011_UD_import.png | 2024-08-13 17:12 | 311K | |
| Glenfarclas_2012_SMWS_1.274_A_snow_melt_waterfall_import.png | 2024-08-13 17:12 | 202K | |
| Glenfarclas_2012_The_Family_Casks_-_Special_Edition_import.png | 2024-08-13 17:12 | 181K | |
| Glenfarclas_2012_Warehouse_Select_-_Edition_#007_import.png | 2024-08-13 17:12 | 253K | |
| Glenfarclas_2012_import.png | 2024-08-13 17:12 | 128K | |
| Glenfarclas_2013_Christmas_Edition_import.png | 2024-08-13 17:12 | 122K | |
| Glenfarclas_2013_SMWS_1.283_Happy_in_a_hippy_shop_import.png | 2024-08-13 17:12 | 87K | |
| Glenfarclas_2013_Single_Cask_import.png | 2024-08-13 17:12 | 122K | |
| Glenfarclas_2013_Special_Edition_import.png | 2024-08-13 17:12 | 131K | |
| Glenfarclas_2015_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 167K | |
| Glenfarclas_2017_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 166K | |
| Glenfarclas_2018_Duty_Paid_Sample_import.png | 2024-08-13 17:12 | 146K | |
| Glenfarclas_Private_Reserve_46th_Anniversary_import.png | 2024-08-13 17:12 | 150K | |
| Glenfiddich 12.jpg | 2024-08-13 17:12 | 1.2M | |
| Glenfiddich 14 Rich Oak.jpg | 2024-08-13 17:12 | 419K | |
| Glenfiddich 15.jpg | 2024-08-13 17:12 | 18K | |
| Glenfiddich 15 Distillery Edition.jpg | 2024-08-13 17:12 | 126K | |
| Glenfiddich 18.jpg | 2024-08-13 17:12 | 16K | |
| Glenfiddich Snow Phoenix.jpg | 2024-08-13 17:12 | 45K | |
| Glenfiddich_12-year-old_Spirit_of_Speyside_Whisky_Festival_import.png | 2024-08-13 17:12 | 99K | |
| Glenfiddich_13-year-old_Spirit_of_Speyside_Whisky_Festival_import.png | 2024-08-13 17:12 | 106K | |
| Glenfiddich_14-year-old_Spirit_of_Speyside_Whisky_Festival_import.png | 2024-08-13 17:12 | 110K | |
| Glenfiddich_15-year-old_CS_Handbottled_at_the_Distillery_import.png | 2024-08-13 17:12 | 114K | |
| Glenfiddich_15-year-old_CS_The_Distillery_Malt_import.png | 2024-08-13 17:12 | 103K | |
| Glenfiddich_15-year-old_Cask_Strength_-_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:12 | 106K | |
| Glenfiddich_15-year-old_Perpetual_VAT_03_import.png | 2024-08-13 17:12 | 96K | |
| Glenfiddich_18-year-old_Perpetual_VAT_04_import.png | 2024-08-13 17:12 | 98K | |
| Glenfiddich_21-year-old_Gran_Reserva_import.png | 2024-08-13 17:12 | 118K | |
| Glenfiddich_2009_Spirit_Of_Speyside_2022_-_The_Coopers_Cask_import.png | 2024-08-13 17:12 | 121K | |
| Glenfiddich_Orchard_Experiment_Experimental_Series_No._05_import.png | 2024-08-13 17:12 | 100K | |
| Glenfiddich_Project_XX_Experimental_Series_No._02_import.png | 2024-08-13 17:12 | 91K | |
| Glenglassaugh_06-year-old_DMor_import.png | 2024-08-13 17:12 | 103K | |
| Glenglassaugh_07-year-old_DMor_import.png | 2024-08-13 17:12 | 104K | |
| Glenglassaugh_12-year-old_import.png | 2024-08-13 17:12 | 135K | |
| Glenglassaugh_1975_import.png | 2024-08-13 17:12 | 190K | |
| Glenglassaugh_2009_TCaH_Crazy_Coos_Collection_4_import.png | 2024-08-13 17:12 | 112K | |
| Glenglassaugh_2011_MoS_Warehouse_Collection_import.png | 2024-08-13 17:12 | 161K | |
| Glenglassaugh_2011_Rare_Cask_Bottling_import.png | 2024-08-13 17:12 | 147K | |
| Glenglassaugh_2012_AD_Selection_import.png | 2024-08-13 17:12 | 86K | |
| Glenglassaugh_2012_Rare_Cask_Release_import.png | 2024-08-13 17:12 | 140K | |
| Glenglassaugh_2012_The_Octave_Cask_import.png | 2024-08-13 17:12 | 89K | |
| Glenglassaugh_2012_UD_import.png | 2024-08-13 17:12 | 81K | |
| Glenglassaugh_2012_import.png | 2024-08-13 17:12 | 133K | |
| Glenglassaugh_2012_whic_Amazing_Whiskies_Ep._23_-_Craigmills_import.png | 2024-08-13 17:12 | 198K | |
| Glenglassaugh_2013_TCaWi_import.png | 2024-08-13 17:12 | 153K | |
| Glenglassaugh_2014_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:12 | 135K | |
| Glenglassaugh_2014_DR_Cask_Collection_import.png | 2024-08-13 17:12 | 107K | |
| Glenglassaugh_2014_VM_The_Coopers_Choice_import.png | 2024-08-13 17:12 | 136K | |
| Glenglassaugh_2014_WW8_The_Warehouse_&_Friends_import.png | 2024-08-13 17:12 | 128K | |
| Glenglassaugh_2015_import.png | 2024-08-13 17:12 | 104K | |
| Glenglassaugh_2018_Cl_Exploration_Series_import.png | 2024-08-13 17:12 | 264K | |
| Glenglassaugh_Evolution_import.png | 2024-08-13 17:12 | 149K | |
| Glenglassaugh_Portsoy_import.png | 2024-08-13 17:12 | 136K | |
| Glenglassaugh_Sandend_import.png | 2024-08-13 17:12 | 135K | |
| Glengoyne 10.jpg | 2024-08-13 17:12 | 20K | |
| Glengoyne_10-year-old_First_Fill_Edition_import.png | 2024-08-13 17:12 | 107K | |
| Glengoyne_10-year-old_import.png | 2024-08-13 17:12 | 92K | |
| Glengoyne_15-year-old_BW_A_Dream_of_Scotland_-_Fairytale_Series_import.png | 2024-08-13 17:12 | 136K | |
| Glengoyne_15-year-old_PX_Cask_Edition_import.png | 2024-08-13 17:12 | 102K | |
| Glengoyne_15-year-old_import.png | 2024-08-13 17:12 | 95K | |
| Glengoyne_21-year-old_Unhurried_Since_1833_import.png | 2024-08-13 17:12 | 129K | |
| Glengoyne_26-year-old_Spirit_of_Time_import.png | 2024-08-13 17:12 | 126K | |
| Glengoyne_2000_Hand_Filled_Single_Cask_Bottling_import.png | 2024-08-13 17:12 | 165K | |
| Glengoyne_2004_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 94K | |
| Glengoyne_2005_JW_Caskman_import.png | 2024-08-13 17:12 | 120K | |
| Glengoyne_2005_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 111K | |
| Glengoyne_2007_AM_import.png | 2024-08-13 17:12 | 96K | |
| Glengoyne_2007_ED_The_First_Editions_import.png | 2024-08-13 17:12 | 118K | |
| Glengoyne_2007_Fb_Italian_Car_Series_import.png | 2024-08-13 17:12 | 135K | |
| Glengoyne_2007_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:12 | 109K | |
| Glengoyne_2007_Hand_bottled_-_available_only_at_the_distillery_import.png | 2024-08-13 17:12 | 97K | |
| Glengoyne_2007_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:12 | 99K | |
| Glengoyne_2007_Handfilled_bottle_import.png | 2024-08-13 17:12 | 94K | |
| Glengoyne_2007_Single_Cask_import.png | 2024-08-13 17:12 | 118K | |
| Glengoyne_2007_import.png | 2024-08-13 17:12 | 111K | |
| Glengoyne_2008_Cask_Owner_import.png | 2024-08-13 17:12 | 92K | |
| Glengoyne_2008_Cask_Owners_import.png | 2024-08-13 17:12 | 96K | |
| Glengoyne_2008_ED_The_First_Editions_import.png | 2024-08-13 17:12 | 118K | |
| Glengoyne_2008_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 96K | |
| Glengoyne_2009_Single_Cask_import.png | 2024-08-13 17:12 | 119K | |
| Glengoyne_2009_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 249K | |
| Glengoyne_2010_Cask_Owner_import.png | 2024-08-13 17:12 | 96K | |
| Glengoyne_2010_Signature_Edition_THE_TRIBUTE_import.png | 2024-08-13 17:12 | 113K | |
| Glengoyne_2010_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 92K | |
| Glengoyne_2010_Wild_Sealion_import.png | 2024-08-13 17:12 | 110K | |
| Glengoyne_2011_Cask_Owner_import.png | 2024-08-13 17:12 | 107K | |
| Glengoyne_2011_DL_Old_Particular_import.png | 2024-08-13 17:12 | 133K | |
| Glengoyne_2011_GlSp_import.png | 2024-08-13 17:12 | 132K | |
| Glengoyne_2011_Private_Cask_import.png | 2024-08-13 17:12 | 97K | |
| Glengoyne_2011_The_Distillery_Cask_import.png | 2024-08-13 17:12 | 170K | |
| Glengoyne_2012_Cask_Owner_import.png | 2024-08-13 17:12 | 237K | |
| Glengoyne_2013_DL_Old_Particular_-_Fanatical_About_Flavour_import.png | 2024-08-13 17:12 | 104K | |
| Glengoyne_Cask_Strength_import.png | 2024-08-13 17:12 | 110K | |
| Glengoyne_Teapot_Dram_Distillery_Only_import.png | 2024-08-13 17:12 | 87K | |
| Glengoyne_The_Legacy_Series_Chapter_Three_-_The_offline_edition_import.png | 2024-08-13 17:12 | 93K | |
| Glengoyne_The_Legacy_Series_Chapter_Three_import.png | 2024-08-13 17:12 | 101K | |
| Glenkinchie_12-year-old_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:12 | 104K | |
| Glenkinchie_27-year-old_The_Floral_Treasure_-_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:12 | 94K | |
| Glenkinchie_2009_Hand_Filled_distillery_Exclusive_import.png | 2024-08-13 17:12 | 106K | |
| Glenkinchie_The_Distillers_Edition_2022_import.png | 2024-08-13 17:12 | 102K | |
| Glenlivet 18.jpg | 2024-08-13 17:12 | 197K | |
| Glenlivet 21 Archive.jpg | 2024-08-13 17:12 | 34K | |
| Glenlivet_12-year-old_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 106K | |
| Glenlivet_12-year-old_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:12 | 109K | |
| Glenlivet_13-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 101K | |
| Glenlivet_13-year-old_First_Fill_Double_Oak_import.png | 2024-08-13 17:12 | 117K | |
| Glenlivet_13-year-old_Tropical_Rum_Cask_import.png | 2024-08-13 17:12 | 254K | |
| Glenlivet_15-year-old_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 109K | |
| Glenlivet_15-year-old_Handfilled_at_Distillery_import.png | 2024-08-13 17:12 | 123K | |
| Glenlivet_15-year-old_Sherry_Cask_Matured_import.png | 2024-08-13 17:12 | 102K | |
| Glenlivet_18-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:12 | 95K | |
| Glenlivet_18-year-old_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 105K | |
| Glenlivet_1994_import.png | 2024-08-13 17:12 | 118K | |
| Glenlivet_1998_Cellar_Collection_import.png | 2024-08-13 17:12 | 120K | |
| Glenlivet_1999_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:12 | 160K | |
| Glenlivet_2004_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 180K | |
| Glenlivet_2006_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 148K | |
| Glenlivet_2006_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:12 | 101K | |
| Glenlivet_2006_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:12 | 113K | |
| Glenlivet_2007_Distillery_Reserve_Collection_import.png | 2024-08-13 17:12 | 147K | |
| Glenlivet_2007_SMWS_2.138_Raisin_toffee_jam_import.png | 2024-08-13 17:12 | 115K | |
| Glenlivet_2007_SV_Decanterserie_import.png | 2024-08-13 17:12 | 164K | |
| Glenlivet_2007_SV_Ralfy_1,000th_Review_import.png | 2024-08-13 17:12 | 110K | |
| Glenlivet_2007_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:12 | 107K | |
| Glenlivet_2007_WSP_Edition_No._57_import.png | 2024-08-13 17:12 | 109K | |
| Glenlivet_2007_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:12 | 116K | |
| Glenlivet_2011_Distillery_Reserve_Collection_import.png | 2024-08-13 17:12 | 148K | |
| Glenlivet_Founders_Reserve_American_Oak_Selection_import.png | 2024-08-13 17:12 | 108K | |
| Glenlivet_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:12 | 100K | |
| Glenlivet_Nàdurra_1st_Fill_Selection_import.png | 2024-08-13 17:12 | 101K | |
| Glenlivet_Rare_Cask_Triple_Cask_Matured_import.png | 2024-08-13 17:12 | 118K | |
| Glenlochy_1979_GM_The_Recollection_Series_nr.2_import.png | 2024-08-13 17:12 | 162K | |
| Glenlossie_10-year-old_JE_Small_Batch_import.png | 2024-08-13 17:12 | 103K | |
| Glenlossie_10-year-old_NSS_Periodical_import.png | 2024-08-13 17:12 | 190K | |
| Glenlossie_12-year-old_CA_Original_Collection_import.png | 2024-08-13 17:12 | 149K | |
| Glenlossie_1992_HL_Old_&_Rare_import.png | 2024-08-13 17:12 | 168K | |
| Glenlossie_1997_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:12 | 120K | |
| Glenlossie_1997_MBl_The_Maltman_import.png | 2024-08-13 17:12 | 107K | |
| Glenlossie_1997_MBl_import.png | 2024-08-13 17:12 | 110K | |
| Glenlossie_2006_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:12 | 156K | |
| Glenlossie_2007_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:12 | 108K | |
| Glenlossie_2008_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:12 | 126K | |
| Glenlossie_2008_SM_Premium_Selection_import.png | 2024-08-13 17:12 | 137K | |
| Glenlossie_2008_SV_Small_Batch_Edition_#12_import.png | 2024-08-13 17:12 | 109K | |
| Glenlossie_2008_TSCL_Family_Series_import.png | 2024-08-13 17:12 | 163K | |
| Glenlossie_2008_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:12 | 102K | |
| Glenlossie_2009_AD_Selection_import.png | 2024-08-13 17:12 | 91K | |
| Glenlossie_2009_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:12 | 126K | |
| Glenlossie_2009_BR_Single_Cask_import.png | 2024-08-13 17:12 | 130K | |
| Glenlossie_2009_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:12 | 94K | |
| Glenlossie_2009_MT_Member_Bottling_2023_import.png | 2024-08-13 17:12 | 93K | |
| Glenlossie_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:12 | 112K | |
| Glenlossie_2009_TWCe_Pintail_import.png | 2024-08-13 17:12 | 94K | |
| Glenlossie_2010_BR_Single_Cask_import.png | 2024-08-13 17:12 | 125K | |
| Glenlossie_2010_SMWS_46.144_Intense_earthy_sweetness_import.png | 2024-08-13 17:12 | 113K | |
| Glenlossie_2011_MoSp_Marble_collection_import.png | 2024-08-13 17:12 | 126K | |
| Glenlossie_2012_NSS_Cask_Series_022_import.png | 2024-08-13 17:12 | 175K | |
| Glenlossie_2012_SMWS_46.116_Snickerdoodle!_import.png | 2024-08-13 17:12 | 113K | |
| Glenlossie_2012_SV_Collection_Plume_import.png | 2024-08-13 17:12 | 174K | |
| Glenlossie_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:12 | 107K | |
| Glenlossie_2012_vW_The_Ultimate_import.png | 2024-08-13 17:13 | 101K | |
| Glenlossie_2013_CV_EWK_19_import.png | 2024-08-13 17:13 | 94K | |
| Glenlossie_2013_CV_import.png | 2024-08-13 17:13 | 98K | |
| Glenlossie_2013_Dar_Private_Barrel_import.png | 2024-08-13 17:13 | 163K | |
| Glenlossie_2013_F.dk_import.png | 2024-08-13 17:13 | 102K | |
| Glenlossie_2013_WM_Barrel_Selection_import.png | 2024-08-13 17:13 | 112K | |
| Glenlossie_2013_WhAr_Nils_Forsberg_fils._import.png | 2024-08-13 17:13 | 151K | |
| Glenmarvellous_2008_Df_62nd_release_import.png | 2024-08-13 17:13 | 122K | |
| Glenmarvellous_2008_Df_import.png | 2024-08-13 17:13 | 111K | |
| Glenmarvellous_2010_Df_48th_release_import.png | 2024-08-13 17:13 | 189K | |
| Glenmorangie 18.jpg | 2024-08-13 17:13 | 125K | |
| Glenmorangie Artein.jpg | 2024-08-13 17:13 | 4.4K | |
| Glenmorangie Astar.jpg | 2024-08-13 17:13 | 2.6K | |
| Glenmorangie Quinta Ruban.jpg | 2024-08-13 17:13 | 29K | |
| Glenmorangie_10-year-old_The_Original_import.png | 2024-08-13 17:13 | 96K | |
| Glenmorangie_12-year-old_Barrel_Select_Release_import.png | 2024-08-13 17:13 | 106K | |
| Glenmorangie_12-year-old_Lasanta_-_5th_Edition_import.png | 2024-08-13 17:13 | 104K | |
| Glenmorangie_14-year-old_Quinta_Ruban_-_5th_Edition_import.png | 2024-08-13 17:13 | 111K | |
| Glenmorangie_15-year-old_The_Cadboll_Estate_import.png | 2024-08-13 17:13 | 114K | |
| Glenmorangie_1998_Grand_Vintage_Malt_-_Bond_House_No._1_Collection_import.png | 2024-08-13 17:13 | 112K | |
| Glenmorangie_1999_CNY_-_Year_Of_The_Rabbit_import.png | 2024-08-13 17:13 | 104K | |
| Glenmorangie_2005_SMWS_125.80_Dance_of_the_pastry_chef_import.png | 2024-08-13 17:13 | 108K | |
| Glenmorangie_A_Tale_of_Tokyo_Limited_Edition_import.png | 2024-08-13 17:13 | 105K | |
| Glenmorangie_A_Tale_of_the_Forest_Limited_Edition_import.png | 2024-08-13 17:13 | 104K | |
| Glenrothes_12-year-old_AtB_Darkness_import.png | 2024-08-13 17:13 | 147K | |
| Glenrothes_12-year-old_DT_Battlehill_import.png | 2024-08-13 17:13 | 107K | |
| Glenrothes_13-year-old_WUA_Ghost_of_Kyiv_import.png | 2024-08-13 17:13 | 121K | |
| Glenrothes_16-year-old_CA_Authentic_Collection_import.png | 2024-08-13 17:13 | 96K | |
| Glenrothes_21-year-old_UD_Stamperla_import.png | 2024-08-13 17:13 | 84K | |
| Glenrothes_31-year-old_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:13 | 117K | |
| Glenrothes_42-year-old_The_42_import.png | 2024-08-13 17:13 | 163K | |
| Glenrothes_1980_WhRp_Book_of_Changes_Series_import.png | 2024-08-13 17:13 | 98K | |
| Glenrothes_1985_TR_import.png | 2024-08-13 17:13 | 111K | |
| Glenrothes_1986_DRFS_import.png | 2024-08-13 17:13 | 107K | |
| Glenrothes_1986_DR_Vintage_Cask_Collection_import.png | 2024-08-13 17:13 | 192K | |
| Glenrothes_1986_NSS_Cask_Series_020_import.png | 2024-08-13 17:13 | 162K | |
| Glenrothes_1986_TWJ_import.png | 2024-08-13 17:13 | 109K | |
| Glenrothes_1989_Sb_White_Label_import.png | 2024-08-13 17:13 | 116K | |
| Glenrothes_1995_LMDW_Artist_#12_import.png | 2024-08-13 17:13 | 158K | |
| Glenrothes_1995_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:13 | 159K | |
| Glenrothes_1995_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 154K | |
| Glenrothes_1996_Kb_Finest_And_Rarest_-_Handwritten_Label_import.png | 2024-08-13 17:13 | 238K | |
| Glenrothes_1996_LotG_import.png | 2024-08-13 17:13 | 118K | |
| Glenrothes_1996_MaUn_Oil_Paintings_01_import.png | 2024-08-13 17:13 | 94K | |
| Glenrothes_1996_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:13 | 158K | |
| Glenrothes_1997_CA_Authentic_Collection_import.png | 2024-08-13 17:13 | 120K | |
| Glenrothes_1997_DR_Cask_Collection_import.png | 2024-08-13 17:13 | 78K | |
| Glenrothes_1997_NSS_Cask_Series_020_import.png | 2024-08-13 17:13 | 146K | |
| Glenrothes_1997_PST_import.png | 2024-08-13 17:13 | 246K | |
| Glenrothes_1997_TWC_import.png | 2024-08-13 17:13 | 128K | |
| Glenrothes_1997_TWJ_import.png | 2024-08-13 17:13 | 97K | |
| Glenrothes_1997_TWf_Chen_Uens_Romance_of_the_Three_Kingdoms_import.png | 2024-08-13 17:13 | 118K | |
| Glenrothes_1998_LotG_Rare_Cask_import.png | 2024-08-13 17:13 | 100K | |
| Glenrothes_1998_MBa_The_26_#1_import.png | 2024-08-13 17:13 | 97K | |
| Glenrothes_1998_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:13 | 140K | |
| Glenrothes_2004_DL_Old_Particular_-_The_Midnight_Series_import.png | 2024-08-13 17:13 | 126K | |
| Glenrothes_2005_ED_The_First_Editions_import.png | 2024-08-13 17:13 | 265K | |
| Glenrothes_2006_DL_Old_Particular_-_The_Dutch_Dram_Masters_import.png | 2024-08-13 17:13 | 114K | |
| Glenrothes_2006_DL_Old_Particular_import.png | 2024-08-13 17:13 | 116K | |
| Glenrothes_2006_NSS_Cask_Series_020_import.png | 2024-08-13 17:13 | 151K | |
| Glenrothes_2006_Sb_NMWL_Oslo_#1_import.png | 2024-08-13 17:13 | 97K | |
| Glenrothes_2006_UD_import.png | 2024-08-13 17:13 | 135K | |
| Glenrothes_2007_AD_Selection_import.png | 2024-08-13 17:13 | 92K | |
| Glenrothes_2007_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:13 | 95K | |
| Glenrothes_2007_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 124K | |
| Glenrothes_2008_AC_Double_Matured_Selection_import.png | 2024-08-13 17:13 | 105K | |
| Glenrothes_2008_SE_Cat_Label_Serie_import.png | 2024-08-13 17:13 | 120K | |
| Glenrothes_2008_SE_import.png | 2024-08-13 17:13 | 117K | |
| Glenrothes_2009_DT_Single_Cask_import.png | 2024-08-13 17:13 | 240K | |
| Glenrothes_2009_DT_The_Octave_import.png | 2024-08-13 17:13 | 92K | |
| Glenrothes_2009_MoM_import.png | 2024-08-13 17:13 | 95K | |
| Glenrothes_2009_WDS_import.png | 2024-08-13 17:13 | 103K | |
| Glenrothes_2010_MaUn_Fantasy_import.png | 2024-08-13 17:13 | 101K | |
| Glenrothes_2010_SV_The_Un-Chillfiltered_Collection_-_white_turf_import.png | 2024-08-13 17:13 | 115K | |
| Glenrothes_2010_VM_The_Coopers_Choice_import.png | 2024-08-13 17:13 | 124K | |
| Glenrothes_2010_WM_Barrel_Selection_-_Private_Cask_import.png | 2024-08-13 17:13 | 116K | |
| Glenrothes_2010_WM_Barrel_Selection_import.png | 2024-08-13 17:13 | 107K | |
| Glenrothes_2011_CsA_import.png | 2024-08-13 17:13 | 106K | |
| Glenrothes_2011_MiMa_import.png | 2024-08-13 17:13 | 229K | |
| Glenrothes_2011_Orc_import.png | 2024-08-13 17:13 | 87K | |
| Glenrothes_2011_PST_Error_502_Series_import.png | 2024-08-13 17:13 | 77K | |
| Glenrothes_2011_PST_import.png | 2024-08-13 17:13 | 89K | |
| Glenrothes_2011_Privatfat_import.png | 2024-08-13 17:13 | 101K | |
| Glenrothes_2011_RM_Single_Cask_import.png | 2024-08-13 17:13 | 205K | |
| Glenrothes_2011_SV_Single_Cask_Seasons_-_Autumn_2022_import.png | 2024-08-13 17:13 | 122K | |
| Glenrothes_2011_SV_Small_Batch_Edition_#2_import.png | 2024-08-13 17:13 | 105K | |
| Glenrothes_2011_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 100K | |
| Glenrothes_2011_TWA_Fhathast_a_lorg_an_uisge_naomh_import.png | 2024-08-13 17:13 | 89K | |
| Glenrothes_2011_TWA_import.png | 2024-08-13 17:13 | 121K | |
| Glenrothes_2012_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:13 | 127K | |
| Glenrothes_2012_CsA_Mc_Shelfie_import.png | 2024-08-13 17:13 | 210K | |
| Glenrothes_2012_DMor_import.png | 2024-08-13 17:13 | 107K | |
| Glenrothes_2012_DT_The_Octave_import.png | 2024-08-13 17:13 | 108K | |
| Glenrothes_2012_F.dk_import.png | 2024-08-13 17:13 | 112K | |
| Glenrothes_2012_TDD_import.png | 2024-08-13 17:13 | 87K | |
| Glenrothes_2012_WDS_import.png | 2024-08-13 17:13 | 102K | |
| Glenrothes_2013_DR_Cask_Collection_import.png | 2024-08-13 17:13 | 91K | |
| Glenrothes_2013_DT_Sherry_Octave_Small_Batch_import.png | 2024-08-13 17:13 | 122K | |
| Glenrothes_2013_DT_Single_Cask_import.png | 2024-08-13 17:13 | 111K | |
| Glenrothes_2013_SMWS_30.122_A_bootful_of_brazil_nuts_import.png | 2024-08-13 17:13 | 102K | |
| Glenrothes_2013_TSCL_Family_Series_import.png | 2024-08-13 17:13 | 152K | |
| Glenrothes_2014_Cl_Warehouse_No._8_import.png | 2024-08-13 17:13 | 245K | |
| Glenrothes_2014_HB_Finest_Collection_-_Cask_Strength_import.png | 2024-08-13 17:13 | 107K | |
| Glenrothes_Late_Hour_Port_Finish_Cask_Strength_-_Limited_Edition_import.png | 2024-08-13 17:13 | 255K | |
| Glenshiel_11-year-old_TSA_Secreta_Essentiae_Cognitionis_import.png | 2024-08-13 17:13 | 165K | |
| Glentauchers_08-year-old_ChWh_import.png | 2024-08-13 17:13 | 114K | |
| Glentauchers_11-year-old_DT_Battlehill_import.png | 2024-08-13 17:13 | 115K | |
| Glentauchers_14-year-old_CA_Original_Collection_import.png | 2024-08-13 17:13 | 150K | |
| Glentauchers_14-year-old_ChWh_import.png | 2024-08-13 17:13 | 113K | |
| Glentauchers_17-year-old_Ballantines_Signature_Malts_-_a_series_of_Three_import.png | 2024-08-13 17:13 | 124K | |
| Glentauchers_24-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:13 | 128K | |
| Glentauchers_26-year-old_ChWh_import.png | 2024-08-13 17:13 | 118K | |
| Glentauchers_1990_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 169K | |
| Glentauchers_1996_DT_The_Octave_Premium_import.png | 2024-08-13 17:13 | 97K | |
| Glentauchers_1996_TWCC_Standard_Bottling_import.png | 2024-08-13 17:13 | 112K | |
| Glentauchers_1997_PST_Error_502_Series_import.png | 2024-08-13 17:13 | 83K | |
| Glentauchers_1997_SMDr_Single_Cask_import.png | 2024-08-13 17:13 | 100K | |
| Glentauchers_2002_AC_The_Alambic_Classique_Collection_import.png | 2024-08-13 17:13 | 117K | |
| Glentauchers_2002_SMWS_63.104_Banana_ice_cream_smoothie_import.png | 2024-08-13 17:13 | 100K | |
| Glentauchers_2002_SMWS_63.112_Pure_class!_import.png | 2024-08-13 17:13 | 111K | |
| Glentauchers_2005_WSP_Edition_No._81_import.png | 2024-08-13 17:13 | 106K | |
| Glentauchers_2006_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 122K | |
| Glentauchers_2007_VWh_import.png | 2024-08-13 17:13 | 199K | |
| Glentauchers_2008_AL&C_Single_Cask_import.png | 2024-08-13 17:13 | 109K | |
| Glentauchers_2008_CA_Warehouse_Tasting_import.png | 2024-08-13 17:13 | 152K | |
| Glentauchers_2008_DHGS_Connoisseurs_Dram_import.png | 2024-08-13 17:13 | 129K | |
| Glentauchers_2008_DT_Sherry_Cask_Octave_Small_Batch_import.png | 2024-08-13 17:13 | 119K | |
| Glentauchers_2008_DT_Single_Cask_import.png | 2024-08-13 17:13 | 112K | |
| Glentauchers_2008_DT_The_Octave_import.png | 2024-08-13 17:13 | 90K | |
| Glentauchers_2008_DT_import.png | 2024-08-13 17:13 | 105K | |
| Glentauchers_2008_GM_Distillery_Labels_import.png | 2024-08-13 17:13 | 130K | |
| Glentauchers_2008_NSS_Cask_Series_021_import.png | 2024-08-13 17:13 | 159K | |
| Glentauchers_2008_NSpS_Modernism_import.png | 2024-08-13 17:13 | 122K | |
| Glentauchers_2008_PDnl_Barnyards_Delight_import.png | 2024-08-13 17:13 | 155K | |
| Glentauchers_2008_Sa_import.png | 2024-08-13 17:13 | 124K | |
| Glentauchers_2008_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:13 | 167K | |
| Glentauchers_2009_BuBa_The_Sticky_Label-_Untamed_Animals_import.png | 2024-08-13 17:13 | 112K | |
| Glentauchers_2009_CA_Authentic_Collection_import.png | 2024-08-13 17:13 | 249K | |
| Glentauchers_2009_DT_The_Octave_import.png | 2024-08-13 17:13 | 95K | |
| Glentauchers_2009_DT_import.png | 2024-08-13 17:13 | 83K | |
| Glentauchers_2009_HSD_Longvalley_Selection_import.png | 2024-08-13 17:13 | 116K | |
| Glentauchers_2009_JW_Saxon_Elbe_Valley_-_Limited_Edition_No._6_import.png | 2024-08-13 17:13 | 116K | |
| Glentauchers_2009_LMDW_Artist_Collective_#6.4_import.png | 2024-08-13 17:13 | 157K | |
| Glentauchers_2009_MBa_No._221_import.png | 2024-08-13 17:13 | 103K | |
| Glentauchers_2009_MMM_Mythical_Series_import.png | 2024-08-13 17:13 | 126K | |
| Glentauchers_2009_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:13 | 118K | |
| Glentauchers_2009_MoM_Single_Cask_import.png | 2024-08-13 17:13 | 86K | |
| Glentauchers_2009_NSpS_Modernism_import.png | 2024-08-13 17:13 | 100K | |
| Glentauchers_2009_Sb_The_Traveller_import.png | 2024-08-13 17:13 | 105K | |
| Glentauchers_2009_TWf_Hiten_Neko_import.png | 2024-08-13 17:13 | 270K | |
| Glentauchers_2009_WJ_Art_Edition_No._5_import.png | 2024-08-13 17:13 | 116K | |
| Glentauchers_2010_PotS_Inverdarach_Potstill_Editions_Aon_import.png | 2024-08-13 17:13 | 111K | |
| Glentauchers_2010_SV_Single_Cask_Seasons_import.png | 2024-08-13 17:13 | 121K | |
| Glentauchers_2010_TWC_import.png | 2024-08-13 17:13 | 113K | |
| Glentauchers_2011_AI_The_Alba_Trail_import.png | 2024-08-13 17:13 | 103K | |
| Glentauchers_2011_CA_Cadenheads_Club_import.png | 2024-08-13 17:13 | 105K | |
| Glentauchers_2011_CA_Warehouse_Tasting_import.png | 2024-08-13 17:13 | 130K | |
| Glentauchers_2011_CA_Wood_Range_-_Sherry_Cask_import.png | 2024-08-13 17:13 | 99K | |
| Glentauchers_2011_CQ_Scary_Tale_Series_import.png | 2024-08-13 17:13 | 116K | |
| Glentauchers_2011_DR_Cask_Collection_import.png | 2024-08-13 17:13 | 74K | |
| Glentauchers_2011_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:13 | 96K | |
| Glentauchers_2011_MSWD_Càrn_Mòr_-_Strictly_Limited_import.png | 2024-08-13 17:13 | 105K | |
| Glentauchers_2011_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:13 | 105K | |
| Glentauchers_2011_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:13 | 154K | |
| Glentauchers_2011_import.png | 2024-08-13 17:13 | 126K | |
| Glentauchers_2012_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:13 | 127K | |
| Glentauchers_2012_BA_Raw_Cask_import.png | 2024-08-13 17:13 | 104K | |
| Glentauchers_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:13 | 110K | |
| Glentauchers_2013_HB_Single_Cask_import.png | 2024-08-13 17:13 | 101K | |
| Glentauchers_2013_HB_import.png | 2024-08-13 17:13 | 109K | |
| Glentauchers_2013_LotG_import.png | 2024-08-13 17:13 | 118K | |
| Glentauchers_2013_UD_import.png | 2024-08-13 17:13 | 90K | |
| Glentauchers_2014_H&H_The_Falls_of_Caledonia_import.png | 2024-08-13 17:13 | 153K | |
| Glentauchers_2014_HAH_The_Falls_of_Caledonia_import.png | 2024-08-13 17:13 | 319K | |
| Glentauchers_2014_JE_Small_Batch_import.png | 2024-08-13 17:13 | 96K | |
| Glentauchers_2015_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:13 | 137K | |
| Glenturret_07-year-old_-_Peat_Smoked_2022_Release_import.png | 2024-08-13 17:13 | 135K | |
| Glenturret_07-year-old_Peat_Smoked_-_2023_Release_import.png | 2024-08-13 17:13 | 156K | |
| Glenturret_10-year-old_-_Peat_Smoked_2022_Release_import.png | 2024-08-13 17:13 | 154K | |
| Glenturret_10-year-old_-_Peat_Smoked_2023_Release_import.png | 2024-08-13 17:13 | 161K | |
| Glenturret_12-year-old_2022_Release_import.png | 2024-08-13 17:13 | 124K | |
| Glenturret_12-year-old_2023_Release_import.png | 2024-08-13 17:13 | 131K | |
| Glenturret_15-year-old_2022_Release_import.png | 2024-08-13 17:13 | 130K | |
| Glenturret_15-year-old_2023_Release_import.png | 2024-08-13 17:13 | 129K | |
| Glenturret_30-year-old_2022_Release_import.png | 2024-08-13 17:13 | 139K | |
| Glenturret_1990_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:13 | 157K | |
| Glenturret_2004_DL_Private_Stock_import.png | 2024-08-13 17:13 | 127K | |
| Glenturret_2006_GM_Connoisseurs_Choice_Cask_Strength_import.png | 2024-08-13 17:13 | 122K | |
| Glenturret_2010_WW8_The_Warehouse_Collection_import.png | 2024-08-13 17:13 | 87K | |
| Glenturret_2011_WhNa_import.png | 2024-08-13 17:13 | 87K | |
| Glenturret_2013_CsA_ruadh_maor_import.png | 2024-08-13 17:13 | 93K | |
| Glenturret_2013_SMWS_16.76_Peat-Smoked_Porter_import.png | 2024-08-13 17:13 | 96K | |
| Glenturret_2013_SMWS_16.81_Firecracker_stir_fry_sauce_import.png | 2024-08-13 17:13 | 94K | |
| Glenturret_2013_VM_The_Coopers_Choice_import.png | 2024-08-13 17:13 | 278K | |
| Glenturret_Ruadh_Mhor_2011_TCaH_Tasting_Tour_import.png | 2024-08-13 17:13 | 95K | |
| Glenturret_Triple_Wood_2022_Release_import.png | 2024-08-13 17:13 | 143K | |
| Glenturret_Triple_Wood_2023_Release_import.png | 2024-08-13 17:13 | 155K | |
| Glina_Whisky_10-year-old_Triple_Cask_import.png | 2024-08-13 17:13 | 147K | |
| Glina_Whisky_11-year-old_import.png | 2024-08-13 17:13 | 148K | |
| Glorious_12th_Artisan_Whisky_import.png | 2024-08-13 17:13 | 139K | |
| Goblins_peated_Islay_2008_WT_The_Goblin_3_import.png | 2024-08-13 17:13 | 108K | |
| Golani_2018_Israeli_Strength_-_Stronger_Together_import.png | 2024-08-13 17:13 | 89K | |
| Gold_Cock_1999_Private_Single_Cask_import.png | 2024-08-13 17:13 | 168K | |
| Gold_Cock_2008_Cask_Strength_import.png | 2024-08-13 17:13 | 139K | |
| Gold_Cock_2008_Coffee_Rum_Finish_import.png | 2024-08-13 17:13 | 172K | |
| Gold_Cock_2008_Wine_Brandy_Finish_import.png | 2024-08-13 17:13 | 143K | |
| Gold_Cock_2008_import.png | 2024-08-13 17:13 | 143K | |
| Gold_Cock_2014_Single_Cask_Bottling_import.png | 2024-08-13 17:13 | 160K | |
| Gold_Cock_2016_Hullein_1224_import.png | 2024-08-13 17:13 | 141K | |
| Gold_Cock_2016_import.png | 2024-08-13 17:13 | 143K | |
| Gold_Cock_2017_Hullein_1224_import.png | 2024-08-13 17:13 | 139K | |
| Gold_Cock_2017_Rye_import.png | 2024-08-13 17:13 | 165K | |
| Gold_Cock_2017_Single_Cask_Bottling_import.png | 2024-08-13 17:13 | 137K | |
| Gold_Cock_2017_import.png | 2024-08-13 17:13 | 134K | |
| Gold_Cock_2018_Hullein_1224_import.png | 2024-08-13 17:13 | 143K | |
| Gold_Cock_2019_Peated_Virgin_Oak_import.png | 2024-08-13 17:13 | 146K | |
| Gold_Cock_Blended_import.png | 2024-08-13 17:13 | 133K | |
| Gold_Cock_Peated_Cask_Strength_import.png | 2024-08-13 17:13 | 147K | |
| Gold_Cock_Peated_import.png | 2024-08-13 17:13 | 154K | |
| Gold_Spot_09-year-old_Limited_Edition_-_135th_Anniversary_import.png | 2024-08-13 17:13 | 113K | |
| Gold_Well_Special_Limited_Edition_import.png | 2024-08-13 17:13 | 113K | |
| Good_Spirit_Experiment_2017_Vtls_Batch_1_import.png | 2024-08-13 17:13 | 110K | |
| Good_Spirit_Experiment_2017_Vtls_Batch_2_import.png | 2024-08-13 17:13 | 111K | |
| Gouden_Carolus_2016_Dame_Jeanne_-_Finest_Collection_import.png | 2024-08-13 17:13 | 141K | |
| Gouden_Carolus_Generosity_Black_Canvas_Series_import.png | 2024-08-13 17:13 | 162K | |
| Gouden_Carolus_Madeira_Oak_import.png | 2024-08-13 17:13 | 140K | |
| Gouden_Carolus_Palomino_Finest_Selection_import.png | 2024-08-13 17:13 | 149K | |
| Gouden_Carolus_Pride_Black_Canvas_Series_import.png | 2024-08-13 17:13 | 193K | |
| Gouden_Carolus_Trust_Black_Canvas_series_import.png | 2024-08-13 17:13 | 165K | |
| Grábrók_08-year-old_Blended_Scotch_Whisky_import.png | 2024-08-13 17:13 | 157K | |
| Grain_Henge_Elevator_Row_import.png | 2024-08-13 17:13 | 114K | |
| Grain_Madness_The_Irish_import.png | 2024-08-13 17:13 | 109K | |
| Grampian_Mountains_Edition_No._1_WE_Fine_Blended_Malt_Whisky_import.png | 2024-08-13 17:13 | 170K | |
| Grampian_Mountains_Edition_No._3_WE_Fine_Blended_Malt_Whisky_import.png | 2024-08-13 17:13 | 167K | |
| Great_King_Street_Glasgow_Blend_CB_Single_Marrying_Cask_import.png | 2024-08-13 17:13 | 128K | |
| Great_Northern_05-year-old_UD_Urban_Legens_of_Whisky_Lovers_Hong_Kong_-_Miss_Mask_import.png | 2024-08-13 17:13 | 338K | |
| Great_Northern_05-year-old_WPB_Just_Dram_it_import.png | 2024-08-13 17:13 | 102K | |
| Great_Plains_2000_Canadian_Whisky_import.png | 2024-08-13 17:13 | 119K | |
| Green Spot.jpg | 2024-08-13 17:13 | 809K | |
| Green_Spot_Quails_Gate_import.png | 2024-08-13 17:13 | 128K | |
| Guestx11.jpg | 2024-08-13 17:13 | 33K | |
| Gurkhas_&_Guns_10-year-old_import.png | 2024-08-13 17:13 | 157K | |
| H.M.Y._Britannia_12-year-old_Highland_Single_Malt_import.png | 2024-08-13 17:13 | 234K | |
| H._Becker_Foundation_Blend_Limited_Edition_Small_Batch_import.png | 2024-08-13 17:13 | 126K | |
| Haavaldsen_2020_Stiger_Serie_import.png | 2024-08-13 17:13 | 150K | |
| Hakushu 12.jpg | 2024-08-13 17:13 | 134K | |
| Hakushu 14.jpg | 2024-08-13 17:13 | 222K | |
| Hakushu_Japanese_Forest_Bittersweet_Edition_import.png | 2024-08-13 17:13 | 127K | |
| Hamburg_Malt_08-year-old_MfLm_Summer_Edition_2023_import.png | 2024-08-13 17:13 | 119K | |
| Hamburg_Malt_Red_light_district_-_Peated_import.png | 2024-08-13 17:13 | 87K | |
| Hamiltons_Islay_import.png | 2024-08-13 17:13 | 95K | |
| Haran_2012_BkSp_Vintage_import.png | 2024-08-13 17:13 | 114K | |
| Hazelburn 8.jpg | 2024-08-13 17:13 | 513K | |
| Hazelburn_14-year-old_Open_Day_-_May_2023_import.png | 2024-08-13 17:13 | 82K | |
| Hazelburn_21-year-old_import.png | 2024-08-13 17:13 | 125K | |
| Hazelburn_1998_Private_Bottling_import.png | 2024-08-13 17:13 | 106K | |
| Hazelburn_1999_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:13 | 177K | |
| Hazelburn_2007_Society_Bottling_import.png | 2024-08-13 17:13 | 87K | |
| Hazelburn_2008_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:13 | 81K | |
| Hazelburn_2008_Oloroso_Cask_Matured_import.png | 2024-08-13 17:13 | 125K | |
| Hazelburn_2017_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:13 | 183K | |
| Hazelburn_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:13 | 108K | |
| Hazelburn_Handfilled_Distillery_Exclusive_import.png | 2024-08-13 17:13 | 208K | |
| Heartgow_Eastereggs_Unique_Collection_import.png | 2024-08-13 17:13 | 133K | |
| Heartgow_Voluptuous_import.png | 2024-08-13 17:13 | 152K | |
| Heartwood_Appisky_HeWo_import.png | 2024-08-13 17:13 | 100K | |
| Heartwood_Audentis_fortuna_iuva_-_Fortune_favours_the_BOLD_H_import.png | 2024-08-13 17:13 | 99K | |
| Heartwood_Blend_Over_Blackwoods_HeWo_import.png | 2024-08-13 17:13 | 100K | |
| Heartwood_Dregs_-_Volume_7_Tasmanian_Vatting_of_Malt_Whisky_import.png | 2024-08-13 17:13 | 99K | |
| Heartwood_Great_Expecations_import.png | 2024-08-13 17:13 | 100K | |
| Heartwood_Silk_Purse_from_a_Sows_Ear_Barrel_&_Batch_import.png | 2024-08-13 17:13 | 104K | |
| Heartwood_The_Beagle_-_Batch_12_HeWo_import.png | 2024-08-13 17:13 | 97K | |
| Heartwood_The_Long_Kiss_Goodnight_import.png | 2024-08-13 17:13 | 96K | |
| Heartwood_Vats_out_of_the_bag_HeWo_Peated_import.png | 2024-08-13 17:13 | 104K | |
| Heartwood_You_cant_handle_the_truth_HeWo_import.png | 2024-08-13 17:13 | 98K | |
| Heaven_Hill_12-year-old_WhB_import.png | 2024-08-13 17:13 | 100K | |
| Hedonism²_23-year-old_CB_import.png | 2024-08-13 17:13 | 104K | |
| HeiligenBergFeld_2019_Village_I_import.png | 2024-08-13 17:13 | 153K | |
| HeiligenBergFeld_2019_import.png | 2024-08-13 17:13 | 146K | |
| HeiligenBergFeld_2020_Sherry_Cream_import.png | 2024-08-13 17:13 | 152K | |
| HeiligenBergFeld_2020_import.png | 2024-08-13 17:13 | 147K | |
| Hell_Fire_2016_2nd_Edition_import.png | 2024-08-13 17:13 | 167K | |
| Hellinger_10-year-old_import.png | 2024-08-13 17:13 | 116K | |
| Hellinger_42_Weiße_Flotte_Sachsen_-_PD_Dresden_import.png | 2024-08-13 17:13 | 204K | |
| Hellinger_70_Jahre_SG_Dynamo_Dresden_Jubiläums_Fan_Edition_2023_import.png | 2024-08-13 17:13 | 98K | |
| Hellinger_Winzer-Edition_Nr._2_Sächsische_Winzeredition_import.png | 2024-08-13 17:13 | 122K | |
| Hellinger_Winzer-Edition_Nr._3_Sächsische_Winzeredition_import.png | 2024-08-13 17:13 | 94K | |
| Hellinger_Winzer-Edition_Nr._4_Sächsische_Winzeredition_import.png | 2024-08-13 17:13 | 102K | |
| Hellyers_Road_2004_import.png | 2024-08-13 17:13 | 107K | |
| Hellyers_Road_2016_import.png | 2024-08-13 17:13 | 106K | |
| Hellyers_Road_Dark_Harmony_import.png | 2024-08-13 17:13 | 140K | |
| Hellyers_Road_Road_2016_import.png | 2024-08-13 17:13 | 110K | |
| Helsinki_Whiskey_Batch_3_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:13 | 334K | |
| Helsinki_Whiskey_Pioneer_Corn_-_Release_#23_Small_Batch_import.png | 2024-08-13 17:13 | 148K | |
| Hibiki 12.jpg | 2024-08-13 17:13 | 1.9M | |
| Hibiki 17.jpg | 2024-08-13 17:13 | 663K | |
| Hibiki_21-year-old_import.png | 2024-08-13 17:13 | 198K | |
| Hibiki_Blossom_Harmony_2023_Release_import.png | 2024-08-13 17:13 | 182K | |
| Hibiki_Japanese_Harmony_import.png | 2024-08-13 17:13 | 228K | |
| Hidden_Barn_04-year-old_Small_Batch_Series_1_import.png | 2024-08-13 17:13 | 100K | |
| Hidden_Barn_Small_Batch_Series_Two_import.png | 2024-08-13 17:13 | 102K | |
| Higgledy_Piggledy_Corn_Whisky_import.png | 2024-08-13 17:13 | 155K | |
| HighGlen_2020_4th_Release_import.png | 2024-08-13 17:13 | 162K | |
| High West A Midwinter Nights Dram.jpg | 2024-08-13 17:13 | 250K | |
| High West American Prairie Reserve.jpg | 2024-08-13 17:13 | 119K | |
| High_Coast_2013_Private_Bottling_import.png | 2024-08-13 17:14 | 115K | |
| High_Coast_2014_Cinco_II_import.png | 2024-08-13 17:14 | 121K | |
| High_Coast_2016_Private_Bottling_import.png | 2024-08-13 17:14 | 95K | |
| High_Coast_2016_WMW-63_-_Private_Bottling_import.png | 2024-08-13 17:14 | 101K | |
| High_Coast_2016_WSla_Private_Bottling_import.png | 2024-08-13 17:14 | 97K | |
| High_Coast_2017_Private_Bottling_import.png | 2024-08-13 17:14 | 100K | |
| High_Coast_2017_Private_Cask_Bottling_import.png | 2024-08-13 17:14 | 104K | |
| High_Coast_2017_WSla_Private_Bottling_import.png | 2024-08-13 17:14 | 102K | |
| High_Coast_2018_WSla_Private_Bottling_import.png | 2024-08-13 17:14 | 104K | |
| High_Coast_2019_WSla_Private_Bottling_import.png | 2024-08-13 17:14 | 94K | |
| High_Coast_2019_import.png | 2024-08-13 17:14 | 104K | |
| High_Coast_Chevaleresk_Inverno_import.png | 2024-08-13 17:14 | 124K | |
| High_Coast_Doubles_Cognac_Casks_import.png | 2024-08-13 17:14 | 95K | |
| High_Coast_Harbours_Collection_03_Lunde_import.png | 2024-08-13 17:14 | 105K | |
| High_Coast_In_Flames_MMXXIII_import.png | 2024-08-13 17:14 | 115K | |
| High_Coast_Mongolica_import.png | 2024-08-13 17:14 | 109K | |
| High_Coast_Small_Batch_27_Viking_Line_import.png | 2024-08-13 17:14 | 105K | |
| High_Coast_Small_Batch_29_Exclusive_for_Höga_Kusten_import.png | 2024-08-13 17:14 | 107K | |
| High_Coast_Small_Batch_30_Exclusive_for_Kramfors_import.png | 2024-08-13 17:14 | 108K | |
| High_Coast_The_Festival_2023_import.png | 2024-08-13 17:14 | 115K | |
| High_Wire_Distilling_Bentons_Smoked_Jimmy_Red_import.png | 2024-08-13 17:14 | 128K | |
| High_n_Wicked_14-year-old_The_Judge_import.png | 2024-08-13 17:14 | 214K | |
| Highland Park 10.jpg | 2024-08-13 17:13 | 1.0M | |
| Highland Park 15.jpg | 2024-08-13 17:13 | 1.0M | |
| Highland Park 15 Loki.jpg | 2024-08-13 17:13 | 23K | |
| Highland Park 18.jpg | 2024-08-13 17:13 | 710K | |
| Highland Park Dark Origins.jpg | 2024-08-13 17:13 | 914K | |
| Highland_13-year-old_Km_import.png | 2024-08-13 17:13 | 167K | |
| Highland_Blended_Malt_Cadenheads_1842_CA_import.png | 2024-08-13 17:13 | 239K | |
| Highland_Malt_#2_Batch_2_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:13 | 136K | |
| Highland_Park_15-year-old_Viking_Heart_import.png | 2024-08-13 17:13 | 192K | |
| Highland_Park_21-year-old_2023_Release_import.png | 2024-08-13 17:13 | 183K | |
| Highland_Park_1987_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:13 | 152K | |
| Highland_Park_1988_Single_Cask_Bottling_-_Vintage_Release_import.png | 2024-08-13 17:13 | 141K | |
| Highland_Park_1998_GM_Connoisseurs_Choice_Cask_Strength_import.png | 2024-08-13 17:13 | 154K | |
| Highland_Park_2000_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:13 | 141K | |
| Highland_Park_2003_DT_Single_Cask_import.png | 2024-08-13 17:13 | 110K | |
| Highland_Park_2004_DT_The_Octave_import.png | 2024-08-13 17:13 | 85K | |
| Highland_Park_2004_DT_import.png | 2024-08-13 17:13 | 93K | |
| Highland_Park_2006_MoM_Single_Cask_Series_import.png | 2024-08-13 17:13 | 94K | |
| Highland_Park_2007_DT_The_Octave_import.png | 2024-08-13 17:13 | 96K | |
| Highland_Park_2008_DT_The_Octave_import.png | 2024-08-13 17:13 | 108K | |
| Highland_Park_2010_SMWS_4.380_Waves_of_aromatic_smoke_import.png | 2024-08-13 17:13 | 121K | |
| Highland_Park_2011_SMWS_4.382_Avast_ye_smoky_apricots_import.png | 2024-08-13 17:13 | 129K | |
| Highland_Park_2012_SMWS_4.366_Kelp_me_if_you_can_import.png | 2024-08-13 17:13 | 99K | |
| Highland_Park_Cask_Strength_Robust_&_Intense_import.png | 2024-08-13 17:13 | 177K | |
| Highland_Park_Heather_Smoke_&_Sherry_VM_The_Coopers_Choice_import.png | 2024-08-13 17:13 | 122K | |
| Highland_Park_Heather_Smoke_&_Strawberries_VM_The_Coopers_Choice_import.png | 2024-08-13 17:13 | 124K | |
| Highland_Single_Malt_2011_PST_import.png | 2024-08-13 17:13 | 97K | |
| Highland_Single_Malt_Scotch_Whisky_2003_TWf_Chen_Uens_Romance_of_the_Three_Kingdoms_import.png | 2024-08-13 17:13 | 127K | |
| Highland_Single_Malt_Scotch_Whisky_2018_EMcI_Taibhse_Cask_import.png | 2024-08-13 17:13 | 101K | |
| Highland_Single_Malt_Whisky_2014_Sxwh_Allt_aMhuilinn_import.png | 2024-08-13 17:13 | 99K | |
| Highland_Symphony_2013_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:13 | 151K | |
| Highland_Symphony_2013_TCaH_Tasting_Tour_import.png | 2024-08-13 17:13 | 103K | |
| Highwayman_Single_Malt_Whisky_The_Dark_Side_import.png | 2024-08-13 17:14 | 161K | |
| Hillock_2019_16st_import.png | 2024-08-13 17:14 | 101K | |
| Hinotori_Blended_Malt_Goldorak_import.png | 2024-08-13 17:14 | 106K | |
| Hinotori_Blended_Whisky_Goldorak_2023_import.png | 2024-08-13 17:14 | 99K | |
| Hinrichsens_Distillers_Cut_Frisian_Single_Farm_Whisky_import.png | 2024-08-13 17:14 | 230K | |
| Hinrichsens_Frisian_Whisky_Single_Farm_import.png | 2024-08-13 17:14 | 212K | |
| Hinrichsens_Harvest_Edition_Frisian_Single_Farm_Whisky_import.png | 2024-08-13 17:14 | 246K | |
| Hobart_Whisky_Winter_Feast_2023_Limited_Edition_import.png | 2024-08-13 17:14 | 175K | |
| Holyrood_Spirit_Merchants_Arrival_Release_N°_01_import.png | 2024-08-13 17:14 | 80K | |
| Horstman_2014_Graan_Whisky_import.png | 2024-08-13 17:14 | 134K | |
| Hven_Seven_Angels_St_Michael_import.png | 2024-08-13 17:14 | 150K | |
| Hyde_Cabernet_Sauvignon_Cask_Finish_Single_Cask_import.png | 2024-08-13 17:14 | 153K | |
| IMG_0909_86.jpeg | 2024-08-13 17:14 | 231K | |
| IMG_0937_30.jfif | 2024-08-13 17:14 | 487K | |
| IMG_3053_3.jpg | 2024-08-13 17:14 | 409K | |
| IMG_3238_12.jpeg | 2024-08-13 17:14 | 227K | |
| IMG_8206_23.jpeg | 2024-08-13 17:14 | 89K | |
| IMG_9630_52.jpeg | 2024-08-13 17:14 | 125K | |
| IMG_20200227_205338_271.jpg | 2024-08-13 17:14 | 1.2M | |
| IMG_20210415_111238__01.jpg | 2024-08-13 17:14 | 1.8M | |
| Ichiros_Choice_Single_Cask_Single_Malt_Whisky_import.png | 2024-08-13 17:14 | 113K | |
| Ichiros_Malt_&_Grain_Japanese_Blended_Whisky_import.png | 2024-08-13 17:14 | 121K | |
| Ichiros_Malt_&_Grain_Single_Cask_Blended_Whisky_import.png | 2024-08-13 17:14 | 106K | |
| Ignis_Templi_Single_Malt_Lowland_Whisky_import.png | 2024-08-13 17:14 | 139K | |
| Ikawa_2021_New_Born_Peated_30ppm_import.png | 2024-08-13 17:14 | 149K | |
| Ikawa_2022_New_Born_Non_Peat_import.png | 2024-08-13 17:14 | 144K | |
| Imperial_1979_GM_The_Recollection_Series_nr.2_import.png | 2024-08-13 17:14 | 162K | |
| Imperial_1995_ElD_A_Bygone_Era_import.png | 2024-08-13 17:14 | 112K | |
| Imperial_1995_SS_New_Vibrations_import.png | 2024-08-13 17:14 | 133K | |
| Imperial_1997_GM_The_Recollection_Series_nr.2_import.png | 2024-08-13 17:14 | 131K | |
| Imperial_1998_CQ_import.png | 2024-08-13 17:14 | 134K | |
| Imperial_1998_MoS_Rare_Casks_Range_import.png | 2024-08-13 17:14 | 157K | |
| Inaugural_Bottle-776x1176-776x1176.png | 2024-08-13 17:14 | 94K | |
| Inchfad_05-year-old_CL_Exploration_series_import.png | 2024-08-13 17:14 | 252K | |
| Inchfad_2007_SMDr_Single_Cask_import.png | 2024-08-13 17:14 | 100K | |
| Inchgower_2008_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:14 | 127K | |
| Inchgower_2008_ED_The_First_Editions_import.png | 2024-08-13 17:14 | 234K | |
| Inchgower_2008_SMWS_18.59_Snuggle_up_import.png | 2024-08-13 17:14 | 116K | |
| Inchgower_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:14 | 149K | |
| Inchgower_2009_GWhL_Auld_Goonsys_import.png | 2024-08-13 17:14 | 254K | |
| Inchgower_2009_HoMc_The_Vintage_Collection_import.png | 2024-08-13 17:14 | 272K | |
| Inchgower_2010_AD_Selection_import.png | 2024-08-13 17:14 | 101K | |
| Inchgower_2011_SC&C_50th_Anniversary_import.png | 2024-08-13 17:14 | 144K | |
| Inchgower_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:14 | 243K | |
| Inchgower_2012_HWM_Dalgety_import.png | 2024-08-13 17:14 | 142K | |
| Inchgower_2012_Orc_import.png | 2024-08-13 17:14 | 87K | |
| Inchgower_2015_DL_Old_Particular_import.png | 2024-08-13 17:14 | 115K | |
| Inchgower_2016_BrlB_Raw_Sienna_import.png | 2024-08-13 17:14 | 152K | |
| Inchmurrin_10-year-old_DMor_import.png | 2024-08-13 17:14 | 102K | |
| Inchmurrin_11-year-old_SMWS_SC112_Society_Spirit_import.png | 2024-08-13 17:14 | 277K | |
| Inchmurrin_1998_Sb_White_Label_import.png | 2024-08-13 17:14 | 109K | |
| Inchmurrin_2010_import.png | 2024-08-13 17:14 | 118K | |
| Inchmurrin_2014_HB_Single_Cask_import.png | 2024-08-13 17:14 | 100K | |
| Inchmurrin_2014_HB_import.png | 2024-08-13 17:14 | 210K | |
| Inchmurrin_2014_PST_import.png | 2024-08-13 17:14 | 91K | |
| Inchmurrin_2014_SMWS_112.114_Chardonnay_butterscotch_import.png | 2024-08-13 17:14 | 114K | |
| Indiana_Rye_2017_KCC_Fragrant_Drops_import.png | 2024-08-13 17:14 | 295K | |
| Indlekofer_Wutach_Erstabfüllung_import.png | 2024-08-13 17:14 | 134K | |
| Indri_2015_Single_Cask_import.png | 2024-08-13 17:14 | 92K | |
| Indri_2017_Single_Cask_import.png | 2024-08-13 17:14 | 93K | |
| Indri_Drú_Cask_Strength_import.png | 2024-08-13 17:14 | 88K | |
| Insel_Whisky_Private_Cask_import.png | 2024-08-13 17:14 | 101K | |
| Integrity_Malts_2019_import.png | 2024-08-13 17:14 | 146K | |
| Invergordon_18-year-old_import.png | 2024-08-13 17:14 | 145K | |
| Invergordon_1972_DrC_import.png | 2024-08-13 17:14 | 111K | |
| Invergordon_1973_AC_Rare_&_Old_Selection_import.png | 2024-08-13 17:14 | 113K | |
| Invergordon_1973_GlMo_A_Rare_Find_import.png | 2024-08-13 17:14 | 90K | |
| Invergordon_1974_JW_Kreuzritter_import.png | 2024-08-13 17:14 | 231K | |
| Invergordon_1974_PST_Error_502_Series_import.png | 2024-08-13 17:14 | 87K | |
| Invergordon_1986_JW_World_of_Orchids_import.png | 2024-08-13 17:14 | 228K | |
| Invergordon_1986_K23_lhistoire_DAliXe_import.png | 2024-08-13 17:14 | 102K | |
| Invergordon_1986_WDS_import.png | 2024-08-13 17:14 | 129K | |
| Invergordon_1986_WwW_import.png | 2024-08-13 17:14 | 103K | |
| Invergordon_1987_EVWC_import.png | 2024-08-13 17:14 | 121K | |
| Invergordon_1987_KCC_Fragrant_Drops_import.png | 2024-08-13 17:14 | 166K | |
| Invergordon_1987_MM_Mission_Gold_import.png | 2024-08-13 17:14 | 120K | |
| Invergordon_1987_PST_import.png | 2024-08-13 17:14 | 124K | |
| Invergordon_1987_TCaH_Exquisite_Casks_import.png | 2024-08-13 17:14 | 169K | |
| Invergordon_1988_3W_import.png | 2024-08-13 17:14 | 88K | |
| Invergordon_1988_BR_import.png | 2024-08-13 17:14 | 117K | |
| Invergordon_1988_Df_import.png | 2024-08-13 17:14 | 161K | |
| Invergordon_1988_WM_Barrel_Selection_-_Special_Release_import.png | 2024-08-13 17:14 | 141K | |
| Invergordon_1990_DT_Rare_Auld_Grain_import.png | 2024-08-13 17:14 | 113K | |
| Invergordon_1997_3W_import.png | 2024-08-13 17:14 | 88K | |
| Invergordon_1997_LBDS_import.png | 2024-08-13 17:14 | 131K | |
| Invergordon_1997_TCaH_The_Grainhound_import.png | 2024-08-13 17:14 | 154K | |
| Invergordon_1997_TWC_import.png | 2024-08-13 17:14 | 112K | |
| Invergordon_2006_Cl_Exploration_Series_import.png | 2024-08-13 17:14 | 112K | |
| Invergordon_2007_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 104K | |
| Invergordon_2007_DR_Cask_Collection_import.png | 2024-08-13 17:14 | 75K | |
| Invergordon_2007_SM_import.png | 2024-08-13 17:14 | 126K | |
| Ireland_2001_DD_The_Nectar_of_the_Daily_Drams_import.png | 2024-08-13 17:14 | 79K | |
| IrishAmerican-Logo-wit-def.png | 2024-08-13 17:14 | 133K | |
| Irish_Diamonds_2002_AC_Small_Batch_No._12_import.png | 2024-08-13 17:14 | 107K | |
| Irish_Diamonds_2002_AC_The_Alambic_Classique_Collection_import.png | 2024-08-13 17:14 | 117K | |
| Irish_Single_Malt_2002_NSpS_Modernism_import.png | 2024-08-13 17:14 | 112K | |
| Irish_Single_Malt_Whiskey_2016_IW_Sonderabfüllung_2023_import.png | 2024-08-13 17:14 | 120K | |
| Irish_Whiskey_Bonding_Co._Grafter_Small_Batch_Irish_Whiskey_import.png | 2024-08-13 17:14 | 108K | |
| Ironroot_Batch_1_TBWC_USA_Series_import.png | 2024-08-13 17:14 | 121K | |
| Island_Single_Malt_Whisky_TwH_Private_Cask_Edition_import.png | 2024-08-13 17:14 | 143K | |
| Islay_03-year-old_82NC_Exclusively_Selected_import.png | 2024-08-13 17:14 | 66K | |
| Islay_06-year-old_Km_import.png | 2024-08-13 17:14 | 169K | |
| Islay_12-year-old_SmBB_import.png | 2024-08-13 17:14 | 102K | |
| Islay_16-year-old_CA_Enigma_import.png | 2024-08-13 17:14 | 85K | |
| Islay_2006_DL_Old_Paticular_-_Big_Peats_Finest_import.png | 2024-08-13 17:14 | 242K | |
| Islay_Blended_Malt_16-year-old_BW_A_Dream_of_Scotland_-_The_Birthday_Dram_import.png | 2024-08-13 17:14 | 115K | |
| Islay_Blended_Malt_2009_ElD_The_Whisky_Trail_import.png | 2024-08-13 17:14 | 257K | |
| Islay_Blended_Malt_Scotch_Whisky_Beach_Bonfire_ElD_Elements_of_Islay_import.png | 2024-08-13 17:14 | 217K | |
| Islay_Blended_Malt_Scotch_Whisky_Maffia_Monkeys_4_import.png | 2024-08-13 17:14 | 96K | |
| Islay_Journey_Blended_Malt_Handbottled_at_Visitor_Center_import.png | 2024-08-13 17:14 | 142K | |
| Islay_Journey_Blendend_Malt_Scotch_Whisky_HL_Journey_Series_import.png | 2024-08-13 17:14 | 121K | |
| Islay_Malt_Scotch_Whisky_2011_SDW_Single_Cask_-_Limited_Edition_import.png | 2024-08-13 17:14 | 213K | |
| Islay_Mist_17-year-old_McDI_import.png | 2024-08-13 17:14 | 157K | |
| Islay_Region_2017_Cl_Exploration_Series_import.png | 2024-08-13 17:14 | 105K | |
| Islay_Single_Malt_1993_TWJ_import.png | 2024-08-13 17:14 | 109K | |
| Islay_Single_Malt_Red_Bag_#2_Df_63rd_release_import.png | 2024-08-13 17:14 | 108K | |
| Islay_Single_Malt_Scotch_Whisky_2009_MW_They_Inspired_III_-_Whisky_Icons_import.png | 2024-08-13 17:14 | 107K | |
| Islay_Single_Malt_Scotch_Whisky_2013_Sa_Coilltean_Int._Co._LTD_import.png | 2024-08-13 17:14 | 134K | |
| Islay_Single_Malt_Scotch_Whisky_2020_Df_67th_release_import.png | 2024-08-13 17:14 | 106K | |
| Islay_Single_Malt_Scotch_Whisky_Peated_HB_import.png | 2024-08-13 17:14 | 104K | |
| Islay_Single_Malt_Whisky_05-year-old_MNC_Andys_Barley_Sugar_Stick_import.png | 2024-08-13 17:14 | 97K | |
| Islay_Single_Malt_Whisky_05-year-old_MNC_Blue_Finger_import.png | 2024-08-13 17:14 | 113K | |
| Islay_Single_Malt_Whisky_05-year-old_MNC_Green_Finger_3rd_Edition_import.png | 2024-08-13 17:14 | 284K | |
| Islay_South_Coast_14-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:14 | 121K | |
| Islay_South_Coast_16-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:14 | 120K | |
| Isle_of_Jura_12-year-old_Sherry_Cask_import.png | 2024-08-13 17:14 | 145K | |
| Isle_of_Jura_1989_PST_import.png | 2024-08-13 17:14 | 95K | |
| Isle_of_Jura_1990_Private_Bottling_import.png | 2024-08-13 17:14 | 158K | |
| Isle_of_Jura_1992_CA_Authentic_Collection_-_Cask_Strength_import.png | 2024-08-13 17:14 | 129K | |
| Isle_of_Jura_1998_DL_XOP_-_Xtra_Old_Particular_-_The_Black_Series_import.png | 2024-08-13 17:14 | 140K | |
| Isle_of_Jura_2005_Distillery_Cask_import.png | 2024-08-13 17:14 | 127K | |
| Isle_of_Jura_2008_CaG_import.png | 2024-08-13 17:14 | 157K | |
| Isle_of_Jura_2008_Distillery_Cask_import.png | 2024-08-13 17:14 | 149K | |
| Isle_of_Jura_2011_BNSp_Antlers_on_the_Sound_import.png | 2024-08-13 17:14 | 110K | |
| Isle_of_Jura_2011_ED_First_Editions_import.png | 2024-08-13 17:14 | 170K | |
| Isle_of_Jura_2014_Distillery_Cask_import.png | 2024-08-13 17:14 | 261K | |
| Isle_of_Jura_No._02_Islanders_Expressions_Collection_import.png | 2024-08-13 17:14 | 136K | |
| Isle_of_Jura_The_Sound_import.png | 2024-08-13 17:14 | 145K | |
| Isle_of_Lime_06-year-old_Salvorev_import.png | 2024-08-13 17:14 | 106K | |
| Isle_of_Lime_06-year-old_Sigdes_-_Shareholders_Edition_VIII_import.png | 2024-08-13 17:14 | 85K | |
| Isle_of_Lime_06-year-old_Trullaik_import.png | 2024-08-13 17:14 | 115K | |
| Isle_of_Lime_10-year-old_Fat_nr_7_-_Singel_Cask_import.png | 2024-08-13 17:14 | 121K | |
| Isle_of_Lime_10-year-old_Fat_nr_8_-_Singel_Cask_import.png | 2024-08-13 17:14 | 121K | |
| Isle_of_Lime_2018_Private_Bottling_import.png | 2024-08-13 17:14 | 97K | |
| Isle_of_Skye_18-year-old_IM_Limited_Edition_import.png | 2024-08-13 17:14 | 143K | |
| Isle of Skye 8.jpg | 2024-08-13 17:14 | 114K | |
| Israeli_Strength_-_Stronger_Together_01-year-old_import.png | 2024-08-13 17:14 | 88K | |
| Israeli_Strength_-_Stronger_Together_03-year-old_import.png | 2024-08-13 17:14 | 85K | |
| J.J._Devine_06-year-old_Oscar_Edition_import.png | 2024-08-13 17:14 | 182K | |
| J.P._Wisers_27-year-old_Cask_Strength_Blend_import.png | 2024-08-13 17:14 | 171K | |
| JJCorryTheFlintockF-510x600.png | 2024-08-13 17:14 | 219K | |
| JWBlackLabel.jpg | 2024-08-13 17:14 | 614K | |
| Jack Daniel's Old No. 7.jpg | 2024-08-13 17:14 | 68K | |
| Jack Daniel's Single Barrel.jpg | 2024-08-13 17:14 | 440K | |
| Jack_Daniels_American_Single_Malt_Oloroso_Sherry_Cask_import.png | 2024-08-13 17:14 | 126K | |
| Jack_Daniels_Bonded_Rye_Bottled_in_Bond_import.png | 2024-08-13 17:14 | 117K | |
| Jack_Daniels_Distillery_Series_Selection_011_Limited_Edition_DSP-TN-1_import.png | 2024-08-13 17:14 | 129K | |
| Jack_Daniels_Single_Barrel_Barrel_Proof_Rye_import.png | 2024-08-13 17:14 | 170K | |
| Jack_Daniels_Single_Barrel_Barrel_Proof_import.png | 2024-08-13 17:14 | 184K | |
| Jack_Daniels_Single_Barrel_Barrel_Strength_import.png | 2024-08-13 17:14 | 183K | |
| Jack_Daniels_Twice_Barreled_Rye_Special_Release_import.png | 2024-08-13 17:14 | 186K | |
| Jameson-18-Cask-Strength.jpg | 2024-08-13 17:14 | 158K | |
| Jameson-Caskmates-IPA.jpg | 2024-08-13 17:14 | 86K | |
| Jameson.jpg | 2024-08-13 17:14 | 101K | |
| JamesonOriginal.jpg | 2024-08-13 17:14 | 92K | |
| JamesonPatricksDay2014.png | 2024-08-13 17:14 | 171K | |
| JamesonTripleTriple.jpg | 2024-08-13 17:14 | 659K | |
| JamesonTripleTripleFinished.jpg | 2024-08-13 17:14 | 1.0M | |
| Jameson_22-year-old_Small_Batch_import.png | 2024-08-13 17:14 | 130K | |
| Jameson_A_Blend_of_Grain_&_Potstill_Irish_Whiskey_Barrel_Club_Edition_import.png | 2024-08-13 17:14 | 112K | |
| Jameson_Black_Barrel_-_Cask_Strength_Hand_bottled_at_the_Distillery_import.png | 2024-08-13 17:14 | 117K | |
| Jameson_Black_Barrel_Cask_Strength_import.png | 2024-08-13 17:14 | 243K | |
| Jameson_Classic_Football_shirts.png | 2024-08-13 17:14 | 216K | |
| Jameson_Great_urban_escape.png | 2024-08-13 17:14 | 165K | |
| Jameson_Irish_Whiskey_Triple_Distilled_import.png | 2024-08-13 17:14 | 101K | |
| Jameson_Tokyo_Edition.png | 2024-08-13 17:14 | 171K | |
| Jameson_home_sweet_home.png | 2024-08-13 17:14 | 167K | |
| Jim Beam Black 8 Double Aged.jpg | 2024-08-13 17:14 | 23K | |
| Jim_Beam_Sunshine_Blend_Special_Release_import.png | 2024-08-13 17:14 | 134K | |
| Jochens_Meiderich_Malt_2020_UD_import.png | 2024-08-13 17:14 | 68K | |
| John J. Bowman.jpg | 2024-08-13 17:14 | 127K | |
| John_E._Fitzgerald_Larceny_Barrel_Proof_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:14 | 134K | |
| John_J._Bowman_Single_Barrel_Virginia_Straight_Bourbon_Whiskey_-_Single_Barrel_import.png | 2024-08-13 17:14 | 177K | |
| Johnett_2013_Single_Cask_import.png | 2024-08-13 17:14 | 113K | |
| Johnnie Walker Black Label.jpg | 2024-08-13 17:14 | 85K | |
| Johnnie Walker Blue Label.jpg | 2024-08-13 17:14 | 89K | |
| Johnnie Walker Green Label.jpg | 2024-08-13 17:14 | 44K | |
| Johnnie Walker Platinum Label.jpg | 2024-08-13 17:14 | 98K | |
| Johnnie_Walker_Black_Air_Ink_import.png | 2024-08-13 17:14 | 129K | |
| Johnnie_Walker_Blue_Label_Elusive_Umami_import.png | 2024-08-13 17:14 | 98K | |
| Johnnie_Walker_Blue_Label_Xordinaire_import.png | 2024-08-13 17:14 | 107K | |
| Jura 16.jpg | 2024-08-13 17:14 | 546K | |
| Kaiyo.jpg | 2024-08-13 17:14 | 410K | |
| Kalas_Single_Malt_Distillery_Bottling_import.png | 2024-08-13 17:14 | 165K | |
| Kalas_Single_Malt_import.png | 2024-08-13 17:14 | 165K | |
| Kanosuke_2018_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 139K | |
| Kanosuke_2018_import.png | 2024-08-13 17:14 | 113K | |
| Kanosuke_2019_Artist_Edition_#2_import.png | 2024-08-13 17:14 | 108K | |
| Kanosuke_2019_Peated_Malt_import.png | 2024-08-13 17:14 | 268K | |
| Kanosuke_2019_Single_Cask_import.png | 2024-08-13 17:14 | 119K | |
| Kanosuke_2019_import.png | 2024-08-13 17:14 | 110K | |
| Kanosuke_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:14 | 98K | |
| Kanosuke_Single_Malt_Limited_Edition_2023_import.png | 2024-08-13 17:14 | 114K | |
| Kavalan_2015_Peaty_Cask_import.png | 2024-08-13 17:14 | 167K | |
| Kavalan_2017_Rum_Cask_import.png | 2024-08-13 17:14 | 269K | |
| Kavalan_Solist_Amontillado_import.png | 2024-08-13 17:14 | 90K | |
| Kavalan_Solist_Manzanilla_Cask_import.png | 2024-08-13 17:14 | 88K | |
| Kavalan_Solist_Moscatel_Cask_import.png | 2024-08-13 17:14 | 200K | |
| Kavalan_Solist_Oloroso_Sherry_import.png | 2024-08-13 17:14 | 194K | |
| Kavalan_Solist_Peated_Malt_import.png | 2024-08-13 17:14 | 201K | |
| Kavalan_Solist_Peated_Whisky_import.png | 2024-08-13 17:14 | 94K | |
| Kavalan_Solist_Pedro_Ximénez_import.png | 2024-08-13 17:14 | 94K | |
| Kavalan_Solist_Port_Cask_import.png | 2024-08-13 17:14 | 104K | |
| Kavalan_Solist_Vinho_Barrique_import.png | 2024-08-13 17:14 | 243K | |
| Kavalan_Solist_Virgin_Oak_import.png | 2024-08-13 17:14 | 90K | |
| Kavalan_Solist_ex-Bourbon_Cask_import.png | 2024-08-13 17:14 | 105K | |
| Kavalan_Solist_ex-Bourbon_import.png | 2024-08-13 17:14 | 97K | |
| Kemlya_05-year-old_Sherry_Wood_import.png | 2024-08-13 17:14 | 151K | |
| Kentucky_Bourbon_Whiskey_2013_TWC_import.png | 2024-08-13 17:14 | 91K | |
| Kentucky_Straight_Bourbon_12-year-old_exclusive_reserve_import.png | 2024-08-13 17:14 | 145K | |
| Ki_One_2020_Batch_1_-_Flagship_import.png | 2024-08-13 17:14 | 169K | |
| Ki_One_2020_Single_Cask_-_Distillery_Edition_import.png | 2024-08-13 17:14 | 198K | |
| Ki_One_Whisky_Batch_2_-_Distillers_Edition_import.png | 2024-08-13 17:14 | 285K | |
| Ki_One_Whisky_Batch_3_-_Flagship_import.png | 2024-08-13 17:14 | 187K | |
| Kilbeggan-21-776x776.jpg | 2024-08-13 17:14 | 258K | |
| Kilbeggan_10-year-old_Distiller’s_Cask_import.png | 2024-08-13 17:14 | 171K | |
| Kilbeggan_10-year-old_Distillers_Cask_-_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 161K | |
| Kilbeggan_10-year-old_Distillers_Cask_import.png | 2024-08-13 17:14 | 151K | |
| Kilbeggan_11-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 160K | |
| Kilbeggan_2012_Distillers_Cask_import.png | 2024-08-13 17:14 | 151K | |
| Kilchoman 100% Islay 3rd Edition.jpg | 2024-08-13 17:14 | 182K | |
| Kilchoman_08-year-old_100%_Islay_-_The_13th_Edition_import.png | 2024-08-13 17:14 | 155K | |
| Kilchoman_16-year-old_import.png | 2024-08-13 17:14 | 179K | |
| Kilchoman_2006_Single_Cask_import.png | 2024-08-13 17:14 | 168K | |
| Kilchoman_2006_Trade_Sample_Not_For_Resale_import.png | 2024-08-13 17:14 | 155K | |
| Kilchoman_2007_Private_Cask_Release_import.png | 2024-08-13 17:14 | 165K | |
| Kilchoman_2008_Vintage_100%_Islay_Private_Cask_import.png | 2024-08-13 17:14 | 156K | |
| Kilchoman_2009_WCR_import.png | 2024-08-13 17:14 | 141K | |
| Kilchoman_2010_Sweden_Exclusive_Volume_6_import.png | 2024-08-13 17:14 | 158K | |
| Kilchoman_2010_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 194K | |
| Kilchoman_2011_100%_Islay_Single_Cask_import.png | 2024-08-13 17:14 | 210K | |
| Kilchoman_2012_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 178K | |
| Kilchoman_2012_Single_Cask_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 230K | |
| Kilchoman_2012_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 170K | |
| Kilchoman_2013_Single_Cask_import.png | 2024-08-13 17:14 | 156K | |
| Kilchoman_2013_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 187K | |
| Kilchoman_2014_Calvados_Cask_Finish_import.png | 2024-08-13 17:14 | 185K | |
| Kilchoman_2014_Marsala_Single_Cask_Finish_import.png | 2024-08-13 17:14 | 172K | |
| Kilchoman_2014_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 186K | |
| Kilchoman_2015_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 186K | |
| Kilchoman_2016_Italian_Cities_-_Milan_import.png | 2024-08-13 17:14 | 175K | |
| Kilchoman_2016_Single_Cask_Release_import.png | 2024-08-13 17:14 | 167K | |
| Kilchoman_2016_The_Kilchoman_Club_-_12th_Edition_import.png | 2024-08-13 17:14 | 163K | |
| Kilchoman_2016_Uniquely_Islay_Series_-_An_Samhradh_2023_import.png | 2024-08-13 17:14 | 189K | |
| Kilchoman_2018_Single_Cask_Matured_import.png | 2024-08-13 17:14 | 142K | |
| Kilchoman_Cognac_Cask_Matured_Edition_2023_import.png | 2024-08-13 17:14 | 169K | |
| Kilchoman_Cognac_Cask_Small_Batch_import.png | 2024-08-13 17:14 | 196K | |
| Kilchoman_Concierge_Small_Batch_No_2_Distillery_Bottling_import.png | 2024-08-13 17:14 | 162K | |
| Kilchoman_Concierge_Small_Batch_No_2_import.png | 2024-08-13 17:14 | 162K | |
| Kilchoman_European_Tour_2023_import.png | 2024-08-13 17:14 | 174K | |
| Kilchoman_Feis_Ile_2023_import.png | 2024-08-13 17:14 | 171K | |
| Kilchoman_Fino_Sherry_Matured_import.png | 2024-08-13 17:14 | 169K | |
| Kilchoman_Genesis_Mashing_-_Stage_4_import.png | 2024-08-13 17:14 | 175K | |
| Kilchoman_Loch_Gorm_2023_Edition_import.png | 2024-08-13 17:14 | 172K | |
| Kilchoman_Loch_Gruinart_import.png | 2024-08-13 17:14 | 171K | |
| Kilchoman_New_Make_Spirit_20ppm_import.png | 2024-08-13 17:14 | 213K | |
| Kilchoman_New_Make_Spirit_50ppm_import.png | 2024-08-13 17:14 | 216K | |
| Kilchoman_PX_Sherry_Cask_Matured_2023_Edition_import.png | 2024-08-13 17:14 | 172K | |
| Kilchoman_Small_Batch_Port_-_French_Exclusive_import.png | 2024-08-13 17:14 | 172K | |
| Kilchoman_Small_Batch_STR_-_French_Exclusive_import.png | 2024-08-13 17:14 | 170K | |
| Kilchoman_Small_Batch_import.png | 2024-08-13 17:14 | 172K | |
| Kilchoman_Triskele_Casks_-_Netherlands_Exclusive_Small_Batch_Release_import.png | 2024-08-13 17:14 | 159K | |
| Kilchoman_United_Kingdom_Small_Batch_Release_No._5_import.png | 2024-08-13 17:14 | 160K | |
| Kilchoman_WCN_20th_Anniversary_Private_Cask_Bottling_import.png | 2024-08-13 17:14 | 170K | |
| Kilchoman_x_Land_Rover_639_Small_Batch_Release_import.png | 2024-08-13 17:14 | 191K | |
| Kildalton_2008_WSP_Islay_Sponge_-_Part_3_import.png | 2024-08-13 17:14 | 101K | |
| Kildalton_2009_SCSM_Small_square_bottle_import.png | 2024-08-13 17:14 | 209K | |
| Kilgarny_2003_JB_import.png | 2024-08-13 17:14 | 144K | |
| Kilkerran_08-year-old_Cask_Strength_import.png | 2024-08-13 17:14 | 124K | |
| Kilkerran_16-year-old_import.png | 2024-08-13 17:14 | 126K | |
| Kilkerran_17-year-old_Open_Day_-_May_2023_import.png | 2024-08-13 17:14 | 102K | |
| Kilkerran_2009_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 132K | |
| Kilkerran_2015_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 127K | |
| Kilkerran_Distillery_Visitors_2023_Private_Bottling_import.png | 2024-08-13 17:14 | 135K | |
| Kilkerran_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 186K | |
| Kilkerran_Heavily_Peated_Peat_in_Progress_-_Batch_8_import.png | 2024-08-13 17:14 | 129K | |
| Kilkerran_Heavily_Peated_Small_Batch_import.png | 2024-08-13 17:14 | 126K | |
| Killara_Reverse_Into_Port_import.png | 2024-08-13 17:14 | 148K | |
| Killara_Single_Cask_import.png | 2024-08-13 17:14 | 102K | |
| Killara_Tasmanian_Whisky_Single_Cask_import.png | 2024-08-13 17:14 | 127K | |
| Killowen_04-year-old_Silent_Valley_import.png | 2024-08-13 17:14 | 148K | |
| Killowen_06-year-old_import.png | 2024-08-13 17:14 | 170K | |
| Killowen_2019_Baràntúil_import.png | 2024-08-13 17:14 | 178K | |
| Killowen_2019_Barántúil_import.png | 2024-08-13 17:14 | 129K | |
| Killowen_2020_Barántúil_import.png | 2024-08-13 17:14 | 129K | |
| Killowen_The_Dagdas_Oats_import.png | 2024-08-13 17:14 | 143K | |
| Kilnaughton_Secret_Islay_Limited_Edition_VM_The_Coopers_Choice_import.png | 2024-08-13 17:14 | 119K | |
| Kim_Chang_Soo_Korean_Single_Malt_Artist_Edition_import.png | 2024-08-13 17:14 | 196K | |
| Kim_Chang_Soo_Korean_Single_Malt_Quarter_Cask_import.png | 2024-08-13 17:14 | 130K | |
| Kim_Chang_Soo_Korean_Single_Malt_The_Private_Cask_import.png | 2024-08-13 17:14 | 105K | |
| King_Barley_Bourbon_cask_import.png | 2024-08-13 17:14 | 169K | |
| King_Barley_Moravian_Virgin_Oak_import.png | 2024-08-13 17:14 | 180K | |
| King_Barley_Port_Cask_import.png | 2024-08-13 17:14 | 181K | |
| King_Barley_Quarter_cask_import.png | 2024-08-13 17:14 | 159K | |
| King_of_Scots_50-year-old_DL_import.png | 2024-08-13 17:14 | 200K | |
| Kingfisher_2016_Distillers_Cut_import.png | 2024-08-13 17:14 | 169K | |
| Kingfisher_2016_import.png | 2024-08-13 17:14 | 196K | |
| Kinglake_Distillery_2017_OGradys_Stand_import.png | 2024-08-13 17:14 | 155K | |
| Kings_County_Distillery_05-year-old_Kings_Code_import.png | 2024-08-13 17:14 | 115K | |
| Kings_County_Distillery_Batch_1_TBWC_USA_Series_import.png | 2024-08-13 17:14 | 120K | |
| Kings_Familiy_Distillery_05-year-old_Toasted_Agave_import.png | 2024-08-13 17:14 | 85K | |
| Kings_Inch_2015_Best_of_Bourbon_import.png | 2024-08-13 17:14 | 152K | |
| Kingsbarns_05-year-old_Single_Cask_Release_import.png | 2024-08-13 17:14 | 128K | |
| Kingsbarns_06-year-old_import.png | 2024-08-13 17:14 | 121K | |
| Kingsbarns_Bell_Rock_Cask_Strength_import.png | 2024-08-13 17:14 | 145K | |
| Kingsbarns_Falkland_import.png | 2024-08-13 17:14 | 125K | |
| Kirkland_Signature_15-year-old_AMC_Highland_import.png | 2024-08-13 17:14 | 96K | |
| Knaplund_2018_import.png | 2024-08-13 17:14 | 208K | |
| Knob_Creek_18-year-old_Small_Batch_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:14 | 178K | |
| Knob_Creek_2012_Single_Barrel_Select_Bourbon_import.png | 2024-08-13 17:14 | 187K | |
| Knockdhu_10-year-old_3W_import.png | 2024-08-13 17:14 | 89K | |
| Knockdhu_2006_LsD_Hepburns_Choice_import.png | 2024-08-13 17:14 | 260K | |
| Knockdhu_2010_CA_Warehouse_tasting_import.png | 2024-08-13 17:14 | 156K | |
| Knockdhu_2012_DT_The_Octave_import.png | 2024-08-13 17:14 | 112K | |
| Knockdhu_2013_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 105K | |
| Knockdhu_2013_CA_import.png | 2024-08-13 17:14 | 108K | |
| Kommunen_Schnaps_Private_Bottling_2023_UD_import.png | 2024-08-13 17:14 | 143K | |
| Kornog_05-year-old_Sant_Erwan_2023_import.png | 2024-08-13 17:14 | 139K | |
| Kornog_2011_LMDW_EX_LIBRIS_import.png | 2024-08-13 17:14 | 198K | |
| Kornog_2012_LMDW_EX_LIBRIS_import.png | 2024-08-13 17:14 | 192K | |
| Kornog_2015_Ex-Libris_import.png | 2024-08-13 17:14 | 193K | |
| Kornog_2018_Single_Cask_import.png | 2024-08-13 17:14 | 128K | |
| Kymsee_2018_import.png | 2024-08-13 17:14 | 149K | |
| Kyrö_Cinderella_Malt_Rye_Whisky_import.png | 2024-08-13 17:14 | 146K | |
| Kyrö_Finland_Edition_Dr._Jekylls_Nordic_Series_import.png | 2024-08-13 17:14 | 126K | |
| Kyrö_Peat_Smoke_Malt_Rye_Whisky_import.png | 2024-08-13 17:14 | 136K | |
| Kyrö_s_Choice_Rye_Whisky_import.png | 2024-08-13 17:14 | 133K | |
| La_Famiglia_Nostra_μολὼν_λαβέ_LFN_import.png | 2024-08-13 17:14 | 94K | |
| La_Famiglia_Nostra_2013_LFN_Variscia_Principalis_import.png | 2024-08-13 17:14 | 111K | |
| La_Famiglia_Nostra_2015_LFN_„RnB“_as_in_Reale_Bastardo_import.png | 2024-08-13 17:14 | 125K | |
| La_Famiglia_Nostra_2015_LFN_Canis_Lupus_Familiaris_import.png | 2024-08-13 17:14 | 131K | |
| La_Famiglia_Nostra_B-Day_Bomb_LFN_vol._4_import.png | 2024-08-13 17:14 | 149K | |
| La_Famiglia_Nostra_Glaube_LFN_import.png | 2024-08-13 17:14 | 120K | |
| La_Famiglia_Nostra_Hoffnung_LFN_import.png | 2024-08-13 17:14 | 122K | |
| La_Famiglia_Nostra_Liebe_LFN_import.png | 2024-08-13 17:14 | 118K | |
| La_Famiglia_Nostra_X_LFN_import.png | 2024-08-13 17:14 | 137K | |
| La_Girafe_Chic_1997_MM_Mission_Gold_import.png | 2024-08-13 17:14 | 178K | |
| Lady_of_Arms_Sword_Edition_No.1_import.png | 2024-08-13 17:14 | 128K | |
| Lafayette_Whisky_Cask_Strength_import.png | 2024-08-13 17:14 | 158K | |
| Lafayette_Whisky_import.png | 2024-08-13 17:14 | 153K | |
| Lagavulin 16.jpg | 2024-08-13 17:14 | 32K | |
| Lagavulin 1997 Distillers Edition.jpg | 2024-08-13 17:14 | 2.6K | |
| Lagavulin_12-year-old_-_The_Ink_of_Legends_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:14 | 104K | |
| Lagavulin_14-year-old_Fèis_Ìle_2023_import.png | 2024-08-13 17:14 | 94K | |
| Lagavulin_15-year-old_Islay_Jazz_Festival_2023_import.png | 2024-08-13 17:14 | 98K | |
| Lagavulin_2014_Hand_Bottled_at_the_Distillery_import.png | 2024-08-13 17:14 | 96K | |
| Lagavulin_Distillery_Exclusive_Batch_01_import.png | 2024-08-13 17:14 | 88K | |
| Lagg_03-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 137K | |
| Lagg_2019_Distillery_Exclusive_Pour_Your_Own_import.png | 2024-08-13 17:14 | 152K | |
| Lagg_2019_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 217K | |
| Lagg_2019_Duty_Paid_Sample_import.png | 2024-08-13 17:14 | 116K | |
| Lagg_Corriecravie_Edition_import.png | 2024-08-13 17:14 | 139K | |
| Lake_Connection_Blended_Whisky_import.png | 2024-08-13 17:14 | 136K | |
| Lamas_Rarus_Single_Malt_Whisky_import.png | 2024-08-13 17:14 | 100K | |
| Lamas_The_Dogs_Bollocks_II_Single_Malt_Whisky_import.png | 2024-08-13 17:14 | 143K | |
| Langatun_9-8-7_Finest_Sherry_-_Cask_Strength_import.png | 2024-08-13 17:14 | 160K | |
| Langatun_2011_Vintage_Reserve_import.png | 2024-08-13 17:14 | 201K | |
| Langatun_2013_The_Distillery_Editions_import.png | 2024-08-13 17:14 | 151K | |
| Langatun_2017_Old_wrong_Train_import.png | 2024-08-13 17:14 | 181K | |
| Langatun_2017_import.png | 2024-08-13 17:14 | 154K | |
| Laphroaig 10 Cask Strength.jpg | 2024-08-13 17:14 | 1.3M | |
| Laphroaig 18.jpg | 2024-08-13 17:14 | 26K | |
| Laphroaig An Cuan Mor.jpg | 2024-08-13 17:14 | 26K | |
| Laphroaig Cairdeas 2012 Origin.jpg | 2024-08-13 17:14 | 230K | |
| Laphroaig Cairdeas 2013 Portwood.jpg | 2024-08-13 17:14 | 69K | |
| Laphroaig Cairdeas 2014 Amontillado.jpg | 2024-08-13 17:14 | 3.4K | |
| Laphroaig Cairdeas 2015.jpg | 2024-08-13 17:14 | 31K | |
| Laphroaig PX Cask.jpg | 2024-08-13 17:14 | 34K | |
| Laphroaig Quarter Cask.jpg | 2024-08-13 17:14 | 90K | |
| Laphroaig Triplewood.jpg | 2024-08-13 17:14 | 32K | |
| Laphroaig_10-year-old_import.png | 2024-08-13 17:14 | 89K | |
| Laphroaig_17-year-old_Single_Cask_import.png | 2024-08-13 17:14 | 91K | |
| Laphroaig_1990_HL_Old_&_Rare_import.png | 2024-08-13 17:14 | 148K | |
| Laphroaig_1997_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:14 | 195K | |
| Laphroaig_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:14 | 195K | |
| Laphroaig_1999_BR_import.png | 2024-08-13 17:14 | 188K | |
| Laphroaig_2000_Single_Cask_Release_3_import.png | 2024-08-13 17:14 | 112K | |
| Laphroaig_2005_Single_Cask_Release_import.png | 2024-08-13 17:14 | 97K | |
| Laphroaig_2010_Single_Cask_Release_import.png | 2024-08-13 17:14 | 118K | |
| Laphroaig_2011_DT_The_Octave_import.png | 2024-08-13 17:14 | 99K | |
| Laphroaig_2012_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:14 | 143K | |
| Laphroaig_2016_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:14 | 152K | |
| Laphroaig_2017_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:14 | 147K | |
| Laphroaig_Cairdeas_Feis_Ile_2023_import.png | 2024-08-13 17:14 | 96K | |
| Laphroaig_L_1.0_Elements_import.png | 2024-08-13 17:14 | 82K | |
| Laphroaig_Oak_Select_Cask_Collection_import.png | 2024-08-13 17:14 | 90K | |
| Laphroaig_Quarter_Cask_import.png | 2024-08-13 17:14 | 92K | |
| Lark_Classic_Cask_Signature_Collection_import.png | 2024-08-13 17:14 | 180K | |
| Launceston_Batch_1_TBWC_import.png | 2024-08-13 17:14 | 142K | |
| Laverq_2019_import.png | 2024-08-13 17:14 | 230K | |
| Ledaig 10.jpg | 2024-08-13 17:14 | 89K | |
| Ledaig_06-year-old_LF_import.png | 2024-08-13 17:14 | 142K | |
| Ledaig_15-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:14 | 130K | |
| Ledaig_16-year-old_BW_The_Fine_Art_of_Whisky_import.png | 2024-08-13 17:14 | 193K | |
| Ledaig_17-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:14 | 123K | |
| Ledaig_1994_SdS_Private_Garden_import.png | 2024-08-13 17:14 | 164K | |
| Ledaig_1996_MBl_The_Maltman_import.png | 2024-08-13 17:14 | 99K | |
| Ledaig_1997_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:14 | 130K | |
| Ledaig_1997_MM_Mission_Gold_import.png | 2024-08-13 17:14 | 125K | |
| Ledaig_2001_MM_Mission_Gold_-_Limited_Release_import.png | 2024-08-13 17:14 | 136K | |
| Ledaig_2005_MM_Mission_Gold_import.png | 2024-08-13 17:14 | 123K | |
| Ledaig_2005_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:14 | 143K | |
| Ledaig_2006_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:14 | 109K | |
| Ledaig_2007_DRFS_Wu_Dram_Clan_Community_import.png | 2024-08-13 17:14 | 132K | |
| Ledaig_2007_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:14 | 102K | |
| Ledaig_2007_LT_import.png | 2024-08-13 17:14 | 116K | |
| Ledaig_2007_WF_A_joint_bottling_with_Liquid_Treasures_import.png | 2024-08-13 17:14 | 262K | |
| Ledaig_2008_DL_Old_Particular_import.png | 2024-08-13 17:14 | 108K | |
| Ledaig_2009_BR_import.png | 2024-08-13 17:14 | 169K | |
| Ledaig_2009_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 118K | |
| Ledaig_2009_Hand_Filled_Exclusive_Edition_import.png | 2024-08-13 17:14 | 139K | |
| Ledaig_2009_MM_Benchmark_import.png | 2024-08-13 17:14 | 129K | |
| Ledaig_2009_NSpS_Modernism_import.png | 2024-08-13 17:14 | 88K | |
| Ledaig_2010_TWS_Glenkeir_Treasures_our_Special_Selection_import.png | 2024-08-13 17:14 | 157K | |
| Ledaig_2012_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 121K | |
| LegendaryRedSilkieCaskStrength.png | 2024-08-13 17:14 | 233K | |
| Limburgse_Whisky_2020_import.png | 2024-08-13 17:14 | 138K | |
| Limeburners_Batch_1_TBWC_import.png | 2024-08-13 17:14 | 141K | |
| Lindores_Abbey_1494_Members_Edition_import.png | 2024-08-13 17:14 | 131K | |
| Lindores_Abbey_2018_Exclusive_Cask_import.png | 2024-08-13 17:14 | 260K | |
| Lindores_Abbey_2018_RMW_Exclusive_import.png | 2024-08-13 17:14 | 162K | |
| Lindores_Abbey_2018_The_Distillery_Cask_import.png | 2024-08-13 17:14 | 274K | |
| Lindores_Abbey_2018_The_Exclusive_Cask_import.png | 2024-08-13 17:14 | 155K | |
| Lindores_Abbey_2019_Private_Cask_Bottling_import.png | 2024-08-13 17:14 | 135K | |
| Lindores_Abbey_2019_Private_Cask_Die_Weinbergritter_Anno_1188_import.png | 2024-08-13 17:14 | 164K | |
| Lindores_Abbey_2019_Single_Cask_import.png | 2024-08-13 17:14 | 142K | |
| Lindores_Abbey_2019_The_Exclusive_Cask_import.png | 2024-08-13 17:14 | 140K | |
| Lindores_Abbey_2019_The_Exclusive_Franconian_Cask_import.png | 2024-08-13 17:14 | 156K | |
| Lindores_Abbey_2020_Private_Cask_Bottling_import.png | 2024-08-13 17:14 | 160K | |
| Lindores_Abbey_2020_The_Private_Cask_import.png | 2024-08-13 17:14 | 146K | |
| Lindores_Abbey_Friar_John_Cor_The_Cask_Strength_Congregation_Chapter_II_import.png | 2024-08-13 17:14 | 129K | |
| Lindores_Abbey_Friar_John_Cor_The_Cask_Strength_Congregation_Chapter_I_import.png | 2024-08-13 17:14 | 126K | |
| Lindores_Abbey_Friar_John_Cor_The_Distillery_Exclusive_Batch_Chapter_1_import.png | 2024-08-13 17:14 | 118K | |
| Lindores_Abbey_The_Casks_of_Lindores_II_Limited_Edition_import.png | 2024-08-13 17:14 | 146K | |
| Lindores_Abbey_The_Casks_of_Lindores_II_import.png | 2024-08-13 17:14 | 136K | |
| Linkwood_17-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:14 | 118K | |
| Linkwood_21-year-old_BW_The_Fine_Art_of_Whisky_import.png | 2024-08-13 17:14 | 93K | |
| Linkwood_31-year-old_ElD_The_Single_Malts_of_Scotland_-_DIRECTOR`S_SPECIAL_import.png | 2024-08-13 17:14 | 168K | |
| Linkwood_1992_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:14 | 127K | |
| Linkwood_1992_TWBl_No._032_import.png | 2024-08-13 17:14 | 102K | |
| Linkwood_1993_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:14 | 155K | |
| Linkwood_1994_GM_Connoisseurs_Choice_import.png | 2024-08-13 17:14 | 120K | |
| Linkwood_1995_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:14 | 144K | |
| Linkwood_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:14 | 153K | |
| Linkwood_2006_NSS_Cask_Series_23_import.png | 2024-08-13 17:14 | 155K | |
| Linkwood_2007_SS_Silver_Seal_Young_import.png | 2024-08-13 17:14 | 140K | |
| Linkwood_2007_TWCC_import.png | 2024-08-13 17:14 | 109K | |
| Linkwood_2007_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:14 | 105K | |
| Linkwood_2008_AD_Selection_import.png | 2024-08-13 17:14 | 93K | |
| Linkwood_2008_MM_Benchmark_-_Limited_Release_import.png | 2024-08-13 17:14 | 131K | |
| Linkwood_2008_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:14 | 178K | |
| Linkwood_2009_BD_import.png | 2024-08-13 17:14 | 153K | |
| Linkwood_2009_WM_Barrel_Selection_-_Cask_Strength_import.png | 2024-08-13 17:14 | 101K | |
| Linkwood_2010_BR_Single_Cask_import.png | 2024-08-13 17:14 | 118K | |
| Linkwood_2010_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:14 | 155K | |
| Linkwood_2010_PST_import.png | 2024-08-13 17:14 | 117K | |
| Linkwood_2010_SV_Loki_Edda_#5_import.png | 2024-08-13 17:14 | 192K | |
| Linkwood_2010_TCaH_Crazy_Coos_Collection_import.png | 2024-08-13 17:14 | 104K | |
| Linkwood_2010_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:14 | 158K | |
| Linkwood_2010_vW_The_Ultimate_import.png | 2024-08-13 17:14 | 111K | |
| Linkwood_2011_AD_Selection_import.png | 2024-08-13 17:14 | 96K | |
| Linkwood_2011_NSpS_Modernism_import.png | 2024-08-13 17:14 | 119K | |
| Linkwood_2011_TFWC_The_Firkin_Ten_import.png | 2024-08-13 17:14 | 121K | |
| Linkwood_2011_WM_Barrel_Selection_import.png | 2024-08-13 17:14 | 111K | |
| Linkwood_2011_WhB_Cree_import.png | 2024-08-13 17:14 | 102K | |
| Linkwood_2012_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 118K | |
| Linkwood_2012_CA_Warehouse_Tasting_import.png | 2024-08-13 17:14 | 149K | |
| Linkwood_2012_JB_Gifted_Stills_import.png | 2024-08-13 17:14 | 113K | |
| Linkwood_2012_JE_Small_Batch_import.png | 2024-08-13 17:14 | 107K | |
| Linkwood_2012_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:14 | 126K | |
| Linkwood_2012_NSS_Cask_Series_022_import.png | 2024-08-13 17:14 | 180K | |
| Linkwood_2012_SV_Cask_Strength_Collection_-_LMDW_import.png | 2024-08-13 17:14 | 156K | |
| Linkwood_2012_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:14 | 143K | |
| Linkwood_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:14 | 113K | |
| Linkwood_2012_Sa_import.png | 2024-08-13 17:14 | 102K | |
| Linkwood_2012_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:14 | 143K | |
| Linkwood_2012_WCR_Club_filling_import.png | 2024-08-13 17:14 | 144K | |
| Linkwood_2013_BR_Single_Cask_import.png | 2024-08-13 17:14 | 231K | |
| Linkwood_2013_BR_Small_Batch_import.png | 2024-08-13 17:14 | 128K | |
| Linkwood_2013_KCC_Fragrant_Drops_import.png | 2024-08-13 17:14 | 294K | |
| Linkwood_2013_RGl_Emergence_Vol_1_import.png | 2024-08-13 17:14 | 144K | |
| Linkwood_2013_SV_Vintage_Collection_import.png | 2024-08-13 17:14 | 103K | |
| Linkwood_2014_TCaH_Special_Release_-_Exclusive_Bottling_import.png | 2024-08-13 17:14 | 135K | |
| Linkwood_2014_WM_Barrel_Selection_import.png | 2024-08-13 17:14 | 112K | |
| Linkwood_2015_Cl_Warehouse_No._1_import.png | 2024-08-13 17:14 | 225K | |
| Linkwood_2019_WhB_import.png | 2024-08-13 17:14 | 128K | |
| Little_Book_2023_Chapter_07_-_In_Retrospect_import.png | 2024-08-13 17:14 | 95K | |
| Littlemill_1988_HB_Legends_Collection_import.png | 2024-08-13 17:14 | 153K | |
| Littlemill_1989_LMDW_Artist_#13_import.png | 2024-08-13 17:14 | 93K | |
| Loch_Lomond_2000_The_Open_Course_Collection_-_Royal_Liverpool_import.png | 2024-08-13 17:14 | 115K | |
| Loch_Lomond_2004_import.png | 2024-08-13 17:14 | 127K | |
| Loch_Lomond_2005_SMWS_135.54_Birch_sap_and_burnt_toffee_import.png | 2024-08-13 17:14 | 113K | |
| Loch_Lomond_2009_Exclusive_Cask_import.png | 2024-08-13 17:14 | 115K | |
| Loch_Lomond_2010_import.png | 2024-08-13 17:14 | 263K | |
| Loch_Lomond_2011_Single_Cask_import.png | 2024-08-13 17:14 | 89K | |
| Loch_Lomond_2012_Distillery_Edition_3_import.png | 2024-08-13 17:14 | 111K | |
| Loch_Lomond_2012_Exclusive_Cask_import.png | 2024-08-13 17:14 | 231K | |
| Loch_Lomond_2012_import.png | 2024-08-13 17:14 | 117K | |
| Loch_Lomond_2013_Exclusive_Cask_import.png | 2024-08-13 17:14 | 166K | |
| Loch_Lomond_2013_Exclusive_Casks_-_Botanic_Road_import.png | 2024-08-13 17:14 | 119K | |
| Loch_Lomond_2013_Single_Cask_import.png | 2024-08-13 17:14 | 300K | |
| Loch_Lomond_2013_import.png | 2024-08-13 17:14 | 119K | |
| Loch_Lomond_2014_Exclusive_Cask_import.png | 2024-08-13 17:14 | 279K | |
| Loch_Lomond_2015_Exclusive_Cask_import.png | 2024-08-13 17:14 | 120K | |
| Loch_Lomond_2015_Exklusiv_Abfüllung_import.png | 2024-08-13 17:14 | 118K | |
| Loch_Lomond_2015_Single_Cask_import.png | 2024-08-13 17:14 | 276K | |
| Loch_Lomond_2016_Distillery_Edition_4_import.png | 2024-08-13 17:14 | 111K | |
| Loch_Lomond_2017_Distillery_Edition_2_import.png | 2024-08-13 17:14 | 113K | |
| Loch_Lomond_The_Open_Special_Edition_151st_Royal_Liverpool_import.png | 2024-08-13 17:14 | 128K | |
| Lochindaal_11-year-old_MNC_import.png | 2024-08-13 17:14 | 94K | |
| Lochindaal_2007_LotG_Rare_Cask_import.png | 2024-08-13 17:14 | 117K | |
| Lochindaal_2009_BlSm_import.png | 2024-08-13 17:14 | 180K | |
| Lochindaal_2009_Df_import.png | 2024-08-13 17:14 | 141K | |
| Lochlea_2018_Single_Cask_import.png | 2024-08-13 17:14 | 189K | |
| Lochlea_2019_Single_Cask_import.png | 2024-08-13 17:14 | 170K | |
| Lochlea_2020_Single_Cask_import.png | 2024-08-13 17:14 | 172K | |
| Lochlea_Cask_Strength_Batch_1_import.png | 2024-08-13 17:14 | 192K | |
| Lochlea_Fallow_Edition_Second_Crop_import.png | 2024-08-13 17:14 | 185K | |
| Lochlea_Harvest_Edition_Second_Crop_import.png | 2024-08-13 17:14 | 177K | |
| Lochlea_Ploughing_Edition_First_Crop_import.png | 2024-08-13 17:14 | 198K | |
| Lochlea_Sowing_Edition_Second_Crop_import.png | 2024-08-13 17:14 | 202K | |
| Longmorn 19 Signatory 1992.jpg | 2024-08-13 17:14 | 119K | |
| Longmorn_1999_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:14 | 139K | |
| Longmorn_2008_MBl_The_Maltman_import.png | 2024-08-13 17:14 | 108K | |
| Longmorn_2011_HI_Maggies_Collection_import.png | 2024-08-13 17:14 | 108K | |
| Longmorn_2011_LotG_import.png | 2024-08-13 17:14 | 117K | |
| Longmorn_2011_PST_import.png | 2024-08-13 17:14 | 112K | |
| Longmorn_2013_WhB_Cree_import.png | 2024-08-13 17:14 | 100K | |
| Longrow CV.jpg | 2024-08-13 17:14 | 128K | |
| Longrow Peated.jpg | 2024-08-13 17:14 | 516K | |
| Longrow Red 11 Fresh Port Cask.jpg | 2024-08-13 17:14 | 506K | |
| Longrow_08-year-old_Open_Day_-_May_2023_import.png | 2024-08-13 17:14 | 90K | |
| Longrow_21-year-old_Limited_Release_import.png | 2024-08-13 17:14 | 124K | |
| Longrow_1994_Barley_to_bottle_tour_import.png | 2024-08-13 17:14 | 236K | |
| Longrow_2001_CA_Authentic_Collection_import.png | 2024-08-13 17:14 | 123K | |
| Longrow_2006_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:14 | 90K | |
| Longrow_2014_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:14 | 96K | |
| Longrow_2015_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:14 | 91K | |
| Longrow_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 105K | |
| Longrow_Hand_Filled_Distillery_Exculsive_import.png | 2024-08-13 17:14 | 100K | |
| Lowland_07-year-old_CA_Enigma_import.png | 2024-08-13 17:14 | 90K | |
| Lowland_Single_Malt_2015_Orc_import.png | 2024-08-13 17:14 | 86K | |
| M&H_2017_Behind_Blue_Eyes_import.png | 2024-08-13 17:14 | 147K | |
| M&H_2017_Single_Cask_import.png | 2024-08-13 17:14 | 114K | |
| M&H_2018_Israeli_Strength_-_Stronger_Together_import.png | 2024-08-13 17:14 | 90K | |
| M&H_2018_K23_De_Shilton_import.png | 2024-08-13 17:14 | 99K | |
| M&H_2018_K23_Fundrasing_for_Charity_import.png | 2024-08-13 17:14 | 101K | |
| M&H_2018_Single_Cask_import.png | 2024-08-13 17:14 | 235K | |
| M&H_2018_WCon_import.png | 2024-08-13 17:14 | 85K | |
| M&H_2019_-_APEX_Cognac_Cask_import.png | 2024-08-13 17:14 | 100K | |
| M&H_2019_AtMy_Wasted_Wolf_Whisky_import.png | 2024-08-13 17:14 | 104K | |
| M&H_2019_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 109K | |
| M&H_2019_K23_Dialects_import.png | 2024-08-13 17:14 | 101K | |
| M&H_2019_Limited_Edition_Whisky_Live_Tel_Aviv_2023_import.png | 2024-08-13 17:14 | 110K | |
| M&H_2019_PDnl_import.png | 2024-08-13 17:14 | 166K | |
| M&H_2019_PST_import.png | 2024-08-13 17:14 | 86K | |
| M&H_2019_Single_Cask_-_Cask_Sample_import.png | 2024-08-13 17:14 | 207K | |
| M&H_2019_Single_Cask_Exclusives_import.png | 2024-08-13 17:14 | 120K | |
| M&H_2019_Single_Cask_import.png | 2024-08-13 17:14 | 237K | |
| M&H_2019_Spirit_of_Hope_import.png | 2024-08-13 17:14 | 112K | |
| M&H_2019_import.png | 2024-08-13 17:14 | 116K | |
| M&H_2020_Distillery_Exclusive_import.png | 2024-08-13 17:14 | 219K | |
| M&H_2020_Min_Morsa_import.png | 2024-08-13 17:14 | 133K | |
| M&H_Local_Barley_import.png | 2024-08-13 17:14 | 300K | |
| M&M Mulberry Wood (2).png | 2024-08-13 17:14 | 2.6M | |
| MALAGA_BOTTLE_PACK_RGB-776x1176.jpeg | 2024-08-13 17:15 | 82K | |
| Mac-Talla_Cluain_MSWD_Flavourscapes_Series_import.png | 2024-08-13 17:14 | 112K | |
| Mac-Talla_Fèis_Ìle_2023_MSWD_import.png | 2024-08-13 17:14 | 107K | |
| Mac-Talla_Fluran_Flavourscapes_Series_import.png | 2024-08-13 17:14 | 99K | |
| Mac-Talla_Fogharach_Flavourscapes_Series_import.png | 2024-08-13 17:14 | 100K | |
| Macallan 10 Fine Oak.jpg | 2024-08-13 17:14 | 118K | |
| Macallan 12 Fine Oak.jpg | 2024-08-13 17:14 | 2.6K | |
| Macallan Sherry Cask Strength.jpg | 2024-08-13 17:14 | 157K | |
| Macallan_12-year-old_The_Colour_Collection_import.png | 2024-08-13 17:14 | 89K | |
| Macallan_15-year-old_The_Colour_Collection_import.png | 2024-08-13 17:15 | 93K | |
| Macallan_18-year-old_The_Colour_Collection_import.png | 2024-08-13 17:15 | 100K | |
| Macallan_21-year-old_The_Colour_Collection_import.png | 2024-08-13 17:15 | 103K | |
| Macallan_25-year-old_Annual_2023_Release_import.png | 2024-08-13 17:15 | 115K | |
| Macallan_25-year-old_Sherry_Oak_import.png | 2024-08-13 17:15 | 181K | |
| Macallan_30-year-old_Annual_2023_Release_import.png | 2024-08-13 17:15 | 184K | |
| Macallan_30-year-old_Double_Cask_import.png | 2024-08-13 17:15 | 180K | |
| Macallan_30-year-old_The_Colour_Collection_import.png | 2024-08-13 17:15 | 279K | |
| Macallan_1988_DL_Celebrating_75th_Anniversary_import.png | 2024-08-13 17:15 | 126K | |
| Macallan_1990_Bobe_The_World_Is_On_Fire_2_Peter_Howson_import.png | 2024-08-13 17:15 | 146K | |
| Macallan_1991_SMWS_24.171_Take_me_to_chantilly_import.png | 2024-08-13 17:15 | 284K | |
| Macallan_1997_SV_Cask_Strength_Collection_-_Symington’s_Choice_import.png | 2024-08-13 17:15 | 159K | |
| Macallan_1997_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:15 | 165K | |
| Macallan_2001_GM_Speymalt_import.png | 2024-08-13 17:15 | 107K | |
| Macallan_2003_GM_Speymalt_import.png | 2024-08-13 17:15 | 96K | |
| Macallan_2005_GM_Speymalt_import.png | 2024-08-13 17:15 | 102K | |
| Macallan_2007_GM_Speymalt_import.png | 2024-08-13 17:15 | 107K | |
| Macallan_A_Night_on_Earth_The_Journey_Seasonal_Release_import.png | 2024-08-13 17:15 | 107K | |
| Macallan_Amber_Meadow_The_Harmony_Collection_import.png | 2024-08-13 17:15 | 104K | |
| Macallan_Classic_Cut_Limited_2023_Edition_import.png | 2024-08-13 17:15 | 98K | |
| Macallan_Distil_Your_World_Mexico_import.png | 2024-08-13 17:15 | 109K | |
| Macallan_Folio_7_The_Archival_Series_import.png | 2024-08-13 17:15 | 94K | |
| Macallan_Litha_import.png | 2024-08-13 17:15 | 95K | |
| Macallan_Rare_Cask_2023_Release_import.png | 2024-08-13 17:15 | 109K | |
| Macaloneys_2005_St._Mallie_-_Single_Cask_Series_import.png | 2024-08-13 17:15 | 143K | |
| Macaloneys_An_Loy_Signature_Selection_import.png | 2024-08-13 17:15 | 175K | |
| Macaloneys_Canadian_Island_Single_Malt_Whisky_Private_Single_Cask_import.png | 2024-08-13 17:15 | 176K | |
| Macaloneys_Cath-Nah-Aven_Signature_Selection_import.png | 2024-08-13 17:15 | 166K | |
| Macaloneys_Invermallie_import.png | 2024-08-13 17:15 | 156K | |
| Macaloneys_Invernahaven_import.png | 2024-08-13 17:15 | 138K | |
| Macaloneys_Killeigh_import.png | 2024-08-13 17:15 | 153K | |
| Macaloneys_Kirkinriola_Single_Cask_Series_import.png | 2024-08-13 17:15 | 163K | |
| Macaloneys_Siol_Dugall_import.png | 2024-08-13 17:15 | 167K | |
| Macduff_11-year-old_BW_A_Dream_of_Scotland_-_Demons_&_Ghosts_import.png | 2024-08-13 17:15 | 103K | |
| Macduff_14-year-old_DMor_import.png | 2024-08-13 17:15 | 100K | |
| Macduff_1990_MBl_The_Maltman_import.png | 2024-08-13 17:15 | 103K | |
| Macduff_2002_BR_Single_Cask_import.png | 2024-08-13 17:15 | 121K | |
| Macduff_2007_BR_Single_Cask_import.png | 2024-08-13 17:15 | 122K | |
| Macduff_2007_ED_The_First_Editions_import.png | 2024-08-13 17:15 | 263K | |
| Macduff_2007_cQs_import.png | 2024-08-13 17:15 | 94K | |
| Macduff_2008_TCaH_import.png | 2024-08-13 17:15 | 133K | |
| Macduff_2009_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:15 | 160K | |
| Macduff_2009_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:15 | 117K | |
| Macduff_2010_DoTh_Signature_Collection_import.png | 2024-08-13 17:15 | 136K | |
| Macduff_2011_HSD_Longvalley_Selection_import.png | 2024-08-13 17:15 | 120K | |
| Macduff_2011_LT_import.png | 2024-08-13 17:15 | 123K | |
| Macduff_2011_TFM_Shipwrecks_import.png | 2024-08-13 17:15 | 108K | |
| Macduff_2011_TWA_Sequences_import.png | 2024-08-13 17:15 | 110K | |
| Macduff_2012_Df_65th_release_import.png | 2024-08-13 17:15 | 111K | |
| Macduff_2012_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:15 | 102K | |
| Macduff_2012_K23_Mobsters_on_Mopeds_import.png | 2024-08-13 17:15 | 110K | |
| Macduff_2012_RS_Bottled_for_Whisky_Hood_import.png | 2024-08-13 17:15 | 108K | |
| Mackinlay's Shackleton Rare Old Highland Malt Whisky.jpg | 2024-08-13 17:15 | 151K | |
| Mackmyra_2018_Reserve_import.png | 2024-08-13 17:15 | 138K | |
| Mackmyra_2019_Reserve_import.png | 2024-08-13 17:15 | 154K | |
| Mackmyra_2020_Norrsken_-_Reserve_Elegant_import.png | 2024-08-13 17:15 | 140K | |
| Mackmyra_Batch_3_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:15 | 305K | |
| Mackmyra_Dram_Way_05_DrWa_Scottish_Strong_Ale_Cask_import.png | 2024-08-13 17:15 | 184K | |
| Mackmyra_Dram_Way_DrWa_Malte_Teilt_Malt_import.png | 2024-08-13 17:15 | 166K | |
| Mackmyra_Identitet_import.png | 2024-08-13 17:15 | 122K | |
| Mackmyra_Muddus_Small_Batch_Kollektion_import.png | 2024-08-13 17:15 | 153K | |
| Mackmyra_Reserve_Swedish_Single_Cask_Whisky_import.png | 2024-08-13 17:15 | 131K | |
| Macleods_15-year-old_IM_import.png | 2024-08-13 17:15 | 101K | |
| Maison_Benjamin_Kuentz_un_fût_à_part_import.png | 2024-08-13 17:15 | 197K | |
| Makers_Mark_2023_Limited_Release_Wood_Finishing_Series_import.png | 2024-08-13 17:15 | 133K | |
| Makers_Mark_Cellar_Aged_import.png | 2024-08-13 17:15 | 112K | |
| Makers_Mark_Private_Select_import.png | 2024-08-13 17:15 | 139K | |
| Makers_Mark_Private_Selection_Kentucky_Custard_import.png | 2024-08-13 17:15 | 123K | |
| Makers_Mark_Private_Selection_Milk_Chocolate_Truffle_import.png | 2024-08-13 17:15 | 145K | |
| Mammoth_2004_Northern_Rye_import.png | 2024-08-13 17:15 | 229K | |
| Manatawny_Still_Works_04-year-old_Small_Batch_Peated_Single_Malt_import.png | 2024-08-13 17:15 | 139K | |
| Manly_Spirits_Coastal_Stone_Italian_Luxe_Trio_import.png | 2024-08-13 17:15 | 229K | |
| Manly_Spirits_Costal_Stone_Italian_Luxe_Trio_import.png | 2024-08-13 17:15 | 221K | |
| Manly_Spirits_Costal_Stone_import.png | 2024-08-13 17:15 | 227K | |
| Mannochmore_1996_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:15 | 130K | |
| Mannochmore_2007_DR_Cask_Collection_import.png | 2024-08-13 17:15 | 77K | |
| Mannochmore_2008_CA_Natural_Strength_import.png | 2024-08-13 17:15 | 117K | |
| Mannochmore_2008_DoTh_import.png | 2024-08-13 17:15 | 136K | |
| Mannochmore_2008_SV_import.png | 2024-08-13 17:15 | 107K | |
| Mannochmore_2008_StmD_XVI_Edition_import.png | 2024-08-13 17:15 | 95K | |
| Mannochmore_2008_TWCe_import.png | 2024-08-13 17:15 | 182K | |
| Mannochmore_2009_LBDS_import.png | 2024-08-13 17:15 | 107K | |
| Mannochmore_2010_TCaH_The_Deerhound_Collection_import.png | 2024-08-13 17:15 | 118K | |
| Mannochmore_2011_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:15 | 110K | |
| Mannochmore_2011_MC_import.png | 2024-08-13 17:15 | 115K | |
| Mannochmore_2011_SC&C_Signature_Strength_import.png | 2024-08-13 17:15 | 116K | |
| Mannochmore_2011_TCaH_import.png | 2024-08-13 17:15 | 163K | |
| Mannochmore_2012_JE_import.png | 2024-08-13 17:15 | 102K | |
| Mannochmore_2013_DMor_import.png | 2024-08-13 17:15 | 104K | |
| Mannochmore_2016_Cl_Exploration_Series_import.png | 2024-08-13 17:15 | 103K | |
| Mannochmore_2018_MM_Spirit_of_Speyside_2023_Festival_Release_import.png | 2024-08-13 17:15 | 120K | |
| Maple_Syrup_&_Toasted_Oats_&_Orange_Zest_&_Vanilla_08-year-old_MoM_Canadian_Corn_Whisky_import.png | 2024-08-13 17:15 | 89K | |
| Marder_2011_Black_Forest_Reserve_import.png | 2024-08-13 17:15 | 177K | |
| Marder_Single_Cask_Sherry_Black_Forest_Reserve_import.png | 2024-08-13 17:15 | 180K | |
| Mars_2018_Komagatake_-_Shinshu_Aging_import.png | 2024-08-13 17:15 | 118K | |
| Mars_Cosmo_Coffee_Cask_Finish_import.png | 2024-08-13 17:15 | 268K | |
| Mars_Komagatake_2023_Edition_import.png | 2024-08-13 17:15 | 146K | |
| Mars_Komagatake_IPA_Cask_Finish_import.png | 2024-08-13 17:15 | 102K | |
| Mars_Maltage_Distillerys_Original_import.png | 2024-08-13 17:15 | 116K | |
| Mars_The_Lucky_Cat_May_&_Luna_The_Lucky_Cat_import.png | 2024-08-13 17:15 | 264K | |
| Mars_The_Y.A._import.png | 2024-08-13 17:15 | 129K | |
| Mars_Tsunuki_2017_Tsunuki_-_Yakushima_Aging_import.png | 2024-08-13 17:15 | 126K | |
| Mars_Tsunuki_2018_import.png | 2024-08-13 17:15 | 108K | |
| Mars_Tsunuki_Minami-satsuma_Art_Collection_#1_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:15 | 132K | |
| Mars_Tsunuki_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:15 | 250K | |
| Martins_Barrel_2020_60%_import.png | 2024-08-13 17:15 | 164K | |
| Martinsloch_Edition_5_import.png | 2024-08-13 17:15 | 181K | |
| Mashbill_06-year-old_Rye_Whiskey_import.png | 2024-08-13 17:15 | 173K | |
| Masthouse_2017_BR_Single_Cask_import.png | 2024-08-13 17:15 | 124K | |
| McCarthys_06-year-old_Oregon_Single_Malt_Whiskey_-_Limited_Release_import.png | 2024-08-13 17:15 | 102K | |
| McCarthys_06-year-old_Oregon_Single_Malt_import.png | 2024-08-13 17:15 | 107K | |
| McNeills_Choice_08-year-old_Heather_Summerwood_import.png | 2024-08-13 17:15 | 102K | |
| McNeills_Prototype_05-year-old_MNC_Experiment_#019_import.png | 2024-08-13 17:15 | 107K | |
| McNeills_Prototype_09-year-old_MNC_Experiment_#20_import.png | 2024-08-13 17:15 | 104K | |
| Mees_2019_import.png | 2024-08-13 17:15 | 142K | |
| Mees_2020_import.png | 2024-08-13 17:15 | 147K | |
| Meikle_Tòir_05-year-old_The_Turbo_import.png | 2024-08-13 17:15 | 120K | |
| Method_2017_import.png | 2024-08-13 17:15 | 135K | |
| Method_and_Madness_07-year-old_Limited_Edition_import.png | 2024-08-13 17:15 | 137K | |
| Method_and_Madness_Single_Pot_Still_Irish_Whiskey_Finished_in_Virgin_Garryana_Oak_Barrels_import.png | 2024-08-13 17:15 | 138K | |
| Method_and_Madness_Single_Pot_Still_Irish_Whiskey_Mezcal_Finish_import.png | 2024-08-13 17:15 | 154K | |
| Metropolis_Blended_Scotch_Whisky_CB_The_Extinct_Blends_Quartet_import.png | 2024-08-13 17:15 | 140K | |
| Meyers_2009_import.png | 2024-08-13 17:15 | 176K | |
| Michel_Couvreur_2000_MCo_Single_PX_Cask_import.png | 2024-08-13 17:15 | 139K | |
| Michel_Couvreur_2016_MCo_The_Garden_Party_-_Special_Edition_import.png | 2024-08-13 17:15 | 107K | |
| Michters-US1-Bourbon-776x1176.jpg | 2024-08-13 17:15 | 71K | |
| MichtersRye.jpg | 2024-08-13 17:15 | 953K | |
| Michters_10-year-old_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:15 | 143K | |
| Michters_10-year-old_Single_Barrel_Bourbon_import.png | 2024-08-13 17:15 | 148K | |
| Michters_10-year-old_Single_Barrel_Rye_import.png | 2024-08-13 17:15 | 157K | |
| Michters_10-year-old_Single_Barrel_import.png | 2024-08-13 17:15 | 147K | |
| Michters_10-year-old_import.png | 2024-08-13 17:15 | 134K | |
| Midleton-An-Dair-Ghaelach-776x776.jpg | 2024-08-13 17:15 | 210K | |
| Midleton-Very-Rare-2017-776x1176-3.jpg | 2024-08-13 17:15 | 176K | |
| Midleton-bottle-outside-box-on-white-700_2019_4d85aa94-98f8-44cd-a4a2-5ee0fa6e6bb3_600x.jpg | 2024-08-13 17:15 | 35K | |
| MidletonSilentDistilleryCollectionChapterOneBottle.jpg | 2024-08-13 17:15 | 19K | |
| MidletonSingleCask.jpg | 2024-08-13 17:15 | 120K | |
| Midleton_2000_Single_Cask_import.png | 2024-08-13 17:15 | 150K | |
| Midleton_Barry_Crockett_Legacy_import.png | 2024-08-13 17:15 | 148K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_1_import.png | 2024-08-13 17:15 | 156K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_2_import.png | 2024-08-13 17:15 | 155K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_3_import.png | 2024-08-13 17:15 | 156K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_4_import.png | 2024-08-13 17:15 | 157K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_5_import.png | 2024-08-13 17:15 | 156K | |
| Midleton_Dair_Ghaelach_Kilranelagh_Wood_-_Tree_6_import.png | 2024-08-13 17:15 | 157K | |
| Midleton_Very_Rare_Vintage_Release_2023_import.png | 2024-08-13 17:15 | 154K | |
| Millstone_07-year-old_DMor_import.png | 2024-08-13 17:15 | 90K | |
| Millstone_1996_Special_No._30_import.png | 2024-08-13 17:15 | 129K | |
| Millstone_2014_import.png | 2024-08-13 17:15 | 128K | |
| Millstone_2016_PX_-_Special_no._29_import.png | 2024-08-13 17:15 | 126K | |
| Millstone_2016_Special_No._27_import.png | 2024-08-13 17:15 | 150K | |
| Millstone_2017_BkSp_import.png | 2024-08-13 17:15 | 99K | |
| Millstone_2017_Dutch_Tulip_Collection_import.png | 2024-08-13 17:15 | 110K | |
| Millstone_2017_Peated_px_import.png | 2024-08-13 17:15 | 124K | |
| Millstone_2018_Peated_Oloroso_import.png | 2024-08-13 17:15 | 127K | |
| Millstone_2018_Special_nr._28_import.png | 2024-08-13 17:15 | 133K | |
| Millstone_2019_Heavy_Peated_Cask_Strength_import.png | 2024-08-13 17:15 | 137K | |
| Miltonduff_11-year-old_DeDr_Equinox_&_Solstice_Winter_Edition_import.png | 2024-08-13 17:15 | 95K | |
| Miltonduff_17-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:15 | 126K | |
| Miltonduff_1982_AD_Limited_import.png | 2024-08-13 17:15 | 82K | |
| Miltonduff_2006_KI_Simply_Good_Whisky_import.png | 2024-08-13 17:15 | 90K | |
| Miltonduff_2007_Orc_import.png | 2024-08-13 17:15 | 88K | |
| Miltonduff_2008_Wy_The_Kitchen_Table_import.png | 2024-08-13 17:15 | 138K | |
| Miltonduff_2009_DT_Single_Cask_import.png | 2024-08-13 17:15 | 103K | |
| Miltonduff_2009_DT_The_Octave_import.png | 2024-08-13 17:15 | 98K | |
| Miltonduff_2009_HiSp_Region_Speyside_import.png | 2024-08-13 17:15 | 111K | |
| Miltonduff_2009_SMWS_72.117_Black_forest_burnt_toast_import.png | 2024-08-13 17:15 | 110K | |
| Miltonduff_2009_SV_Private_Edition_No._9_A_Kind_Of_Magic_import.png | 2024-08-13 17:15 | 202K | |
| Miltonduff_2009_SV_The_Un-Chillfiltered_Collection_-_Cask_Strength_import.png | 2024-08-13 17:15 | 105K | |
| Miltonduff_2009_TWC_Single_Cask_import.png | 2024-08-13 17:15 | 113K | |
| Miltonduff_2009_The_Octave_import.png | 2024-08-13 17:15 | 106K | |
| Miltonduff_2010_Hhd_import.png | 2024-08-13 17:15 | 88K | |
| Miltonduff_2011_AM_Hootch_import.png | 2024-08-13 17:15 | 250K | |
| Miltonduff_2011_DT_The_Octave_import.png | 2024-08-13 17:15 | 100K | |
| Miltonduff_2011_MSWD_Càrn_Mòr_-_Strictly_Limited_Edition_import.png | 2024-08-13 17:15 | 140K | |
| Miltonduff_2011_TTOW_Mr._Santa_from_Speyside_import.png | 2024-08-13 17:15 | 321K | |
| Miltonduff_2012_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:15 | 151K | |
| Miltonduff_2013_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:15 | 107K | |
| Miltonduff_2013_JE_Small_Batch_import.png | 2024-08-13 17:15 | 117K | |
| Monkey Shoulder.jpg | 2024-08-13 17:15 | 70K | |
| Moon_Harbour_Port_Bacalan_import.png | 2024-08-13 17:15 | 189K | |
| Moor_Whisky_10-year-old_import.png | 2024-08-13 17:15 | 136K | |
| Morris_Smoked_Sherry_Limited_Edition_import.png | 2024-08-13 17:15 | 140K | |
| Mortlach 16 Flora & Fauna.jpg | 2024-08-13 17:15 | 86K | |
| Mortlach_19-year-old_BW_The_Fine_Art_of_Whisky_import.png | 2024-08-13 17:15 | 117K | |
| Mortlach_2007_TWC_import.png | 2024-08-13 17:15 | 106K | |
| Mortlach_2008_ED_The_First_Editions_import.png | 2024-08-13 17:15 | 222K | |
| Mortlach_2008_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:15 | 107K | |
| Mortlach_2008_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:15 | 94K | |
| Mortlach_2008_WJ_Art_Edition_No._6_import.png | 2024-08-13 17:15 | 126K | |
| Mortlach_2009_vW_The_Ultimate_import.png | 2024-08-13 17:15 | 107K | |
| Mortlach_2012_SV_Small_Batch_Edition_#1_import.png | 2024-08-13 17:15 | 106K | |
| Mortlach_2013_MoM_import.png | 2024-08-13 17:15 | 95K | |
| Mortlach_2014_SV_The_Un-Chillfiltered_Collection_-_Very_Cloudy_import.png | 2024-08-13 17:15 | 104K | |
| Mortlach_The_Katanas_Edge_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:15 | 141K | |
| Mosgaard_03-year-old_Organic_import.png | 2024-08-13 17:15 | 122K | |
| Mosgaard_05-year-old_MWS_Edition_#2_import.png | 2024-08-13 17:15 | 211K | |
| Mosgaard_2017_Organic_-_Single_Cask_import.png | 2024-08-13 17:15 | 115K | |
| Mosgaard_Black_Peat_Organic_import.png | 2024-08-13 17:15 | 119K | |
| Mosgaard_Cask_Experimet_series_No_3_import.png | 2024-08-13 17:15 | 130K | |
| Mosgaard_Organic_-_Single_Cask_Dr._Jekylls_Nordic_Series_import.png | 2024-08-13 17:15 | 206K | |
| Mosgaard_Organic_-_Single_Cask_Peat_&_Port_import.png | 2024-08-13 17:15 | 125K | |
| Mosgaard_Organic_MC_Single_Cask_import.png | 2024-08-13 17:15 | 196K | |
| Moutard_05-year-old_Distillery_Bottling_import.png | 2024-08-13 17:15 | 126K | |
| Moutard_05-year-old_import.png | 2024-08-13 17:15 | 126K | |
| Mulls_Finest_2014_MM_Mystery_Malt_-_Limited_Release_import.png | 2024-08-13 17:15 | 119K | |
| Mulls_Finest_2014_MM_The_Art_of_Maturation_-_Mystery_Malt_import.png | 2024-08-13 17:15 | 120K | |
| Mwórveld_03-year-old_The_Seventh_import.png | 2024-08-13 17:15 | 105K | |
| Mwórveld_03-year-old_The_Sixth_import.png | 2024-08-13 17:15 | 113K | |
| Myken_04-year-old_Pinkernells_Limburg_Edition_no._2_import.png | 2024-08-13 17:15 | 111K | |
| Myken_2020_Cask_of_Distinction_import.png | 2024-08-13 17:15 | 98K | |
| Myken_Ocean_Heart_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:15 | 107K | |
| Myken_Sabotør_#2_Gunnerside_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:15 | 120K | |
| Myken_Two_Islands_Chorus_of_Smoke_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:15 | 107K | |
| Myken_Two_Islands_Echoes_of_Smoke_Arctic_Single_Malt_Whisky_import.png | 2024-08-13 17:15 | 113K | |
| Myken_Værfast_Dr._Jekylls_Nordic_Series_import.png | 2024-08-13 17:15 | 115K | |
| Myken_Whisky_i_tønna_RR040_Private_Bottling_import.png | 2024-08-13 17:15 | 92K | |
| Nagahama_Dream_of_Craft_Distillery_Wine_Cask_Blend_import.png | 2024-08-13 17:15 | 107K | |
| Nantou_Omar_Cask_Strength_import.png | 2024-08-13 17:15 | 149K | |
| Nantou_Omar_Sherry_Type_-_Commemorative_Limited_Edition_import.png | 2024-08-13 17:15 | 112K | |
| Nashville_Barrel_Company_Straight_Bourbon_Whiskey_Single_Barrel_import.png | 2024-08-13 17:15 | 99K | |
| Natterjack_Blend_No._1_Cask_Strength_import.png | 2024-08-13 17:15 | 201K | |
| Natterjack_Irish_Whiskey_GoDi_Cask_Strength_import.png | 2024-08-13 17:15 | 204K | |
| Ncnean_2017_Aon_import.png | 2024-08-13 17:15 | 220K | |
| Ncnean_2017_LBDS_import.png | 2024-08-13 17:15 | 142K | |
| Ncnean_2017_MMM_Black_&_White_Series_import.png | 2024-08-13 17:15 | 94K | |
| Ncnean_2018_DeDr_Westie_Sponge_1_import.png | 2024-08-13 17:15 | 105K | |
| Ncnean_2018_Huntress_-_Woodland_Candy_import.png | 2024-08-13 17:15 | 196K | |
| Ncnean_2019_Organic_Single_Malt_import.png | 2024-08-13 17:15 | 195K | |
| Ncnean_2019_Quiet_Rebels_-_Gordon_import.png | 2024-08-13 17:15 | 207K | |
| Ncnean_Batch_4_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:15 | 123K | |
| Nectar_Grove_Blended_Malt_Scotch_Whisky_Wy_Limited_Edition_import.png | 2024-08-13 17:15 | 125K | |
| Neeley_Family_2020_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:15 | 190K | |
| Nestville_2016_Single_Cask_import.png | 2024-08-13 17:15 | 293K | |
| New_Riff_2019_Single_Barrel_import.png | 2024-08-13 17:15 | 97K | |
| Nikka_Coffey_Malt_Whisky_import.png | 2024-08-13 17:15 | 104K | |
| Nikka_The_Grain_Whisky_Discovery_Series_Vol.3_import.png | 2024-08-13 17:15 | 105K | |
| Ninkasi_Cuvée_Printemps_import.png | 2024-08-13 17:15 | 138K | |
| Noah's Mill.jpg | 2024-08-13 17:15 | 1.0M | |
| Nordmarkens_Primus_Fumea_import.png | 2024-08-13 17:15 | 140K | |
| Nordstern_UD_Very_Small_Batch_Swedish_Whisky_import.png | 2024-08-13 17:15 | 135K | |
| North_British_15-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:15 | 125K | |
| North_British_16-year-old_82NC_Exclusive_Selected_import.png | 2024-08-13 17:15 | 70K | |
| North_British_1989_Cl_Warehouse_No._1_import.png | 2024-08-13 17:15 | 165K | |
| North_British_1989_Cl_Warehouse_No._8_import.png | 2024-08-13 17:15 | 239K | |
| North_British_1991_Cl_Warehouse_No._1_import.png | 2024-08-13 17:15 | 215K | |
| North_British_1991_DrC_import.png | 2024-08-13 17:15 | 120K | |
| North_British_1991_FN_20th_anniversary_import.png | 2024-08-13 17:15 | 96K | |
| North_British_1991_KiW_Single_Cask_Collection_import.png | 2024-08-13 17:15 | 102K | |
| North_British_1991_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:15 | 172K | |
| North_British_1991_TCaH_Hilgering_Premium_Cask_import.png | 2024-08-13 17:15 | 84K | |
| North_British_1991_WAGE_No._0020_import.png | 2024-08-13 17:15 | 93K | |
| North_British_1991_WCP_import.png | 2024-08-13 17:15 | 116K | |
| North_British_1991_WF_import.png | 2024-08-13 17:15 | 116K | |
| North_British_1991_WPB_Just_Dram_it_import.png | 2024-08-13 17:15 | 110K | |
| North_British_1992_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:15 | 124K | |
| North_British_1992_KCC_Fragrant_Drops_import.png | 2024-08-13 17:15 | 189K | |
| North_British_1992_LotG_import.png | 2024-08-13 17:15 | 213K | |
| North_British_1992_TCaH_The_Grainhound_import.png | 2024-08-13 17:15 | 149K | |
| North_British_1992_TSA_The_Alchemist’s_Chronicles_–_Chapter_No._4_import.png | 2024-08-13 17:15 | 131K | |
| North_British_1993_KCC_Fragrant_Drops_import.png | 2024-08-13 17:15 | 187K | |
| North_British_1993_TCaH_Tasting_Tour_import.png | 2024-08-13 17:15 | 104K | |
| North_British_1994_82NC_Creatures_of_Cask_Strength_import.png | 2024-08-13 17:15 | 102K | |
| North_British_1994_AI_The_Alba_Trail_import.png | 2024-08-13 17:15 | 126K | |
| North_British_1994_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:15 | 159K | |
| North_British_2006_AM_import.png | 2024-08-13 17:15 | 92K | |
| North_British_2006_VM_The_Coopers_Choice_import.png | 2024-08-13 17:15 | 118K | |
| North_British_2007_BD_import.png | 2024-08-13 17:15 | 160K | |
| North_British_2008_TcaH_The_Stillmans_Gold_import.png | 2024-08-13 17:15 | 157K | |
| North_British_2011_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:15 | 108K | |
| North_British_Batch_10_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:15 | 149K | |
| Northern_Highland_14-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:15 | 115K | |
| NotSubscribed.png | 2024-08-13 17:15 | 848K | |
| NotSubscribedRetail.png | 2024-08-13 17:15 | 615K | |
| Nulu_08-year-old_import.png | 2024-08-13 17:15 | 149K | |
| Nulu_2018_import.png | 2024-08-13 17:15 | 158K | |
| O.K.I._06-year-old_Repeal_Day_-_Act_1_import.png | 2024-08-13 17:15 | 88K | |
| O.K.I._06-year-old_Repeal_Day_-_Act_III_import.png | 2024-08-13 17:15 | 88K | |
| O.K.I._06-year-old_Repeal_Day_-_Act_II_import.png | 2024-08-13 17:15 | 87K | |
| OIP.jpg | 2024-08-13 17:15 | 41K | |
| Oban 18.jpg | 2024-08-13 17:15 | 66K | |
| Oban_11-year-old_-_The_Soul_of_Calypso_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:15 | 101K | |
| Oban_11-year-old_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:15 | 82K | |
| Oban_Distillery_Exclusive_Bottling_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:15 | 76K | |
| Oban_Young_Teddy_The_Macleans_import.png | 2024-08-13 17:15 | 112K | |
| Octain_Whisky_Single_Malt_-_Single_Cask_import.png | 2024-08-13 17:15 | 134K | |
| Octolotte_08-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:15 | 130K | |
| Octomore_10-year-old_BW_A_Dream_of_Scotland_-_Holly_Islay_Christmas_import.png | 2024-08-13 17:15 | 371K | |
| Octomore_2011_Df_Jim_McEwan_Signature_Collection_6.3_import.png | 2024-08-13 17:15 | 154K | |
| Octomore_2012_Octomore_Farm_import.png | 2024-08-13 17:15 | 107K | |
| Octomore_2014_Df_Jim_McEwan_Signature_Collection_7_import.png | 2024-08-13 17:15 | 141K | |
| Oerfrysk_2020_import.png | 2024-08-13 17:15 | 141K | |
| Ogham_07-year-old_OIW_import.png | 2024-08-13 17:15 | 161K | |
| Ogham_07-year-old_Release_No.2_import.png | 2024-08-13 17:15 | 130K | |
| Oishii_Gurein_Wisukii_35-Year-Old_HI_Delicious_Grain_Whisky_import.png | 2024-08-13 17:15 | 107K | |
| Old Ezra 101.jpg | 2024-08-13 17:15 | 46K | |
| Old Grand Dad 100 Bottled in Bond.jpg | 2024-08-13 17:15 | 89K | |
| Old Pulteney 12.jpg | 2024-08-13 17:15 | 456K | |
| Old Pulteney 21.jpg | 2024-08-13 17:15 | 25K | |
| Old Pulteney 1990.jpg | 2024-08-13 17:15 | 584K | |
| Old Rip Van Winkle 10 Year.jpg | 2024-08-13 17:15 | 108K | |
| Old_Bones_2012_Reserve_import.png | 2024-08-13 17:15 | 166K | |
| Old_Buck_2019_import.png | 2024-08-13 17:15 | 103K | |
| Old_Castle_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:15 | 97K | |
| Old_Cock_Single_Cask_import.png | 2024-08-13 17:15 | 131K | |
| Old_Comber_Blended_Irish_Whiskey_import.png | 2024-08-13 17:15 | 128K | |
| Old_Forester_Single_Barrel_Barrel_Strength_import.png | 2024-08-13 17:15 | 109K | |
| Old_Kempton_2021_Small_Cask_import.png | 2024-08-13 17:15 | 184K | |
| Old_Kempton_Fortified_Shiraz_Cask_import.png | 2024-08-13 17:15 | 182K | |
| Old_Midleton_Private_Bottling_Munich - Copy.png | 2024-08-13 17:15 | 119K | |
| Old_Midleton_Private_Bottling_Munich.png | 2024-08-13 17:15 | 119K | |
| Old_Orkney_2004_DeDr_import.png | 2024-08-13 17:15 | 105K | |
| Old_Orkney_2009_DeDr_import.png | 2024-08-13 17:15 | 106K | |
| Old_Perth_Blended_Malt_Scotch_Whisky_MSWD_Palo_Cortado_import.png | 2024-08-13 17:15 | 108K | |
| Old_Pulteney_12-year-old_The_Maritime_Malt_import.png | 2024-08-13 17:15 | 140K | |
| Old_Pulteney_13-year-old_Traveller’s_Exclusive_import.png | 2024-08-13 17:15 | 137K | |
| Old_Pulteney_2006_Distillery_Hand_Bottling_import.png | 2024-08-13 17:15 | 254K | |
| Old_Pulteney_2007_Distillery_Hand_Bottling_import.png | 2024-08-13 17:15 | 133K | |
| Old_Pulteney_2007_WroE_Warehouse_Reserve_import.png | 2024-08-13 17:15 | 89K | |
| Old_Pulteney_2010_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:15 | 139K | |
| Old_Pulteney_2010_Single_Cask_import.png | 2024-08-13 17:15 | 140K | |
| Old_Pulteney_2011_HB_Single_Cask_import.png | 2024-08-13 17:15 | 100K | |
| Old_Pulteney_2011_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:15 | 106K | |
| Old_Pulteney_2012_Single_Cask_import.png | 2024-08-13 17:15 | 138K | |
| Old_Pulteney_Distillery_Exclusive_French_Oak_Cask_Matured_import.png | 2024-08-13 17:15 | 144K | |
| Old_Pulteney_Port_Coastal_Series_import.png | 2024-08-13 17:15 | 132K | |
| Old_Raven_05-year-old_Smoky_Devil_import.png | 2024-08-13 17:15 | 133K | |
| Old_Raven_08-year-old_Hand_filled_at_the_distillery_import.png | 2024-08-13 17:15 | 106K | |
| Old_Raven_2016_Hand-filled_at_the_distillery_import.png | 2024-08-13 17:15 | 102K | |
| Old_Raven_2017_UD_Attack_of_the_Super_Awesome_Laser_Flippers_import.png | 2024-08-13 17:15 | 109K | |
| Old_Well_2017_Blue_Life_Edition_import.png | 2024-08-13 17:15 | 140K | |
| Old_Well_2018_Aingeall_import.png | 2024-08-13 17:15 | 115K | |
| Old_Well_Bohemian_Virgin_Oak_Cask_Finish_Peated_import.png | 2024-08-13 17:15 | 263K | |
| Old_Well_Distillery_exclusive_Distillery_Exclusive_import.png | 2024-08-13 17:15 | 186K | |
| Old_Well_Distillery_only_Distillery_Only_import.png | 2024-08-13 17:15 | 150K | |
| Old_Well_Drunk_cats_go_to_Switzerland_import.png | 2024-08-13 17:15 | 144K | |
| Old_Well_Golden_Rose_import.png | 2024-08-13 17:15 | 131K | |
| Old_Well_Kagor_Cask_Finish_import.png | 2024-08-13 17:15 | 132K | |
| Old_Well_wine_cask_series_import.png | 2024-08-13 17:15 | 120K | |
| Ord_2008_CA_Cadenheads_Club_10th_Anniversary_import.png | 2024-08-13 17:15 | 133K | |
| Orkney_2005_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:15 | 150K | |
| Orkney_2006_DR_Cask_Collection_import.png | 2024-08-13 17:15 | 72K | |
| Orkney_2007_MaUn_Cultural_Series_import.png | 2024-08-13 17:15 | 121K | |
| Orkney_2008_PST_Error_502_Series_import.png | 2024-08-13 17:15 | 81K | |
| Orkney_Islands_1998_BR_German_Retailers_Choice_import.png | 2024-08-13 17:15 | 134K | |
| Orkney_Islands_2003_SpSp_import.png | 2024-08-13 17:15 | 91K | |
| Orkney_Islands_2006_BR_Single_Cask_import.png | 2024-08-13 17:15 | 121K | |
| Orkney_Islands_2008_BR_import.png | 2024-08-13 17:15 | 123K | |
| Orkney_Islands_2012_Cl_Warehouse_No._1_import.png | 2024-08-13 17:15 | 237K | |
| Orma_2013_Limited_Edition_import.png | 2024-08-13 17:15 | 149K | |
| Orma_2013_X_import.png | 2024-08-13 17:15 | 142K | |
| Orma_Bottling_323_Anagram_Edition_import.png | 2024-08-13 17:15 | 128K | |
| Orma_Corvatsch_Edition_import.png | 2024-08-13 17:15 | 133K | |
| Orma_In_Lain_Limited_Edition_import.png | 2024-08-13 17:15 | 147K | |
| Orma_Larix_import.png | 2024-08-13 17:15 | 147K | |
| Orma_Peated_import.png | 2024-08-13 17:15 | 134K | |
| Orma_Tarasp_import.png | 2024-08-13 17:15 | 136K | |
| Orphan Barrel Barterhouse 20.jpg | 2024-08-13 17:15 | 66K | |
| Orphan Barrel Old Blowhard 26.jpg | 2024-08-13 17:15 | 66K | |
| Osuzu_Malt_import.png | 2024-08-13 17:15 | 152K | |
| Ouche_Nanon_2019_Bertha_The_Great_import.png | 2024-08-13 17:15 | 189K | |
| Overaged_Malt_Whisky_12-year-old_MCo_Distilled_in_Scotland_import.png | 2024-08-13 17:15 | 126K | |
| Overaged_Malt_Whisky_Distilled_in_Scotland_MCo_import.png | 2024-08-13 17:15 | 119K | |
| Overeem_Batch_3_TBWC_import.png | 2024-08-13 17:15 | 154K | |
| Owen_2015_Albdinkel-Whisky_import.png | 2024-08-13 17:15 | 150K | |
| Oxford_Rye_Whisky_2017_Summerton_Sipping_Session_2023_import.png | 2024-08-13 17:15 | 113K | |
| Pōkeno_2019_Single_Cask_import.png | 2024-08-13 17:15 | 121K | |
| P1000665.jpg | 2024-08-13 17:15 | 107K | |
| P1050101.jpg | 2024-08-13 17:15 | 176K | |
| P1420800.jpg | 2024-08-13 17:15 | 188K | |
| POWERS_CWS-CASK-3-Personalise02_Merry_Christmas_copy-776x1176.jpg | 2024-08-13 17:15 | 317K | |
| Paddy.jpg | 2024-08-13 17:15 | 474K | |
| Paddy_centenary_7_year_old.png | 2024-08-13 17:15 | 244K | |
| Palatinatus_2017_import.png | 2024-08-13 17:15 | 110K | |
| Pappy Van Winkle Family Reserve Bourbon 15.jpg | 2024-08-13 17:15 | 132K | |
| Pappy_Van_Winkles_15-year-old_Bourbon_Whiskey_-_Family_Reserve_import.png | 2024-08-13 17:15 | 111K | |
| Pappy_Van_Winkles_15-year-old_Family_Reserve_import.png | 2024-08-13 17:15 | 110K | |
| Pappy_Van_Winkles_20-year-old_import.png | 2024-08-13 17:15 | 125K | |
| Pardi_Batch_Spirits_Pardi_Batch_112_Batch_001_import.png | 2024-08-13 17:15 | 111K | |
| Park_Avenue_04-year-old_Stillmens_Select_import.png | 2024-08-13 17:15 | 85K | |
| Parkmore_08-year-old_AcL_Selection_import.png | 2024-08-13 17:15 | 160K | |
| Paul_John_2014_CA_Warehouse_Tasting_import.png | 2024-08-13 17:15 | 152K | |
| Paul_John_Batch_6_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:15 | 278K | |
| Paul_John_Christmas_Edition_2023_import.png | 2024-08-13 17:15 | 93K | |
| Pearse_Genesis_Release_Single_Malt_Irish_Whiskey_import.png | 2024-08-13 17:15 | 137K | |
| Peat_Bog_2010_TWC_import.png | 2024-08-13 17:15 | 119K | |
| Peat_Islay_Blended_Malt_Scotch_Whisky_ElD_Elements_of_Islay_import.png | 2024-08-13 17:15 | 163K | |
| Peated_Highland_2000_CWCL_Watt_Whisky_import.png | 2024-08-13 17:15 | 84K | |
| Peated_Highland_2004_Hhd_import.png | 2024-08-13 17:15 | 89K | |
| Peatside_2011_TWCC_import.png | 2024-08-13 17:15 | 109K | |
| Peerless_Double_Oak_import.png | 2024-08-13 17:15 | 175K | |
| Pemberton_Valley_2014_Single_Malt_&_Single_Cask_import.png | 2024-08-13 17:15 | 205K | |
| Penderyn_12-year-old_Zn09_Samouraï_import.png | 2024-08-13 17:15 | 114K | |
| Penderyn_20-year-old_import.png | 2024-08-13 17:15 | 90K | |
| Penderyn_2015_Distillery_Cask_import.png | 2024-08-13 17:15 | 83K | |
| Penderyn_2018_Single_Cask_import.png | 2024-08-13 17:15 | 162K | |
| Penderyn_2018_import.png | 2024-08-13 17:15 | 75K | |
| Penderyn_Red_Wine_&_Cognac_Small_Batch_Series_import.png | 2024-08-13 17:15 | 74K | |
| Penelope_Bourbon_05-year-old_Toasted_Rye_Series_import.png | 2024-08-13 17:15 | 89K | |
| Penninger_2020_16st_import.png | 2024-08-13 17:15 | 97K | |
| Penninger_2020_First_of_our_own_import.png | 2024-08-13 17:15 | 153K | |
| Perpetuity_Blended_Scotch_Whisky_import.png | 2024-08-13 17:15 | 84K | |
| Pic_2017_SpSw_import.png | 2024-08-13 17:15 | 256K | |
| Pittyvaich_1990_HL_Old_&_Rare_import.png | 2024-08-13 17:15 | 148K | |
| Port_Askaig_08-year-old_ElD_Port_Askaig_import.png | 2024-08-13 17:15 | 94K | |
| Port_Askaig_17-year-old_ElD_import.png | 2024-08-13 17:15 | 108K | |
| Port_Askaig_2014_ElD_Sherry_Cask_Quarter_import.png | 2024-08-13 17:15 | 107K | |
| Port_Askaig_2014_ElD_import.png | 2024-08-13 17:15 | 95K | |
| Port_Askaig_Cask_Strength_ElD_Small_Batch_import.png | 2024-08-13 17:15 | 106K | |
| Port_Askaig_Nouvelle_Vague_Edition_ElD_Limited_Edition_import.png | 2024-08-13 17:15 | 98K | |
| Port_Charlotte_10-year-old_Heavily_Peated_import.png | 2024-08-13 17:15 | 126K | |
| Port_Charlotte_14-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:15 | 111K | |
| Port_Charlotte_18-year-old_Niflheim_-_Private_Cask_import.png | 2024-08-13 17:15 | 98K | |
| Port_Charlotte_21-year-old_Csks_Collective_Series_import.png | 2024-08-13 17:15 | 133K | |
| Port_Charlotte_2001_WhB_Friends_of_Bruichladdich_import.png | 2024-08-13 17:15 | 139K | |
| Port_Charlotte_2003_WSP_Islay_Sponge_-_Part_4_import.png | 2024-08-13 17:15 | 120K | |
| Port_Charlotte_2004_SCSM_import.png | 2024-08-13 17:15 | 115K | |
| Port_Charlotte_2007_RBTW_import.png | 2024-08-13 17:15 | 153K | |
| Port_Charlotte_2011_Df_Jim_McEwan_Signature_Collection_6.2_import.png | 2024-08-13 17:15 | 153K | |
| Port_Charlotte_2012_Df_Jim_McEwan_Signature_Collection_7_import.png | 2024-08-13 17:15 | 140K | |
| Port_Charlotte_2015_MoS_Mr._Hyde_import.png | 2024-08-13 17:15 | 166K | |
| Port_Dundas_1978_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:15 | 128K | |
| Port_Dundas_1995_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:15 | 142K | |
| Port_Dundas_2000_FibW_Permutations_Series_1_import.png | 2024-08-13 17:15 | 124K | |
| Port_Dundas_2000_FibW_import.png | 2024-08-13 17:15 | 154K | |
| Port_Dundas_2000_JE_Sherry_Cask_Finish_import.png | 2024-08-13 17:15 | 98K | |
| Port_Dundas_2000_cQs_import.png | 2024-08-13 17:15 | 91K | |
| Port_Dundas_2006_BNSp_A_Cask_Noir_Production_import.png | 2024-08-13 17:15 | 121K | |
| Port_Dundas_2008_SV_Single_Grain_import.png | 2024-08-13 17:15 | 105K | |
| Port_Dundas_2009_TCah_import.png | 2024-08-13 17:15 | 109K | |
| Port_Ellen_1981_GM_The_Recollection_Series_nr.2_import.png | 2024-08-13 17:15 | 148K | |
| Port_Ellen_1982_DL_Celebrating_75th_Anniversary_import.png | 2024-08-13 17:15 | 129K | |
| Port_Ellen_1982_HL_Eidolon_-_Release_03_import.png | 2024-08-13 17:15 | 154K | |
| Portmagee-NAS-Front-Final.jpg | 2024-08-13 17:15 | 156K | |
| Powers3Swallows.jpg | 2024-08-13 17:15 | 529K | |
| Powers_12-year-old_Johns_Lane_Cask_Strength_-_The_Palace_Bar_Edition_import.png | 2024-08-13 17:15 | 150K | |
| Powers_12-year-old_Johns_Lane_Cask_Strength_import.png | 2024-08-13 17:15 | 143K | |
| Powers_Irish_Rye_Distillery_Bottling_import.png | 2024-08-13 17:15 | 147K | |
| Powers_Irish_Rye_import.png | 2024-08-13 17:15 | 147K | |
| Prádlo_2011_import.png | 2024-08-13 17:15 | 154K | |
| Probably_Orkneys_Finest_2008_DL_Old_Particular_import.png | 2024-08-13 17:15 | 106K | |
| Proof_and_Wood_The_Representative_Barrel_Proof_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:15 | 84K | |
| Puni_Arte_Limited_Edition_04_import.png | 2024-08-13 17:15 | 78K | |
| Puni_Aura_Limited_Edition_03_import.png | 2024-08-13 17:15 | 81K | |
| Puni_Batch_2_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:15 | 268K | |
| Puni_Cubo_import.png | 2024-08-13 17:15 | 68K | |
| Quests_End_Paladin_import.png | 2024-08-13 17:15 | 212K | |
| R.jpg | 2024-08-13 17:15 | 170K | |
| RB-12-1.jpg | 2024-08-13 17:15 | 21K | |
| RB-12.jpg | 2024-08-13 17:15 | 21K | |
| RBSmallBatchBacthDRedstoneAndJulios.jpg | 2024-08-13 17:15 | 776K | |
| Raasay_2018_Clan_MacLeod_exclusive_release_import.png | 2024-08-13 17:15 | 172K | |
| Raasay_2018_Na_Sia_Single_Cask_Series_import.png | 2024-08-13 17:15 | 214K | |
| Raasay_2018_Special_Release_import.png | 2024-08-13 17:15 | 168K | |
| Raasay_2018_WhDr_import.png | 2024-08-13 17:15 | 119K | |
| Raasay_2019_Distillery_Exclusive_import.png | 2024-08-13 17:15 | 175K | |
| Raasay_2019_Na_Sia_Single_Cask_Series_import.png | 2024-08-13 17:15 | 216K | |
| Raasay_2019_Private_Cask_import.png | 2024-08-13 17:15 | 234K | |
| Raasay_2019_import.png | 2024-08-13 17:15 | 242K | |
| Raasay_Dùn_Cana_Sherry_Quarter_Cask_Release_import.png | 2024-08-13 17:15 | 165K | |
| Raasay_Lightly_Peated_R-01.2_import.png | 2024-08-13 17:15 | 167K | |
| Raasay_Lightly_Peated_R-02.2_import.png | 2024-08-13 17:15 | 154K | |
| Raasay_Peated_Sherry_Cask_Distillery_Special_Release_import.png | 2024-08-13 17:15 | 171K | |
| Rangers_(SCO)_Edmiston_House_DL_Malt_Scotch_Whisky_import.png | 2024-08-13 17:15 | 126K | |
| Rebel_2017_Cask_Strength_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:15 | 154K | |
| Rebel_2017_Cask_Strength_Single_Barrel_import.png | 2024-08-13 17:15 | 146K | |
| RedBreast21.jpg | 2024-08-13 17:15 | 371K | |
| Red_Deer_10-year-old_TCaH_Happy_Easter_Edition_import.png | 2024-08-13 17:15 | 148K | |
| Redbreast-12YO-SinglePotStill.jpg | 2024-08-13 17:15 | 21K | |
| Redbreast-Single-Cask-Generic-776x1176.jpg | 2024-08-13 17:15 | 114K | |
| Redbreast_10-year-old_Distillery_Edition_import.png | 2024-08-13 17:15 | 165K | |
| Redbreast_12-year-old_Cask_Strength_import.png | 2024-08-13 17:15 | 126K | |
| Redbreast_16-year-old_Single_Cask_import.png | 2024-08-13 17:15 | 123K | |
| Redbreast_19-year-old_Small_Batch_import.png | 2024-08-13 17:15 | 116K | |
| Redbreast_27-year-old_Dream_Cask_-_Port_to_Port_Edition_import.png | 2024-08-13 17:15 | 155K | |
| Redbreast_Lustau_Edition_The_Iberian_Series_import.png | 2024-08-13 17:15 | 127K | |
| Redbreast_Tawny_Port_Cask_Edition_Iberian_Series_import.png | 2024-08-13 17:15 | 121K | |
| Remarkable_Regional_Malts_The_Asia_Moon_Edition_DL_import.png | 2024-08-13 17:15 | 177K | |
| Rheinfall_2019_Schlossabfüllung_import.png | 2024-08-13 17:15 | 123K | |
| Rhinns_10-year-old_MNC_import.png | 2024-08-13 17:15 | 97K | |
| Rhinns_2011_AI_The_Alba_Trail_import.png | 2024-08-13 17:15 | 111K | |
| Rhinns_2011_Cl_Claxtons_Exclusives_import.png | 2024-08-13 17:15 | 251K | |
| Rhinns_2011_Cl_Warehouse_No._1_import.png | 2024-08-13 17:15 | 262K | |
| Rhinns_2011_SE_Cat_Label_Serie_import.png | 2024-08-13 17:15 | 113K | |
| Rittenhouse Rye 100.jpg | 2024-08-13 17:15 | 272K | |
| Rittenhouse_05-year-old_Private_Single_Barrel_import.png | 2024-08-13 17:15 | 116K | |
| Rock_Island_Rum_Cask_Edition_DL_import.png | 2024-08-13 17:15 | 181K | |
| Rock_Island_Sherry_Edition_14-year-old_DL_Remarkable_Regional_Malts_import.png | 2024-08-13 17:15 | 196K | |
| Rock_Island_Sherry_Edition_14-years-old_DL_Remarkable_Regional_Malts_import.png | 2024-08-13 17:15 | 196K | |
| Rock_Town_2016_BR_import.png | 2024-08-13 17:15 | 121K | |
| Roe_&_Co_Irish_Whiskey_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:15 | 156K | |
| Rogues_Reserve_First_Release_Limited_Edtion_import.png | 2024-08-13 17:15 | 168K | |
| Rose_Valley_2015_Dark_Kiss_import.png | 2024-08-13 17:15 | 160K | |
| Rosebank_21-year-old_SMS_The_Roses_-_Edition_7_import.png | 2024-08-13 17:15 | 113K | |
| Rosebank_1991_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:15 | 153K | |
| Roseisle_12-year-old_The_Origami_Kite_-_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:15 | 90K | |
| Rowan's Creek.jpg | 2024-08-13 17:15 | 1.0M | |
| Royal_Brackla_11-year-old_CA_Original_Collection_import.png | 2024-08-13 17:15 | 146K | |
| Royal_Brackla_14-year-old_FibW_Spirit_of_Alba_import.png | 2024-08-13 17:15 | 179K | |
| Royal_Brackla_2000_Exceptional_Cask_import.png | 2024-08-13 17:15 | 244K | |
| Royal_Brackla_2008_DR_Cask_Collection_import.png | 2024-08-13 17:15 | 97K | |
| Royal_Brackla_2008_FibW_Permutations_Series_1_import.png | 2024-08-13 17:15 | 123K | |
| Royal_Brackla_2008_HI_Maggies_Collection_import.png | 2024-08-13 17:15 | 104K | |
| Royal_Brackla_2008_MW_Inspiring_Friends_import.png | 2024-08-13 17:15 | 100K | |
| Royal_Brackla_2008_SS_Silver_Seal_Young_import.png | 2024-08-13 17:15 | 190K | |
| Royal_Brackla_2008_vW_The_Ultimate_-_Cask_Strength_import.png | 2024-08-13 17:15 | 115K | |
| Royal_Brackla_2009_BR_Single_Cask_import.png | 2024-08-13 17:15 | 128K | |
| Royal_Brackla_2009_ED_The_First_Editions_import.png | 2024-08-13 17:15 | 229K | |
| Royal_Brackla_2009_HL_The_First_Editions_import.png | 2024-08-13 17:15 | 114K | |
| Royal_Brackla_2011_DMor_import.png | 2024-08-13 17:15 | 101K | |
| Royal_Brackla_2011_DT_The_Octave_import.png | 2024-08-13 17:15 | 100K | |
| Royal_Brackla_2011_DoV_Private_Cellar_Cask_import.png | 2024-08-13 17:15 | 269K | |
| Royal_Brackla_2011_LsD_Hepburns_Choice_import.png | 2024-08-13 17:15 | 253K | |
| Royal_Brackla_2011_OXH_import.png | 2024-08-13 17:15 | 130K | |
| Royal_Brackla_2011_Orc_import.png | 2024-08-13 17:15 | 85K | |
| Royal_Brackla_2011_TWA_import.png | 2024-08-13 17:15 | 107K | |
| Royal_Brackla_2013_JE_Small_Batch_import.png | 2024-08-13 17:15 | 122K | |
| Royal_Brackla_2013_JE_import.png | 2024-08-13 17:15 | 94K | |
| Royal_Lochnagar_2008_Hand_Filled_import.png | 2024-08-13 17:15 | 114K | |
| Royal_Salute_21-year-old_The_Jodhpur_Polo_Edition_import.png | 2024-08-13 17:15 | 139K | |
| Royal_Salute_21-year-old_The_Lunar_New_Year_Special_Edition_import.png | 2024-08-13 17:15 | 175K | |
| Royal_Salute_21-year-old_The_Richard_Quinn_Edition_II_import.png | 2024-08-13 17:15 | 164K | |
| Royal_Salute_23-year-old_import.png | 2024-08-13 17:15 | 161K | |
| Royal_Salute_The_Coronation_of_King_Charles_III_Edition_import.png | 2024-08-13 17:15 | 182K | |
| Ruadh_Maor_12-year-old_DMor_import.png | 2024-08-13 17:15 | 102K | |
| Ruadh_Maor_2010_MBl_import.png | 2024-08-13 17:15 | 210K | |
| Ruadh_Maor_2010_WCh_import.png | 2024-08-13 17:15 | 161K | |
| Ruadh_Maor_2011_LotG_import.png | 2024-08-13 17:15 | 236K | |
| Ruadh_Maor_2012_BR_Single_Cask_import.png | 2024-08-13 17:15 | 115K | |
| Ruadh_Maor_2013_WDS_import.png | 2024-08-13 17:15 | 107K | |
| Ruadh_Mhor_2010_DR_Cask_Collection_import.png | 2024-08-13 17:15 | 69K | |
| Ruadh_Mhor_2011_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:15 | 103K | |
| Ruadh_Mhor_2011_TCaH_Special_Release_import.png | 2024-08-13 17:15 | 166K | |
| Ruadh_Mhor_2012_BR_Single_Cask_import.png | 2024-08-13 17:15 | 123K | |
| Ruadh_Moar_2010_SpSw_import.png | 2024-08-13 17:15 | 89K | |
| Rugenbräu_2012_Swiss_Mountain_-_Ice_Label_-_Edition_2023_import.png | 2024-08-13 17:15 | 155K | |
| Rugenbräu_2017_Master_Distiller_-_Tropenhaus_Edition_III_import.png | 2024-08-13 17:15 | 105K | |
| Rugenbräu_2017_Master_Distiller_-_Tropenhaus_Edition_II_import.png | 2024-08-13 17:15 | 117K | |
| Rumours_2008_UWC_Chapter_Three_import.png | 2024-08-13 17:15 | 145K | |
| Russell's Reserve 10.jpg | 2024-08-13 17:15 | 119K | |
| Russells_Reserve_13-year-old_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:15 | 150K | |
| Russells_Reserve_2013_Private_Barrel_Selection_import.png | 2024-08-13 17:15 | 146K | |
| Russells_Reserve_2013_Single_Barrel_-_Private_Barrel_Selection_import.png | 2024-08-13 17:15 | 151K | |
| Russells_Reserve_Single_Barrel_Private_Barrel_Selection_import.png | 2024-08-13 17:15 | 152K | |
| Ruvaal_2015_WW8_Das_Vatertagsfass_2022_import.png | 2024-08-13 17:15 | 121K | |
| Ruvaal_2015_WW8_import.png | 2024-08-13 17:15 | 127K | |
| Rye_Single_Rye_Whisky_deuW_Batch_3_import.png | 2024-08-13 17:15 | 142K | |
| Ryuka_New_Born_import.png | 2024-08-13 17:15 | 92K | |
| Säntis_Malt_07-year-old_Single_Cask_Exploration_-_Pinot_Noir_import.png | 2024-08-13 17:16 | 125K | |
| Säntis_Malt_08-year-old_Single_Cask_Exploration_-_Rum_Cask_import.png | 2024-08-13 17:16 | 154K | |
| Säntis_Malt_12-year-old_Single_Cask_Exploration_-_Beer_&_Monbazillac_import.png | 2024-08-13 17:16 | 154K | |
| Säntis_Malt_2018_TWTC_Presidents_Choice_import.png | 2024-08-13 17:16 | 108K | |
| Säntis_Malt_Edition_Genesis_No._4_import.png | 2024-08-13 17:16 | 129K | |
| Säntis_Malt_Single_Cask_Exploration_Fleeting_&_Rare_import.png | 2024-08-13 17:16 | 135K | |
| Säntis_Malt_Snow_White_No.11_Limited_Winter_Edition_import.png | 2024-08-13 17:16 | 158K | |
| Säntis_Malt_Triple_Cask_Annual_Special_Release_import.png | 2024-08-13 17:16 | 168K | |
| Säntis_Malt_Whiskytrek_Edition_Bollenwees_import.png | 2024-08-13 17:16 | 151K | |
| Säntis_Malt_Whiskytrek_Edition_Plattenbödeli_import.png | 2024-08-13 17:16 | 162K | |
| Séquoia_10.23_import.png | 2024-08-13 17:16 | 140K | |
| Séquoia_Signature_import.png | 2024-08-13 17:16 | 142K | |
| Séquoia_Tourbé_Réserve_import.png | 2024-08-13 17:16 | 214K | |
| SPEY_Trutinā_Cask_Strength_-_Limited_Edition_import.png | 2024-08-13 17:16 | 217K | |
| Saburomaru_2019_import.png | 2024-08-13 17:15 | 328K | |
| Sagamore_Spirit_07-year-old_Single_Barrel_Vintage_import.png | 2024-08-13 17:15 | 136K | |
| Saillt_Mór_2013_cQs_import.png | 2024-08-13 17:15 | 133K | |
| Saillt_Mór_2014_Single_Malt_import.png | 2024-08-13 17:15 | 131K | |
| Saillt_Mór_2014_cQs_import.png | 2024-08-13 17:15 | 151K | |
| Saillt_Mór_2014_import.png | 2024-08-13 17:15 | 133K | |
| Saillt_Mór_2015_Bourbon_Peated_import.png | 2024-08-13 17:15 | 141K | |
| Saillt_Mór_2015_import.png | 2024-08-13 17:15 | 133K | |
| Saint_&_Peat_Heavily_Peated_vW_Islay_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:15 | 113K | |
| Saint_Brandarius_2016_IoS_Oloroso_Pedro_Ximénez_import.png | 2024-08-13 17:15 | 147K | |
| Saint_Brandarius_Harlingen-Terschelling_Roeirace_2023_IoS_Limited_Edition_import.png | 2024-08-13 17:15 | 153K | |
| Sakurao_2019_Limited_Edition_Single_Cask_import.png | 2024-08-13 17:15 | 111K | |
| Sall_Whisky_03-year-old_Shared_Cask_#13_import.png | 2024-08-13 17:15 | 199K | |
| Sall_Whisky_First_Ex-Oloroso_Cask_Release_import.png | 2024-08-13 17:15 | 92K | |
| Sall_Whisky_First_Peated_Release_import.png | 2024-08-13 17:15 | 100K | |
| San_Diego_Distillery_Straight_Bourbon_Whiskey_Cali_Gold_import.png | 2024-08-13 17:15 | 168K | |
| Santa_Fe_04-year-old_TBWC_World_of_Smoke_import.png | 2024-08-13 17:15 | 296K | |
| Sazerac 18.jpg | 2024-08-13 17:15 | 114K | |
| Sazerac_Straight_Rye_Whiskey_import.png | 2024-08-13 17:15 | 103K | |
| Scallywag_2023_DL_Scallywags_Adventure_Series_-_Highlander_Inn_Edition_import.png | 2024-08-13 17:15 | 175K | |
| Scallywag_Easter_Edition_2023_DL_Scallywags_Adventure_Series_import.png | 2024-08-13 17:15 | 171K | |
| Scallywag_The_Alberta_Edition_DL_import.png | 2024-08-13 17:15 | 162K | |
| Scallywag_The_Chocolate_Edition_DL_Limited_Edition_import.png | 2024-08-13 17:15 | 146K | |
| Scallywag_The_Korean_Baseball_Edition_DL_import.png | 2024-08-13 17:15 | 163K | |
| Scallywag_The_Winter_Edition_DL_Remarkable_Regional_Malts_import.png | 2024-08-13 17:15 | 160K | |
| Scallywag_White_DL_The_Ghost_Festival_Edition_import.png | 2024-08-13 17:15 | 146K | |
| Scapa 16.jpg | 2024-08-13 17:15 | 23K | |
| Scapa_1993_Vintage_Edition_import.png | 2024-08-13 17:15 | 88K | |
| Scapa_2008_Distillery_Exclusive_import.png | 2024-08-13 17:15 | 91K | |
| Scapa_2012_Single_Cask_Edition_import.png | 2024-08-13 17:15 | 151K | |
| Scapa_2014_The_Distillery_Reserve_Collection_import.png | 2024-08-13 17:15 | 145K | |
| Scotch_Universe_Ganymed_IV_-_121°_U.7.1_1881.4_import.png | 2024-08-13 17:15 | 134K | |
| Scotch_Universe_Hale_Bopp_148°_U.41_1826._import.png | 2024-08-13 17:15 | 142K | |
| Scotch_Universe_Mothership_II_-_151°_U.2.1_1824.1_import.png | 2024-08-13 17:15 | 154K | |
| Scotch_Universe_Omega_Nebula_II_-_134°_U.4.1_1965.1_import.png | 2024-08-13 17:15 | 134K | |
| Scotch_Universe_Titania_II_-_150°_U.2.1_1958.2_import.png | 2024-08-13 17:15 | 154K | |
| Scotch_Universe_Virgo_II_-_136°_P.4.1_1874.1_import.png | 2024-08-13 17:15 | 144K | |
| Screen Shot 2021-11-01 at 1.56.57 PM.png | 2024-08-13 17:15 | 81K | |
| Screenshot 2022-11-27 215439.png | 2024-08-13 17:15 | 250K | |
| Scriptor_Whisky-Spring-Edition_2023_import.png | 2024-08-13 17:15 | 115K | |
| Sculte_2018_Triple_Oak_-_peated_import.png | 2024-08-13 17:15 | 112K | |
| Sculte_2019_-_Twentse_Whisky_import.png | 2024-08-13 17:15 | 135K | |
| Sculte_2020_-_Twentse_Whisky_Peated_4_import.png | 2024-08-13 17:15 | 140K | |
| Sculte_Twentse_Whisky_-_Refill_Special_Limited_Edition_2MB_Recipe_One_import.png | 2024-08-13 17:15 | 141K | |
| Seagram's Seven Crown.jpg | 2024-08-13 17:16 | 66K | |
| Seaweed_&_Aeons_&_Digging_&_Fire_10-year-old_MoM_Islay_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:16 | 87K | |
| Seaweed_&_Aeons_&_Digging_&_Fire_18-year-old_MoM_Highland_Single_Malt_Scotch_Whisky_import.png | 2024-08-13 17:16 | 88K | |
| Secret_Grain_1986_TSA_The_Alchemists_Chronicles_-_Secret_Chapter_of_the_Dark_Alchemist_import.png | 2024-08-13 17:16 | 195K | |
| Secret_Highland_1978_TR_import.png | 2024-08-13 17:16 | 103K | |
| Secret_Highland_2008_LT_Sutherland_import.png | 2024-08-13 17:16 | 111K | |
| Secret_Highland_2010_JCWS_26th_Release_import.png | 2024-08-13 17:16 | 102K | |
| Secret_Highland_2013_WJ_Art_Edition_No._8_import.png | 2024-08-13 17:16 | 139K | |
| Secret_Highland_Distillery_2008_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:16 | 133K | |
| Secret_Highland_Single_Malt_Whisky_2010_WD_20th_Anniversary_import.png | 2024-08-13 17:16 | 109K | |
| Secret_Irish_Distillery_1990_Sb_White_Label_import.png | 2024-08-13 17:16 | 114K | |
| Secret_Islay_06-year-old_MNC_Sherry_Christmas_import.png | 2024-08-13 17:16 | 116K | |
| Secret_Islay_08-year-old_HeaS_Hand_Filled_import.png | 2024-08-13 17:16 | 133K | |
| Secret_Islay_2007_MBl_The_Maltman_import.png | 2024-08-13 17:16 | 226K | |
| Secret_Islay_2007_TFM_Shores_of_Scotland_import.png | 2024-08-13 17:16 | 105K | |
| Secret_Islay_2008_WN_import.png | 2024-08-13 17:16 | 94K | |
| Secret_Islay_2009_AdF_10th_Anniversary_Serie_import.png | 2024-08-13 17:16 | 104K | |
| Secret_Islay_2009_Arc_Birds_from_the_Orient_import.png | 2024-08-13 17:16 | 102K | |
| Secret_Islay_2017_JB_Gifted_Stills_of_Scotland_import.png | 2024-08-13 17:16 | 104K | |
| Secret_Islay_2019_EVWC_import.png | 2024-08-13 17:16 | 131K | |
| Secret_Islay_Distillery_2009_Sb_Finest_Whisky_Berlin_import.png | 2024-08-13 17:16 | 134K | |
| Secret_Islay_Distillery_2011_MaUn_Cultural_Series_import.png | 2024-08-13 17:16 | 116K | |
| Secret_Islay_Distillery_2012_MoM_Masters_Of_Malt_Branded_import.png | 2024-08-13 17:16 | 107K | |
| Secret_Orkney_2005_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:16 | 169K | |
| Secret_Orkney_2005_SV_Single_Cask_Seasons_Winter_2022_import.png | 2024-08-13 17:16 | 135K | |
| Secret_Orkney_2006_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 106K | |
| Secret_Orkney_2009_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:16 | 152K | |
| Secret_Orkney_2009_SV_Spirits_of_the_Forest_import.png | 2024-08-13 17:16 | 105K | |
| Secret_Orkney_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 110K | |
| Secret_Orkney_Distillery_2009_TFM_Flowers_import.png | 2024-08-13 17:16 | 110K | |
| Secret_Speyside_18-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:16 | 113K | |
| Secret_Speyside_31-year-old_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:16 | 115K | |
| Secret_Speyside_1993_MBl_The_Maltman_import.png | 2024-08-13 17:16 | 109K | |
| Secret_Speyside_1998_LotG_Rare_Cask_import.png | 2024-08-13 17:16 | 237K | |
| Secret_Speyside_2005_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:16 | 179K | |
| Secret_Speyside_2006_PST_import.png | 2024-08-13 17:16 | 91K | |
| Secret_Speyside_2007_TCaH_The_Deerhound_Collection_import.png | 2024-08-13 17:16 | 108K | |
| Secret_Speyside_2007_TWC_import.png | 2024-08-13 17:16 | 107K | |
| Secret_Speyside_2007_TWTC_Club_Members_Only_import.png | 2024-08-13 17:16 | 96K | |
| Secret_Speyside_2008_Arc_Birds_from_the_Orient_import.png | 2024-08-13 17:16 | 101K | |
| Secret_Speyside_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 112K | |
| Secret_Speyside_2009_SV_Vintage_import.png | 2024-08-13 17:16 | 109K | |
| Secret_Speyside_2009_TcaH_import.png | 2024-08-13 17:16 | 131K | |
| Secret_Speyside_2011_WDM_Monasteria_import.png | 2024-08-13 17:16 | 156K | |
| Secret_Speyside_Distillery_2008_SdS_Arcade_import.png | 2024-08-13 17:16 | 123K | |
| Secret_Speyside_Single_Malt_2009_TCaH_True_Friends_-_Fìor_Charaidean_import.png | 2024-08-13 17:16 | 107K | |
| Secret_Speyside_Single_Malt_2011_PST_import.png | 2024-08-13 17:16 | 97K | |
| Secret_Sutherland_Distillery_2010_SdS_WILD_import.png | 2024-08-13 17:16 | 148K | |
| Secrets_of_Blending_1987_3W_Vol._2_import.png | 2024-08-13 17:16 | 90K | |
| Seven_Seals_The_Age_of_Aries_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 152K | |
| Seven_Seals_The_Age_of_Cancer_Zodiac_Line_import.png | 2024-08-13 17:16 | 167K | |
| Seven_Seals_The_Age_of_Gemini_Zodiac_Line_import.png | 2024-08-13 17:16 | 151K | |
| Seven_Seals_Vinazion_import.png | 2024-08-13 17:16 | 122K | |
| Seven_Sons_2012_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 234K | |
| Sheep Dip.jpg | 2024-08-13 17:16 | 33K | |
| Shenks_Homestead_Kentucky_Sour_Mash_Whiskey_Small_Batch_import.png | 2024-08-13 17:16 | 100K | |
| Shizuoka_2017_Private_Cask_Bottling_import.png | 2024-08-13 17:16 | 237K | |
| Shizuoka_2019_Ghost_Series_import.png | 2024-08-13 17:16 | 128K | |
| Shizuoka_2019_Mecha_Jupiter_import.png | 2024-08-13 17:16 | 122K | |
| Shizuoka_2019_Mecha_Mars_import.png | 2024-08-13 17:16 | 120K | |
| Shizuoka_2019_Mecha_Neptune_import.png | 2024-08-13 17:16 | 122K | |
| Shizuoka_2019_Mecha_Saturn_import.png | 2024-08-13 17:16 | 122K | |
| Shizuoka_2019_Mecha_Sun_import.png | 2024-08-13 17:16 | 119K | |
| Shizuoka_2019_Private_Cask_Bottling_import.png | 2024-08-13 17:16 | 136K | |
| Shizuoka_2019_Private_Cask_import.png | 2024-08-13 17:16 | 108K | |
| Shizuoka_2019_Single_Cask_import.png | 2024-08-13 17:16 | 107K | |
| Shizuoka_2019_Warrior_Series_Edition_1_import.png | 2024-08-13 17:16 | 119K | |
| Shizuoka_2019_Warrior_Series_Edition_2_import.png | 2024-08-13 17:16 | 117K | |
| Shizuoka_2019_Warrior_Series_Edition_3_import.png | 2024-08-13 17:16 | 118K | |
| Shizuoka_2019_Warrior_Series_Edition_4_import.png | 2024-08-13 17:16 | 118K | |
| Shortbarrel_Bourbon_Single_Barrel_Series_import.png | 2024-08-13 17:16 | 158K | |
| Siderit_05-year-old_PX_Cask_Rye_import.png | 2024-08-13 17:16 | 140K | |
| Sild_2018_Eeb_import.png | 2024-08-13 17:16 | 89K | |
| Sild_2018_Flören_import.png | 2024-08-13 17:16 | 107K | |
| Sild_Crannog_Edition_2023_import.png | 2024-08-13 17:16 | 93K | |
| Silver_Grove_04-year-old_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:16 | 88K | |
| Simons_Bavarian_Single_Rye_Whisky_Whisky_is_art_import.png | 2024-08-13 17:16 | 217K | |
| Sin-Gold_2018_Bergwerk_St._Christoph,_Breitenbrunn_Erzgebirge_import.png | 2024-08-13 17:16 | 192K | |
| Sin-Gold_2019_import.png | 2024-08-13 17:16 | 121K | |
| Single_Grain_Scotch_Whisky_2006_3W_import.png | 2024-08-13 17:16 | 88K | |
| Single_Islay_Malt_Whisky_Villa_Carefree_WlRb_import.png | 2024-08-13 17:16 | 140K | |
| Single_Malt_Irish_Whiskey_2002_TWCC_Tree_of_Life_Serie_-_The_Pine_Tree_import.png | 2024-08-13 17:16 | 129K | |
| Single_Malt_Irish_Whiskey_2002_TWCC_Tree_of_Life_Serie_import.png | 2024-08-13 17:16 | 126K | |
| Single_Malt_Scotch_Whisky_08-Year-Old_TBWC_Core_Range_import.png | 2024-08-13 17:16 | 190K | |
| Single_Malt_Scotch_Whisky_09-year-old_SMWS_Bazaar_Berries_-_Small_Batch_import.png | 2024-08-13 17:16 | 126K | |
| Single_Malt_Scotch_Whisky_12-year-old_TBWC_Core_Range_import.png | 2024-08-13 17:16 | 205K | |
| Single_Malt_Scotch_Whisky_18-year-old_TBWC_Core_Range_import.png | 2024-08-13 17:16 | 233K | |
| Single_Malt_Scotch_Whisky_2009_UWC_Smokestack_Lightning_import.png | 2024-08-13 17:16 | 119K | |
| Single_Malt_Scotch_Whisky_BXXXXXXR_2011_NSpS_Modernism_import.png | 2024-08-13 17:16 | 103K | |
| Single_Malt_Scotch_Whisky_Dunnage_Nougat_SMWS_Small_Batch_import.png | 2024-08-13 17:16 | 104K | |
| Single_Malt_Scotch_Whisky_Sherry_Cask_Matured_BR_import.png | 2024-08-13 17:16 | 125K | |
| Single_Malt_Whisky_07-year-old_SaW_import.png | 2024-08-13 17:16 | 133K | |
| Single_Malt_Whisky_12-year-old_MNC_Silk_Road_import.png | 2024-08-13 17:16 | 244K | |
| Single_Malt_Whisky_2017_DrWa_Christmas_Malt_import.png | 2024-08-13 17:16 | 189K | |
| Single_Malt_Whisky_2017_myBar_Pier_Road_import.png | 2024-08-13 17:16 | 125K | |
| Single_Malt_Whisky_2020_myBar_import.png | 2024-08-13 17:16 | 137K | |
| Single_Malt_Whisky_Red_Fantasy_Private_Cask_Edition_import.png | 2024-08-13 17:16 | 124K | |
| Single_Malt_Whisky_Secret_Islay_myBar_Peated_import.png | 2024-08-13 17:16 | 130K | |
| Skånska_Spritfabriken_07-year-old_Resenär_import.png | 2024-08-13 17:16 | 167K | |
| Slyrs_12-year-old_Rum_Cask_Finish_-_Edition_2011_import.png | 2024-08-13 17:16 | 162K | |
| Slyrs_18-year-old_The_First_import.png | 2024-08-13 17:16 | 160K | |
| Slyrs_2014_Single_Cask_import.png | 2024-08-13 17:16 | 164K | |
| Slyrs_2015_Lakeside_Edition_2023_import.png | 2024-08-13 17:16 | 184K | |
| Slyrs_2017_Whisky.de_import.png | 2024-08-13 17:16 | 163K | |
| Slyrs_2018_Single_Cask_import.png | 2024-08-13 17:16 | 171K | |
| Slyrs_2018_Spitalkeller_-_Handfilled_import.png | 2024-08-13 17:16 | 151K | |
| Slyrs_Distillers_Choice_Maibock_Beer_Cask_import.png | 2024-08-13 17:16 | 164K | |
| Slyrs_Mountain_Edition_Jägerkamp_import.png | 2024-08-13 17:16 | 169K | |
| Slyrs_Mountain_Edition_Stümpfling_1501_import.png | 2024-08-13 17:16 | 170K | |
| Slyrs_Oktoberfest_Edition_2023_import.png | 2024-08-13 17:16 | 160K | |
| Slyrs_Single_Malt_Port_Cask_Finish_import.png | 2024-08-13 17:16 | 172K | |
| Slyrs_Tequila_Cask_Single_Cask_import.png | 2024-08-13 17:16 | 154K | |
| Slyrs_Walhalla_of_Whisky_Welcome_Edition_2023_import.png | 2024-08-13 17:16 | 154K | |
| Smögen_90_Proof_import.png | 2024-08-13 17:16 | 130K | |
| Smögen_100_Proof_Sherry_Quarter_Casks_import.png | 2024-08-13 17:16 | 131K | |
| Smögen_2012_SE_Cask_Owners_Club_import.png | 2024-08-13 17:16 | 111K | |
| Smögen_2012_import.png | 2024-08-13 17:16 | 133K | |
| Smögen_2013_Dr._Jekylls_Nordic_Series_import.png | 2024-08-13 17:16 | 137K | |
| Smögen_2013_SE_The_Guardians_of_Smögen_import.png | 2024-08-13 17:16 | 105K | |
| Smögen_2013_Single_Cask_import.png | 2024-08-13 17:16 | 140K | |
| Smögen_2014_DRFS_Wu_Dram_Clan_Lighthouse_Series_import.png | 2024-08-13 17:16 | 108K | |
| Smögen_2014_Single_Cask_import.png | 2024-08-13 17:16 | 130K | |
| Smögen_2015_Privatbuteljerad_import.png | 2024-08-13 17:16 | 140K | |
| Smögen_2017_Privatbuteljerad_import.png | 2024-08-13 17:16 | 147K | |
| Small_Brook_2020_Gruppenabfüllung_2_import.png | 2024-08-13 17:16 | 123K | |
| Small_Brook_2020_Rum_import.png | 2024-08-13 17:16 | 122K | |
| Smoke_Wagon_Straight_Rye_Whiskey_Malted_Rye_Whiskey_import.png | 2024-08-13 17:16 | 114K | |
| Smoke_Wagon_Uncut_Unfiltered_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:16 | 118K | |
| Smooth Ambler Old Scout Bourbon 7 Year.jpg | 2024-08-13 17:16 | 28K | |
| Smooth Ambler Old Scout Rye 7 Year.jpg | 2024-08-13 17:16 | 29K | |
| Sons_of_Vancouver_Summer_Road_Trip_Across_the_Midwest_Release_#4_import.png | 2024-08-13 17:16 | 87K | |
| South_Islay_Single_Malt_12-year-old_BW_A_Dream_of_Scotland_-_Demons_&_Ghosts_import.png | 2024-08-13 17:16 | 195K | |
| South_Islay_Single_Malt_15-year-old_BW_A_Dream_of_Scotland_-_The_Sweet_One_import.png | 2024-08-13 17:16 | 119K | |
| South_Islay_Single_Malt_21-year-old_BW_A_Dream_of_Scotland_-_X-Mas_Malt_import.png | 2024-08-13 17:16 | 420K | |
| South_Islay_Single_Malt_2010_BW_A_Dream_of_Scotland_import.png | 2024-08-13 17:16 | 120K | |
| South_Islay_Single_Malt_2011_BW_A_Dream_of_Scotland_-_Demons_&_Ghosts_import.png | 2024-08-13 17:16 | 124K | |
| Special_Islay_Malt_1991_AC_Rare_&_Old_Selection_import.png | 2024-08-13 17:16 | 115K | |
| Special_Islay_Malt_2011_AC_Special_Vintage_Selection_import.png | 2024-08-13 17:16 | 118K | |
| Special_Vatting_12-year-old_MCo_import.png | 2024-08-13 17:16 | 117K | |
| Speybridge_2011_WM_Barrel_Selection_import.png | 2024-08-13 17:16 | 111K | |
| Speyburn 10.jpg | 2024-08-13 17:16 | 28K | |
| Speyburn_2007_import.png | 2024-08-13 17:16 | 108K | |
| Speyburn_2008_GM_Connoisseurs_Choice_-_Cask_Strength_import.png | 2024-08-13 17:16 | 130K | |
| Speyside_#1_TBWC_Advent_2023_Exclusive_import.png | 2024-08-13 17:16 | 200K | |
| Speyside_(M)_2005_SV_Cask_Strength_Collection_import.png | 2024-08-13 17:16 | 158K | |
| Speyside_(M)_2005_SV_import.png | 2024-08-13 17:16 | 171K | |
| Speyside_Blended_Malt_Scotch_Whisky_12-year-old_MDB_The_Cask_Collaboration_Series_import.png | 2024-08-13 17:16 | 146K | |
| Speyside_Blended_Malt_Scotch_Whisky_1989_ADWC_import.png | 2024-08-13 17:16 | 154K | |
| Speyside_Distillery_1994_Cl_Warehouse_No._8_import.png | 2024-08-13 17:16 | 265K | |
| Speyside_Distillery_2014_DMor_import.png | 2024-08-13 17:16 | 103K | |
| Speyside_Finest_1967_DL_XOP_-_Xtra_Old_Particular_import.png | 2024-08-13 17:16 | 128K | |
| Speyside_Hero_2009_WCh_Vol._VI_import.png | 2024-08-13 17:16 | 159K | |
| Speyside_Region_1993_The_Clans_Label_import.png | 2024-08-13 17:16 | 131K | |
| Speyside_Single_Malt_2015_BiM_import.png | 2024-08-13 17:16 | 107K | |
| Speyside_Single_Malt_Scotch_Whisky_1998_PST_import.png | 2024-08-13 17:16 | 105K | |
| Speyside_Single_Malt_Scotch_Whisky_2009_PST_Error_502_Series_import.png | 2024-08-13 17:16 | 84K | |
| Speyside_Single_Malt_Scotch_Whisky_2011_EMcI_Taibhse_Cask_import.png | 2024-08-13 17:16 | 95K | |
| Spirale_MCo_Chapter_IV_import.png | 2024-08-13 17:16 | 107K | |
| Spiris_2017_SpSw_import.png | 2024-08-13 17:16 | 259K | |
| Spirit_of_Nauen_2015_Distillery_Bottling_import.png | 2024-08-13 17:16 | 186K | |
| Spirit_of_Nauen_2015_import.png | 2024-08-13 17:16 | 186K | |
| Spirit_of_Sahti_Single_Cask_Whisky_import.png | 2024-08-13 17:16 | 196K | |
| Spirit_of_Speyside_Whisky_Festival_2023_Spirit_of_Speyside_Whisky_Festival_import.png | 2024-08-13 17:16 | 95K | |
| Spirit_of_Yorkshire_Distillery_2017_BR_import.png | 2024-08-13 17:16 | 119K | |
| Spring_Bay_2017_The_Rheban_-_Cask_Strength_import.png | 2024-08-13 17:16 | 149K | |
| Spring_Mill_Traditional_Straight_Whisky_import.png | 2024-08-13 17:16 | 134K | |
| Springbank 10.jpg | 2024-08-13 17:16 | 19K | |
| Springbank 10 100 Proof.jpg | 2024-08-13 17:16 | 161K | |
| Springbank 12 Calvados Wood.jpg | 2024-08-13 17:16 | 91K | |
| Springbank 12 Cask Strength.jpg | 2024-08-13 17:16 | 108K | |
| Springbank CV.jpg | 2024-08-13 17:16 | 362K | |
| Springbank_10-year-old_Sherry_Wood_import.png | 2024-08-13 17:16 | 127K | |
| Springbank_11-year-old_CA_Original_Collection_import.png | 2024-08-13 17:16 | 141K | |
| Springbank_12-year-old_Cask_Strength_import.png | 2024-08-13 17:16 | 128K | |
| Springbank_13-year-old_Local_Barley_import.png | 2024-08-13 17:16 | 229K | |
| Springbank_20-year-old_The_Limburg_Dozen_import.png | 2024-08-13 17:16 | 134K | |
| Springbank_21-year-old_import.png | 2024-08-13 17:16 | 122K | |
| Springbank_24-year-old_Open_Day_2023_import.png | 2024-08-13 17:16 | 99K | |
| Springbank_27-year-old_Countdown_Collection_import.png | 2024-08-13 17:16 | 140K | |
| Springbank_30-year-old_Limited_Release_import.png | 2024-08-13 17:16 | 122K | |
| Springbank_1992_Coronation_Year_-_Private_Bottling_import.png | 2024-08-13 17:16 | 115K | |
| Springbank_1993_Csks_Collective_Series_import.png | 2024-08-13 17:16 | 146K | |
| Springbank_1993_MW_Inspiring_Friends_import.png | 2024-08-13 17:16 | 103K | |
| Springbank_1993_MoM_import.png | 2024-08-13 17:16 | 94K | |
| Springbank_1993_RM_import.png | 2024-08-13 17:16 | 119K | |
| Springbank_1995_BA_Blackadder_Statement_Edition_No._60_import.png | 2024-08-13 17:16 | 103K | |
| Springbank_1996_RW101_JJ_Adams_Mouse_Fight_import.png | 2024-08-13 17:16 | 143K | |
| Springbank_1996_WSP_Special_Edition_import.png | 2024-08-13 17:16 | 108K | |
| Springbank_1997_CA_Authentic_Collection_import.png | 2024-08-13 17:16 | 131K | |
| Springbank_1998_Private_Bottling_import.png | 2024-08-13 17:16 | 119K | |
| Springbank_1998_Starkicker_import.png | 2024-08-13 17:16 | 119K | |
| Springbank_2002_import.png | 2024-08-13 17:16 | 149K | |
| Springbank_2009_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:16 | 92K | |
| Springbank_2011_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:16 | 94K | |
| Springbank_2013_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:16 | 90K | |
| Springbank_2016_Duty_Paid_Sample_-_For_Trade_Purposes_Only_import.png | 2024-08-13 17:16 | 91K | |
| Springbank_2017_Society_Bottling_import.png | 2024-08-13 17:16 | 104K | |
| Springbank_Barley_to_Bottle_Tour_2023_import.png | 2024-08-13 17:16 | 129K | |
| Springbank_Batch_28_TBWC_import.png | 2024-08-13 17:16 | 150K | |
| Springbank_Batch_29_TBWC_TBWC_At_The_Movies_import.png | 2024-08-13 17:16 | 136K | |
| Springbank_Distillery_Visitors_2023_Private_Bottling_import.png | 2024-08-13 17:16 | 151K | |
| Springbank_Hand_Filled_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 200K | |
| Springbank_Whisky_School_2023_import.png | 2024-08-13 17:16 | 119K | |
| Squaremountains_2020_Peated_import.png | 2024-08-13 17:16 | 135K | |
| St._Kilian_05-year-old_TSA_I_Am_Root,_too!_import.png | 2024-08-13 17:16 | 202K | |
| St._Kilian_2016_import.png | 2024-08-13 17:16 | 120K | |
| St._Kilian_2017_Distillery_Only_import.png | 2024-08-13 17:16 | 111K | |
| St._Kilian_2017_Dram_Talk_Frankfurt_Chapter_One_import.png | 2024-08-13 17:16 | 117K | |
| St._Kilian_2017_Friendly_Mr._Z_Bunker_Choice_No._1_import.png | 2024-08-13 17:16 | 123K | |
| St._Kilian_2017_Frohe_Weihnachten_-_Winter_Edition_import.png | 2024-08-13 17:16 | 109K | |
| St._Kilian_2017_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 132K | |
| St._Kilian_2017_Handfilled_import.png | 2024-08-13 17:16 | 121K | |
| St._Kilian_2017_Private_Cask_import.png | 2024-08-13 17:16 | 112K | |
| St._Kilian_2017_import.png | 2024-08-13 17:16 | 125K | |
| St._Kilian_2018_Ambassadors_choice_No.7_import.png | 2024-08-13 17:16 | 123K | |
| St._Kilian_2018_BiM_import.png | 2024-08-13 17:16 | 132K | |
| St._Kilian_2018_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 126K | |
| St._Kilian_2018_Handfilled_import.png | 2024-08-13 17:16 | 127K | |
| St._Kilian_2018_Holy_Apple_import.png | 2024-08-13 17:16 | 131K | |
| St._Kilian_2018_Special_Bottling_import.png | 2024-08-13 17:16 | 105K | |
| St._Kilian_2018_St._Kilian_Messeabfüllung_import.png | 2024-08-13 17:16 | 139K | |
| St._Kilian_2018_Whiskyburg_Wittlich_Handfilled_No._2_import.png | 2024-08-13 17:16 | 128K | |
| St._Kilian_2018_import.png | 2024-08-13 17:16 | 113K | |
| St._Kilian_2019_Celtic_Castle_Edition_import.png | 2024-08-13 17:16 | 109K | |
| St._Kilian_2019_Ex_Rotwein_Zweigelt_-_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 139K | |
| St._Kilian_2019_Ex_Rotwein_Zweigelt_-_Handfilled_import.png | 2024-08-13 17:16 | 115K | |
| St._Kilian_2019_Exceptional_Range_import.png | 2024-08-13 17:16 | 123K | |
| St._Kilian_2019_Fassstärke_import.png | 2024-08-13 17:16 | 116K | |
| St._Kilian_2019_Hand_Filled_-_Distillery_Only_import.png | 2024-08-13 17:16 | 122K | |
| St._Kilian_2019_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 110K | |
| St._Kilian_2019_Handfilled_import.png | 2024-08-13 17:16 | 135K | |
| St._Kilian_2019_Limited_Edition_2023_import.png | 2024-08-13 17:16 | 121K | |
| St._Kilian_2019_Private_Cask_import.png | 2024-08-13 17:16 | 127K | |
| St._Kilian_2019_TWJ_import.png | 2024-08-13 17:16 | 107K | |
| St._Kilian_2019_Tarona_import.png | 2024-08-13 17:16 | 103K | |
| St._Kilian_2019_Taste_of_Whisky_Gelnhausen_import.png | 2024-08-13 17:16 | 121K | |
| St._Kilian_2019_import.png | 2024-08-13 17:16 | 123K | |
| St._Kilian_2020_1._St.Kilian_Whisky_Festival_import.png | 2024-08-13 17:16 | 110K | |
| St._Kilian_2020_Handfilled_import.png | 2024-08-13 17:16 | 122K | |
| St._Kilian_2020_Jar_of_Dirt_import.png | 2024-08-13 17:16 | 105K | |
| St._Kilian_2020_Peated_Twins_import.png | 2024-08-13 17:16 | 160K | |
| St._Kilian_2020_Uisge_Beatha_First_Fill_-_Private_Cask_import.png | 2024-08-13 17:16 | 115K | |
| St._Kilian_2020_Whiskyzwergs_Peated_Port_Dream_import.png | 2024-08-13 17:16 | 132K | |
| St._Kilian_British_Steel_Judas_Priest_British_Steel_import.png | 2024-08-13 17:16 | 148K | |
| St._Kilian_Bud_Spencer_Ein_Koch_für_alle_Fälle_import.png | 2024-08-13 17:16 | 145K | |
| St._Kilian_Burkard_Kiliani_Edition_import.png | 2024-08-13 17:16 | 119K | |
| St._Kilian_Deutscher_Hörfilmpreis_2023_import.png | 2024-08-13 17:16 | 150K | |
| St._Kilian_Don_Matteo_import.png | 2024-08-13 17:16 | 167K | |
| St._Kilian_Grave_Digger_Exhumation_import.png | 2024-08-13 17:16 | 147K | |
| St._Kilian_My_Name_Is_Nobody_import.png | 2024-08-13 17:16 | 161K | |
| St._Kilian_Ram_It_Down_Judas_Priest_Ram_it_down_import.png | 2024-08-13 17:16 | 152K | |
| St._Magdalene_1982_GM_Private_Collection_import.png | 2024-08-13 17:16 | 163K | |
| Stagg Jr.jpg | 2024-08-13 17:16 | 128K | |
| Stagg_Kentucky_Straight_Bourbon_Whiskey_Barrel_Proof_import.png | 2024-08-13 17:16 | 134K | |
| Stagg_Kentucky_Straight_Bourbon_Whiskey_Single_Barrel_import.png | 2024-08-13 17:16 | 142K | |
| Staoisha_2013_BD_import.png | 2024-08-13 17:16 | 164K | |
| Staoisha_2013_DR_Cask_Collection_import.png | 2024-08-13 17:16 | 68K | |
| Staoisha_2013_IS&m_The_Islay_Whisky_Vault_import.png | 2024-08-13 17:16 | 207K | |
| Staoisha_2013_Orc_import.png | 2024-08-13 17:16 | 89K | |
| Staoisha_2013_WhB_Private_Cask_import.png | 2024-08-13 17:16 | 206K | |
| Staoisha_2014_BD_import.png | 2024-08-13 17:16 | 152K | |
| Staoisha_2014_MBl_The_Maltman_import.png | 2024-08-13 17:16 | 109K | |
| Staoisha_2018_DV_Private_Cellar_Cask_import.png | 2024-08-13 17:16 | 104K | |
| Starward_2016_BR_Exclusive_Fair_Bottling_2023_import.png | 2024-08-13 17:16 | 135K | |
| Starward_2017_Single_Barrel_import.png | 2024-08-13 17:16 | 142K | |
| Starward_2019_Muscat_import.png | 2024-08-13 17:16 | 106K | |
| Starward_Lagavulin_Cask_Strength_Limited_Edition_Release_import.png | 2024-08-13 17:16 | 119K | |
| Starward_Pedro_Ximenez_Cask_import.png | 2024-08-13 17:16 | 123K | |
| Starward_Single_Malt_Australian_Whisky_Limited_Edition_Release_import.png | 2024-08-13 17:16 | 111K | |
| Stauning_2014_Distillery_Edition_-_Barley_-_Bourbon_&_Cabernet_Sauvignon_import.png | 2024-08-13 17:16 | 113K | |
| Stauning_2015_Distillers_Edition_-_Barley_-_Bourbon_&_Cabernet_Sauvignon_Cask_import.png | 2024-08-13 17:16 | 119K | |
| Stauning_2016-2018_Flvr_Heather_Smoked_import.png | 2024-08-13 17:16 | 118K | |
| Stauning_2016_Distillery_Edition_-_Barley_-_Virgin_Quarter_Cask_import.png | 2024-08-13 17:16 | 130K | |
| Stauning_2016_Distillery_Edition_-_Rye_Whisky_-_Virgin_&_Maple_Syrup_Cask_517_import.png | 2024-08-13 17:16 | 132K | |
| Stauning_2016_Distillery_Edition_-_Rye_Whisky_-_Virgin_&_Maple_Syrup_Cask_import.png | 2024-08-13 17:16 | 114K | |
| Stauning_2017-2019_SMOKE_-_Summerton_-_Small_Batch_import.png | 2024-08-13 17:16 | 130K | |
| Stauning_2017_Barley_-_German_Ambassador_import.png | 2024-08-13 17:16 | 120K | |
| Stauning_2017_Cask_Share_-_Peated_Whisky_import.png | 2024-08-13 17:16 | 172K | |
| Stauning_2017_Distillers_Edition_-_SMOKE_-_Bourbon_&_Barbados_Rum_Cask_import.png | 2024-08-13 17:16 | 108K | |
| Stauning_2017_Distillers_Edition_-_Smoke_-_Bourbon_&_Madeira_Cask_HEATHER_import.png | 2024-08-13 17:16 | 117K | |
| Stauning_2017_Distillery_Edition_-_Barley_-_Bourbon_&_Australian_Rum_cask_import.png | 2024-08-13 17:16 | 119K | |
| Stauning_2017_Distillery_Edition_-_Smoke_-_Bourbon_&_Moscatel_Cask_HEATHER_import.png | 2024-08-13 17:16 | 105K | |
| Stauning_2017_Distillery_Edition_-_Smoke_-_Virgin_Quarter_cask_-_HEATER_import.png | 2024-08-13 17:16 | 122K | |
| Stauning_2017_Heather_-_30_Jahre_whisky.de_import.png | 2024-08-13 17:16 | 123K | |
| Stauning_2017_TLM_Spirit_Adventures_import.png | 2024-08-13 17:16 | 193K | |
| Stauning_2018_Distillery_Edition_-_Smoke_-_Bourbon_&_Maple_Syrup_import.png | 2024-08-13 17:16 | 119K | |
| Stauning_2019_BLL_Barley_-_Billund_2023_import.png | 2024-08-13 17:16 | 107K | |
| Stauning_2019_Distillersy_Edition_-_KAOS_-_Virgin_American_Standard_Barrel_import.png | 2024-08-13 17:16 | 110K | |
| Stauning_2019_Distillery_Edition_-_Barley_-_Bourbon_&_Moscatel_Cask_import.png | 2024-08-13 17:16 | 100K | |
| Stauning_2019_Distillery_Edition_-_Barley_-_Bourbon_&_Oloroso_Sherry_Cask_import.png | 2024-08-13 17:16 | 111K | |
| Stauning_2019_Distillery_Edition_-_Barley_-_Virgin_American_Standard_Barrel_import.png | 2024-08-13 17:16 | 112K | |
| Stauning_2019_Distillery_Edition_-_KAOS_-_Maple_Syrup_Cask_Finish_import.png | 2024-08-13 17:16 | 110K | |
| Stauning_2019_Distillery_Edition_-_Rye_-_Virgin_&_Cuban_Rum_Cask_import.png | 2024-08-13 17:16 | 103K | |
| Stauning_2019_Distillery_Edition_-_Rye_-_Virgin_Quarter_&_Calvados_Cask_import.png | 2024-08-13 17:16 | 108K | |
| Stauning_2019_Distillery_Edition_-_Rye_-_Virgin_Quarter_Cask_import.png | 2024-08-13 17:16 | 111K | |
| Stauning_2019_Distillery_Edition_-_Rye_Whisky_-_Virgin_&_Cuban_Rum_Cask_import.png | 2024-08-13 17:16 | 199K | |
| Stauning_2019_Distillery_Edition_-_Rye_Whisky_-_Virgin_Quarte_&_VermouthCask_import.png | 2024-08-13 17:16 | 104K | |
| Stauning_2019_Distillery_Edition_-_Smoke_-_Bourbon_Barrel_import.png | 2024-08-13 17:16 | 108K | |
| Stauning_2019_Rye_-_Maple_Syrup_-_Limited_Edition_Finish_import.png | 2024-08-13 17:16 | 114K | |
| Stauning_2020_Distillery_Edition_-_Rye_-_Virgin_&_Panama_Rum_Cask_import.png | 2024-08-13 17:16 | 103K | |
| Stauning_2020_Distillery_Edition_-_Rye_Whisky_-_Virgin_&_West_Indies_Rum_Cask_import.png | 2024-08-13 17:16 | 95K | |
| Stauning_2020_LH-R_Skjern_River_Whisky_-_Rye_import.png | 2024-08-13 17:16 | 95K | |
| Stauning_2020_Single_Maple_Syrup_Cask_Rye_Whisky_-_Summerton_Whisky_Club_import.png | 2024-08-13 17:16 | 140K | |
| Stauning_Dirty_Bastard_Research_Series_import.png | 2024-08-13 17:16 | 118K | |
| Stauning_KAOS_Batch_1-2023_import.png | 2024-08-13 17:16 | 95K | |
| Stauning_Rye_-_Douro_Dreams_Limited_Edition_import.png | 2024-08-13 17:16 | 114K | |
| Stauning_Rye_Batch_1-2023_import.png | 2024-08-13 17:16 | 93K | |
| Stauning_Rye_Danish_Whisky_import.png | 2024-08-13 17:16 | 124K | |
| Stauning_Rye_Hardcore_Edition_import.png | 2024-08-13 17:16 | 119K | |
| Stauning_Smoke_Batch_1-2023_import.png | 2024-08-13 17:16 | 92K | |
| Stokerij_de_Molenberg_Aurora_10th_Anniversary_Edition_import.png | 2024-08-13 17:16 | 165K | |
| Stonewood_2015_Woaz_Amarone_One_-_Family_Stock_Ed._2_import.png | 2024-08-13 17:16 | 182K | |
| Stonewood_2016_Woaz_import.png | 2024-08-13 17:16 | 145K | |
| Stonewood_2020_Smokey_Monk_import.png | 2024-08-13 17:16 | 252K | |
| Stork_Club_2017_WhJs_German_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 129K | |
| Stork_Club_2019_Single_Barrel_Whiskey_import.png | 2024-08-13 17:16 | 129K | |
| Stork_Club_2020_Distillery_Only_Handbottled_import.png | 2024-08-13 17:16 | 155K | |
| Stork_Club_Ryezcal_Smoky_Agave_x_Spicy_Rye_Whiskey_import.png | 2024-08-13 17:16 | 160K | |
| Stork_Club_Toffee_Rye_Limited_Edition_import.png | 2024-08-13 17:16 | 124K | |
| Stork_Club_Wine_Barrel_Series_Rye_Whiskey_import.png | 2024-08-13 17:16 | 78K | |
| Stranahans_07-year-old_Single_Barrel_-_Cask_Strength_import.png | 2024-08-13 17:16 | 264K | |
| Stranahans_2017_Single_Barrel_import.png | 2024-08-13 17:16 | 87K | |
| Stranahans_Diamond_Peak_Colorado_Single_Malt_Whiskey_import.png | 2024-08-13 17:16 | 104K | |
| Strathclyde_1989_CA_Authentic_Collection_import.png | 2024-08-13 17:16 | 116K | |
| Strathclyde_1992_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:16 | 104K | |
| Strathclyde_1993_DoTh_import.png | 2024-08-13 17:16 | 139K | |
| Strathclyde_1993_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:16 | 102K | |
| Strathclyde_1994_3W_import.png | 2024-08-13 17:16 | 90K | |
| Strathclyde_1994_PST_Error_502_Series_import.png | 2024-08-13 17:16 | 87K | |
| Strathclyde_1994_TCah_The_Grainhound_import.png | 2024-08-13 17:16 | 151K | |
| Strathcona_Spirits_Malted_Dreams_Whisky_#12_import.png | 2024-08-13 17:16 | 175K | |
| Strathearn_2013_PST_A_Seven_Cask_Series_import.png | 2024-08-13 17:16 | 163K | |
| Strathearn_2014_PST_A_Seven_Cask_Series_import.png | 2024-08-13 17:16 | 170K | |
| Strathearn_2014_PST_import.png | 2024-08-13 17:16 | 189K | |
| Strathearn_2014_Private_Cask_import.png | 2024-08-13 17:16 | 112K | |
| Strathearn_2015_DL_Beathas_Vänner_import.png | 2024-08-13 17:16 | 140K | |
| Strathearn_2019_Private_Cask_import.png | 2024-08-13 17:16 | 116K | |
| Strathearn_Celebrating_75th_Anniversary_DL_Single_Cask_Collection_import.png | 2024-08-13 17:16 | 137K | |
| Strathenry_2016_RBTW_Small_Batch_#2_import.png | 2024-08-13 17:16 | 164K | |
| Strathisla_18-year-old_import.png | 2024-08-13 17:16 | 155K | |
| Strathisla_20-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 132K | |
| Strathisla_1997_GM_Cask_Strength_Connoisseurs_Choice_import.png | 2024-08-13 17:16 | 109K | |
| Strathisla_2011_The_Distillery_Reserve_Collection_-_Single_Cask_Edition_import.png | 2024-08-13 17:16 | 186K | |
| Strathisla_2012_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:16 | 156K | |
| Strathisla_2012_TWCe_import.png | 2024-08-13 17:16 | 96K | |
| Strathisla_2013_The_Distillery_Reserve_Collection_-_Single_Cask_Edition_import.png | 2024-08-13 17:16 | 177K | |
| Strathmill_2009_Fs_Sláinte_import.png | 2024-08-13 17:16 | 115K | |
| Strathmill_2009_JE_import.png | 2024-08-13 17:16 | 110K | |
| Strathmill_2009_WW8_The_Warehouse_Friends_import.png | 2024-08-13 17:16 | 107K | |
| Strathmill_2009_WW8_import.png | 2024-08-13 17:16 | 120K | |
| Strathmill_2010_DT_The_Octave_import.png | 2024-08-13 17:16 | 97K | |
| Strathmill_2010_PDnl_import.png | 2024-08-13 17:16 | 141K | |
| Strathmill_2010_SMWS_100.39_Beautiful,_deep,_sweet_mouth_caress_import.png | 2024-08-13 17:16 | 111K | |
| Strathmill_2010_UD_Wad_Whisky_import.png | 2024-08-13 17:16 | 128K | |
| Strathmill_2011_HMcD_The_Golden_Cask_import.png | 2024-08-13 17:16 | 110K | |
| Strathmill_2011_WDS_import.png | 2024-08-13 17:16 | 102K | |
| Strathmill_2012_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 91K | |
| Strathmill_2014_IN2S_Release_09_import.png | 2024-08-13 17:16 | 95K | |
| Strathmill_2014_IN2S_Release_10_import.png | 2024-08-13 17:16 | 100K | |
| Sullivans_Cove_17-year-old_Old_&_Rare_import.png | 2024-08-13 17:16 | 168K | |
| Sullivans_Cove_2005_Old_&_Rare_import.png | 2024-08-13 17:16 | 164K | |
| Sullivans_Cove_2007_American_Oak_-_Single_Cask_import.png | 2024-08-13 17:16 | 185K | |
| Sullivans_Cove_2008_import.png | 2024-08-13 17:16 | 162K | |
| Suntory_100th_Anniversary_Thanks_(感謝)_import.png | 2024-08-13 17:16 | 118K | |
| Suntory_Toki_import.png | 2024-08-13 17:16 | 131K | |
| Supreme_Master_Blend_26-year-old_vF_import.png | 2024-08-13 17:16 | 280K | |
| Sylter_Haven_Whisky_2016_SyT_import.png | 2024-08-13 17:16 | 118K | |
| TGTBTS1.png | 2024-08-13 17:16 | 178K | |
| TWC-01-black.png | 2024-08-13 17:17 | 115K | |
| Taichung_2013_Cask_Strength_import.png | 2024-08-13 17:16 | 118K | |
| Taichung_2015_Cask_Strength_import.png | 2024-08-13 17:16 | 117K | |
| Taichung_Supremacy_Taiwan_Whisky_Duty_Free_Edition_import.png | 2024-08-13 17:16 | 148K | |
| Talisker 18.jpg | 2024-08-13 17:16 | 66K | |
| Talisker Storm.jpg | 2024-08-13 17:16 | 66K | |
| Talisker_09-year-old_Hand-filled_Distillery_only_import.png | 2024-08-13 17:16 | 95K | |
| Talisker_09-year-old_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 102K | |
| Talisker_45-year-old_Glacial_Edge_import.png | 2024-08-13 17:16 | 128K | |
| Talisker_2010_DL_Old_Particular_import.png | 2024-08-13 17:16 | 95K | |
| Talisker_2010_DL_Private_Stock_import.png | 2024-08-13 17:16 | 143K | |
| Talisker_2011_DL_Single_Minded_-_World_of_Whisky_Trilogie_import.png | 2024-08-13 17:16 | 112K | |
| Talisker_2011_HL_The_Old_Malt_Cask_import.png | 2024-08-13 17:16 | 135K | |
| Talisker_Distillery_Exclusive_Bottling_Distillery_Only_import.png | 2024-08-13 17:16 | 106K | |
| Talisker_Port_Ruighe_Finished_in_Port_Casks_import.png | 2024-08-13 17:16 | 94K | |
| Talisker_The_Wild_Explorador_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:16 | 100K | |
| Talisker_Wilder_Seas_Parley_import.png | 2024-08-13 17:16 | 120K | |
| Tamdhu 8 Signatory 2005.jpg | 2024-08-13 17:16 | 249K | |
| Tamdhu_15-year-old_CA_Original_Collection_import.png | 2024-08-13 17:16 | 139K | |
| Tamdhu_2004_import.png | 2024-08-13 17:16 | 111K | |
| Tamdhu_2006_Single_Cask_import.png | 2024-08-13 17:16 | 205K | |
| Tamdhu_2006_import.png | 2024-08-13 17:16 | 105K | |
| Tamdhu_2007_CA_Authentic_Collection_import.png | 2024-08-13 17:16 | 123K | |
| Tamdhu_2007_DL_Old_Particular_import.png | 2024-08-13 17:16 | 101K | |
| Tamdhu_2008_BR_Single_Cask_import.png | 2024-08-13 17:16 | 129K | |
| Tamdhu_2013_AI_The_Alba_Trail_import.png | 2024-08-13 17:16 | 112K | |
| Tamdhu_2013_BR_Single_Cask_import.png | 2024-08-13 17:16 | 116K | |
| Tamdhu_2013_Cl_Warehouse_No._8_import.png | 2024-08-13 17:16 | 271K | |
| Tamdhu_2013_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:16 | 98K | |
| Tamdhu_2013_HB_import.png | 2024-08-13 17:16 | 110K | |
| Tamdhu_2014_DL_Provenance_import.png | 2024-08-13 17:16 | 241K | |
| Tamdhu_2014_McG_Clan_Denny_import.png | 2024-08-13 17:16 | 125K | |
| Tamdhu_2015_3W_Mocha_Chocolata_Ya_Ya_import.png | 2024-08-13 17:16 | 117K | |
| Tamdhu_Batch_Strength_import.png | 2024-08-13 17:16 | 124K | |
| Tamdhu_Cigar_Malt_Limited_Release_import.png | 2024-08-13 17:16 | 116K | |
| Tamdhu_Dalbeallie_Dram_Collectors_Journey_06_import.png | 2024-08-13 17:16 | 121K | |
| Tamnavulin_2008_BR_import.png | 2024-08-13 17:16 | 124K | |
| Tamnavulin_2008_TCaH_Tasting_Tour_import.png | 2024-08-13 17:16 | 102K | |
| Tamnavulin_2009_HSD_Longvalley_Selection_import.png | 2024-08-13 17:16 | 116K | |
| Tamnavulin_2009_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:16 | 102K | |
| Tamnavulin_2009_MaUn_Cultural_Series_import.png | 2024-08-13 17:16 | 120K | |
| Tamnavulin_2009_PST_Error_502_Series_import.png | 2024-08-13 17:16 | 83K | |
| Tamnavulin_2009_ShW_import.png | 2024-08-13 17:16 | 89K | |
| Tamnavulin_2010_HL_Hepburns_Choice_import.png | 2024-08-13 17:16 | 115K | |
| Tamnavulin_2016_CL_Exploration_Series_import.png | 2024-08-13 17:16 | 102K | |
| Tasmanian_Independent_Bottlers_The_Blend_-_3_TmIB_(Oat_+_Malt_+_Peat)_import.png | 2024-08-13 17:16 | 95K | |
| Tayovulin_2016_TnTC_import.png | 2024-08-13 17:16 | 122K | |
| TeachersHighlandCream.jpg | 2024-08-13 17:16 | 855K | |
| Teaninich_12-year-old_LotG_import.png | 2024-08-13 17:16 | 119K | |
| Teaninich_12-year-old_WUA_CounteroffensiveUA_import.png | 2024-08-13 17:16 | 94K | |
| Teaninich_2007_Cl_Warehouse_No._1_import.png | 2024-08-13 17:16 | 231K | |
| Teaninich_2007_DR_Cask_Collection_import.png | 2024-08-13 17:16 | 68K | |
| Teaninich_2007_WDS_import.png | 2024-08-13 17:16 | 112K | |
| Teaninich_2008_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:16 | 129K | |
| Teaninich_2008_CA_Original_Collection_import.png | 2024-08-13 17:16 | 163K | |
| Teaninich_2008_CQ_Scary_Tale_Series_import.png | 2024-08-13 17:16 | 116K | |
| Teaninich_2008_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 183K | |
| Teaninich_2008_TWCe_Private_Cellars_Selection_import.png | 2024-08-13 17:16 | 99K | |
| Teaninich_2008_Whb_Creetown_Distillers_import.png | 2024-08-13 17:16 | 97K | |
| Teaninich_2009_CA_Warehouse_Tasting_import.png | 2024-08-13 17:16 | 138K | |
| Teaninich_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:16 | 113K | |
| Teaninich_2009_TDW_import.png | 2024-08-13 17:16 | 95K | |
| Teaninich_2010_BR_Single_Cask_import.png | 2024-08-13 17:16 | 237K | |
| Teaninich_2010_SMDr_Single_Cask_import.png | 2024-08-13 17:16 | 107K | |
| Teaninich_2010_WhB_import.png | 2024-08-13 17:16 | 102K | |
| Teaninich_2011_72er_Double_Pack_Edt._import.png | 2024-08-13 17:16 | 124K | |
| Teaninich_2011_AM_import.png | 2024-08-13 17:16 | 98K | |
| Teaninich_2011_JE_import.png | 2024-08-13 17:16 | 97K | |
| Teaninich_2011_Orc_import.png | 2024-08-13 17:16 | 86K | |
| Teaninich_2011_Private_Cask_-_Special_Release_2023_import.png | 2024-08-13 17:16 | 123K | |
| Teaninich_2011_SMWS_59.73_Discombobulation_at_40ppm_import.png | 2024-08-13 17:16 | 102K | |
| Teaninich_2011_SMWS_59.74_For_Fawkes_sake_import.png | 2024-08-13 17:16 | 106K | |
| Teaninich_2011_TCaH_Tasting_Tour_import.png | 2024-08-13 17:16 | 110K | |
| Teaninich_2011_TCaH_import.png | 2024-08-13 17:16 | 152K | |
| Teaninich_2011_WhB_QMs_Sommar_Malt_import.png | 2024-08-13 17:16 | 106K | |
| Teaninich_2012_MM_The_Art_of_Maturation_-_Benchmark_import.png | 2024-08-13 17:16 | 117K | |
| Teaninich_2012_NSS_Obscurities_&_Curiosities_import.png | 2024-08-13 17:16 | 122K | |
| Teaninich_2013_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:16 | 116K | |
| Teaninich_2013_PST_import.png | 2024-08-13 17:16 | 86K | |
| Teaninich_2015_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:16 | 93K | |
| Teaninich_2016_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:16 | 120K | |
| TeelingBrabazonSeries01.jpg | 2024-08-13 17:16 | 592K | |
| TeelingRenaissance4.png | 2024-08-13 17:16 | 268K | |
| Teeling_8th_Birthday_Batch_import.png | 2024-08-13 17:16 | 138K | |
| Teeling_14-year-old_Vintage_Reserve_Collection_import.png | 2024-08-13 17:16 | 177K | |
| Teeling_15-year-old_Explorers_Series_-_Japanese_Edition_import.png | 2024-08-13 17:16 | 142K | |
| Teeling_15-year-old_Single_Grain_import.png | 2024-08-13 17:16 | 115K | |
| Teeling_19-year-old_They_Inspired_III_-_Whisky_Icons_import.png | 2024-08-13 17:16 | 124K | |
| Teeling_20-year-old_import.png | 2024-08-13 17:16 | 201K | |
| Teeling_21-year-old_Rising_Reserve_No._2_import.png | 2024-08-13 17:16 | 139K | |
| Teeling_32-year-old_Very_Rare_Casks_import.png | 2024-08-13 17:16 | 172K | |
| Teeling_2001_Hand_Filled_at_Distillery_import.png | 2024-08-13 17:16 | 279K | |
| Teeling_2009_Single_Cask_import.png | 2024-08-13 17:16 | 256K | |
| Teeling_2015_Hand_bottled_at_Distillery_import.png | 2024-08-13 17:16 | 126K | |
| Teeling_2015_Handfilled_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 177K | |
| Teeling_Belgian_Ale_Casks_(Duvel)_Small_Batch_Series_import.png | 2024-08-13 17:16 | 127K | |
| Teeling_Blackpitts_Single_Cask_import.png | 2024-08-13 17:16 | 148K | |
| Teeling_Single_Cask_Single_Cask_import.png | 2024-08-13 17:16 | 126K | |
| Teeling_Single_Cask_Single_Pot_Still_import.png | 2024-08-13 17:16 | 112K | |
| Teeling_Single_Pot_Still_import.png | 2024-08-13 17:16 | 139K | |
| Teeling_Spätburgunder_Suez_Pinot_Noir_Cask_import.png | 2024-08-13 17:16 | 108K | |
| Teeling_stiggins_fancy_pineapple - Copy.png | 2024-08-13 17:16 | 277K | |
| Teeling_stiggins_fancy_pineapple.png | 2024-08-13 17:16 | 277K | |
| Teerenpeli_10-year-old_Vetehinen_-_Amarone_Cask_Whisky_Trilogy,_Part_1_import.png | 2024-08-13 17:16 | 179K | |
| Teerenpeli_10-year-old_Weden_Emo_-_Amarone_Cask_Whisky_Trilogy,_Part_2_import.png | 2024-08-13 17:16 | 184K | |
| Teerenpeli_Länki_Distillers_Choice_import.png | 2024-08-13 17:16 | 178K | |
| Teerenpeli_Pikkulintu_Puotila_2023_import.png | 2024-08-13 17:16 | 179K | |
| Templeton Rye.jpg | 2024-08-13 17:16 | 93K | |
| Tennessee_Whiskey_2007_PST_import.png | 2024-08-13 17:16 | 84K | |
| Tennessee_Whiskey_2016_TFM_import.png | 2024-08-13 17:16 | 102K | |
| Tennessee_Whisky_19-year-old_CA_Authentic_Collection_import.png | 2024-08-13 17:16 | 120K | |
| Texelse_03-year-old_Single_smoked_malt_import.png | 2024-08-13 17:16 | 132K | |
| Thal_08-year-old_Limited_First_Edition_LT1_import.png | 2024-08-13 17:16 | 121K | |
| TheLibertiesCooperAlley.jpg | 2024-08-13 17:16 | 789K | |
| The_Akkeshi_2019_Blenders_Choice_-_Single_Cask_Series_import.png | 2024-08-13 17:16 | 261K | |
| The_Akkeshi_2019_Blenders_Choice_import.png | 2024-08-13 17:16 | 208K | |
| The_Akkeshi_Hakuro_24_Solar_Term_Series_import.png | 2024-08-13 17:16 | 123K | |
| The_Akkeshi_Keichitsu_24_Solar_Term_Series_import.png | 2024-08-13 17:16 | 103K | |
| The_Akkeshi_Peated_24_Solar_Term_Series_import.png | 2024-08-13 17:16 | 112K | |
| The_Akkeshi_Shoman_24_Solar_Term_Series_import.png | 2024-08-13 17:16 | 94K | |
| The_Alrik_09-year-old_The_Handfilled_-_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 102K | |
| The_Alrik_The_Handfilled_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 93K | |
| The_Alrik_The_Woodsmoked_Hercynian_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 128K | |
| The_Bellards_07-year-old_Medium_Peated_import.png | 2024-08-13 17:16 | 124K | |
| The_Cardrona_07-year-old_Full_Flight_Solera_import.png | 2024-08-13 17:16 | 127K | |
| The_Cask_Wizard_10-year-old_TCaWi_Peat_Fire_Baked_Sweets_import.png | 2024-08-13 17:16 | 130K | |
| The_Cask_Wizard_2001_TCaWi_Golden_Summer_Dram_import.png | 2024-08-13 17:16 | 163K | |
| The_Cask_Wizard_2008_TCaWi_Wizards_Sweet_Fifteen_import.png | 2024-08-13 17:16 | 155K | |
| The_Cask_Wizard_2010_TCaWi_Enchanting_Fruit_Salad_import.png | 2024-08-13 17:16 | 164K | |
| The_Cask_Wizard_2010_TCaWi_Portuguese_Fruit_Delight_import.png | 2024-08-13 17:16 | 154K | |
| The_Cask_Wizard_2010_TCaWi_The_Double_import.png | 2024-08-13 17:16 | 157K | |
| The_Cask_Wizard_2010_TCaWi_The_Iberian_Temptation_import.png | 2024-08-13 17:16 | 145K | |
| The_Cask_Wizard_2011_TCaWi_Peat_Smoked_Fruits_import.png | 2024-08-13 17:16 | 133K | |
| The_Cask_Wizard_2012_TCaWi_Honey_Crumble_Fruit_Pie_import.png | 2024-08-13 17:16 | 160K | |
| The_Cask_Wizard_2012_TCaWi_Pipers_Elixir_import.png | 2024-08-13 17:16 | 134K | |
| The_Cask_Wizard_2012_TCaWi_Sweet_n_Peaty_Vol._2_import.png | 2024-08-13 17:16 | 144K | |
| The_Cask_Wizard_2012_TCaWi_Wizard’s_Orchard_Party_Vol_1_import.png | 2024-08-13 17:16 | 164K | |
| The_Cask_Wizard_2013_TCaWi_Sweet_n_Fruity_Vol._2_import.png | 2024-08-13 17:16 | 147K | |
| The_Cask_Wizard_2013_TCaWi_The_Oloroso_Experience_import.png | 2024-08-13 17:16 | 158K | |
| The_Cask_Wizard_2013_TCaWi_Wizards_Stoisha_import.png | 2024-08-13 17:16 | 145K | |
| The_Cask_Wizard_2014_TCaWi_Rich_&_Fruity_import.png | 2024-08-13 17:16 | 158K | |
| The_Cask_Wizard_2015_TCaWi_Crème_Brûlée_&_Red_Berries_import.png | 2024-08-13 17:16 | 171K | |
| The_Cask_Wizard_2015_TCaWi_Garden_Fruit_Jam_import.png | 2024-08-13 17:16 | 147K | |
| The_Cask_Wizard_2017_TCaWi_Young_&_Sassy_import.png | 2024-08-13 17:16 | 147K | |
| The_Chamberick_The_Immature_import.png | 2024-08-13 17:16 | 112K | |
| The_Cheshire_Fireside_Special_Release_import.png | 2024-08-13 17:16 | 93K | |
| The_Cheshire_Second_Release_import.png | 2024-08-13 17:16 | 96K | |
| The_Cigar_Malt_2006_IM_Chieftains_import.png | 2024-08-13 17:16 | 117K | |
| The_Clydeside_Distillery_2018_Hand_filled_at_distillery_import.png | 2024-08-13 17:16 | 224K | |
| The_Clydeside_Distillery_2018_import.png | 2024-08-13 17:16 | 202K | |
| The_Clydeside_Distillery_2019_Handfilled_-_Distillery_Only_import.png | 2024-08-13 17:16 | 114K | |
| The_Clydeside_Distillery_2023_limited_edition_import.png | 2024-08-13 17:16 | 128K | |
| The_Dark_Side_of_Islay_20-year-old_MoS_Seagrave_import.png | 2024-08-13 17:16 | 187K | |
| The_English_Whisky_2011_Small_Batch_Release_import.png | 2024-08-13 17:16 | 189K | |
| The_English_Whisky_2015_Open_Day_2023_import.png | 2024-08-13 17:16 | 124K | |
| The_English_Whisky_Coronation_of_King_Charles_III_Royal_Range_import.png | 2024-08-13 17:16 | 164K | |
| The_Epicurean_Glasgow_Edition_DL_Limited_Edition_import.png | 2024-08-13 17:16 | 137K | |
| The_Epicurean_Lowland_Blended_Malt_Scotch_Whisky_DL_Wood_Series_-_Amarone_Cask_import.png | 2024-08-13 17:16 | 159K | |
| The_Four_Gates_Distillery_2011_Vredelander_Gate_import.png | 2024-08-13 17:16 | 136K | |
| The_Four_Gates_Distillery_2016_Treptower_Gate_import.png | 2024-08-13 17:16 | 141K | |
| The_Gauldrons_Campbeltown_Blended_Malt_DL_Limited_Edition_Cask_Strength_import.png | 2024-08-13 17:16 | 144K | |
| The_Gauldrons_Campbeltown_Blended_Malt_DL_Limited_Edition_Sherry_Casks_import.png | 2024-08-13 17:16 | 139K | |
| The_Glover_06-year-old_AD_The_Glover_import.png | 2024-08-13 17:16 | 88K | |
| The_Gospel_Batch_1_TBWC_import.png | 2024-08-13 17:16 | 148K | |
| The_Great_Northern_05-year-old_TWBl_No._046_import.png | 2024-08-13 17:16 | 94K | |
| The_Great_Northern_05-year-old_WAGE_No._0019_import.png | 2024-08-13 17:16 | 92K | |
| The_Hearach_First_Release_Batch_2_import.png | 2024-08-13 17:16 | 266K | |
| The_Hearach_First_Release_Batch_3_import.png | 2024-08-13 17:16 | 266K | |
| The_Hearach_First_Release_Batch_4_import.png | 2024-08-13 17:16 | 266K | |
| The_Hearach_First_Release_Batch_5_import.png | 2024-08-13 17:16 | 198K | |
| The_Hearach_First_Release_Batch_6_import.png | 2024-08-13 17:16 | 193K | |
| The_Hearach_First_Release_Batch_7_import.png | 2024-08-13 17:16 | 266K | |
| The_Hearach_First_Release_Batch_8_import.png | 2024-08-13 17:16 | 266K | |
| The_Hearach_Inaugural_Release_1st_Batch_import.png | 2024-08-13 17:16 | 276K | |
| The_Hearach_The_1,916_Inaugural_Release_import.png | 2024-08-13 17:16 | 253K | |
| The_Irishman_Legacy_import.png | 2024-08-13 17:16 | 122K | |
| The_Kurayoshi_Special_2023_Release_Year_of_the_Rabbit_import.png | 2024-08-13 17:16 | 134K | |
| The_Lübbehusen_07-year-old_Special_Edition_import.png | 2024-08-13 17:16 | 137K | |
| The_Lübbehusen_09-year-old_Peated_Redwine_Cask_import.png | 2024-08-13 17:16 | 145K | |
| The_Lakes_08-year-old_Founders_Club_-_Limited_Edition_import.png | 2024-08-13 17:16 | 148K | |
| The_Lakes_Cascade_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 125K | |
| The_Lakes_Decadence_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 131K | |
| The_Lakes_Elements_-_#1_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 110K | |
| The_Lakes_Elements_-_#2_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 114K | |
| The_Lakes_Elements_-_#3_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 111K | |
| The_Lakes_Elements_-_#4_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 109K | |
| The_Lakes_Elements_-_#5_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 121K | |
| The_Lakes_Elements_-_#6_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 106K | |
| The_Lakes_Elements_-_#7_A_Whiskymakers_Project_import.png | 2024-08-13 17:16 | 104K | |
| The_Lakes_Equinox_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 122K | |
| The_Lakes_Iris_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 120K | |
| The_Lakes_Odyssey_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 130K | |
| The_Lakes_Resfeber_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 114K | |
| The_Lakes_Resfeber_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 114K | |
| The_Lakes_Rivêa_The_Whiskymakers_Editions_import.png | 2024-08-13 17:16 | 124K | |
| The_Lakes_The_One_Fine_Blended_Whisky_import.png | 2024-08-13 17:16 | 121K | |
| The_Liberator_The_Reeks_Devils_Ladder_Edition_import.png | 2024-08-13 17:16 | 131K | |
| The_Loch_Fyne_The_Living_Cask_import.png | 2024-08-13 17:16 | 118K | |
| The_Nine_Springs_05-year-old_Festival_Whisky_import.png | 2024-08-13 17:16 | 199K | |
| The_Nine_Springs_06-year-old_GNA_Charity_Cask_import.png | 2024-08-13 17:16 | 188K | |
| The_Nine_Springs_2014_import.png | 2024-08-13 17:16 | 132K | |
| The_Nine_Springs_2015_16st_import.png | 2024-08-13 17:16 | 100K | |
| The_Nine_Springs_2017_DrWa_import.png | 2024-08-13 17:16 | 200K | |
| The_Nine_Springs_2018_Peated_Breeze_Edition_import.png | 2024-08-13 17:16 | 189K | |
| The_Nine_Springs_2018_Single_Cask_Selection_import.png | 2024-08-13 17:16 | 129K | |
| The_Nine_Springs_Port_Wine_Cask_No._3_Single_Cask_Selection_import.png | 2024-08-13 17:16 | 129K | |
| The_Nine_Springs_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 147K | |
| The_OA_Islay_Single_Malt_Whisky_MNC_Premium_Line_import.png | 2024-08-13 17:16 | 103K | |
| The_Ox_2015_import.png | 2024-08-13 17:16 | 99K | |
| The_Oxford_Artisan_Distillery_Black_Pine_import.png | 2024-08-13 17:16 | 125K | |
| The_Riverbourne_Batch_2_TBWC_import.png | 2024-08-13 17:16 | 142K | |
| The_Scotch_Malt_Whisky_Society_SMWS_Blend_Straight_From_The_Cask_import.png | 2024-08-13 17:16 | 213K | |
| The_Singleton_of_Glen_Ord_11-year-old_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 126K | |
| The_Singleton_of_Glen_Ord_40-year-old_The_Epicurean_Odyssey_Series_import.png | 2024-08-13 17:16 | 152K | |
| The_Singleton_of_Glendullan_14-year-old_-_The_Silken_Gown_Diageo_Special_Releases_2023_import.png | 2024-08-13 17:16 | 122K | |
| The_Stillery_Amsterdam_Rye_Whisky_Inaugural_Release_2023_import.png | 2024-08-13 17:16 | 153K | |
| The_Unexpected_n°3_2012_MCo_The_Unexpected_import.png | 2024-08-13 17:16 | 112K | |
| The_Vogel_2014_Eagle_-_Fordernd_import.png | 2024-08-13 17:16 | 229K | |
| The_Westfalian_2013_German_Single_Malt_Whisky_import.png | 2024-08-13 17:16 | 155K | |
| The_Westfalian_2015_Robin_Laing._Up_in_the_Dram_Room_import.png | 2024-08-13 17:16 | 161K | |
| The_Westfalian_2015_The_Warehouse_Dram_No.2_import.png | 2024-08-13 17:16 | 142K | |
| The_Westfalian_2019_Cask_Experiment_MAGELLAN_import.png | 2024-08-13 17:16 | 158K | |
| The_Whistler_15-year-old_BoD_P.X._I_Love_You_import.png | 2024-08-13 17:16 | 214K | |
| Theres_a_peatwave_comin_Old_enough_to_be_bloody_tasty!_Friends_of_Caskhound_import.png | 2024-08-13 17:16 | 105K | |
| Thin_Lizzy_Irish_Whiskey_Double_Charred_import.png | 2024-08-13 17:16 | 129K | |
| Thirteenth_Colony_Southern_Rye_Whiskey_import.png | 2024-08-13 17:16 | 195K | |
| Thomas H. Handy 2013.jpg | 2024-08-13 17:16 | 106K | |
| Thomond_Gate_Chateau_Kirwan_Cask_Finish_TLS_import.png | 2024-08-13 17:16 | 152K | |
| Thomond_Gate_The_Clash_of_the_Ash_import.png | 2024-08-13 17:16 | 138K | |
| Thornæs_2020_1st_Release_import.png | 2024-08-13 17:16 | 161K | |
| Thousand_Mountains_2018_ANHA_Ravenheart_import.png | 2024-08-13 17:16 | 259K | |
| Thousand_Mountains_2018_Handfill_Raven_Single_Cask_Whisky_import.png | 2024-08-13 17:16 | 208K | |
| Thousand_Mountains_2018_Handfill_Raven_import.png | 2024-08-13 17:16 | 216K | |
| Thousand_Mountains_2019_Handfill_Raven_Single_Cask_Whisky_import.png | 2024-08-13 17:16 | 175K | |
| Thousand_Mountains_2019_die-whisky-taster_Edition_import.png | 2024-08-13 17:16 | 157K | |
| Thy_Whisky_03-year-old_Shared_cask_no._354_-_PX_import.png | 2024-08-13 17:16 | 73K | |
| Thy_Whisky_2019_Distillery_Edition_#292_import.png | 2024-08-13 17:16 | 81K | |
| Thy_Whisky_2020_Distillery_Edition_#129-2_import.png | 2024-08-13 17:16 | 86K | |
| Thy_Whisky_Germany_Tour_23_import.png | 2024-08-13 17:16 | 76K | |
| Thy_Whisky_No._22_Bøg-PX_import.png | 2024-08-13 17:16 | 79K | |
| Timorous_Beastie_DL_Small_Batch_Release_import.png | 2024-08-13 17:16 | 263K | |
| Timorous_Beastie_Meet_the_Beast_2023_DL_Limited_Edition_import.png | 2024-08-13 17:16 | 167K | |
| Timorous_Beastie_Specialist_Limited_Edition_DL_The_Cheese_Cellar_Collection_No._01_import.png | 2024-08-13 17:16 | 95K | |
| Timorous_Beastie_The_Sherried_Beast_Edition_#2_DL_Limited_Edition_No._2_import.png | 2024-08-13 17:16 | 169K | |
| Tinkabella_2017_aus_dem_Pummerland_Nr.3_import.png | 2024-08-13 17:16 | 125K | |
| Tipperary_2008_Boutique_Selection_-_Single_Cask_Release_import.png | 2024-08-13 17:16 | 229K | |
| Tipperary_Boutique_Homegrown_Barley_Single_Cask_June_2022_(1)-776x1176.png | 2024-08-13 17:16 | 246K | |
| Tobermory_25-year-old_The_Hebridean_Series_import.png | 2024-08-13 17:16 | 125K | |
| Tobermory_1994_Cl_Warehouse_No._1_import.png | 2024-08-13 17:16 | 235K | |
| Tobermory_1994_NSpS_Neoclassicism_import.png | 2024-08-13 17:16 | 98K | |
| Tobermory_1994_RM_Single_Cask_import.png | 2024-08-13 17:16 | 128K | |
| Tobermory_1995_LTDW_Drink_Limited_import.png | 2024-08-13 17:16 | 158K | |
| Tobermory_1995_LT_import.png | 2024-08-13 17:16 | 122K | |
| Tobermory_2006_SMWS_42.83_Muscovado_pipe_tobacco_import.png | 2024-08-13 17:16 | 105K | |
| Tobermory_2008_BR_German_Retailers_Choice_import.png | 2024-08-13 17:16 | 138K | |
| Tobermory_2008_MoS_import.png | 2024-08-13 17:16 | 174K | |
| Tobermory_2012_Distillery_Exclusive_Handfilled_import.png | 2024-08-13 17:16 | 122K | |
| Tobermory_2013_CSJS_The_National_Choice_import.png | 2024-08-13 17:16 | 133K | |
| Tobermory_2013_import.png | 2024-08-13 17:16 | 110K | |
| Tobermory_2015_3W_Peallach_import.png | 2024-08-13 17:16 | 92K | |
| Togouchi_Blended_Japanese_Whisky_Peated_import.png | 2024-08-13 17:16 | 157K | |
| Tomatin 18.jpg | 2024-08-13 17:16 | 1.1M | |
| Tomatin_12-year-old_Cù_Bòcan_-_Limited_Edition_import.png | 2024-08-13 17:16 | 213K | |
| Tomatin_1991_FrSp_Old&Rare_Selection_import.png | 2024-08-13 17:16 | 119K | |
| Tomatin_1994_WSP_Edition_No._82_import.png | 2024-08-13 17:16 | 113K | |
| Tomatin_2004_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:16 | 130K | |
| Tomatin_2006_import.png | 2024-08-13 17:16 | 138K | |
| Tomatin_2008_AI_The_Alba_Trail_import.png | 2024-08-13 17:16 | 123K | |
| Tomatin_2008_Handfilled_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 144K | |
| Tomatin_2008_Single_Cask_-_Year_of_The_Dragon_import.png | 2024-08-13 17:16 | 169K | |
| Tomatin_2008_WPB_Emblem_06_import.png | 2024-08-13 17:16 | 105K | |
| Tomatin_2009_BR_Scyfion_Special_Selection_import.png | 2024-08-13 17:16 | 118K | |
| Tomatin_2009_GlMo_Water_of_Life_Single_Cask_import.png | 2024-08-13 17:16 | 175K | |
| Tomatin_2010_Distillery_Exclusive_Single_Cask_import.png | 2024-08-13 17:16 | 131K | |
| Tomatin_2010_Italian_Collection_import.png | 2024-08-13 17:16 | 137K | |
| Tomatin_2011_3W_Friends_of_the_Quaich_import.png | 2024-08-13 17:16 | 100K | |
| Tomatin_2011_3W_import.png | 2024-08-13 17:16 | 89K | |
| Tomatin_2011_Arc_The_Fishes_of_Samoa_import.png | 2024-08-13 17:16 | 99K | |
| Tomatin_2011_Distillery_Exclusive_Single_Cask_import.png | 2024-08-13 17:16 | 248K | |
| Tomatin_2011_DoV_import.png | 2024-08-13 17:16 | 107K | |
| Tomatin_2011_GM_Discovery_import.png | 2024-08-13 17:16 | 110K | |
| Tomatin_2011_HB_Single_Cask_-_Cask_Strength_import.png | 2024-08-13 17:16 | 105K | |
| Tomatin_2011_WCh_Hogmanay_Malt_import.png | 2024-08-13 17:16 | 173K | |
| Tomatin_2013_EWL_The_Discovery_Collection_import.png | 2024-08-13 17:16 | 91K | |
| Tomatin_2013_VM_The_Coopers_Choice_import.png | 2024-08-13 17:16 | 123K | |
| Tomatin_2014_SMWS_11.45_Ruddy-cheeked_old_fruit_import.png | 2024-08-13 17:16 | 103K | |
| Tomatin_2015_JE_Small_Batch_import.png | 2024-08-13 17:16 | 104K | |
| Tomatin_2016_Bottle_Your_Own_-_Single_Cask_import.png | 2024-08-13 17:16 | 145K | |
| Tomatin_2017_Distillery_Exclusive_import.png | 2024-08-13 17:16 | 134K | |
| Tomatin_2017_Handfilled_-_Distillery_only_import.png | 2024-08-13 17:16 | 139K | |
| Tomatin_Cù_Bòcan_Creation_#5_import.png | 2024-08-13 17:16 | 131K | |
| Tomintoul 14.jpg | 2024-08-13 17:16 | 85K | |
| Tomintoul_13-year-old_vF_import.png | 2024-08-13 17:16 | 254K | |
| Tomintoul_1973_Vintage_import.png | 2024-08-13 17:16 | 170K | |
| Tomintoul_2005_Limited_Edition_import.png | 2024-08-13 17:16 | 218K | |
| Tomintoul_2006_CA_Authentic_Collection_import.png | 2024-08-13 17:16 | 113K | |
| Tomintoul_2008_TWC_import.png | 2024-08-13 17:16 | 112K | |
| Tomintoul_2012_TWS_GlenKeir_Treasures_import.png | 2024-08-13 17:16 | 144K | |
| Tomintoul_2012_WCh_import.png | 2024-08-13 17:16 | 162K | |
| Torabhaig_2018_Batch_Strength_Special_Reserve_import.png | 2024-08-13 17:16 | 116K | |
| Torabhaig_2018_Club_Reserve_-_Release_No.4_import.png | 2024-08-13 17:16 | 113K | |
| Torabhaig_2018_Club_Reserve_-_Release_No.5_import.png | 2024-08-13 17:16 | 104K | |
| Torabhaig_2018_Distillery_Reserve_import.png | 2024-08-13 17:16 | 97K | |
| Torabhaig_Allt_Gleann_Batch_Strength_The_Legacy_Series_import.png | 2024-08-13 17:16 | 101K | |
| Torabhaig_New_Make_Spirit_import.png | 2024-08-13 17:16 | 113K | |
| Torabhaig_Small_Batch_2023_import.png | 2024-08-13 17:16 | 116K | |
| Tormore_14-year-old_82NC_Creatures_of_Cask_Strength_import.png | 2024-08-13 17:16 | 116K | |
| Tormore_14-year-old_82NC_Triple_Wood_import.png | 2024-08-13 17:16 | 108K | |
| Tormore_1988_DL_XOP_-_Xtra_Old_Particular_-_Scallywag_Limited_Edition_-_75th_Anniversary_import.png | 2024-08-13 17:16 | 148K | |
| Tormore_1992_SMWS_105.41_Lemon_de_luxe_import.png | 2024-08-13 17:16 | 111K | |
| Tormore_1992_WhB_import.png | 2024-08-13 17:16 | 150K | |
| Tormore_1999_ElD_The_Single_Malts_of_Scotland_import.png | 2024-08-13 17:16 | 99K | |
| Tormore_2009_TCaH_Friends_of_Caskhound_import.png | 2024-08-13 17:17 | 130K | |
| Tormore_2010_3W_import.png | 2024-08-13 17:17 | 88K | |
| Tormore_2010_DT_The_Octave_import.png | 2024-08-13 17:17 | 96K | |
| Tormore_2010_Df_Dramfools_middle_cut_import.png | 2024-08-13 17:17 | 138K | |
| Tormore_2010_K23_Mobsters_on_Mopeds_import.png | 2024-08-13 17:17 | 104K | |
| Tormore_2011_DR_Cask_Collection_import.png | 2024-08-13 17:17 | 67K | |
| Tormore_2011_LotG_Lady_of_the_Glen_import.png | 2024-08-13 17:17 | 108K | |
| Tormore_2011_LotG_Rare_Cask_import.png | 2024-08-13 17:17 | 111K | |
| Tormore_2015_3W_import.png | 2024-08-13 17:17 | 108K | |
| Trolden_Nimbus_No._9_import.png | 2024-08-13 17:17 | 131K | |
| Tullahoma_2011_MoS_import.png | 2024-08-13 17:17 | 153K | |
| Tullamore_Dew_Distillery_Exclusive_Be_the_Blender_import.png | 2024-08-13 17:17 | 133K | |
| Tullamore_Dew_The_Legendary_Irish_Whiskey_Limited_Edition_import.png | 2024-08-13 17:17 | 102K | |
| Tullibardine_11-year-old_DMor_import.png | 2024-08-13 17:17 | 103K | |
| Tullibardine_12-year-old_CA_Original_Collection_import.png | 2024-08-13 17:17 | 142K | |
| Tullibardine_15-year-old_import.png | 2024-08-13 17:17 | 89K | |
| Tullibardine_18-year-old_import.png | 2024-08-13 17:17 | 99K | |
| Tullibardine_1989_HL_Old_&_Rare_-_A_Platinum_Selection_import.png | 2024-08-13 17:17 | 164K | |
| Tullibardine_2005_LA_import.png | 2024-08-13 17:17 | 96K | |
| Tullibardine_2006_BD_import.png | 2024-08-13 17:17 | 163K | |
| Tullibardine_2006_Single_Cask_Edition_import.png | 2024-08-13 17:17 | 95K | |
| Tullibardine_2006_The_Murray_-_The_Marquess_Collection_import.png | 2024-08-13 17:17 | 102K | |
| Tullibardine_2006_WSP_Edition_No._79_import.png | 2024-08-13 17:17 | 100K | |
| Tullibardine_2007_LoDz_Rambler_import.png | 2024-08-13 17:17 | 105K | |
| Tullibardine_2007_The_Murray_-_The_Marquess_Collection_import.png | 2024-08-13 17:17 | 115K | |
| Tullibardine_2008_The_Murray_-_The_Marquess_Collection_import.png | 2024-08-13 17:17 | 96K | |
| Tullibardine_2009_TCaH_Crazy_Coos_Collection_import.png | 2024-08-13 17:17 | 109K | |
| Tullibardine_2010_BR_Scyfion_Special_Selection_import.png | 2024-08-13 17:17 | 120K | |
| Tullibardine_2012_AWWC_Infrequent_Flyers_import.png | 2024-08-13 17:17 | 130K | |
| Tullibardine_2012_BiM_DÙN_DUBH_import.png | 2024-08-13 17:17 | 99K | |
| Tullibardine_2012_Fs_Sláinte_import.png | 2024-08-13 17:17 | 111K | |
| Tullibardine_2012_PDnl_Classics_of_Eyewear_-_Gijs_-_Rembrandt_import.png | 2024-08-13 17:17 | 157K | |
| Tullibardine_2012_The_Murray_import.png | 2024-08-13 17:17 | 107K | |
| Tullibardine_2013_DT_Octaves_import.png | 2024-08-13 17:17 | 193K | |
| Tullibardine_2013_DT_Single_Cask_import.png | 2024-08-13 17:17 | 107K | |
| Tullibardine_2013_DT_The_Octave_import.png | 2024-08-13 17:17 | 108K | |
| Tullibardine_2013_TCaH_Special_Release_-_Exclusive_Bottling_import.png | 2024-08-13 17:17 | 147K | |
| Tullibardine_2015_DMor_import.png | 2024-08-13 17:17 | 91K | |
| Tullibardine_2015_UD_import.png | 2024-08-13 17:17 | 235K | |
| Tullibardine_2018_UD_Silesian_Whisky_Fest_2023_import.png | 2024-08-13 17:17 | 98K | |
| Tullibardine_Pirates`N`Highlanders_Where_Barlet_Meets_Cane..._T_Single_Cask_Bottling_import.png | 2024-08-13 17:17 | 171K | |
| Turntable_Bittersweet_Symphony_TuSp_import.png | 2024-08-13 17:17 | 210K | |
| Turntable_Paradise_Funk_TuSp_import.png | 2024-08-13 17:17 | 193K | |
| Turntable_Smokin_Riff_TuSp_import.png | 2024-08-13 17:17 | 213K | |
| Turntable_Track_01_-_Joy,_Discovery,_Invention_TuSp_2023_Collection_import.png | 2024-08-13 17:17 | 183K | |
| Turntable_Track_02_-_Firestarter_TuSp_2023_Collection_import.png | 2024-08-13 17:17 | 178K | |
| Turntable_Track_03_-_Purple_Haze_TuSp_2023_Collection_import.png | 2024-08-13 17:17 | 183K | |
| Two_Stacks_06-year-old_Polaris_Collection_1.3_import.png | 2024-08-13 17:17 | 133K | |
| Two_Stacks_13-year-old_import.png | 2024-08-13 17:17 | 154K | |
| Two_Stacks_Dram_in_a_Can_KD_Double_Barrel_import.png | 2024-08-13 17:17 | 237K | |
| Two_Stacks_Smoke_&_Mirrors_Peated_Single_Malt_import.png | 2024-08-13 17:17 | 150K | |
| Tyrconnell Irish Single Malt.jpg | 2024-08-13 17:17 | 68K | |
| Unchained_Single_Malt_New_Make_Peated_import.png | 2024-08-13 17:17 | 200K | |
| Unchained_Single_Malt_Whisky_peated_2020_import.png | 2024-08-13 17:17 | 219K | |
| Undisclosed_Distillery_2007_MrW_Stag_of_Meall_Mor_import.png | 2024-08-13 17:17 | 112K | |
| Union_Distillery_Maltwhisky_do_Brasil_2017_CA_Authentic_Collection_import.png | 2024-08-13 17:17 | 151K | |
| Unknown_Baillargegail_import.png | 2024-08-13 17:17 | 163K | |
| Unnamed_Islay_Malt_Pheasant_Castle_WlRb_import.png | 2024-08-13 17:17 | 142K | |
| Unnamed_Orkney_2006_vW_The_Ultimate_import.png | 2024-08-13 17:17 | 110K | |
| Unnamed_Speyside_2009_SV_The_Un-Chillfiltered_Collection_import.png | 2024-08-13 17:17 | 122K | |
| Unnamed_Speyside_2009_vW_The_Ultimate_import.png | 2024-08-13 17:17 | 108K | |
| Urwhisky_2017_import.png | 2024-08-13 17:17 | 160K | |
| Valamo_Monastery_8_Unpeated_-_Batch_#1_import.png | 2024-08-13 17:17 | 151K | |
| Vame_Malts_23-year-old_VAME_Rude_Olph_import.png | 2024-08-13 17:17 | 157K | |
| Van Winkle Family Reserve Rye 13 Years Old.jpg | 2024-08-13 17:17 | 134K | |
| Van_Winkle_12-year-old_Special_Reserve_-_Lot_“B”_import.png | 2024-08-13 17:17 | 95K | |
| Vardberg_Born_Inaugural_Release_import.png | 2024-08-13 17:17 | 127K | |
| Vardberg_Born_Limited_Edition_import.png | 2024-08-13 17:17 | 133K | |
| Vatted_Islay_Malt_16-year-old_Bq_Special_Heavy_Peated_import.png | 2024-08-13 17:17 | 136K | |
| Vatted_Malt_Franconian_Peated_import.png | 2024-08-13 17:17 | 199K | |
| Version_Française_2003_Blavier_import.png | 2024-08-13 17:17 | 145K | |
| Version_Française_2013_Secale_import.png | 2024-08-13 17:17 | 159K | |
| Version_Française_2014_Zea_Mays_import.png | 2024-08-13 17:17 | 156K | |
| Version_Française_2018_Triticum_import.png | 2024-08-13 17:17 | 161K | |
| Version_Française_2019_Hordeum_import.png | 2024-08-13 17:17 | 164K | |
| Very Old Barton Bottled In Bond.jpg | 2024-08-13 17:17 | 37K | |
| Very_Sherried_1998_MCo_Single_Malts_import.png | 2024-08-13 17:17 | 126K | |
| Vielanker_Brauhaus_2011_AurOx_-_Double_Cask_import.png | 2024-08-13 17:17 | 131K | |
| Vielanker_Brauhaus_2019_AurOx_import.png | 2024-08-13 17:17 | 132K | |
| Vink_2018_Batch_Strength_1st_Edition_import.png | 2024-08-13 17:17 | 107K | |
| Virginia_2017_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:17 | 167K | |
| Vossenberg_2018_First_Release_import.png | 2024-08-13 17:17 | 126K | |
| W.D._OConnell_07-year-old_Cask_Share_2_import.png | 2024-08-13 17:17 | 144K | |
| W.D._OConnell_2017_Limited_Edition_import.png | 2024-08-13 17:17 | 121K | |
| W.D._OConnell_Bill_Phil_-_Peated_Series_WDO_Single_Malt_Irish_Whiskey_import.png | 2024-08-13 17:17 | 117K | |
| W.L._Weller_Special_Reserve_Buffalo_Trace_Distillery_import.png | 2024-08-13 17:17 | 122K | |
| WL_Weller_Antique.png | 2024-08-13 17:17 | 122K | |
| Wagging_Finger_2019_Diamonds_and_rust_import.png | 2024-08-13 17:17 | 173K | |
| Wagging_Finger_2019_Limited_Edition_import.png | 2024-08-13 17:17 | 161K | |
| Wagging_Finger_2019_The_2019_WF_WOW!_Project_import.png | 2024-08-13 17:17 | 124K | |
| Wagging_Finger_2019_import.png | 2024-08-13 17:17 | 109K | |
| Walsetal_2019_Single_Malt_Nr._05_import.png | 2024-08-13 17:17 | 162K | |
| Wannborga_11-year-old_import.png | 2024-08-13 17:17 | 146K | |
| Wardhead_1997_MacA_import.png | 2024-08-13 17:17 | 95K | |
| Wardhead_1997_SpSp_import.png | 2024-08-13 17:17 | 94K | |
| Waterford_2019_Good_Vibrations_-_Micro_Cuvée_import.png | 2024-08-13 17:17 | 121K | |
| Waterford_Argot_Cuvée_import.png | 2024-08-13 17:17 | 110K | |
| Waterford_Blackcastle_Edition_1.1_Single_Farm_Origin_import.png | 2024-08-13 17:17 | 123K | |
| Waterford_Bons_Moments_Micro_Cuvée_import.png | 2024-08-13 17:17 | 129K | |
| Waterford_Die_Ermittler_Micro_Cuvée_import.png | 2024-08-13 17:17 | 156K | |
| Waterford_Killone_Organic_Single_Farm_Origin_import.png | 2024-08-13 17:17 | 116K | |
| Waterford_Lacken_Single_Farm_Origin_import.png | 2024-08-13 17:17 | 113K | |
| Waterford_Rathclough.png | 2024-08-13 17:17 | 883K | |
| Waterford_Woodbrook_Single_Farm_Origin_import.png | 2024-08-13 17:17 | 115K | |
| Wave_Distil_11-year-old_Distillery_Edition_import.png | 2024-08-13 17:17 | 225K | |
| Wave_Distil_2014_B&L_Légendes_Des_Circuits_import.png | 2024-08-13 17:17 | 127K | |
| Wave_Distil_Peat_Cathedral_40_Bottles_import.png | 2024-08-13 17:17 | 170K | |
| Wave_Distil_Red_whisky_FSpB_import.png | 2024-08-13 17:17 | 143K | |
| Wayward-Irish-Spirits-Roundel_mobile_100.png | 2024-08-13 17:17 | 13K | |
| Weller_Antique_107_Single_Barrel_Select_import.png | 2024-08-13 17:17 | 116K | |
| Weller_Full_Proof_Single_Barrel_import.png | 2024-08-13 17:17 | 122K | |
| Westland_07-year-old_Distillery_Exclusive_import.png | 2024-08-13 17:17 | 123K | |
| Westland_07-year-old_Single_Cask_import.png | 2024-08-13 17:17 | 278K | |
| Westland_2014_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:17 | 240K | |
| Westland_Cask_No._7431_Single_Cask_Release_-_Hand-Filled_import.png | 2024-08-13 17:17 | 162K | |
| Westland_Solum_1st_Edition_Outpost_Range_import.png | 2024-08-13 17:17 | 121K | |
| Westport_1999_Sb_Xaver_Bar_Choice_No._9_import.png | 2024-08-13 17:17 | 129K | |
| Westport_2006_WSP_Edition_No._83_import.png | 2024-08-13 17:17 | 100K | |
| Westward_2016_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:17 | 158K | |
| Westward_2016_WhDr_import.png | 2024-08-13 17:17 | 138K | |
| Westward_Stout_Cask_Finish_Single_Barrel_Selection_import.png | 2024-08-13 17:17 | 135K | |
| Westward_Vintage_Muscat_Cask_import.png | 2024-08-13 17:17 | 130K | |
| Wheelhouse_08-year-old_import.png | 2024-08-13 17:17 | 137K | |
| Whisky_Festival_Radebeul_2010_Tasting_Tour_import.png | 2024-08-13 17:17 | 150K | |
| WhistlePig_The_Boss_Hog_-_10th_Edition_The_Commandments_import.png | 2024-08-13 17:17 | 161K | |
| White_Peak_Wire_Works_Double_Oak_Port_import.png | 2024-08-13 17:17 | 141K | |
| Whitlaw_08-year-old_BNSp_Whisky_of_Voodoo_import.png | 2024-08-13 17:17 | 124K | |
| Whitlaw_2013_MSWD_Càrn_Mòr_-_Strictly_Limited_Edition_import.png | 2024-08-13 17:17 | 110K | |
| Whitlaw_2013_SV_Horsemen_&_Archangels_import.png | 2024-08-13 17:17 | 150K | |
| Widow_Jane_10-year-old_Decadence_import.png | 2024-08-13 17:17 | 263K | |
| Wild Turkey 101.jpg | 2024-08-13 17:17 | 152K | |
| Wild_Turkey_101_Kentucky_Straight_Bourbon_Whiskey_import.png | 2024-08-13 17:17 | 105K | |
| Willems_Whisky_05-year-old_Small_Batch_1_import.png | 2024-08-13 17:17 | 83K | |
| Willems_Whisky_05-year-old_Small_Batch_2_import.png | 2024-08-13 17:17 | 83K | |
| Willett_06-year-old_Family_Estate_Bottled_Single_Barrel_Bourbon_import.png | 2024-08-13 17:17 | 98K | |
| Willett_06-year-old_Family_Estate_Bottled_Single_Barrel_Rye_import.png | 2024-08-13 17:17 | 96K | |
| William Larue Weller.jpg | 2024-08-13 17:17 | 20K | |
| William_Lawsons_Blended_Scotch_Whisky_import.png | 2024-08-13 17:17 | 93K | |
| Williamson_12-year-old_BW_A_Dream_of_Scotland_-_The_Tasteful_8_import.png | 2024-08-13 17:17 | 131K | |
| Williamson_2005_PST_Error_502_Series_import.png | 2024-08-13 17:17 | 85K | |
| Williamson_2006_TWBl_No._054_import.png | 2024-08-13 17:17 | 102K | |
| Williamson_2008_AL&C_Single_Cask_import.png | 2024-08-13 17:17 | 106K | |
| Williamson_2010_DR_Gau_Gau_Gau_import.png | 2024-08-13 17:17 | 241K | |
| Williamson_2010_DR_The_Black_Cat_Series_import.png | 2024-08-13 17:17 | 95K | |
| Williamson_2010_OXH_Spirit_Medicine_import.png | 2024-08-13 17:17 | 112K | |
| Williamson_2010_TFM_Flowers_import.png | 2024-08-13 17:17 | 101K | |
| Williamson_2011_AM_import.png | 2024-08-13 17:17 | 101K | |
| Williamson_2011_UD_import.png | 2024-08-13 17:17 | 100K | |
| Williamson_2012_NSS_Cask_Series_022_import.png | 2024-08-13 17:17 | 191K | |
| Williamson_2012_Orc_import.png | 2024-08-13 17:17 | 88K | |
| Williamson_2012_Sb_The_Clans_Label_import.png | 2024-08-13 17:17 | 143K | |
| Williamson_2013_BR_Single_Cask_import.png | 2024-08-13 17:17 | 120K | |
| Williamson_2013_MSWD_Càrn_Mòr_Strictly_Limited_import.png | 2024-08-13 17:17 | 113K | |
| Williamson_2014_BR_Small_Batch_import.png | 2024-08-13 17:17 | 135K | |
| Williamson_2014_Cl_Warehouse_No._1_import.png | 2024-08-13 17:17 | 223K | |
| Williamson_2014_WhDr_import.png | 2024-08-13 17:17 | 105K | |
| Williamson_2015_SCSM_import.png | 2024-08-13 17:17 | 188K | |
| Williamson_2015_WhB_import.png | 2024-08-13 17:17 | 98K | |
| Williamson_2020_mybar_import.png | 2024-08-13 17:17 | 145K | |
| WillowBurn_2014_The_Distillery_Exclusive_-_Cask_Strength_import.png | 2024-08-13 17:17 | 129K | |
| WillowBurn_2014_The_Distillery_Exclusive_import.png | 2024-08-13 17:17 | 131K | |
| WillowBurn_2018_The_Distillery_Exclusive_import.png | 2024-08-13 17:17 | 131K | |
| WillowBurn_2019_Moon_Over_Bourbon_Cask_import.png | 2024-08-13 17:17 | 143K | |
| WillowBurn_All_Hallows_Eve_2023_The_Dusk_import.png | 2024-08-13 17:17 | 142K | |
| WillowBurn_Moscatel_Casks_import.png | 2024-08-13 17:17 | 145K | |
| WillowBurn_The_Distillery_Exclusive_import.png | 2024-08-13 17:17 | 160K | |
| WillowBurn_Theophanu_2023_import.png | 2024-08-13 17:17 | 145K | |
| Wire_Works_2018_BR_Single_Cask_import.png | 2024-08-13 17:17 | 124K | |
| Wire_Works_2019_import.png | 2024-08-13 17:17 | 138K | |
| Wire_Works_Necessary_Evil_Finish_import.png | 2024-08-13 17:17 | 119K | |
| Wire_Works_Single_Cask_import.png | 2024-08-13 17:17 | 133K | |
| Wire_Works_Virgin_Oak_import.png | 2024-08-13 17:17 | 107K | |
| Wolfburn_08-year-old_Mythical_Beast_import.png | 2024-08-13 17:17 | 132K | |
| Wolfburn_08-year-old_Mythical_Beasts_-_Dragon_import.png | 2024-08-13 17:17 | 129K | |
| Wolfburn_08-year-old_Mythical_Beasts_-_Tiger_import.png | 2024-08-13 17:17 | 148K | |
| Wolfburn_08-year-old_Mythical_Beasts_-_Tortoise_import.png | 2024-08-13 17:17 | 130K | |
| Wolfburn_10-year-old_2023_Vatting_import.png | 2024-08-13 17:17 | 137K | |
| Wolfburn_2013_The_Anniversary_Series_-_2023_import.png | 2024-08-13 17:17 | 155K | |
| Wolfburn_2014_Distillery_Edition_-_Hand_Filled_In_Thurso_import.png | 2024-08-13 17:17 | 137K | |
| Wolfburn_2014_Private_Cask_Botteling_import.png | 2024-08-13 17:17 | 141K | |
| Wolfburn_2014_The_Braves_import.png | 2024-08-13 17:17 | 136K | |
| Wolfburn_2015_Double_Cask_Release_2023_import.png | 2024-08-13 17:17 | 135K | |
| Wolfburn_2015_Vibrant_Stills_-_Small_Batch_import.png | 2024-08-13 17:17 | 149K | |
| Wolfburn_2016_Distillery_Edition_-_Hand_Filled_In_Thurso_import.png | 2024-08-13 17:17 | 139K | |
| Wolfburn_2016_Japan_-_Exclusive_VI_import.png | 2024-08-13 17:17 | 141K | |
| Wolfburn_2016_Mey_Games_2023_import.png | 2024-08-13 17:17 | 138K | |
| Wolfburn_2017_Handfilled_at_the_Distillery_import.png | 2024-08-13 17:17 | 141K | |
| Wolfburn_Cask_Strength_Limited_Edition_import.png | 2024-08-13 17:17 | 145K | |
| Wolfburn_Coronation_import.png | 2024-08-13 17:17 | 152K | |
| Wolfburn_Its_the_most_wonderful_time_of_the_year_Christmas_Edition_2023_import.png | 2024-08-13 17:17 | 156K | |
| Wolfburn_No._177_Small_Batch_Release_import.png | 2024-08-13 17:17 | 140K | |
| Wolfburn_Slava_Ukraini_import.png | 2024-08-13 17:17 | 139K | |
| Wolfburn_The_Brave_Fortune_Favours_import.png | 2024-08-13 17:17 | 182K | |
| Wolfburn_The_Kylver_Series_-_11_Isa_import.png | 2024-08-13 17:17 | 130K | |
| Wolfburn_The_Kylver_Series_-_12_Jera_import.png | 2024-08-13 17:17 | 141K | |
| Wolfburn_Year_of_the_Rabbit_Chinese_New_Year_2023_import.png | 2024-08-13 17:17 | 140K | |
| Wolfgangsee_Whisky_03-year-old_Oberland_import.png | 2024-08-13 17:17 | 155K | |
| Wolfgangsee_Whisky_03-year-old_Unterwelt_import.png | 2024-08-13 17:17 | 150K | |
| Wolfies_Blended_Scotch_Whisky_First_Release_import.png | 2024-08-13 17:17 | 114K | |
| Woodford Reserve.jpg | 2024-08-13 17:17 | 232K | |
| Woodford_Reserve_Distillers_Select_Holiday_Edition_import.png | 2024-08-13 17:17 | 209K | |
| Woodford_Reserve_Distillers_Select_Holiday_LIMITED_import.png | 2024-08-13 17:17 | 192K | |
| Woodford_Reserve_Kentucky_Derby_149_import.png | 2024-08-13 17:17 | 213K | |
| Woodinville_05-year-old_Applewood_Staves_import.png | 2024-08-13 17:17 | 189K | |
| Woodinville_2017_JWC_Single_Cask_Nation_import.png | 2024-08-13 17:17 | 167K | |
| Woven_Experience_5.1_WvnW_Joy_in_Nature_import.png | 2024-08-13 17:17 | 117K | |
| Woven_Experience_11_WvnW_peachy_import.png | 2024-08-13 17:17 | 148K | |
| Woven_Experience_12_WvnW_Echoes_import.png | 2024-08-13 17:17 | 155K | |
| Woven_Experience_13_WvnW_Catalyst_import.png | 2024-08-13 17:17 | 138K | |
| Woven_Experience_14_WvnW_Kaleidoscopic_import.png | 2024-08-13 17:17 | 137K | |
| Woven_Experience_16_WvnW_Loom_import.png | 2024-08-13 17:17 | 136K | |
| Woven_Superblend_WvnW_import.png | 2024-08-13 17:17 | 132K | |
| WritersTearsCopperPot.jpg | 2024-08-13 17:17 | 447K | |
| WritersTearsDeauXOCognac.jpg | 2024-08-13 17:17 | 401K | |
| Writers_Tears_Cask_Strength_2023_Limited_Edition_import.png | 2024-08-13 17:17 | 95K | |
| Writers_Tears_Single_Pot_Still_Tequila_Cask_import.png | 2024-08-13 17:17 | 93K | |
| Yamazaki_12-year-old_import.png | 2024-08-13 17:17 | 120K | |
| Yamazaki_18-year-old_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:17 | 125K | |
| Yamazaki_Distillers_Reserve_import.png | 2024-08-13 17:17 | 118K | |
| Yamazaki_Limited_Edition_2023_import.png | 2024-08-13 17:17 | 107K | |
| Yamazakura_Asaka_Peated_Single_Cask_import.png | 2024-08-13 17:17 | 115K | |
| Yamazakura_Kuyuri_Peated_Blended_Whisky_import.png | 2024-08-13 17:17 | 161K | |
| Yarm_Distillery_First_Release_import.png | 2024-08-13 17:17 | 150K | |
| YellowSpot.jpg | 2024-08-13 17:17 | 1.0M | |
| Yellow_Spot_13_Box_Bottle_2000x.jpg | 2024-08-13 17:17 | 234K | |
| Yellow_Spot_13_Box_Bottle_2000x.png | 2024-08-13 17:17 | 48K | |
| Yellowstone_04-year-old_American_Single_Malt_Whiskey_import.png | 2024-08-13 17:17 | 103K | |
| Yellowstone_2018_Hand_Picked_Collection_-_Single_Barrel_import.png | 2024-08-13 17:17 | 112K | |
| Yellowstone_Single_Barrel_Hand_Picked_Collection_import.png | 2024-08-13 17:17 | 110K | |
| Yerushalmi_2020_Israeli_Strength_-_Stronger_Together_import.png | 2024-08-13 17:17 | 86K | |
| Yoichi 26 SMWS 116.20.jpg | 2024-08-13 17:17 | 346K | |
| Yuza_2019_SMWS_158.1_Shirley_Temple_and_a_grown-up_limeade_import.png | 2024-08-13 17:17 | 104K | |
| Yuza_2019_Single_Cask_import.png | 2024-08-13 17:17 | 91K | |
| Yuza_Single_Malt_Japanese_Whisky_import.png | 2024-08-13 17:17 | 94K | |
| ZGraggen_Single_Malt_Whisky_import.png | 2024-08-13 17:17 | 81K | |
| Zeitzer_Whisky_Batch_28_import.png | 2024-08-13 17:17 | 155K | |
| Zeitzer_Whisky_Batch_31_import.png | 2024-08-13 17:17 | 152K | |
| Zmajska_Pivovara_05-year-old_Tale_of_the_Dragon’s_Tail_import.png | 2024-08-13 17:17 | 192K | |
| Zwolse_Bravoure_Single_Malt_Whisky_import.png | 2024-08-13 17:17 | 138K | |
| anCnoc_2006_Single_Cask_Exclusive_import.png | 2024-08-13 17:07 | 105K | |
| anCnoc_2006_Single_Cask_Exclusives_import.png | 2024-08-13 17:07 | 89K | |
| anCnoc_2007_Single_Cask_Exclusive_import.png | 2024-08-13 17:07 | 98K | |
| anCnoc_Sherry_Cask_Finish_Peated_edition_import.png | 2024-08-13 17:07 | 92K | |
| appicon_black.png | 2024-08-13 17:07 | 261K | |
| ardbeg-an-oa.jpg | 2024-08-13 17:07 | 233K | |
![[DIR]](/icons/folder.gif) | auctionHouses/ | 2024-09-09 17:06 | - | |
| auctionSite/ | 2024-08-13 17:25 | - | |
| ballykeefeLogo.jpg | 2024-08-13 17:08 | 20K | |
| barrycrockettlegacy.jpg | 2024-08-13 17:08 | 1.0M | |
| barrycrockettlegacystock.jpg | 2024-08-13 17:08 | 564K | |
| bcLegacy.png | 2024-08-13 17:08 | 85K | |
| beaus-jameson.jpeg | 2024-08-13 17:08 | 83K | |
| beavertown.jpg | 2024-08-13 17:08 | 175K | |
| blacksLogo.png | 2024-08-13 17:09 | 34K | |
| blackwaterLogo.png | 2024-08-13 17:09 | 96K | |
| blanton.jpg | 2024-08-13 17:09 | 100K | |
| blantons_special_reserve.png | 2024-08-13 17:09 | 202K | |
| boannLogo.jpg | 2024-08-13 17:09 | 32K | |
| booker-s-bourbon-7-year.jpg | 2024-08-13 17:09 | 326K | |
| bottleImages/ | 2025-04-27 22:40 | - | |
| brabazon2 - Copy.png | 2024-08-13 17:09 | 139K | |
| brbon_wil43_diamond_anniversary.jpg | 2024-08-13 17:09 | 207K | |
| burren_distillery_logo.png | 2024-08-13 17:10 | 293K | |
| bush30.jpg | 2024-08-13 17:10 | 43K | |
| bush30.png | 2024-08-13 17:10 | 353K | |
| bush1992cognac.jpg | 2024-08-13 17:10 | 56K | |
| bushmills2006.jpg | 2024-08-13 17:10 | 54K | |
| bushmillsLogo.jpg | 2024-08-13 17:10 | 159K | |
| bushmills_2001_causewaycollection_feuillettecask_ps.jpg | 2024-08-13 17:10 | 406K | |
| bushmills_steamship_bourbon_cask_gb_1000ml_40_vol.-776x1176.jpg | 2024-08-13 17:10 | 98K | |
| bushmillscognac.jpg | 2024-08-13 17:10 | 48K | |
| bushsteamshiprum.jpg | 2024-08-13 17:10 | 85K | |
| cameraphoto.jpg | 2024-08-13 17:10 | 5.7M | |
| caskmates.jpg | 2024-08-13 17:10 | 29K | |
| caskmatesdieuduciel.png | 2024-08-13 17:10 | 743K | |
| caskmatesfourpure.jpg | 2024-08-13 17:10 | 102K | |
| caskmatesgreatdivide.jpg | 2024-08-13 17:10 | 37K | |
| caskmateskelsopaleale.jpg | 2024-08-13 17:10 | 67K | |
| caskmatesrevolution.jpg | 2024-08-13 17:10 | 15K | |
| caskmatesyounghenry.jpg | 2024-08-13 17:10 | 545K | |
| celitcCask15-776x1176.jpg | 2024-08-13 17:10 | 230K | |
| cgmob.12yo.jpg | 2024-08-13 17:10 | 251K | |
| clonakiltyLogo.jpg | 2024-08-13 17:10 | 65K | |
| connachtLogo.jpg | 2024-08-13 17:11 | 32K | |
| connemara-peated-irish-whiskey-p2320-6373_image.jpg | 2024-08-13 17:11 | 84K | |
![[ ]](/icons/unknown.gif) | content.json | 2024-08-13 17:11 | 512K | |
| convalmore_32_1984_caskstrength.png | 2024-08-13 17:11 | 243K | |
| cq5dam.web.1280.1280.jpeg | 2024-08-13 17:11 | 128K | |
| crested_1990.png | 2024-08-13 17:11 | 273K | |
| crested_ten.png | 2024-08-13 17:11 | 202K | |
| crollyLogo.jpg | 2024-08-13 17:11 | 12K | |
| csm_0_9caefc_conne00ca_aw_f2e7e30aa4.jpg | 2024-08-13 17:11 | 229K | |
| csm_1606929318_image_BUSHM28CC_1_ed9560a9d7.jpg | 2024-08-13 17:11 | 46K | |
| currach-single-malt-founders-cask.jpg | 2024-08-13 17:11 | 112K | |
| dalwhinnie_15.jpg | 2024-08-13 17:11 | 43K | |
| default.jpg | 2024-08-13 17:11 | 567K | |
| dingle-first-single-pot-still-whiskey.jpg | 2024-08-13 17:11 | 30K | |
| dingle-fourth-single-pot-still-cask-strength.png | 2024-08-13 17:11 | 731K | |
| dingle-second-single-pot-still-whiskey.jpg | 2024-08-13 17:11 | 30K | |
| dingle-single-malt-batch-1-cs.jpg | 2024-08-13 17:11 | 65K | |
| dingle-single-malt-batch-1.jpg | 2024-08-13 17:11 | 63K | |
| dingle-single-malt-batch-2-cs.jpg | 2024-08-13 17:11 | 96K | |
| dingle-single-malt-batch-2.jpg | 2024-08-13 17:11 | 41K | |
| dingle-single-malt-batch-3-cs.jpg | 2024-08-13 17:11 | 148K | |
| dingle-single-malt-batch-3.jpg | 2024-08-13 17:11 | 134K | |
| dingle-single-malt-batch-4-cask-strength.jpg | 2024-08-13 17:11 | 154K | |
| dingle-single-malt-batch-4.jpg | 2024-08-13 17:11 | 151K | |
| dingle-single-malt-batch-5.jpg | 2024-08-13 17:11 | 46K | |
| dingle-single-pot-still-fourth-release.jpg | 2024-08-13 17:11 | 1.2M | |
| dingle-single-pot-still-third-release.jpg | 2024-08-13 17:11 | 164K | |
| dingle-sps-cs.png | 2024-08-13 17:11 | 351K | |
| distilleryLogos/ | 2025-06-09 22:03 | - | |
| dublin-liberties-distillery-logo.jpg | 2024-08-13 17:11 | 41K | |
| dunville-s-vr18-palo-cortado-finish.jpg | 2024-08-13 17:11 | 121K | |
| eclinvillelogo.jpg | 2024-08-13 17:11 | 49K | |
| famous-grouse-smoky-black-whisky.jpg | 2024-08-13 17:12 | 19K | |
| glen.png | 2024-08-13 17:12 | 195K | |
| glendalough_13_bod.png | 2024-08-13 17:12 | 210K | |
| glendalough_13_mizunara.png | 2024-08-13 17:12 | 363K | |
| glendalough_distillery_logo.png | 2024-08-13 17:12 | 100K | |
| glendreeDistillerylogo.jpg | 2024-08-13 17:12 | 31K | |
| golser_2017_Premium_-_Vintage_Reserve_2017_import.png | 2024-08-13 17:13 | 122K | |
| greatNorthernLogo.jpg | 2024-08-13 17:13 | 9.6K | |
| greenspot_old_label.png | 2024-08-13 17:13 | 152K | |
| greenspot_palacece.png | 2024-08-13 17:13 | 328K | |
| greenspot_rev.png | 2024-08-13 17:13 | 319K | |
| hibikigold.png | 2024-08-13 17:13 | 260K | |
| hibikimasterlimitededition.png | 2024-08-13 17:13 | 194K | |
| hibikimastersselect.png | 2024-08-13 17:13 | 239K | |
| hinchlogo.png | 2024-08-13 17:14 | 21K | |
| image.jpg | 2024-08-13 17:14 | 2.1M | |
| image10.png | 2024-08-13 17:14 | 1.2M | |
![[TXT]](/icons/text.gif) | images.txt | 2024-08-13 17:14 | 17K | |
| inQuota_Mountain_Rye_Whisky_First_Edition_import.png | 2024-08-13 17:14 | 126K | |
| inQuota_Mountain_Single_Malt_Whisky_First_Edition_import.png | 2024-08-13 17:14 | 120K | |
| inQuota_Mountain_Single_Malt_Whisky_import.png | 2024-08-13 17:14 | 129K | |
| irish_mid42.jpg | 2024-08-13 17:14 | 131K | |
| irishamerican19.png | 2024-08-13 17:14 | 221K | |
| irishman_coffee_stout_dick_macks.png | 2024-08-13 17:14 | 144K | |
| irishwhiskeyauctionspng.png | 2024-08-13 17:14 | 111K | |
| irishwhiskeymagazine.png | 2024-08-13 17:14 | 144K | |
| james12magiul.png | 2024-08-13 17:14 | 332K | |
| jameson-caskmates-outland-paris-brewery.jpg | 2024-08-13 17:14 | 652K | |
| jameson-caskmates-stout-edition-irish-whiskey_1.jpg | 2024-08-13 17:14 | 25K | |
| jameson12.png | 2024-08-13 17:14 | 289K | |
| jameson1780box.png | 2024-08-13 17:14 | 383K | |
| jameson1975soffianoimport.png | 2024-08-13 17:14 | 322K | |
| jameson121780.png | 2024-08-13 17:14 | 301K | |
| jameson121780hex.png | 2024-08-13 17:14 | 380K | |
| jamesonDistillersSafe.png | 2024-08-13 17:14 | 164K | |
| jameson_18_masters_selection.png | 2024-08-13 17:14 | 253K | |
| jameson_1980s.png | 2024-08-13 17:14 | 155K | |
| jameson_1990s.png | 2024-08-13 17:14 | 160K | |
| jameson_2013_bartenders_ball.png | 2024-08-13 17:14 | 124K | |
| jameson_bartenders_ball_2015.png | 2024-08-13 17:14 | 144K | |
| jameson_blenders_dog.png | 2024-08-13 17:14 | 143K | |
| jameson_caskmates_angel_city__33628.1489723736.480.480.jpg | 2024-08-13 17:14 | 25K | |
| jameson_crested_1990.png | 2024-08-13 17:14 | 156K | |
| jameson_patricks_day_2012.png | 2024-08-13 17:14 | 168K | |
| jameson_patricks_day_2013.png | 2024-08-13 17:14 | 169K | |
| jameson_patricks_day_2014.png | 2024-08-13 17:14 | 160K | |
| jameson_patricks_day_2015.png | 2024-08-13 17:14 | 174K | |
| jameson_patricks_day_2016.png | 2024-08-13 17:14 | 165K | |
| jameson_patricks_day_2017.png | 2024-08-13 17:14 | 170K | |
| jameson_patricks_day_2018.png | 2024-08-13 17:14 | 159K | |
| jameson_patricks_day_2020.png | 2024-08-13 17:14 | 170K | |
| jamesonbalebreaker.jpg | 2024-08-13 17:14 | 198K | |
| jamesoncaptainlawrence.jpg | 2024-08-13 17:14 | 29K | |
| jamesongold.jpg | 2024-08-13 17:14 | 136K | |
| jamesonrvr2007graphite.jpg | 2024-08-13 17:14 | 345K | |
| jamesonrvr2007wooden.jpg | 2024-08-13 17:14 | 325K | |
| jj12-distilleryreserve.png | 2024-08-13 17:14 | 362K | |
| jj_corry_battallion_php_gen.png | 2024-08-13 17:14 | 126K | |
| jj_gold.png | 2024-08-13 17:14 | 272K | |
| jj_gold_special.png | 2024-08-13 17:14 | 431K | |
| jj_goldreserve.png | 2024-08-13 17:14 | 327K | |
| john-powers-gold-label-0-7l-43-2.jpg | 2024-08-13 17:14 | 114K | |
| johnnie-walker-blue-label-cask-edition-p9397-15698_image.jpg | 2024-08-13 17:14 | 223K | |
| kilbegganLogo.jpg | 2024-08-13 17:14 | 58K | |
| killowenLogo.png | 2024-08-13 17:14 | 239K | |
| knappogue1951.jpg | 2024-08-13 17:14 | 98K | |
| lagavulin-16yo.jpg | 2024-08-13 17:14 | 68K | |
| lagavulin-offerman-guinness.png | 2024-08-13 17:14 | 287K | |
| lagavulin-offerman.png | 2024-08-13 17:14 | 373K | |
| large-5011007001971.jpg | 2024-08-13 17:14 | 216K | |
| liberator_port_b3.png | 2024-08-13 17:14 | 207K | |
| liberator_portnpeat.png | 2024-08-13 17:14 | 182K | |
| lochlea_first_release.png | 2024-08-13 17:14 | 270K | |
| loughGillLogo.png | 2024-08-13 17:14 | 43K | |
| loughmasklogo.png | 2024-08-13 17:14 | 40K | |
| macallan-1966.png | 2024-08-13 17:14 | 236K | |
| macallan_30_double_cask.png | 2024-08-13 17:15 | 399K | |
| macallan_aera.png | 2024-08-13 17:15 | 297K | |
| macallan_archival_folio-1.png | 2024-08-13 17:15 | 215K | |
| macallan_classic_cut_2017.png | 2024-08-13 17:15 | 248K | |
| macallan_classic_cut_2018.png | 2024-08-13 17:15 | 284K | |
| macallan_classic_cut_2019.png | 2024-08-13 17:15 | 284K | |
| macallan_classic_cut_2020.png | 2024-08-13 17:15 | 265K | |
| macallan_classic_cut_2021.png | 2024-08-13 17:15 | 263K | |
| macallan_no_6_in_lalique.png | 2024-08-13 17:15 | 250K | |
| mackmyra_stjarnrok.png | 2024-08-13 17:15 | 237K | |
| methodandmadness28yearoldport.png | 2024-08-13 17:15 | 289K | |
| methodandmadness31.png | 2024-08-13 17:15 | 342K | |
| methodmadnessFrenchLimousine.jpg | 2024-08-13 17:15 | 179K | |
| mettermalt_2018_Single_Lemberger_Cask_Wheat_Whisky_import.png | 2024-08-13 17:15 | 168K | |
| mettermalt_VfB_Stuttgart_Edition_2023_import.png | 2024-08-13 17:15 | 139K | |
| mettermalt_Whisky_Schützenverein_Sersheim_e._V._1923_import.png | 2024-08-13 17:15 | 170K | |
| mettermalt_Whisky_Smoky_Single_Rye_import.png | 2024-08-13 17:15 | 159K | |
| midleton-very-rare-30th-anniversary-pearl-edition.png | 2024-08-13 17:15 | 348K | |
| midletonLogo.jpg | 2024-08-13 17:15 | 254K | |
| midleton_academy_3.png | 2024-08-13 17:15 | 151K | |
| midleton_academy_virtual_kit.png | 2024-08-13 17:15 | 149K | |
| mvr1984.jpg | 2024-08-13 17:15 | 514K | |
| mvr1985.jpg | 2024-08-13 17:15 | 276K | |
| mvr1987.jpg | 2024-08-13 17:15 | 353K | |
| mvr1988.jpg | 2024-08-13 17:15 | 124K | |
| mvr1988.jpg.png | 2024-08-13 17:15 | 332K | |
| mvr1988.png | 2024-08-13 17:15 | 332K | |
| mvr1989.jpg | 2024-08-13 17:15 | 136K | |
| mvr1989.png | 2024-08-13 17:15 | 279K | |
| mvr1990.jpg | 2024-08-13 17:15 | 339K | |
| mvr1991.jpg | 2024-08-13 17:15 | 397K | |
| mvr1992.jpg | 2024-08-13 17:15 | 30K | |
| mvr1993.jpg | 2024-08-13 17:15 | 156K | |
| mvr1994.jpg | 2024-08-13 17:15 | 247K | |
| mvr1995.jpg | 2024-08-13 17:15 | 28K | |
| mvr1996.jpg | 2024-08-13 17:15 | 358K | |
| mvr1997.jpg | 2024-08-13 17:15 | 401K | |
| mvr1998.jpg | 2024-08-13 17:15 | 424K | |
| mvr1999.jpg | 2024-08-13 17:15 | 27K | |
| mvr2000.jpg | 2024-08-13 17:15 | 160K | |
| mvr2001.jpg | 2024-08-13 17:15 | 29K | |
| mvr2002.jpg | 2024-08-13 17:15 | 619K | |
| mvr2003.jpg | 2024-08-13 17:15 | 61K | |
| mvr2004.jpg | 2024-08-13 17:15 | 419K | |
| mvr2005.jpg | 2024-08-13 17:15 | 29K | |
| mvr2006.jpg | 2024-08-13 17:15 | 349K | |
| mvr2007.jpg | 2024-08-13 17:15 | 397K | |
| mvr2008.jpg | 2024-08-13 17:15 | 30K | |
| mvr2009.jpg | 2024-08-13 17:15 | 277K | |
| mvr2010.jpg | 2024-08-13 17:15 | 510K | |
| mvr2011.jpg | 2024-08-13 17:15 | 25K | |
| mvr2012.jpg | 2024-08-13 17:15 | 27K | |
| mvr2013.jpg | 2024-08-13 17:15 | 866K | |
| mvr2014.jpg | 2024-08-13 17:15 | 106K | |
| mvr2015.jpg | 2024-08-13 17:15 | 383K | |
| mvr2016.jpg | 2024-08-13 17:15 | 98K | |
| mvr2018.jpg | 2024-08-13 17:15 | 80K | |
| mvr2020.jpg | 2024-08-13 17:15 | 210K | |
| obriens bottle front.jpg | 2024-08-13 17:15 | 507K | |
| onlineShops/ | 2024-09-09 19:32 | - | |
| papp20.jpg | 2024-08-13 17:15 | 156K | |
| papp20.png | 2024-08-13 17:15 | 291K | |
| pappy23.png | 2024-08-13 17:15 | 350K | |
| pearse-lyons-logo-2.jpg | 2024-08-13 17:15 | 14K | |
| plattevalleycorn.png | 2024-08-13 17:15 | 217K | |
| powers_singlecask_fom.png | 2024-08-13 17:15 | 151K | |
| powers_three_swallow_old_label-776x1176.png | 2024-08-13 17:15 | 183K | |
| quinngroup.png | 2024-08-13 17:15 | 244K | |
| rademondLogo.jpg | 2024-08-13 17:15 | 1.2M | |
| rb12new.png | 2024-08-13 17:15 | 67K | |
| rb_single_cask_bowstreet_21316.png | 2024-08-13 17:15 | 275K | |
| rb_single_cask_cws_30088.png | 2024-08-13 17:15 | 210K | |
| rb_single_cask_cws_42884.png | 2024-08-13 17:15 | 208K | |
| rb_single_cask_fah_82858.png | 2024-08-13 17:15 | 245K | |
| rb_single_cask_iwc_42966.png | 2024-08-13 17:15 | 261K | |
| rb_single_cask_lmdw_26494.png | 2024-08-13 17:15 | 284K | |
| rb_single_cask_lmdw_42972.png | 2024-08-13 17:15 | 295K | |
| rb_single_cask_lmdw_70946.png | 2024-08-13 17:15 | 328K | |
| rb_single_cask_mom_18829.png | 2024-08-13 17:15 | 305K | |
| rb_single_cask_palacebar_8.png | 2024-08-13 17:15 | 192K | |
| rb_single_cask_sonnys_10351.png | 2024-08-13 17:15 | 321K | |
| rb_single_cask_templebar_82861.png | 2024-08-13 17:15 | 273K | |
| rb_single_cask_twe_30087.png | 2024-08-13 17:15 | 261K | |
| rbdc32.jpg | 2024-08-13 17:15 | 143K | |
| redbreast-28-years-old-dream-cask-ruby-port.jpg | 2024-08-13 17:15 | 43K | |
| redbreast_1999_IWC.png | 2024-08-13 17:15 | 255K | |
| redbreast__blakes_47560.jpg | 2024-08-13 17:15 | 64K | |
| redbreast_birdfeeder.png | 2024-08-13 17:15 | 276K | |
| retreonaut17.png | 2024-08-13 17:15 | 269K | |
| roeandco.jpg | 2024-08-13 17:15 | 63K | |
| royalOakLogo.jpg | 2024-08-13 17:15 | 23K | |
| shed_distillery_logo.png | 2024-08-13 17:16 | 207K | |
| slaneLogo.jpg | 2024-08-13 17:16 | 35K | |
| sliabhliaglogo.jpg | 2024-08-13 17:16 | 36K | |
| smws51.5.png | 2024-08-13 17:16 | 128K | |
| spade-14-marsala-776x1176.jpg | 2024-08-13 17:16 | 80K | |
| spirits-bushmills-black-bush-70cl-14270878777422_x500.png | 2024-08-13 17:16 | 146K | |
| spirits-jameson-coopers-croze-70cl-14270795055182_1024x1024.png | 2024-08-13 17:16 | 118K | |
| springbank_15.jpg | 2024-08-13 17:16 | 141K | |
| st-patricks-day-limited-edition-bottle-single.jpg | 2024-08-13 17:16 | 161K | |
| talisker_sm_house_greyjoy.png | 2025-04-30 20:51 | 306K | |
| teeling-loupiac-collinstown - Copy.png | 2024-08-13 17:16 | 268K | |
| teeling-loupiac-collinstown.png | 2024-08-13 17:16 | 268K | |
| teelingLogo.jpg | 2024-08-13 17:16 | 17K | |
| teelingTheLiberties.jpg | 2024-08-13 17:16 | 26K | |
| teeling_20_fathom_smbatch - Copy.png | 2024-08-13 17:16 | 307K | |
| teeling_20_fathom_smbatch.png | 2024-08-13 17:16 | 307K | |
| teeling__distillery_chestnut.png | 2024-08-13 17:16 | 289K | |
| teeling_amber_ale.png | 2024-08-13 17:16 | 298K | |
| teeling_kyro_gin.png | 2024-08-13 17:16 | 266K | |
| teeling_riesling_smbatch - Copy.png | 2024-08-13 17:16 | 260K | |
| teeling_riesling_smbatch.png | 2024-08-13 17:16 | 260K | |
| teeling_singlecask_galwaybay - Copy.png | 2024-08-13 17:16 | 329K | |
| teeling_singlecask_galwaybay.png | 2024-08-13 17:16 | 329K | |
| teeling_trois_riveres.png | 2024-08-13 17:16 | 269K | |
| teelingthegathering.jpg | 2024-08-13 17:16 | 282K | |
| teelingtherising.jpg | 2024-08-13 17:16 | 526K | |
| test | 2024-08-13 17:16 | 1.0M | |
| the-powerscourt-distillery-logojpg.jpg | 2024-08-13 17:16 | 259K | |
| trial.png | 2024-08-13 17:17 | 817K | |
| tullamore-dew-phoenix-whiskey.jpg | 2024-08-13 17:17 | 26K | |
| tullyLogo.jpg | 2024-08-13 17:17 | 28K | |
| two-stack-rum.png | 2024-08-13 17:17 | 234K | |
| twostack-aprioct.png | 2024-08-13 17:17 | 232K | |
| twostack-port.png | 2024-08-13 17:17 | 239K | |
| twostack-sauternes.png | 2024-08-13 17:17 | 244K | |
| usertools/ | 2024-08-13 17:26 | - | |
| waterford.jpg | 2024-08-13 17:17 | 4.4K | |
| waterford_ballykilcavan.jpg | 2024-08-13 17:17 | 386K | |
| waterford_ballykilcavan.png | 2024-08-13 17:17 | 235K | |
| waterford_bannowisland.jpg | 2024-08-13 17:17 | 370K | |
| waterford_dunbell.jpg | 2024-08-13 17:17 | 31K | |
| waterford_dunmore.jpg | 2024-08-13 17:17 | 31K | |
| wb_WB238890_1770_Glasgow_Single_Malt_Limited_Edition_Release_-_The_Netherlands_Exclusive_import.png | 2024-08-13 17:17 | 104K | |
| wb_WB239115_1770_2018_Limited_Edition_Release_import.png | 2024-08-13 17:17 | 112K | |
| wb_WB239179_1770_2016_Limited_Edition_Release_import.png | 2024-08-13 17:17 | 107K | |
| wb_WB241065_1770_Glasgow_Single_Malt_Peated_-_Cask_Strength_import.png | 2024-08-13 17:17 | 102K | |
| wb_WB241066_1770_Glasgow_Single_Malt_The_Original_-_Cask_Strength_-_Batch_01_import.png | 2024-08-13 17:17 | 105K | |
| wb_WB242545_1770_2018_Limited_Edition_Release_import.png | 2024-08-13 17:17 | 107K | |
| wb_WB242772_1770_2017_-_Glasgow_Single_Malt_Limited_Edition_Release_import.png | 2024-08-13 17:17 | 93K | |
| wb_WB243532_1770_2017_-_Glasgow_Single_Malt_import.png | 2024-08-13 17:17 | 107K | |
| wb_WB243533_1770_2017_-_Glasgow_Single_Malt_import.png | 2024-08-13 17:17 | 109K | |
| wb_WB244934_1770_2018_Small_Batch_Series_-_Peated_import.png | 2024-08-13 17:17 | 117K | |
| westCorkLogo.jpg | 2024-08-13 17:17 | 114K | |
| westcorkcaskcollectionbourbon.png | 2024-08-13 17:17 | 144K | |
| wfmicrocuvee.jpg | 2024-08-13 17:17 | 29K | |
| whiskeyDetails.php | 2024-08-13 17:17 | 10K | |
| whiskeyDetailsupload.php | 2024-08-13 17:17 | 1.1K | |
| winterjack.png | 2024-08-13 17:17 | 190K | |
| writer_tear_cask_strength_2014.png | 2024-08-13 17:17 | 376K | |
| writer_tear_cask_strength_2015.png | 2024-08-13 17:17 | 404K | |
| writer_tear_cask_strength_2016.png | 2024-08-13 17:17 | 344K | |
| writer_tear_cask_strength_2017.png | 2024-08-13 17:17 | 380K | |
| writer_tear_cask_strength_2018.png | 2024-08-13 17:17 | 380K | |
| writer_tear_cask_strength_2019.png | 2024-08-13 17:17 | 398K | |
| writers_tears_japanese_mizunara.png | 2024-08-13 17:17 | 253K | |
| writerstears_copper_pot.png | 2024-08-13 17:17 | 893K | |
| writerstears_seaweed.png | 2024-08-13 17:17 | 142K | |
|
|---|
-776x1176%20(1)-1000x1000.jpg){kind=link}
-776x1176.png){kind=link}
.png){kind=link}
_Kentucky_Straight_Bourbon_Whiskey_import.png){kind=link}
_05-year-old_IW_Batch_9_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
.png){kind=link}
_Edmiston_House_DL_Malt_Scotch_Whisky_import.png){kind=link}
_2005_SV_Cask_Strength_Collection_import.png){kind=link}
_2005_SV_import.png){kind=link}
_import.png){kind=link}
_import.png){kind=link}
_Small_Batch_Series_import.png){kind=link}
-776x1176.png){kind=link}
